diff --git a/img_generator.sh b/img_generator.sh index 1fca4a8..492a57b 100755 --- a/img_generator.sh +++ b/img_generator.sh @@ -19,7 +19,7 @@ TMPFILE=$(mktemp) # Search images for i in {1..99}; do - RAND=$( echo | awk ' { srand(); print int(rand() * 234937 ) } ') + RAND=$( echo | awk ' { srand(); print int(rand() * 99171 ) } ') WORD=$(awk "NR==$RAND" /usr/share/dict/words); [ -n "$TAG" ] && WORD=$TAG URL="https://api.flickr.com/services/feeds/photos_public.gne?tags=$WORD&tagmode=any"; diff --git a/public/background_tshirt.png b/public/background_tshirt.png new file mode 100644 index 0000000..f654c39 Binary files /dev/null and b/public/background_tshirt.png differ diff --git a/public/batman_small.png b/public/batman_small.png new file mode 100644 index 0000000..90e4cc0 Binary files /dev/null and b/public/batman_small.png differ diff --git a/public/fabric.js b/public/fabric.js new file mode 100644 index 0000000..bcc9caf --- /dev/null +++ b/public/fabric.js @@ -0,0 +1,29387 @@ +/*! Fabric.js Copyright 2008-2015, Printio (Juriy Zaytsev, Maxim Chernyak) */ + +var fabric = fabric || { version: '3.4.0' }; +if (typeof exports !== 'undefined') { + exports.fabric = fabric; +} +/* _AMD_START_ */ +else if (typeof define === 'function' && define.amd) { + define([], function() { return fabric; }); +} +/* _AMD_END_ */ +if (typeof document !== 'undefined' && typeof window !== 'undefined') { + if (document instanceof (typeof HTMLDocument !== 'undefined' ? HTMLDocument : Document)) { + fabric.document = document; + } + else { + fabric.document = document.implementation.createHTMLDocument(''); + } + fabric.window = window; +} +else { + // assume we're running under node.js when document/window are not present + var jsdom = require('jsdom'); + var virtualWindow = new jsdom.JSDOM( + decodeURIComponent('%3C!DOCTYPE%20html%3E%3Chtml%3E%3Chead%3E%3C%2Fhead%3E%3Cbody%3E%3C%2Fbody%3E%3C%2Fhtml%3E'), + { + features: { + FetchExternalResources: ['img'] + }, + resources: 'usable' + }).window; + fabric.document = virtualWindow.document; + fabric.jsdomImplForWrapper = require('jsdom/lib/jsdom/living/generated/utils').implForWrapper; + fabric.nodeCanvas = require('jsdom/lib/jsdom/utils').Canvas; + fabric.window = virtualWindow; + DOMParser = fabric.window.DOMParser; +} + +/** + * True when in environment that supports touch events + * @type boolean + */ +fabric.isTouchSupported = 'ontouchstart' in fabric.window || 'ontouchstart' in fabric.document || + (fabric.window && fabric.window.navigator && fabric.window.navigator.maxTouchPoints > 0); + +/** + * True when in environment that's probably Node.js + * @type boolean + */ +fabric.isLikelyNode = typeof Buffer !== 'undefined' && + typeof window === 'undefined'; + +/* _FROM_SVG_START_ */ +/** + * Attributes parsed from all SVG elements + * @type array + */ +fabric.SHARED_ATTRIBUTES = [ + 'display', + 'transform', + 'fill', 'fill-opacity', 'fill-rule', + 'opacity', + 'stroke', 'stroke-dasharray', 'stroke-linecap', 'stroke-dashoffset', + 'stroke-linejoin', 'stroke-miterlimit', + 'stroke-opacity', 'stroke-width', + 'id', 'paint-order', 'vector-effect', + 'instantiated_by_use', 'clip-path' +]; +/* _FROM_SVG_END_ */ + +/** + * Pixel per Inch as a default value set to 96. Can be changed for more realistic conversion. + */ +fabric.DPI = 96; +fabric.reNum = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:[eE][-+]?\\d+)?)'; +fabric.fontPaths = { }; +fabric.iMatrix = [1, 0, 0, 1, 0, 0]; + +/** + * Pixel limit for cache canvases. 1Mpx , 4Mpx should be fine. + * @since 1.7.14 + * @type Number + * @default + */ +fabric.perfLimitSizeTotal = 2097152; + +/** + * Pixel limit for cache canvases width or height. IE fixes the maximum at 5000 + * @since 1.7.14 + * @type Number + * @default + */ +fabric.maxCacheSideLimit = 4096; + +/** + * Lowest pixel limit for cache canvases, set at 256PX + * @since 1.7.14 + * @type Number + * @default + */ +fabric.minCacheSideLimit = 256; + +/** + * Cache Object for widths of chars in text rendering. + */ +fabric.charWidthsCache = { }; + +/** + * if webgl is enabled and available, textureSize will determine the size + * of the canvas backend + * @since 2.0.0 + * @type Number + * @default + */ +fabric.textureSize = 2048; + +/** + * When 'true', style information is not retained when copy/pasting text, making + * pasted text use destination style. + * Defaults to 'false'. + * @type Boolean + * @default + */ +fabric.disableStyleCopyPaste = false; + +/** + * Enable webgl for filtering picture is available + * A filtering backend will be initialized, this will both take memory and + * time since a default 2048x2048 canvas will be created for the gl context + * @since 2.0.0 + * @type Boolean + * @default + */ +fabric.enableGLFiltering = true; + +/** + * Device Pixel Ratio + * @see https://developer.apple.com/library/safari/documentation/AudioVideo/Conceptual/HTML-canvas-guide/SettingUptheCanvas/SettingUptheCanvas.html + */ +fabric.devicePixelRatio = fabric.window.devicePixelRatio || + fabric.window.webkitDevicePixelRatio || + fabric.window.mozDevicePixelRatio || + 1; +/** + * Browser-specific constant to adjust CanvasRenderingContext2D.shadowBlur value, + * which is unitless and not rendered equally across browsers. + * + * Values that work quite well (as of October 2017) are: + * - Chrome: 1.5 + * - Edge: 1.75 + * - Firefox: 0.9 + * - Safari: 0.95 + * + * @since 2.0.0 + * @type Number + * @default 1 + */ +fabric.browserShadowBlurConstant = 1; + +/** + * This object contains the result of arc to beizer conversion for faster retrieving if the same arc needs to be converted again. + * It was an internal variable, is accessible since version 2.3.4 + */ +fabric.arcToSegmentsCache = { }; + +/** + * This object keeps the results of the boundsOfCurve calculation mapped by the joined arguments necessary to calculate it. + * It does speed up calculation, if you parse and add always the same paths, but in case of heavy usage of freedrawing + * you do not get any speed benefit and you get a big object in memory. + * The object was a private variable before, while now is appended to the lib so that you have access to it and you + * can eventually clear it. + * It was an internal variable, is accessible since version 2.3.4 + */ +fabric.boundsOfCurveCache = { }; + +/** + * If disabled boundsOfCurveCache is not used. For apps that make heavy usage of pencil drawing probably disabling it is better + * @default true + */ +fabric.cachesBoundsOfCurve = true; + +/** + * Skip performance testing of setupGLContext and force the use of putImageData that seems to be the one that works best on + * Chrome + old hardware. if your users are experiencing empty images after filtering you may try to force this to true + * this has to be set before instantiating the filtering backend ( before filtering the first image ) + * @type Boolean + * @default false + */ +fabric.forceGLPutImageData = false; + +fabric.initFilterBackend = function() { + if (fabric.enableGLFiltering && fabric.isWebglSupported && fabric.isWebglSupported(fabric.textureSize)) { + console.log('max texture size: ' + fabric.maxTextureSize); + return (new fabric.WebglFilterBackend({ tileSize: fabric.textureSize })); + } + else if (fabric.Canvas2dFilterBackend) { + return (new fabric.Canvas2dFilterBackend()); + } +}; +if (typeof document !== 'undefined' && typeof window !== 'undefined') { + // ensure globality even if entire library were function wrapped (as in Meteor.js packaging system) + window.fabric = fabric; +} +(function() { + + /** + * @private + * @param {String} eventName + * @param {Function} handler + */ + function _removeEventListener(eventName, handler) { + if (!this.__eventListeners[eventName]) { + return; + } + var eventListener = this.__eventListeners[eventName]; + if (handler) { + eventListener[eventListener.indexOf(handler)] = false; + } + else { + fabric.util.array.fill(eventListener, false); + } + } + + /** + * Observes specified event + * @deprecated `observe` deprecated since 0.8.34 (use `on` instead) + * @memberOf fabric.Observable + * @alias on + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function that receives a notification when an event of the specified type occurs + * @return {Self} thisArg + * @chainable + */ + function observe(eventName, handler) { + if (!this.__eventListeners) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + if (arguments.length === 1) { + for (var prop in eventName) { + this.on(prop, eventName[prop]); + } + } + else { + if (!this.__eventListeners[eventName]) { + this.__eventListeners[eventName] = []; + } + this.__eventListeners[eventName].push(handler); + } + return this; + } + + /** + * Stops event observing for a particular event handler. Calling this method + * without arguments removes all handlers for all events + * @deprecated `stopObserving` deprecated since 0.8.34 (use `off` instead) + * @memberOf fabric.Observable + * @alias off + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function to be deleted from EventListeners + * @return {Self} thisArg + * @chainable + */ + function stopObserving(eventName, handler) { + if (!this.__eventListeners) { + return this; + } + + // remove all key/value pairs (event name -> event handler) + if (arguments.length === 0) { + for (eventName in this.__eventListeners) { + _removeEventListener.call(this, eventName); + } + } + // one object with key/value pairs was passed + else if (arguments.length === 1 && typeof arguments[0] === 'object') { + for (var prop in eventName) { + _removeEventListener.call(this, prop, eventName[prop]); + } + } + else { + _removeEventListener.call(this, eventName, handler); + } + return this; + } + + /** + * Fires event with an optional options object + * @deprecated `fire` deprecated since 1.0.7 (use `trigger` instead) + * @memberOf fabric.Observable + * @alias trigger + * @param {String} eventName Event name to fire + * @param {Object} [options] Options object + * @return {Self} thisArg + * @chainable + */ + function fire(eventName, options) { + if (!this.__eventListeners) { + return this; + } + + var listenersForEvent = this.__eventListeners[eventName]; + if (!listenersForEvent) { + return this; + } + + for (var i = 0, len = listenersForEvent.length; i < len; i++) { + listenersForEvent[i] && listenersForEvent[i].call(this, options || { }); + } + this.__eventListeners[eventName] = listenersForEvent.filter(function(value) { + return value !== false; + }); + return this; + } + + /** + * @namespace fabric.Observable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#events} + * @see {@link http://fabricjs.com/events|Events demo} + */ + fabric.Observable = { + observe: observe, + stopObserving: stopObserving, + fire: fire, + + on: observe, + off: stopObserving, + trigger: fire + }; +})(); +/** + * @namespace fabric.Collection + */ +fabric.Collection = { + + _objects: [], + + /** + * Adds objects to collection, Canvas or Group, then renders canvas + * (if `renderOnAddRemove` is not `false`). + * in case of Group no changes to bounding box are made. + * Objects should be instances of (or inherit from) fabric.Object + * Use of this function is highly discouraged for groups. + * you can add a bunch of objects with the add method but then you NEED + * to run a addWithUpdate call for the Group class or position/bbox will be wrong. + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + add: function () { + this._objects.push.apply(this._objects, arguments); + if (this._onObjectAdded) { + for (var i = 0, length = arguments.length; i < length; i++) { + this._onObjectAdded(arguments[i]); + } + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Inserts an object into collection at specified index, then renders canvas (if `renderOnAddRemove` is not `false`) + * An object should be an instance of (or inherit from) fabric.Object + * Use of this function is highly discouraged for groups. + * you can add a bunch of objects with the insertAt method but then you NEED + * to run a addWithUpdate call for the Group class or position/bbox will be wrong. + * @param {Object} object Object to insert + * @param {Number} index Index to insert object at + * @param {Boolean} nonSplicing When `true`, no splicing (shifting) of objects occurs + * @return {Self} thisArg + * @chainable + */ + insertAt: function (object, index, nonSplicing) { + var objects = this._objects; + if (nonSplicing) { + objects[index] = object; + } + else { + objects.splice(index, 0, object); + } + this._onObjectAdded && this._onObjectAdded(object); + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Removes objects from a collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + remove: function() { + var objects = this._objects, + index, somethingRemoved = false; + + for (var i = 0, length = arguments.length; i < length; i++) { + index = objects.indexOf(arguments[i]); + + // only call onObjectRemoved if an object was actually removed + if (index !== -1) { + somethingRemoved = true; + objects.splice(index, 1); + this._onObjectRemoved && this._onObjectRemoved(arguments[i]); + } + } + + this.renderOnAddRemove && somethingRemoved && this.requestRenderAll(); + return this; + }, + + /** + * Executes given function for each object in this group + * @param {Function} callback + * Callback invoked with current object as first argument, + * index - as second and an array of all objects - as third. + * Callback is invoked in a context of Global Object (e.g. `window`) + * when no `context` argument is given + * + * @param {Object} context Context (aka thisObject) + * @return {Self} thisArg + * @chainable + */ + forEachObject: function(callback, context) { + var objects = this.getObjects(); + for (var i = 0, len = objects.length; i < len; i++) { + callback.call(context, objects[i], i, objects); + } + return this; + }, + + /** + * Returns an array of children objects of this instance + * Type parameter introduced in 1.3.10 + * since 2.3.5 this method return always a COPY of the array; + * @param {String} [type] When specified, only objects of this type are returned + * @return {Array} + */ + getObjects: function(type) { + if (typeof type === 'undefined') { + return this._objects.concat(); + } + return this._objects.filter(function(o) { + return o.type === type; + }); + }, + + /** + * Returns object at specified index + * @param {Number} index + * @return {Self} thisArg + */ + item: function (index) { + return this._objects[index]; + }, + + /** + * Returns true if collection contains no objects + * @return {Boolean} true if collection is empty + */ + isEmpty: function () { + return this._objects.length === 0; + }, + + /** + * Returns a size of a collection (i.e: length of an array containing its objects) + * @return {Number} Collection size + */ + size: function() { + return this._objects.length; + }, + + /** + * Returns true if collection contains an object + * @param {Object} object Object to check against + * @return {Boolean} `true` if collection contains an object + */ + contains: function(object) { + return this._objects.indexOf(object) > -1; + }, + + /** + * Returns number representation of a collection complexity + * @return {Number} complexity + */ + complexity: function () { + return this._objects.reduce(function (memo, current) { + memo += current.complexity ? current.complexity() : 0; + return memo; + }, 0); + } +}; +/** + * @namespace fabric.CommonMethods + */ +fabric.CommonMethods = { + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + _setOptions: function(options) { + for (var prop in options) { + this.set(prop, options[prop]); + } + }, + + /** + * @private + * @param {Object} [filler] Options object + * @param {String} [property] property to set the Gradient to + */ + _initGradient: function(filler, property) { + if (filler && filler.colorStops && !(filler instanceof fabric.Gradient)) { + this.set(property, new fabric.Gradient(filler)); + } + }, + + /** + * @private + * @param {Object} [filler] Options object + * @param {String} [property] property to set the Pattern to + * @param {Function} [callback] callback to invoke after pattern load + */ + _initPattern: function(filler, property, callback) { + if (filler && filler.source && !(filler instanceof fabric.Pattern)) { + this.set(property, new fabric.Pattern(filler, callback)); + } + else { + callback && callback(); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initClipping: function(options) { + if (!options.clipTo || typeof options.clipTo !== 'string') { + return; + } + + var functionBody = fabric.util.getFunctionBody(options.clipTo); + if (typeof functionBody !== 'undefined') { + this.clipTo = new Function('ctx', functionBody); + } + }, + + /** + * @private + */ + _setObject: function(obj) { + for (var prop in obj) { + this._set(prop, obj[prop]); + } + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + if (typeof key === 'object') { + this._setObject(key); + } + else { + if (typeof value === 'function' && key !== 'clipTo') { + this._set(key, value(this.get(key))); + } + else { + this._set(key, value); + } + } + return this; + }, + + _set: function(key, value) { + this[key] = value; + }, + + /** + * Toggles specified property from `true` to `false` or from `false` to `true` + * @param {String} property Property to toggle + * @return {fabric.Object} thisArg + * @chainable + */ + toggle: function(property) { + var value = this.get(property); + if (typeof value === 'boolean') { + this.set(property, !value); + } + return this; + }, + + /** + * Basic getter + * @param {String} property Property name + * @return {*} value of a property + */ + get: function(property) { + return this[property]; + } +}; +(function(global) { + + var sqrt = Math.sqrt, + atan2 = Math.atan2, + pow = Math.pow, + PiBy180 = Math.PI / 180, + PiBy2 = Math.PI / 2; + + /** + * @namespace fabric.util + */ + fabric.util = { + + /** + * Calculate the cos of an angle, avoiding returning floats for known results + * @static + * @memberOf fabric.util + * @param {Number} angle the angle in radians or in degree + * @return {Number} + */ + cos: function(angle) { + if (angle === 0) { return 1; } + if (angle < 0) { + // cos(a) = cos(-a) + angle = -angle; + } + var angleSlice = angle / PiBy2; + switch (angleSlice) { + case 1: case 3: return 0; + case 2: return -1; + } + return Math.cos(angle); + }, + + /** + * Calculate the sin of an angle, avoiding returning floats for known results + * @static + * @memberOf fabric.util + * @param {Number} angle the angle in radians or in degree + * @return {Number} + */ + sin: function(angle) { + if (angle === 0) { return 0; } + var angleSlice = angle / PiBy2, sign = 1; + if (angle < 0) { + // sin(-a) = -sin(a) + sign = -1; + } + switch (angleSlice) { + case 1: return sign; + case 2: return 0; + case 3: return -sign; + } + return Math.sin(angle); + }, + + /** + * Removes value from an array. + * Presence of value (and its position in an array) is determined via `Array.prototype.indexOf` + * @static + * @memberOf fabric.util + * @param {Array} array + * @param {*} value + * @return {Array} original array + */ + removeFromArray: function(array, value) { + var idx = array.indexOf(value); + if (idx !== -1) { + array.splice(idx, 1); + } + return array; + }, + + /** + * Returns random number between 2 specified ones. + * @static + * @memberOf fabric.util + * @param {Number} min lower limit + * @param {Number} max upper limit + * @return {Number} random value (between min and max) + */ + getRandomInt: function(min, max) { + return Math.floor(Math.random() * (max - min + 1)) + min; + }, + + /** + * Transforms degrees to radians. + * @static + * @memberOf fabric.util + * @param {Number} degrees value in degrees + * @return {Number} value in radians + */ + degreesToRadians: function(degrees) { + return degrees * PiBy180; + }, + + /** + * Transforms radians to degrees. + * @static + * @memberOf fabric.util + * @param {Number} radians value in radians + * @return {Number} value in degrees + */ + radiansToDegrees: function(radians) { + return radians / PiBy180; + }, + + /** + * Rotates `point` around `origin` with `radians` + * @static + * @memberOf fabric.util + * @param {fabric.Point} point The point to rotate + * @param {fabric.Point} origin The origin of the rotation + * @param {Number} radians The radians of the angle for the rotation + * @return {fabric.Point} The new rotated point + */ + rotatePoint: function(point, origin, radians) { + point.subtractEquals(origin); + var v = fabric.util.rotateVector(point, radians); + return new fabric.Point(v.x, v.y).addEquals(origin); + }, + + /** + * Rotates `vector` with `radians` + * @static + * @memberOf fabric.util + * @param {Object} vector The vector to rotate (x and y) + * @param {Number} radians The radians of the angle for the rotation + * @return {Object} The new rotated point + */ + rotateVector: function(vector, radians) { + var sin = fabric.util.sin(radians), + cos = fabric.util.cos(radians), + rx = vector.x * cos - vector.y * sin, + ry = vector.x * sin + vector.y * cos; + return { + x: rx, + y: ry + }; + }, + + /** + * Apply transform t to point p + * @static + * @memberOf fabric.util + * @param {fabric.Point} p The point to transform + * @param {Array} t The transform + * @param {Boolean} [ignoreOffset] Indicates that the offset should not be applied + * @return {fabric.Point} The transformed point + */ + transformPoint: function(p, t, ignoreOffset) { + if (ignoreOffset) { + return new fabric.Point( + t[0] * p.x + t[2] * p.y, + t[1] * p.x + t[3] * p.y + ); + } + return new fabric.Point( + t[0] * p.x + t[2] * p.y + t[4], + t[1] * p.x + t[3] * p.y + t[5] + ); + }, + + /** + * Returns coordinates of points's bounding rectangle (left, top, width, height) + * @param {Array} points 4 points array + * @param {Array} [transform] an array of 6 numbers representing a 2x3 transform matrix + * @return {Object} Object with left, top, width, height properties + */ + makeBoundingBoxFromPoints: function(points, transform) { + if (transform) { + for (var i = 0; i < points.length; i++) { + points[i] = fabric.util.transformPoint(points[i], transform); + } + } + var xPoints = [points[0].x, points[1].x, points[2].x, points[3].x], + minX = fabric.util.array.min(xPoints), + maxX = fabric.util.array.max(xPoints), + width = maxX - minX, + yPoints = [points[0].y, points[1].y, points[2].y, points[3].y], + minY = fabric.util.array.min(yPoints), + maxY = fabric.util.array.max(yPoints), + height = maxY - minY; + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Invert transformation t + * @static + * @memberOf fabric.util + * @param {Array} t The transform + * @return {Array} The inverted transform + */ + invertTransform: function(t) { + var a = 1 / (t[0] * t[3] - t[1] * t[2]), + r = [a * t[3], -a * t[1], -a * t[2], a * t[0]], + o = fabric.util.transformPoint({ x: t[4], y: t[5] }, r, true); + r[4] = -o.x; + r[5] = -o.y; + return r; + }, + + /** + * A wrapper around Number#toFixed, which contrary to native method returns number, not string. + * @static + * @memberOf fabric.util + * @param {Number|String} number number to operate on + * @param {Number} fractionDigits number of fraction digits to "leave" + * @return {Number} + */ + toFixed: function(number, fractionDigits) { + return parseFloat(Number(number).toFixed(fractionDigits)); + }, + + /** + * Converts from attribute value to pixel value if applicable. + * Returns converted pixels or original value not converted. + * @param {Number|String} value number to operate on + * @param {Number} fontSize + * @return {Number|String} + */ + parseUnit: function(value, fontSize) { + var unit = /\D{0,2}$/.exec(value), + number = parseFloat(value); + if (!fontSize) { + fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + switch (unit[0]) { + case 'mm': + return number * fabric.DPI / 25.4; + + case 'cm': + return number * fabric.DPI / 2.54; + + case 'in': + return number * fabric.DPI; + + case 'pt': + return number * fabric.DPI / 72; // or * 4 / 3 + + case 'pc': + return number * fabric.DPI / 72 * 12; // or * 16 + + case 'em': + return number * fontSize; + + default: + return number; + } + }, + + /** + * Function which always returns `false`. + * @static + * @memberOf fabric.util + * @return {Boolean} + */ + falseFunction: function() { + return false; + }, + + /** + * Returns klass "Class" object of given namespace + * @memberOf fabric.util + * @param {String} type Type of object (eg. 'circle') + * @param {String} namespace Namespace to get klass "Class" object from + * @return {Object} klass "Class" + */ + getKlass: function(type, namespace) { + // capitalize first letter only + type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1)); + return fabric.util.resolveNamespace(namespace)[type]; + }, + + /** + * Returns array of attributes for given svg that fabric parses + * @memberOf fabric.util + * @param {String} type Type of svg element (eg. 'circle') + * @return {Array} string names of supported attributes + */ + getSvgAttributes: function(type) { + var attributes = [ + 'instantiated_by_use', + 'style', + 'id', + 'class' + ]; + switch (type) { + case 'linearGradient': + attributes = attributes.concat(['x1', 'y1', 'x2', 'y2', 'gradientUnits', 'gradientTransform']); + break; + case 'radialGradient': + attributes = attributes.concat(['gradientUnits', 'gradientTransform', 'cx', 'cy', 'r', 'fx', 'fy', 'fr']); + break; + case 'stop': + attributes = attributes.concat(['offset', 'stop-color', 'stop-opacity']); + break; + } + return attributes; + }, + + /** + * Returns object of given namespace + * @memberOf fabric.util + * @param {String} namespace Namespace string e.g. 'fabric.Image.filter' or 'fabric' + * @return {Object} Object for given namespace (default fabric) + */ + resolveNamespace: function(namespace) { + if (!namespace) { + return fabric; + } + + var parts = namespace.split('.'), + len = parts.length, i, + obj = global || fabric.window; + + for (i = 0; i < len; ++i) { + obj = obj[parts[i]]; + } + + return obj; + }, + + /** + * Loads image element from given url and passes it to a callback + * @memberOf fabric.util + * @param {String} url URL representing an image + * @param {Function} callback Callback; invoked with loaded image + * @param {*} [context] Context to invoke callback in + * @param {Object} [crossOrigin] crossOrigin value to set image element to + */ + loadImage: function(url, callback, context, crossOrigin) { + if (!url) { + callback && callback.call(context, url); + return; + } + + var img = fabric.util.createImage(); + + /** @ignore */ + var onLoadCallback = function () { + callback && callback.call(context, img); + img = img.onload = img.onerror = null; + }; + + img.onload = onLoadCallback; + /** @ignore */ + img.onerror = function() { + fabric.log('Error loading ' + img.src); + callback && callback.call(context, null, true); + img = img.onload = img.onerror = null; + }; + + // data-urls appear to be buggy with crossOrigin + // https://github.com/kangax/fabric.js/commit/d0abb90f1cd5c5ef9d2a94d3fb21a22330da3e0a#commitcomment-4513767 + // see https://code.google.com/p/chromium/issues/detail?id=315152 + // https://bugzilla.mozilla.org/show_bug.cgi?id=935069 + if (url.indexOf('data') !== 0 && crossOrigin) { + img.crossOrigin = crossOrigin; + } + + // IE10 / IE11-Fix: SVG contents from data: URI + // will only be available if the IMG is present + // in the DOM (and visible) + if (url.substring(0,14) === 'data:image/svg') { + img.onload = null; + fabric.util.loadImageInDom(img, onLoadCallback); + } + + img.src = url; + }, + + /** + * Attaches SVG image with data: URL to the dom + * @memberOf fabric.util + * @param {Object} img Image object with data:image/svg src + * @param {Function} callback Callback; invoked with loaded image + * @return {Object} DOM element (div containing the SVG image) + */ + loadImageInDom: function(img, onLoadCallback) { + var div = fabric.document.createElement('div'); + div.style.width = div.style.height = '1px'; + div.style.left = div.style.top = '-100%'; + div.style.position = 'absolute'; + div.appendChild(img); + fabric.document.querySelector('body').appendChild(div); + /** + * Wrap in function to: + * 1. Call existing callback + * 2. Cleanup DOM + */ + img.onload = function () { + onLoadCallback(); + div.parentNode.removeChild(div); + div = null; + }; + }, + + /** + * Creates corresponding fabric instances from their object representations + * @static + * @memberOf fabric.util + * @param {Array} objects Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * @param {String} namespace Namespace to get klass "Class" object from + * @param {Function} reviver Method for further parsing of object elements, + * called after each fabric object created. + */ + enlivenObjects: function(objects, callback, namespace, reviver) { + objects = objects || []; + + var enlivenedObjects = [], + numLoadedObjects = 0, + numTotalObjects = objects.length; + + function onLoaded() { + if (++numLoadedObjects === numTotalObjects) { + callback && callback(enlivenedObjects.filter(function(obj) { + // filter out undefined objects (objects that gave error) + return obj; + })); + } + } + + if (!numTotalObjects) { + callback && callback(enlivenedObjects); + return; + } + + objects.forEach(function (o, index) { + // if sparse array + if (!o || !o.type) { + onLoaded(); + return; + } + var klass = fabric.util.getKlass(o.type, namespace); + klass.fromObject(o, function (obj, error) { + error || (enlivenedObjects[index] = obj); + reviver && reviver(o, obj, error); + onLoaded(); + }); + }); + }, + + /** + * Create and wait for loading of patterns + * @static + * @memberOf fabric.util + * @param {Array} patterns Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * called after each fabric object created. + */ + enlivenPatterns: function(patterns, callback) { + patterns = patterns || []; + + function onLoaded() { + if (++numLoadedPatterns === numPatterns) { + callback && callback(enlivenedPatterns); + } + } + + var enlivenedPatterns = [], + numLoadedPatterns = 0, + numPatterns = patterns.length; + + if (!numPatterns) { + callback && callback(enlivenedPatterns); + return; + } + + patterns.forEach(function (p, index) { + if (p && p.source) { + new fabric.Pattern(p, function(pattern) { + enlivenedPatterns[index] = pattern; + onLoaded(); + }); + } + else { + enlivenedPatterns[index] = p; + onLoaded(); + } + }); + }, + + /** + * Groups SVG elements (usually those retrieved from SVG document) + * @static + * @memberOf fabric.util + * @param {Array} elements SVG elements to group + * @param {Object} [options] Options object + * @param {String} path Value to set sourcePath to + * @return {fabric.Object|fabric.Group} + */ + groupSVGElements: function(elements, options, path) { + var object; + if (elements && elements.length === 1) { + return elements[0]; + } + if (options) { + if (options.width && options.height) { + options.centerPoint = { + x: options.width / 2, + y: options.height / 2 + }; + } + else { + delete options.width; + delete options.height; + } + } + object = new fabric.Group(elements, options); + if (typeof path !== 'undefined') { + object.sourcePath = path; + } + return object; + }, + + /** + * Populates an object with properties of another object + * @static + * @memberOf fabric.util + * @param {Object} source Source object + * @param {Object} destination Destination object + * @return {Array} properties Properties names to include + */ + populateWithProperties: function(source, destination, properties) { + if (properties && Object.prototype.toString.call(properties) === '[object Array]') { + for (var i = 0, len = properties.length; i < len; i++) { + if (properties[i] in source) { + destination[properties[i]] = source[properties[i]]; + } + } + } + }, + + /** + * Draws a dashed line between two points + * + * This method is used to draw dashed line around selection area. + * See dotted stroke in canvas + * + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x start x coordinate + * @param {Number} y start y coordinate + * @param {Number} x2 end x coordinate + * @param {Number} y2 end y coordinate + * @param {Array} da dash array pattern + */ + drawDashedLine: function(ctx, x, y, x2, y2, da) { + var dx = x2 - x, + dy = y2 - y, + len = sqrt(dx * dx + dy * dy), + rot = atan2(dy, dx), + dc = da.length, + di = 0, + draw = true; + + ctx.save(); + ctx.translate(x, y); + ctx.moveTo(0, 0); + ctx.rotate(rot); + + x = 0; + while (len > x) { + x += da[di++ % dc]; + if (x > len) { + x = len; + } + ctx[draw ? 'lineTo' : 'moveTo'](x, 0); + draw = !draw; + } + + ctx.restore(); + }, + + /** + * Creates canvas element + * @static + * @memberOf fabric.util + * @return {CanvasElement} initialized canvas element + */ + createCanvasElement: function() { + return fabric.document.createElement('canvas'); + }, + + /** + * Creates a canvas element that is a copy of another and is also painted + * @param {CanvasElement} canvas to copy size and content of + * @static + * @memberOf fabric.util + * @return {CanvasElement} initialized canvas element + */ + copyCanvasElement: function(canvas) { + var newCanvas = fabric.util.createCanvasElement(); + newCanvas.width = canvas.width; + newCanvas.height = canvas.height; + newCanvas.getContext('2d').drawImage(canvas, 0, 0); + return newCanvas; + }, + + /** + * since 2.6.0 moved from canvas instance to utility. + * @param {CanvasElement} canvasEl to copy size and content of + * @param {String} format 'jpeg' or 'png', in some browsers 'webp' is ok too + * @param {Number} quality <= 1 and > 0 + * @static + * @memberOf fabric.util + * @return {String} data url + */ + toDataURL: function(canvasEl, format, quality) { + return canvasEl.toDataURL('image/' + format, quality); + }, + + /** + * Creates image element (works on client and node) + * @static + * @memberOf fabric.util + * @return {HTMLImageElement} HTML image element + */ + createImage: function() { + return fabric.document.createElement('img'); + }, + + /** + * @static + * @memberOf fabric.util + * @deprecated since 2.0.0 + * @param {fabric.Object} receiver Object implementing `clipTo` method + * @param {CanvasRenderingContext2D} ctx Context to clip + */ + clipContext: function(receiver, ctx) { + ctx.save(); + ctx.beginPath(); + receiver.clipTo(ctx); + ctx.clip(); + }, + + /** + * Multiply matrix A by matrix B to nest transformations + * @static + * @memberOf fabric.util + * @param {Array} a First transformMatrix + * @param {Array} b Second transformMatrix + * @param {Boolean} is2x2 flag to multiply matrices as 2x2 matrices + * @return {Array} The product of the two transform matrices + */ + multiplyTransformMatrices: function(a, b, is2x2) { + // Matrix multiply a * b + return [ + a[0] * b[0] + a[2] * b[1], + a[1] * b[0] + a[3] * b[1], + a[0] * b[2] + a[2] * b[3], + a[1] * b[2] + a[3] * b[3], + is2x2 ? 0 : a[0] * b[4] + a[2] * b[5] + a[4], + is2x2 ? 0 : a[1] * b[4] + a[3] * b[5] + a[5] + ]; + }, + + /** + * Decomposes standard 2x3 matrix into transform components + * @static + * @memberOf fabric.util + * @param {Array} a transformMatrix + * @return {Object} Components of transform + */ + qrDecompose: function(a) { + var angle = atan2(a[1], a[0]), + denom = pow(a[0], 2) + pow(a[1], 2), + scaleX = sqrt(denom), + scaleY = (a[0] * a[3] - a[2] * a [1]) / scaleX, + skewX = atan2(a[0] * a[2] + a[1] * a [3], denom); + return { + angle: angle / PiBy180, + scaleX: scaleX, + scaleY: scaleY, + skewX: skewX / PiBy180, + skewY: 0, + translateX: a[4], + translateY: a[5] + }; + }, + + /** + * Returns a transform matrix starting from an object of the same kind of + * the one returned from qrDecompose, useful also if you want to calculate some + * transformations from an object that is not enlived yet + * @static + * @memberOf fabric.util + * @param {Object} options + * @param {Number} [options.angle] angle in degrees + * @return {Array[Number]} transform matrix + */ + calcRotateMatrix: function(options) { + if (!options.angle) { + return fabric.iMatrix.concat(); + } + var theta = fabric.util.degreesToRadians(options.angle), + cos = fabric.util.cos(theta), + sin = fabric.util.sin(theta); + return [cos, sin, -sin, cos, 0, 0]; + }, + + /** + * Returns a transform matrix starting from an object of the same kind of + * the one returned from qrDecompose, useful also if you want to calculate some + * transformations from an object that is not enlived yet. + * is called DimensionsTransformMatrix because those properties are the one that influence + * the size of the resulting box of the object. + * @static + * @memberOf fabric.util + * @param {Object} options + * @param {Number} [options.scaleX] + * @param {Number} [options.scaleY] + * @param {Boolean} [options.flipX] + * @param {Boolean} [options.flipY] + * @param {Number} [options.skewX] + * @param {Number} [options.skewX] + * @return {Array[Number]} transform matrix + */ + calcDimensionsMatrix: function(options) { + var scaleX = typeof options.scaleX === 'undefined' ? 1 : options.scaleX, + scaleY = typeof options.scaleY === 'undefined' ? 1 : options.scaleY, + scaleMatrix = [ + options.flipX ? -scaleX : scaleX, + 0, + 0, + options.flipY ? -scaleY : scaleY, + 0, + 0], + multiply = fabric.util.multiplyTransformMatrices, + degreesToRadians = fabric.util.degreesToRadians; + if (options.skewX) { + scaleMatrix = multiply( + scaleMatrix, + [1, 0, Math.tan(degreesToRadians(options.skewX)), 1], + true); + } + if (options.skewY) { + scaleMatrix = multiply( + scaleMatrix, + [1, Math.tan(degreesToRadians(options.skewY)), 0, 1], + true); + } + return scaleMatrix; + }, + + /** + * Returns a transform matrix starting from an object of the same kind of + * the one returned from qrDecompose, useful also if you want to calculate some + * transformations from an object that is not enlived yet + * @static + * @memberOf fabric.util + * @param {Object} options + * @param {Number} [options.angle] + * @param {Number} [options.scaleX] + * @param {Number} [options.scaleY] + * @param {Boolean} [options.flipX] + * @param {Boolean} [options.flipY] + * @param {Number} [options.skewX] + * @param {Number} [options.skewX] + * @param {Number} [options.translateX] + * @param {Number} [options.translateY] + * @return {Array[Number]} transform matrix + */ + composeMatrix: function(options) { + var matrix = [1, 0, 0, 1, options.translateX || 0, options.translateY || 0], + multiply = fabric.util.multiplyTransformMatrices; + if (options.angle) { + matrix = multiply(matrix, fabric.util.calcRotateMatrix(options)); + } + if (options.scaleX || options.scaleY || options.skewX || options.skewY || options.flipX || options.flipY) { + matrix = multiply(matrix, fabric.util.calcDimensionsMatrix(options)); + } + return matrix; + }, + + /** + * Returns a transform matrix that has the same effect of scaleX, scaleY and skewX. + * Is deprecated for composeMatrix. Please do not use it. + * @static + * @deprecated since 3.4.0 + * @memberOf fabric.util + * @param {Number} scaleX + * @param {Number} scaleY + * @param {Number} skewX + * @return {Array[Number]} transform matrix + */ + customTransformMatrix: function(scaleX, scaleY, skewX) { + return fabric.util.composeMatrix({ scaleX: scaleX, scaleY: scaleY, skewX: skewX }); + }, + + /** + * reset an object transform state to neutral. Top and left are not accounted for + * @static + * @memberOf fabric.util + * @param {fabric.Object} target object to transform + */ + resetObjectTransform: function (target) { + target.scaleX = 1; + target.scaleY = 1; + target.skewX = 0; + target.skewY = 0; + target.flipX = false; + target.flipY = false; + target.rotate(0); + }, + + /** + * Extract Object transform values + * @static + * @memberOf fabric.util + * @param {fabric.Object} target object to read from + * @return {Object} Components of transform + */ + saveObjectTransform: function (target) { + return { + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + angle: target.angle, + left: target.left, + flipX: target.flipX, + flipY: target.flipY, + top: target.top + }; + }, + + /** + * Returns string representation of function body + * @param {Function} fn Function to get body of + * @return {String} Function body + */ + getFunctionBody: function(fn) { + return (String(fn).match(/function[^{]*\{([\s\S]*)\}/) || {})[1]; + }, + + /** + * Returns true if context has transparent pixel + * at specified location (taking tolerance into account) + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x x coordinate + * @param {Number} y y coordinate + * @param {Number} tolerance Tolerance + */ + isTransparent: function(ctx, x, y, tolerance) { + + // If tolerance is > 0 adjust start coords to take into account. + // If moves off Canvas fix to 0 + if (tolerance > 0) { + if (x > tolerance) { + x -= tolerance; + } + else { + x = 0; + } + if (y > tolerance) { + y -= tolerance; + } + else { + y = 0; + } + } + + var _isTransparent = true, i, temp, + imageData = ctx.getImageData(x, y, (tolerance * 2) || 1, (tolerance * 2) || 1), + l = imageData.data.length; + + // Split image data - for tolerance > 1, pixelDataSize = 4; + for (i = 3; i < l; i += 4) { + temp = imageData.data[i]; + _isTransparent = temp <= 0; + if (_isTransparent === false) { + break; // Stop if colour found + } + } + + imageData = null; + + return _isTransparent; + }, + + /** + * Parse preserveAspectRatio attribute from element + * @param {string} attribute to be parsed + * @return {Object} an object containing align and meetOrSlice attribute + */ + parsePreserveAspectRatioAttribute: function(attribute) { + var meetOrSlice = 'meet', alignX = 'Mid', alignY = 'Mid', + aspectRatioAttrs = attribute.split(' '), align; + + if (aspectRatioAttrs && aspectRatioAttrs.length) { + meetOrSlice = aspectRatioAttrs.pop(); + if (meetOrSlice !== 'meet' && meetOrSlice !== 'slice') { + align = meetOrSlice; + meetOrSlice = 'meet'; + } + else if (aspectRatioAttrs.length) { + align = aspectRatioAttrs.pop(); + } + } + //divide align in alignX and alignY + alignX = align !== 'none' ? align.slice(1, 4) : 'none'; + alignY = align !== 'none' ? align.slice(5, 8) : 'none'; + return { + meetOrSlice: meetOrSlice, + alignX: alignX, + alignY: alignY + }; + }, + + /** + * Clear char widths cache for the given font family or all the cache if no + * fontFamily is specified. + * Use it if you know you are loading fonts in a lazy way and you are not waiting + * for custom fonts to load properly when adding text objects to the canvas. + * If a text object is added when its own font is not loaded yet, you will get wrong + * measurement and so wrong bounding boxes. + * After the font cache is cleared, either change the textObject text content or call + * initDimensions() to trigger a recalculation + * @memberOf fabric.util + * @param {String} [fontFamily] font family to clear + */ + clearFabricFontCache: function(fontFamily) { + fontFamily = (fontFamily || '').toLowerCase(); + if (!fontFamily) { + fabric.charWidthsCache = { }; + } + else if (fabric.charWidthsCache[fontFamily]) { + delete fabric.charWidthsCache[fontFamily]; + } + }, + + /** + * Given current aspect ratio, determines the max width and height that can + * respect the total allowed area for the cache. + * @memberOf fabric.util + * @param {Number} ar aspect ratio + * @param {Number} maximumArea Maximum area you want to achieve + * @return {Object.x} Limited dimensions by X + * @return {Object.y} Limited dimensions by Y + */ + limitDimsByArea: function(ar, maximumArea) { + var roughWidth = Math.sqrt(maximumArea * ar), + perfLimitSizeY = Math.floor(maximumArea / roughWidth); + return { x: Math.floor(roughWidth), y: perfLimitSizeY }; + }, + + capValue: function(min, value, max) { + return Math.max(min, Math.min(value, max)); + }, + + findScaleToFit: function(source, destination) { + return Math.min(destination.width / source.width, destination.height / source.height); + }, + + findScaleToCover: function(source, destination) { + return Math.max(destination.width / source.width, destination.height / source.height); + }, + + /** + * given an array of 6 number returns something like `"matrix(...numbers)"` + * @memberOf fabric.util + * @param {Array} trasnform an array with 6 numbers + * @return {String} transform matrix for svg + * @return {Object.y} Limited dimensions by Y + */ + matrixToSVG: function(transform) { + return 'matrix(' + transform.map(function(value) { + return fabric.util.toFixed(value, fabric.Object.NUM_FRACTION_DIGITS); + }).join(' ') + ')'; + } + }; +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + var _join = Array.prototype.join; + + /* Adapted from http://dxr.mozilla.org/mozilla-central/source/content/svg/content/src/nsSVGPathDataParser.cpp + * by Andrea Bogazzi code is under MPL. if you don't have a copy of the license you can take it here + * http://mozilla.org/MPL/2.0/ + */ + function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) { + var argsString = _join.call(arguments); + if (fabric.arcToSegmentsCache[argsString]) { + return fabric.arcToSegmentsCache[argsString]; + } + + var PI = Math.PI, th = rotateX * PI / 180, + sinTh = fabric.util.sin(th), + cosTh = fabric.util.cos(th), + fromX = 0, fromY = 0; + + rx = Math.abs(rx); + ry = Math.abs(ry); + + var px = -cosTh * toX * 0.5 - sinTh * toY * 0.5, + py = -cosTh * toY * 0.5 + sinTh * toX * 0.5, + rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px, + pl = rx2 * ry2 - rx2 * py2 - ry2 * px2, + root = 0; + + if (pl < 0) { + var s = Math.sqrt(1 - pl / (rx2 * ry2)); + rx *= s; + ry *= s; + } + else { + root = (large === sweep ? -1.0 : 1.0) * + Math.sqrt( pl / (rx2 * py2 + ry2 * px2)); + } + + var cx = root * rx * py / ry, + cy = -root * ry * px / rx, + cx1 = cosTh * cx - sinTh * cy + toX * 0.5, + cy1 = sinTh * cx + cosTh * cy + toY * 0.5, + mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry), + dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry); + + if (sweep === 0 && dtheta > 0) { + dtheta -= 2 * PI; + } + else if (sweep === 1 && dtheta < 0) { + dtheta += 2 * PI; + } + + // Convert into cubic bezier segments <= 90deg + var segments = Math.ceil(Math.abs(dtheta / PI * 2)), + result = [], mDelta = dtheta / segments, + mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2), + th3 = mTheta + mDelta; + + for (var i = 0; i < segments; i++) { + result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY); + fromX = result[i][4]; + fromY = result[i][5]; + mTheta = th3; + th3 += mDelta; + } + fabric.arcToSegmentsCache[argsString] = result; + return result; + } + + function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) { + var costh2 = fabric.util.cos(th2), + sinth2 = fabric.util.sin(th2), + costh3 = fabric.util.cos(th3), + sinth3 = fabric.util.sin(th3), + toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1, + toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1, + cp1X = fromX + mT * ( -cosTh * rx * sinth2 - sinTh * ry * costh2), + cp1Y = fromY + mT * ( -sinTh * rx * sinth2 + cosTh * ry * costh2), + cp2X = toX + mT * ( cosTh * rx * sinth3 + sinTh * ry * costh3), + cp2Y = toY + mT * ( sinTh * rx * sinth3 - cosTh * ry * costh3); + + return [ + cp1X, cp1Y, + cp2X, cp2Y, + toX, toY + ]; + } + + /* + * Private + */ + function calcVectorAngle(ux, uy, vx, vy) { + var ta = Math.atan2(uy, ux), + tb = Math.atan2(vy, vx); + if (tb >= ta) { + return tb - ta; + } + else { + return 2 * Math.PI - (ta - tb); + } + } + + /** + * Draws arc + * @param {CanvasRenderingContext2D} ctx + * @param {Number} fx + * @param {Number} fy + * @param {Array} coords + */ + fabric.util.drawArc = function(ctx, fx, fy, coords) { + var rx = coords[0], + ry = coords[1], + rot = coords[2], + large = coords[3], + sweep = coords[4], + tx = coords[5], + ty = coords[6], + segs = [[], [], [], []], + segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segsNorm.length; i < len; i++) { + segs[i][0] = segsNorm[i][0] + fx; + segs[i][1] = segsNorm[i][1] + fy; + segs[i][2] = segsNorm[i][2] + fx; + segs[i][3] = segsNorm[i][3] + fy; + segs[i][4] = segsNorm[i][4] + fx; + segs[i][5] = segsNorm[i][5] + fy; + ctx.bezierCurveTo.apply(ctx, segs[i]); + } + }; + + /** + * Calculate bounding box of a elliptic-arc + * @param {Number} fx start point of arc + * @param {Number} fy + * @param {Number} rx horizontal radius + * @param {Number} ry vertical radius + * @param {Number} rot angle of horizontal axe + * @param {Number} large 1 or 0, whatever the arc is the big or the small on the 2 points + * @param {Number} sweep 1 or 0, 1 clockwise or counterclockwise direction + * @param {Number} tx end point of arc + * @param {Number} ty + */ + fabric.util.getBoundsOfArc = function(fx, fy, rx, ry, rot, large, sweep, tx, ty) { + + var fromX = 0, fromY = 0, bound, bounds = [], + segs = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segs.length; i < len; i++) { + bound = getBoundsOfCurve(fromX, fromY, segs[i][0], segs[i][1], segs[i][2], segs[i][3], segs[i][4], segs[i][5]); + bounds.push({ x: bound[0].x + fx, y: bound[0].y + fy }); + bounds.push({ x: bound[1].x + fx, y: bound[1].y + fy }); + fromX = segs[i][4]; + fromY = segs[i][5]; + } + return bounds; + }; + + /** + * Calculate bounding box of a beziercurve + * @param {Number} x0 starting point + * @param {Number} y0 + * @param {Number} x1 first control point + * @param {Number} y1 + * @param {Number} x2 secondo control point + * @param {Number} y2 + * @param {Number} x3 end of beizer + * @param {Number} y3 + */ + // taken from http://jsbin.com/ivomiq/56/edit no credits available for that. + function getBoundsOfCurve(x0, y0, x1, y1, x2, y2, x3, y3) { + var argsString; + if (fabric.cachesBoundsOfCurve) { + argsString = _join.call(arguments); + if (fabric.boundsOfCurveCache[argsString]) { + return fabric.boundsOfCurveCache[argsString]; + } + } + + var sqrt = Math.sqrt, + min = Math.min, max = Math.max, + abs = Math.abs, tvalues = [], + bounds = [[], []], + a, b, c, t, t1, t2, b2ac, sqrtb2ac; + + b = 6 * x0 - 12 * x1 + 6 * x2; + a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3; + c = 3 * x1 - 3 * x0; + + for (var i = 0; i < 2; ++i) { + if (i > 0) { + b = 6 * y0 - 12 * y1 + 6 * y2; + a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3; + c = 3 * y1 - 3 * y0; + } + + if (abs(a) < 1e-12) { + if (abs(b) < 1e-12) { + continue; + } + t = -c / b; + if (0 < t && t < 1) { + tvalues.push(t); + } + continue; + } + b2ac = b * b - 4 * c * a; + if (b2ac < 0) { + continue; + } + sqrtb2ac = sqrt(b2ac); + t1 = (-b + sqrtb2ac) / (2 * a); + if (0 < t1 && t1 < 1) { + tvalues.push(t1); + } + t2 = (-b - sqrtb2ac) / (2 * a); + if (0 < t2 && t2 < 1) { + tvalues.push(t2); + } + } + + var x, y, j = tvalues.length, jlen = j, mt; + while (j--) { + t = tvalues[j]; + mt = 1 - t; + x = (mt * mt * mt * x0) + (3 * mt * mt * t * x1) + (3 * mt * t * t * x2) + (t * t * t * x3); + bounds[0][j] = x; + + y = (mt * mt * mt * y0) + (3 * mt * mt * t * y1) + (3 * mt * t * t * y2) + (t * t * t * y3); + bounds[1][j] = y; + } + + bounds[0][jlen] = x0; + bounds[1][jlen] = y0; + bounds[0][jlen + 1] = x3; + bounds[1][jlen + 1] = y3; + var result = [ + { + x: min.apply(null, bounds[0]), + y: min.apply(null, bounds[1]) + }, + { + x: max.apply(null, bounds[0]), + y: max.apply(null, bounds[1]) + } + ]; + if (fabric.cachesBoundsOfCurve) { + fabric.boundsOfCurveCache[argsString] = result; + } + return result; + } + + fabric.util.getBoundsOfCurve = getBoundsOfCurve; + +})(); +(function() { + + var slice = Array.prototype.slice; + + /** + * Invokes method on all items in a given array + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} method Name of a method to invoke + * @return {Array} + */ + function invoke(array, method) { + var args = slice.call(arguments, 2), result = []; + for (var i = 0, len = array.length; i < len; i++) { + result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]); + } + return result; + } + + /** + * Finds maximum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {*} + */ + function max(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 >= value2; + }); + } + + /** + * Finds minimum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {*} + */ + function min(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 < value2; + }); + } + + /** + * @private + */ + function fill(array, value) { + var k = array.length; + while (k--) { + array[k] = value; + } + return array; + } + + /** + * @private + */ + function find(array, byProperty, condition) { + if (!array || array.length === 0) { + return; + } + + var i = array.length - 1, + result = byProperty ? array[i][byProperty] : array[i]; + if (byProperty) { + while (i--) { + if (condition(array[i][byProperty], result)) { + result = array[i][byProperty]; + } + } + } + else { + while (i--) { + if (condition(array[i], result)) { + result = array[i]; + } + } + } + return result; + } + + /** + * @namespace fabric.util.array + */ + fabric.util.array = { + fill: fill, + invoke: invoke, + min: min, + max: max + }; + +})(); +(function() { + /** + * Copies all enumerable properties of one js object to another + * this does not and cannot compete with generic utils. + * Does not clone or extend fabric.Object subclasses. + * This is mostly for internal use and has extra handling for fabricJS objects + * it skips the canvas property in deep cloning. + * @memberOf fabric.util.object + * @param {Object} destination Where to copy to + * @param {Object} source Where to copy from + * @return {Object} + */ + + function extend(destination, source, deep) { + // JScript DontEnum bug is not taken care of + // the deep clone is for internal use, is not meant to avoid + // javascript traps or cloning html element or self referenced objects. + if (deep) { + if (!fabric.isLikelyNode && source instanceof Element) { + // avoid cloning deep images, canvases, + destination = source; + } + else if (source instanceof Array) { + destination = []; + for (var i = 0, len = source.length; i < len; i++) { + destination[i] = extend({ }, source[i], deep); + } + } + else if (source && typeof source === 'object') { + for (var property in source) { + if (property === 'canvas') { + destination[property] = extend({ }, source[property]); + } + else if (source.hasOwnProperty(property)) { + destination[property] = extend({ }, source[property], deep); + } + } + } + else { + // this sounds odd for an extend but is ok for recursive use + destination = source; + } + } + else { + for (var property in source) { + destination[property] = source[property]; + } + } + return destination; + } + + /** + * Creates an empty object and copies all enumerable properties of another object to it + * @memberOf fabric.util.object + * TODO: this function return an empty object if you try to clone null + * @param {Object} object Object to clone + * @return {Object} + */ + function clone(object, deep) { + return extend({ }, object, deep); + } + + /** @namespace fabric.util.object */ + fabric.util.object = { + extend: extend, + clone: clone + }; + fabric.util.object.extend(fabric.util, fabric.Observable); +})(); +(function() { + + /** + * Camelizes a string + * @memberOf fabric.util.string + * @param {String} string String to camelize + * @return {String} Camelized version of a string + */ + function camelize(string) { + return string.replace(/-+(.)?/g, function(match, character) { + return character ? character.toUpperCase() : ''; + }); + } + + /** + * Capitalizes a string + * @memberOf fabric.util.string + * @param {String} string String to capitalize + * @param {Boolean} [firstLetterOnly] If true only first letter is capitalized + * and other letters stay untouched, if false first letter is capitalized + * and other letters are converted to lowercase. + * @return {String} Capitalized version of a string + */ + function capitalize(string, firstLetterOnly) { + return string.charAt(0).toUpperCase() + + (firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase()); + } + + /** + * Escapes XML in a string + * @memberOf fabric.util.string + * @param {String} string String to escape + * @return {String} Escaped version of a string + */ + function escapeXml(string) { + return string.replace(/&/g, '&') + .replace(/"/g, '"') + .replace(/'/g, ''') + .replace(//g, '>'); + } + + /** + * Divide a string in the user perceived single units + * @memberOf fabric.util.string + * @param {String} textstring String to escape + * @return {Array} array containing the graphemes + */ + function graphemeSplit(textstring) { + var i = 0, chr, graphemes = []; + for (i = 0, chr; i < textstring.length; i++) { + if ((chr = getWholeChar(textstring, i)) === false) { + continue; + } + graphemes.push(chr); + } + return graphemes; + } + + // taken from mdn in the charAt doc page. + function getWholeChar(str, i) { + var code = str.charCodeAt(i); + + if (isNaN(code)) { + return ''; // Position not found + } + if (code < 0xD800 || code > 0xDFFF) { + return str.charAt(i); + } + + // High surrogate (could change last hex to 0xDB7F to treat high private + // surrogates as single characters) + if (0xD800 <= code && code <= 0xDBFF) { + if (str.length <= (i + 1)) { + throw 'High surrogate without following low surrogate'; + } + var next = str.charCodeAt(i + 1); + if (0xDC00 > next || next > 0xDFFF) { + throw 'High surrogate without following low surrogate'; + } + return str.charAt(i) + str.charAt(i + 1); + } + // Low surrogate (0xDC00 <= code && code <= 0xDFFF) + if (i === 0) { + throw 'Low surrogate without preceding high surrogate'; + } + var prev = str.charCodeAt(i - 1); + + // (could change last hex to 0xDB7F to treat high private + // surrogates as single characters) + if (0xD800 > prev || prev > 0xDBFF) { + throw 'Low surrogate without preceding high surrogate'; + } + // We can pass over low surrogates now as the second component + // in a pair which we have already processed + return false; + } + + + /** + * String utilities + * @namespace fabric.util.string + */ + fabric.util.string = { + camelize: camelize, + capitalize: capitalize, + escapeXml: escapeXml, + graphemeSplit: graphemeSplit + }; +})(); +(function() { + + var slice = Array.prototype.slice, emptyFunction = function() { }, + + IS_DONTENUM_BUGGY = (function() { + for (var p in { toString: 1 }) { + if (p === 'toString') { + return false; + } + } + return true; + })(), + + /** @ignore */ + addMethods = function(klass, source, parent) { + for (var property in source) { + + if (property in klass.prototype && + typeof klass.prototype[property] === 'function' && + (source[property] + '').indexOf('callSuper') > -1) { + + klass.prototype[property] = (function(property) { + return function() { + + var superclass = this.constructor.superclass; + this.constructor.superclass = parent; + var returnValue = source[property].apply(this, arguments); + this.constructor.superclass = superclass; + + if (property !== 'initialize') { + return returnValue; + } + }; + })(property); + } + else { + klass.prototype[property] = source[property]; + } + + if (IS_DONTENUM_BUGGY) { + if (source.toString !== Object.prototype.toString) { + klass.prototype.toString = source.toString; + } + if (source.valueOf !== Object.prototype.valueOf) { + klass.prototype.valueOf = source.valueOf; + } + } + } + }; + + function Subclass() { } + + function callSuper(methodName) { + var parentMethod = null, + _this = this; + + // climb prototype chain to find method not equal to callee's method + while (_this.constructor.superclass) { + var superClassMethod = _this.constructor.superclass.prototype[methodName]; + if (_this[methodName] !== superClassMethod) { + parentMethod = superClassMethod; + break; + } + // eslint-disable-next-line + _this = _this.constructor.superclass.prototype; + } + + if (!parentMethod) { + return console.log('tried to callSuper ' + methodName + ', method not found in prototype chain', this); + } + + return (arguments.length > 1) + ? parentMethod.apply(this, slice.call(arguments, 1)) + : parentMethod.call(this); + } + + /** + * Helper for creation of "classes". + * @memberOf fabric.util + * @param {Function} [parent] optional "Class" to inherit from + * @param {Object} [properties] Properties shared by all instances of this class + * (be careful modifying objects defined here as this would affect all instances) + */ + function createClass() { + var parent = null, + properties = slice.call(arguments, 0); + + if (typeof properties[0] === 'function') { + parent = properties.shift(); + } + function klass() { + this.initialize.apply(this, arguments); + } + + klass.superclass = parent; + klass.subclasses = []; + + if (parent) { + Subclass.prototype = parent.prototype; + klass.prototype = new Subclass(); + parent.subclasses.push(klass); + } + for (var i = 0, length = properties.length; i < length; i++) { + addMethods(klass, properties[i], parent); + } + if (!klass.prototype.initialize) { + klass.prototype.initialize = emptyFunction; + } + klass.prototype.constructor = klass; + klass.prototype.callSuper = callSuper; + return klass; + } + + fabric.util.createClass = createClass; +})(); +(function () { + // since ie10 or ie9 can use addEventListener but they do not support options, i need to check + var couldUseAttachEvent = !!fabric.document.createElement('div').attachEvent; + /** + * Adds an event listener to an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.addListener = function(element, eventName, handler, options) { + element && element.addEventListener(eventName, handler, couldUseAttachEvent ? false : options); + }; + + /** + * Removes an event listener from an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.removeListener = function(element, eventName, handler, options) { + element && element.removeEventListener(eventName, handler, couldUseAttachEvent ? false : options); + }; + + function getTouchInfo(event) { + var touchProp = event.changedTouches; + if (touchProp && touchProp[0]) { + return touchProp[0]; + } + return event; + } + + fabric.util.getPointer = function(event) { + var element = event.target, + scroll = fabric.util.getScrollLeftTop(element), + _evt = getTouchInfo(event); + return { + x: _evt.clientX + scroll.left, + y: _evt.clientY + scroll.top + }; + }; +})(); +(function () { + + /** + * Cross-browser wrapper for setting element's style + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {Object} styles + * @return {HTMLElement} Element that was passed as a first argument + */ + function setStyle(element, styles) { + var elementStyle = element.style; + if (!elementStyle) { + return element; + } + if (typeof styles === 'string') { + element.style.cssText += ';' + styles; + return styles.indexOf('opacity') > -1 + ? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) + : element; + } + for (var property in styles) { + if (property === 'opacity') { + setOpacity(element, styles[property]); + } + else { + var normalizedProperty = (property === 'float' || property === 'cssFloat') + ? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat') + : property; + elementStyle[normalizedProperty] = styles[property]; + } + } + return element; + } + + var parseEl = fabric.document.createElement('div'), + supportsOpacity = typeof parseEl.style.opacity === 'string', + supportsFilters = typeof parseEl.style.filter === 'string', + reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/, + + /** @ignore */ + setOpacity = function (element) { return element; }; + + if (supportsOpacity) { + /** @ignore */ + setOpacity = function(element, value) { + element.style.opacity = value; + return element; + }; + } + else if (supportsFilters) { + /** @ignore */ + setOpacity = function(element, value) { + var es = element.style; + if (element.currentStyle && !element.currentStyle.hasLayout) { + es.zoom = 1; + } + if (reOpacity.test(es.filter)) { + value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')'); + es.filter = es.filter.replace(reOpacity, value); + } + else { + es.filter += ' alpha(opacity=' + (value * 100) + ')'; + } + return element; + }; + } + + fabric.util.setStyle = setStyle; + +})(); +(function() { + + var _slice = Array.prototype.slice; + + /** + * Takes id and returns an element with that id (if one exists in a document) + * @memberOf fabric.util + * @param {String|HTMLElement} id + * @return {HTMLElement|null} + */ + function getById(id) { + return typeof id === 'string' ? fabric.document.getElementById(id) : id; + } + + var sliceCanConvertNodelists, + /** + * Converts an array-like object (e.g. arguments or NodeList) to an array + * @memberOf fabric.util + * @param {Object} arrayLike + * @return {Array} + */ + toArray = function(arrayLike) { + return _slice.call(arrayLike, 0); + }; + + try { + sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array; + } + catch (err) { } + + if (!sliceCanConvertNodelists) { + toArray = function(arrayLike) { + var arr = new Array(arrayLike.length), i = arrayLike.length; + while (i--) { + arr[i] = arrayLike[i]; + } + return arr; + }; + } + + /** + * Creates specified element with specified attributes + * @memberOf fabric.util + * @param {String} tagName Type of an element to create + * @param {Object} [attributes] Attributes to set on an element + * @return {HTMLElement} Newly created element + */ + function makeElement(tagName, attributes) { + var el = fabric.document.createElement(tagName); + for (var prop in attributes) { + if (prop === 'class') { + el.className = attributes[prop]; + } + else if (prop === 'for') { + el.htmlFor = attributes[prop]; + } + else { + el.setAttribute(prop, attributes[prop]); + } + } + return el; + } + + /** + * Adds class to an element + * @memberOf fabric.util + * @param {HTMLElement} element Element to add class to + * @param {String} className Class to add to an element + */ + function addClass(element, className) { + if (element && (' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) { + element.className += (element.className ? ' ' : '') + className; + } + } + + /** + * Wraps element with another element + * @memberOf fabric.util + * @param {HTMLElement} element Element to wrap + * @param {HTMLElement|String} wrapper Element to wrap with + * @param {Object} [attributes] Attributes to set on a wrapper + * @return {HTMLElement} wrapper + */ + function wrapElement(element, wrapper, attributes) { + if (typeof wrapper === 'string') { + wrapper = makeElement(wrapper, attributes); + } + if (element.parentNode) { + element.parentNode.replaceChild(wrapper, element); + } + wrapper.appendChild(element); + return wrapper; + } + + /** + * Returns element scroll offsets + * @memberOf fabric.util + * @param {HTMLElement} element Element to operate on + * @return {Object} Object with left/top values + */ + function getScrollLeftTop(element) { + + var left = 0, + top = 0, + docElement = fabric.document.documentElement, + body = fabric.document.body || { + scrollLeft: 0, scrollTop: 0 + }; + + // While loop checks (and then sets element to) .parentNode OR .host + // to account for ShadowDOM. We still want to traverse up out of ShadowDOM, + // but the .parentNode of a root ShadowDOM node will always be null, instead + // it should be accessed through .host. See http://stackoverflow.com/a/24765528/4383938 + while (element && (element.parentNode || element.host)) { + + // Set element to element parent, or 'host' in case of ShadowDOM + element = element.parentNode || element.host; + + if (element === fabric.document) { + left = body.scrollLeft || docElement.scrollLeft || 0; + top = body.scrollTop || docElement.scrollTop || 0; + } + else { + left += element.scrollLeft || 0; + top += element.scrollTop || 0; + } + + if (element.nodeType === 1 && element.style.position === 'fixed') { + break; + } + } + + return { left: left, top: top }; + } + + /** + * Returns offset for a given element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element Element to get offset for + * @return {Object} Object with "left" and "top" properties + */ + function getElementOffset(element) { + var docElem, + doc = element && element.ownerDocument, + box = { left: 0, top: 0 }, + offset = { left: 0, top: 0 }, + scrollLeftTop, + offsetAttributes = { + borderLeftWidth: 'left', + borderTopWidth: 'top', + paddingLeft: 'left', + paddingTop: 'top' + }; + + if (!doc) { + return offset; + } + + for (var attr in offsetAttributes) { + offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0; + } + + docElem = doc.documentElement; + if ( typeof element.getBoundingClientRect !== 'undefined' ) { + box = element.getBoundingClientRect(); + } + + scrollLeftTop = getScrollLeftTop(element); + + return { + left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left, + top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top + }; + } + + /** + * Returns style attribute value of a given element + * @memberOf fabric.util + * @param {HTMLElement} element Element to get style attribute for + * @param {String} attr Style attribute to get for element + * @return {String} Style attribute value of the given element. + */ + var getElementStyle; + if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) { + getElementStyle = function(element, attr) { + var style = fabric.document.defaultView.getComputedStyle(element, null); + return style ? style[attr] : undefined; + }; + } + else { + getElementStyle = function(element, attr) { + var value = element.style[attr]; + if (!value && element.currentStyle) { + value = element.currentStyle[attr]; + } + return value; + }; + } + + (function () { + var style = fabric.document.documentElement.style, + selectProp = 'userSelect' in style + ? 'userSelect' + : 'MozUserSelect' in style + ? 'MozUserSelect' + : 'WebkitUserSelect' in style + ? 'WebkitUserSelect' + : 'KhtmlUserSelect' in style + ? 'KhtmlUserSelect' + : ''; + + /** + * Makes element unselectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make unselectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementUnselectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = fabric.util.falseFunction; + } + if (selectProp) { + element.style[selectProp] = 'none'; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = 'on'; + } + return element; + } + + /** + * Makes element selectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make selectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementSelectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = null; + } + if (selectProp) { + element.style[selectProp] = ''; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = ''; + } + return element; + } + + fabric.util.makeElementUnselectable = makeElementUnselectable; + fabric.util.makeElementSelectable = makeElementSelectable; + })(); + + (function() { + + /** + * Inserts a script element with a given url into a document; invokes callback, when that script is finished loading + * @memberOf fabric.util + * @param {String} url URL of a script to load + * @param {Function} callback Callback to execute when script is finished loading + */ + function getScript(url, callback) { + var headEl = fabric.document.getElementsByTagName('head')[0], + scriptEl = fabric.document.createElement('script'), + loading = true; + + /** @ignore */ + scriptEl.onload = /** @ignore */ scriptEl.onreadystatechange = function(e) { + if (loading) { + if (typeof this.readyState === 'string' && + this.readyState !== 'loaded' && + this.readyState !== 'complete') { + return; + } + loading = false; + callback(e || fabric.window.event); + scriptEl = scriptEl.onload = scriptEl.onreadystatechange = null; + } + }; + scriptEl.src = url; + headEl.appendChild(scriptEl); + // causes issue in Opera + // headEl.removeChild(scriptEl); + } + + fabric.util.getScript = getScript; + })(); + + function getNodeCanvas(element) { + var impl = fabric.jsdomImplForWrapper(element); + return impl._canvas || impl._image; + }; + + function cleanUpJsdomNode(element) { + if (!fabric.isLikelyNode) { + return; + } + var impl = fabric.jsdomImplForWrapper(element); + if (impl) { + impl._image = null; + impl._canvas = null; + // unsure if necessary + impl._currentSrc = null; + impl._attributes = null; + impl._classList = null; + } + } + + fabric.util.getById = getById; + fabric.util.toArray = toArray; + fabric.util.makeElement = makeElement; + fabric.util.addClass = addClass; + fabric.util.wrapElement = wrapElement; + fabric.util.getScrollLeftTop = getScrollLeftTop; + fabric.util.getElementOffset = getElementOffset; + fabric.util.getElementStyle = getElementStyle; + fabric.util.getNodeCanvas = getNodeCanvas; + fabric.util.cleanUpJsdomNode = cleanUpJsdomNode; + +})(); +(function() { + + function addParamToUrl(url, param) { + return url + (/\?/.test(url) ? '&' : '?') + param; + } + + function emptyFn() { } + + /** + * Cross-browser abstraction for sending XMLHttpRequest + * @memberOf fabric.util + * @param {String} url URL to send XMLHttpRequest to + * @param {Object} [options] Options object + * @param {String} [options.method="GET"] + * @param {String} [options.parameters] parameters to append to url in GET or in body + * @param {String} [options.body] body to send with POST or PUT request + * @param {Function} options.onComplete Callback to invoke when request is completed + * @return {XMLHttpRequest} request + */ + function request(url, options) { + options || (options = { }); + + var method = options.method ? options.method.toUpperCase() : 'GET', + onComplete = options.onComplete || function() { }, + xhr = new fabric.window.XMLHttpRequest(), + body = options.body || options.parameters; + + /** @ignore */ + xhr.onreadystatechange = function() { + if (xhr.readyState === 4) { + onComplete(xhr); + xhr.onreadystatechange = emptyFn; + } + }; + + if (method === 'GET') { + body = null; + if (typeof options.parameters === 'string') { + url = addParamToUrl(url, options.parameters); + } + } + + xhr.open(method, url, true); + + if (method === 'POST' || method === 'PUT') { + xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded'); + } + + xhr.send(body); + return xhr; + } + + fabric.util.request = request; +})(); +/** + * Wrapper around `console.log` (when available) + * @param {*} [values] Values to log + */ +fabric.log = function() { }; + +/** + * Wrapper around `console.warn` (when available) + * @param {*} [values] Values to log as a warning + */ +fabric.warn = function() { }; + +/* eslint-disable */ +if (typeof console !== 'undefined') { + + ['log', 'warn'].forEach(function(methodName) { + + if (typeof console[methodName] !== 'undefined' && + typeof console[methodName].apply === 'function') { + + fabric[methodName] = function() { + return console[methodName].apply(console, arguments); + }; + } + }); +} +/* eslint-enable */ +(function() { + + function noop() { + return false; + } + + function defaultEasing(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + + /** + * Changes value from one to another within certain period of time, invoking callbacks as value is being changed. + * @memberOf fabric.util + * @param {Object} [options] Animation options + * @param {Function} [options.onChange] Callback; invoked on every value change + * @param {Function} [options.onComplete] Callback; invoked when value change is completed + * @param {Number} [options.startValue=0] Starting value + * @param {Number} [options.endValue=100] Ending value + * @param {Number} [options.byValue=100] Value to modify the property by + * @param {Function} [options.easing] Easing function + * @param {Number} [options.duration=500] Duration of change (in ms) + * @param {Function} [options.abort] Additional function with logic. If returns true, onComplete is called. + */ + function animate(options) { + + requestAnimFrame(function(timestamp) { + options || (options = { }); + + var start = timestamp || +new Date(), + duration = options.duration || 500, + finish = start + duration, time, + onChange = options.onChange || noop, + abort = options.abort || noop, + onComplete = options.onComplete || noop, + easing = options.easing || defaultEasing, + startValue = 'startValue' in options ? options.startValue : 0, + endValue = 'endValue' in options ? options.endValue : 100, + byValue = options.byValue || endValue - startValue; + + options.onStart && options.onStart(); + + (function tick(ticktime) { + // TODO: move abort call after calculation + // and pass (current,valuePerc, timePerc) as arguments + time = ticktime || +new Date(); + var currentTime = time > finish ? duration : (time - start), + timePerc = currentTime / duration, + current = easing(currentTime, startValue, byValue, duration), + valuePerc = Math.abs((current - startValue) / byValue); + if (abort()) { + onComplete(endValue, 1, 1); + return; + } + if (time > finish) { + onChange(endValue, 1, 1); + onComplete(endValue, 1, 1); + return; + } + else { + onChange(current, valuePerc, timePerc); + requestAnimFrame(tick); + } + })(start); + }); + } + + var _requestAnimFrame = fabric.window.requestAnimationFrame || + fabric.window.webkitRequestAnimationFrame || + fabric.window.mozRequestAnimationFrame || + fabric.window.oRequestAnimationFrame || + fabric.window.msRequestAnimationFrame || + function(callback) { + return fabric.window.setTimeout(callback, 1000 / 60); + }; + + var _cancelAnimFrame = fabric.window.cancelAnimationFrame || fabric.window.clearTimeout; + + /** + * requestAnimationFrame polyfill based on http://paulirish.com/2011/requestanimationframe-for-smart-animating/ + * In order to get a precise start time, `requestAnimFrame` should be called as an entry into the method + * @memberOf fabric.util + * @param {Function} callback Callback to invoke + * @param {DOMElement} element optional Element to associate with animation + */ + function requestAnimFrame() { + return _requestAnimFrame.apply(fabric.window, arguments); + } + + function cancelAnimFrame() { + return _cancelAnimFrame.apply(fabric.window, arguments); + } + + fabric.util.animate = animate; + fabric.util.requestAnimFrame = requestAnimFrame; + fabric.util.cancelAnimFrame = cancelAnimFrame; +})(); +(function() { + // Calculate an in-between color. Returns a "rgba()" string. + // Credit: Edwin Martin + // http://www.bitstorm.org/jquery/color-animation/jquery.animate-colors.js + function calculateColor(begin, end, pos) { + var color = 'rgba(' + + parseInt((begin[0] + pos * (end[0] - begin[0])), 10) + ',' + + parseInt((begin[1] + pos * (end[1] - begin[1])), 10) + ',' + + parseInt((begin[2] + pos * (end[2] - begin[2])), 10); + + color += ',' + (begin && end ? parseFloat(begin[3] + pos * (end[3] - begin[3])) : 1); + color += ')'; + return color; + } + + /** + * Changes the color from one to another within certain period of time, invoking callbacks as value is being changed. + * @memberOf fabric.util + * @param {String} fromColor The starting color in hex or rgb(a) format. + * @param {String} toColor The starting color in hex or rgb(a) format. + * @param {Number} [duration] Duration of change (in ms). + * @param {Object} [options] Animation options + * @param {Function} [options.onChange] Callback; invoked on every value change + * @param {Function} [options.onComplete] Callback; invoked when value change is completed + * @param {Function} [options.colorEasing] Easing function. Note that this function only take two arguments (currentTime, duration). Thus the regular animation easing functions cannot be used. + * @param {Function} [options.abort] Additional function with logic. If returns true, onComplete is called. + */ + function animateColor(fromColor, toColor, duration, options) { + var startColor = new fabric.Color(fromColor).getSource(), + endColor = new fabric.Color(toColor).getSource(); + + options = options || {}; + + fabric.util.animate(fabric.util.object.extend(options, { + duration: duration || 500, + startValue: startColor, + endValue: endColor, + byValue: endColor, + easing: function (currentTime, startValue, byValue, duration) { + var posValue = options.colorEasing + ? options.colorEasing(currentTime, duration) + : 1 - Math.cos(currentTime / duration * (Math.PI / 2)); + return calculateColor(startValue, byValue, posValue); + } + })); + } + + fabric.util.animateColor = animateColor; + +})(); +(function() { + + function normalize(a, c, p, s) { + if (a < Math.abs(c)) { + a = c; + s = p / 4; + } + else { + //handle the 0/0 case: + if (c === 0 && a === 0) { + s = p / (2 * Math.PI) * Math.asin(1); + } + else { + s = p / (2 * Math.PI) * Math.asin(c / a); + } + } + return { a: a, c: c, p: p, s: s }; + } + + function elastic(opts, t, d) { + return opts.a * + Math.pow(2, 10 * (t -= 1)) * + Math.sin( (t * d - opts.s) * (2 * Math.PI) / opts.p ); + } + + /** + * Cubic easing out + * @memberOf fabric.util.ease + */ + function easeOutCubic(t, b, c, d) { + return c * ((t = t / d - 1) * t * t + 1) + b; + } + + /** + * Cubic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCubic(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t + 2) + b; + } + + /** + * Quartic easing in + * @memberOf fabric.util.ease + */ + function easeInQuart(t, b, c, d) { + return c * (t /= d) * t * t * t + b; + } + + /** + * Quartic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuart(t, b, c, d) { + return -c * ((t = t / d - 1) * t * t * t - 1) + b; + } + + /** + * Quartic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuart(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t + b; + } + return -c / 2 * ((t -= 2) * t * t * t - 2) + b; + } + + /** + * Quintic easing in + * @memberOf fabric.util.ease + */ + function easeInQuint(t, b, c, d) { + return c * (t /= d) * t * t * t * t + b; + } + + /** + * Quintic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuint(t, b, c, d) { + return c * ((t = t / d - 1) * t * t * t * t + 1) + b; + } + + /** + * Quintic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuint(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t * t * t + 2) + b; + } + + /** + * Sinusoidal easing in + * @memberOf fabric.util.ease + */ + function easeInSine(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + + /** + * Sinusoidal easing out + * @memberOf fabric.util.ease + */ + function easeOutSine(t, b, c, d) { + return c * Math.sin(t / d * (Math.PI / 2)) + b; + } + + /** + * Sinusoidal easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutSine(t, b, c, d) { + return -c / 2 * (Math.cos(Math.PI * t / d) - 1) + b; + } + + /** + * Exponential easing in + * @memberOf fabric.util.ease + */ + function easeInExpo(t, b, c, d) { + return (t === 0) ? b : c * Math.pow(2, 10 * (t / d - 1)) + b; + } + + /** + * Exponential easing out + * @memberOf fabric.util.ease + */ + function easeOutExpo(t, b, c, d) { + return (t === d) ? b + c : c * (-Math.pow(2, -10 * t / d) + 1) + b; + } + + /** + * Exponential easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutExpo(t, b, c, d) { + if (t === 0) { + return b; + } + if (t === d) { + return b + c; + } + t /= d / 2; + if (t < 1) { + return c / 2 * Math.pow(2, 10 * (t - 1)) + b; + } + return c / 2 * (-Math.pow(2, -10 * --t) + 2) + b; + } + + /** + * Circular easing in + * @memberOf fabric.util.ease + */ + function easeInCirc(t, b, c, d) { + return -c * (Math.sqrt(1 - (t /= d) * t) - 1) + b; + } + + /** + * Circular easing out + * @memberOf fabric.util.ease + */ + function easeOutCirc(t, b, c, d) { + return c * Math.sqrt(1 - (t = t / d - 1) * t) + b; + } + + /** + * Circular easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCirc(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return -c / 2 * (Math.sqrt(1 - t * t) - 1) + b; + } + return c / 2 * (Math.sqrt(1 - (t -= 2) * t) + 1) + b; + } + + /** + * Elastic easing in + * @memberOf fabric.util.ease + */ + function easeInElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return -elastic(opts, t, d) + b; + } + + /** + * Elastic easing out + * @memberOf fabric.util.ease + */ + function easeOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return opts.a * Math.pow(2, -10 * t) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) + opts.c + b; + } + + /** + * Elastic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d / 2; + if (t === 2) { + return b + c; + } + if (!p) { + p = d * (0.3 * 1.5); + } + var opts = normalize(a, c, p, s); + if (t < 1) { + return -0.5 * elastic(opts, t, d) + b; + } + return opts.a * Math.pow(2, -10 * (t -= 1)) * + Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) * 0.5 + opts.c + b; + } + + /** + * Backwards easing in + * @memberOf fabric.util.ease + */ + function easeInBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * (t /= d) * t * ((s + 1) * t - s) + b; + } + + /** + * Backwards easing out + * @memberOf fabric.util.ease + */ + function easeOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * ((t = t / d - 1) * t * ((s + 1) * t + s) + 1) + b; + } + + /** + * Backwards easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + t /= d / 2; + if (t < 1) { + return c / 2 * (t * t * (((s *= (1.525)) + 1) * t - s)) + b; + } + return c / 2 * ((t -= 2) * t * (((s *= (1.525)) + 1) * t + s) + 2) + b; + } + + /** + * Bouncing easing in + * @memberOf fabric.util.ease + */ + function easeInBounce(t, b, c, d) { + return c - easeOutBounce (d - t, 0, c, d) + b; + } + + /** + * Bouncing easing out + * @memberOf fabric.util.ease + */ + function easeOutBounce(t, b, c, d) { + if ((t /= d) < (1 / 2.75)) { + return c * (7.5625 * t * t) + b; + } + else if (t < (2 / 2.75)) { + return c * (7.5625 * (t -= (1.5 / 2.75)) * t + 0.75) + b; + } + else if (t < (2.5 / 2.75)) { + return c * (7.5625 * (t -= (2.25 / 2.75)) * t + 0.9375) + b; + } + else { + return c * (7.5625 * (t -= (2.625 / 2.75)) * t + 0.984375) + b; + } + } + + /** + * Bouncing easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBounce(t, b, c, d) { + if (t < d / 2) { + return easeInBounce (t * 2, 0, c, d) * 0.5 + b; + } + return easeOutBounce(t * 2 - d, 0, c, d) * 0.5 + c * 0.5 + b; + } + + /** + * Easing functions + * See Easing Equations by Robert Penner + * @namespace fabric.util.ease + */ + fabric.util.ease = { + + /** + * Quadratic easing in + * @memberOf fabric.util.ease + */ + easeInQuad: function(t, b, c, d) { + return c * (t /= d) * t + b; + }, + + /** + * Quadratic easing out + * @memberOf fabric.util.ease + */ + easeOutQuad: function(t, b, c, d) { + return -c * (t /= d) * (t - 2) + b; + }, + + /** + * Quadratic easing in and out + * @memberOf fabric.util.ease + */ + easeInOutQuad: function(t, b, c, d) { + t /= (d / 2); + if (t < 1) { + return c / 2 * t * t + b; + } + return -c / 2 * ((--t) * (t - 2) - 1) + b; + }, + + /** + * Cubic easing in + * @memberOf fabric.util.ease + */ + easeInCubic: function(t, b, c, d) { + return c * (t /= d) * t * t + b; + }, + + easeOutCubic: easeOutCubic, + easeInOutCubic: easeInOutCubic, + easeInQuart: easeInQuart, + easeOutQuart: easeOutQuart, + easeInOutQuart: easeInOutQuart, + easeInQuint: easeInQuint, + easeOutQuint: easeOutQuint, + easeInOutQuint: easeInOutQuint, + easeInSine: easeInSine, + easeOutSine: easeOutSine, + easeInOutSine: easeInOutSine, + easeInExpo: easeInExpo, + easeOutExpo: easeOutExpo, + easeInOutExpo: easeInOutExpo, + easeInCirc: easeInCirc, + easeOutCirc: easeOutCirc, + easeInOutCirc: easeInOutCirc, + easeInElastic: easeInElastic, + easeOutElastic: easeOutElastic, + easeInOutElastic: easeInOutElastic, + easeInBack: easeInBack, + easeOutBack: easeOutBack, + easeInOutBack: easeInOutBack, + easeInBounce: easeInBounce, + easeOutBounce: easeOutBounce, + easeInOutBounce: easeInOutBounce + }; + +})(); +(function(global) { + + 'use strict'; + + /** + * @name fabric + * @namespace + */ + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + parseUnit = fabric.util.parseUnit, + multiplyTransformMatrices = fabric.util.multiplyTransformMatrices, + + svgValidTagNames = ['path', 'circle', 'polygon', 'polyline', 'ellipse', 'rect', 'line', + 'image', 'text'], + svgViewBoxElements = ['symbol', 'image', 'marker', 'pattern', 'view', 'svg'], + svgInvalidAncestors = ['pattern', 'defs', 'symbol', 'metadata', 'clipPath', 'mask', 'desc'], + svgValidParents = ['symbol', 'g', 'a', 'svg', 'clipPath', 'defs'], + + attributesMap = { + cx: 'left', + x: 'left', + r: 'radius', + cy: 'top', + y: 'top', + display: 'visible', + visibility: 'visible', + transform: 'transformMatrix', + 'fill-opacity': 'fillOpacity', + 'fill-rule': 'fillRule', + 'font-family': 'fontFamily', + 'font-size': 'fontSize', + 'font-style': 'fontStyle', + 'font-weight': 'fontWeight', + 'letter-spacing': 'charSpacing', + 'paint-order': 'paintFirst', + 'stroke-dasharray': 'strokeDashArray', + 'stroke-dashoffset': 'strokeDashOffset', + 'stroke-linecap': 'strokeLineCap', + 'stroke-linejoin': 'strokeLineJoin', + 'stroke-miterlimit': 'strokeMiterLimit', + 'stroke-opacity': 'strokeOpacity', + 'stroke-width': 'strokeWidth', + 'text-decoration': 'textDecoration', + 'text-anchor': 'textAnchor', + opacity: 'opacity', + 'clip-path': 'clipPath', + 'clip-rule': 'clipRule', + 'vector-effect': 'strokeUniform' + }, + + colorAttributes = { + stroke: 'strokeOpacity', + fill: 'fillOpacity' + }; + + fabric.svgValidTagNamesRegEx = getSvgRegex(svgValidTagNames); + fabric.svgViewBoxElementsRegEx = getSvgRegex(svgViewBoxElements); + fabric.svgInvalidAncestorsRegEx = getSvgRegex(svgInvalidAncestors); + fabric.svgValidParentsRegEx = getSvgRegex(svgValidParents); + + fabric.cssRules = { }; + fabric.gradientDefs = { }; + fabric.clipPaths = { }; + + function normalizeAttr(attr) { + // transform attribute names + if (attr in attributesMap) { + return attributesMap[attr]; + } + return attr; + } + + function normalizeValue(attr, value, parentAttributes, fontSize) { + var isArray = Object.prototype.toString.call(value) === '[object Array]', + parsed; + + if ((attr === 'fill' || attr === 'stroke') && value === 'none') { + value = ''; + } + else if (attr === 'vector-effect') { + value = value === 'non-scaling-stroke'; + } + else if (attr === 'strokeDashArray') { + if (value === 'none') { + value = null; + } + else { + value = value.replace(/,/g, ' ').split(/\s+/).map(parseFloat); + } + } + else if (attr === 'transformMatrix') { + if (parentAttributes && parentAttributes.transformMatrix) { + value = multiplyTransformMatrices( + parentAttributes.transformMatrix, fabric.parseTransformAttribute(value)); + } + else { + value = fabric.parseTransformAttribute(value); + } + } + else if (attr === 'visible') { + value = value !== 'none' && value !== 'hidden'; + // display=none on parent element always takes precedence over child element + if (parentAttributes && parentAttributes.visible === false) { + value = false; + } + } + else if (attr === 'opacity') { + value = parseFloat(value); + if (parentAttributes && typeof parentAttributes.opacity !== 'undefined') { + value *= parentAttributes.opacity; + } + } + else if (attr === 'textAnchor' /* text-anchor */) { + value = value === 'start' ? 'left' : value === 'end' ? 'right' : 'center'; + } + else if (attr === 'charSpacing') { + // parseUnit returns px and we convert it to em + parsed = parseUnit(value, fontSize) / fontSize * 1000; + } + else if (attr === 'paintFirst') { + var fillIndex = value.indexOf('fill'); + var strokeIndex = value.indexOf('stroke'); + var value = 'fill'; + if (fillIndex > -1 && strokeIndex > -1 && strokeIndex < fillIndex) { + value = 'stroke'; + } + else if (fillIndex === -1 && strokeIndex > -1) { + value = 'stroke'; + } + } + else if (attr === 'href' || attr === 'xlink:href') { + return value; + } + else { + parsed = isArray ? value.map(parseUnit) : parseUnit(value, fontSize); + } + + return (!isArray && isNaN(parsed) ? value : parsed); + } + + /** + * @private + */ + function getSvgRegex(arr) { + return new RegExp('^(' + arr.join('|') + ')\\b', 'i'); + } + + /** + * @private + * @param {Object} attributes Array of attributes to parse + */ + function _setStrokeFillOpacity(attributes) { + for (var attr in colorAttributes) { + + if (typeof attributes[colorAttributes[attr]] === 'undefined' || attributes[attr] === '') { + continue; + } + + if (typeof attributes[attr] === 'undefined') { + if (!fabric.Object.prototype[attr]) { + continue; + } + attributes[attr] = fabric.Object.prototype[attr]; + } + + if (attributes[attr].indexOf('url(') === 0) { + continue; + } + + var color = new fabric.Color(attributes[attr]); + attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba(); + } + return attributes; + } + + /** + * @private + */ + function _getMultipleNodes(doc, nodeNames) { + var nodeName, nodeArray = [], nodeList, i, len; + for (i = 0, len = nodeNames.length; i < len; i++) { + nodeName = nodeNames[i]; + nodeList = doc.getElementsByTagName(nodeName); + nodeArray = nodeArray.concat(Array.prototype.slice.call(nodeList)); + } + return nodeArray; + } + + /** + * Parses "transform" attribute, returning an array of values + * @static + * @function + * @memberOf fabric + * @param {String} attributeValue String containing attribute value + * @return {Array} Array of 6 elements representing transformation matrix + */ + fabric.parseTransformAttribute = (function() { + function rotateMatrix(matrix, args) { + var cos = fabric.util.cos(args[0]), sin = fabric.util.sin(args[0]), + x = 0, y = 0; + if (args.length === 3) { + x = args[1]; + y = args[2]; + } + + matrix[0] = cos; + matrix[1] = sin; + matrix[2] = -sin; + matrix[3] = cos; + matrix[4] = x - (cos * x - sin * y); + matrix[5] = y - (sin * x + cos * y); + } + + function scaleMatrix(matrix, args) { + var multiplierX = args[0], + multiplierY = (args.length === 2) ? args[1] : args[0]; + + matrix[0] = multiplierX; + matrix[3] = multiplierY; + } + + function skewMatrix(matrix, args, pos) { + matrix[pos] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + + function translateMatrix(matrix, args) { + matrix[4] = args[0]; + if (args.length === 2) { + matrix[5] = args[1]; + } + } + + // identity matrix + var iMatrix = fabric.iMatrix, + + // == begin transform regexp + number = fabric.reNum, + + commaWsp = '(?:\\s+,?\\s*|,\\s*)', + + skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))', + + skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))', + + rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + ')' + + commaWsp + '(' + number + '))?\\s*\\))', + + scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + matrix = '(?:(matrix)\\s*\\(\\s*' + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + + '\\s*\\))', + + transform = '(?:' + + matrix + '|' + + translate + '|' + + scale + '|' + + rotate + '|' + + skewX + '|' + + skewY + + ')', + + transforms = '(?:' + transform + '(?:' + commaWsp + '*' + transform + ')*' + ')', + + transformList = '^\\s*(?:' + transforms + '?)\\s*$', + + // http://www.w3.org/TR/SVG/coords.html#TransformAttribute + reTransformList = new RegExp(transformList), + // == end transform regexp + + reTransform = new RegExp(transform, 'g'); + + return function(attributeValue) { + + // start with identity matrix + var matrix = iMatrix.concat(), + matrices = []; + + // return if no argument was given or + // an argument does not match transform attribute regexp + if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) { + return matrix; + } + + attributeValue.replace(reTransform, function(match) { + + var m = new RegExp(transform).exec(match).filter(function (match) { + // match !== '' && match != null + return (!!match); + }), + operation = m[1], + args = m.slice(2).map(parseFloat); + + switch (operation) { + case 'translate': + translateMatrix(matrix, args); + break; + case 'rotate': + args[0] = fabric.util.degreesToRadians(args[0]); + rotateMatrix(matrix, args); + break; + case 'scale': + scaleMatrix(matrix, args); + break; + case 'skewX': + skewMatrix(matrix, args, 2); + break; + case 'skewY': + skewMatrix(matrix, args, 1); + break; + case 'matrix': + matrix = args; + break; + } + + // snapshot current matrix into matrices array + matrices.push(matrix.concat()); + // reset + matrix = iMatrix.concat(); + }); + + var combinedMatrix = matrices[0]; + while (matrices.length > 1) { + matrices.shift(); + combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]); + } + return combinedMatrix; + }; + })(); + + /** + * @private + */ + function parseStyleString(style, oStyle) { + var attr, value; + style.replace(/;\s*$/, '').split(';').forEach(function (chunk) { + var pair = chunk.split(':'); + + attr = pair[0].trim().toLowerCase(); + value = pair[1].trim(); + + oStyle[attr] = value; + }); + } + + /** + * @private + */ + function parseStyleObject(style, oStyle) { + var attr, value; + for (var prop in style) { + if (typeof style[prop] === 'undefined') { + continue; + } + + attr = prop.toLowerCase(); + value = style[prop]; + + oStyle[attr] = value; + } + } + + /** + * @private + */ + function getGlobalStylesForElement(element, svgUid) { + var styles = { }; + for (var rule in fabric.cssRules[svgUid]) { + if (elementMatchesRule(element, rule.split(' '))) { + for (var property in fabric.cssRules[svgUid][rule]) { + styles[property] = fabric.cssRules[svgUid][rule][property]; + } + } + } + return styles; + } + + /** + * @private + */ + function elementMatchesRule(element, selectors) { + var firstMatching, parentMatching = true; + //start from rightmost selector. + firstMatching = selectorMatches(element, selectors.pop()); + if (firstMatching && selectors.length) { + parentMatching = doesSomeParentMatch(element, selectors); + } + return firstMatching && parentMatching && (selectors.length === 0); + } + + function doesSomeParentMatch(element, selectors) { + var selector, parentMatching = true; + while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) { + if (parentMatching) { + selector = selectors.pop(); + } + element = element.parentNode; + parentMatching = selectorMatches(element, selector); + } + return selectors.length === 0; + } + + /** + * @private + */ + function selectorMatches(element, selector) { + var nodeName = element.nodeName, + classNames = element.getAttribute('class'), + id = element.getAttribute('id'), matcher, i; + // i check if a selector matches slicing away part from it. + // if i get empty string i should match + matcher = new RegExp('^' + nodeName, 'i'); + selector = selector.replace(matcher, ''); + if (id && selector.length) { + matcher = new RegExp('#' + id + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + if (classNames && selector.length) { + classNames = classNames.split(' '); + for (i = classNames.length; i--;) { + matcher = new RegExp('\\.' + classNames[i] + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + } + return selector.length === 0; + } + + /** + * @private + * to support IE8 missing getElementById on SVGdocument and on node xmlDOM + */ + function elementById(doc, id) { + var el; + doc.getElementById && (el = doc.getElementById(id)); + if (el) { + return el; + } + var node, i, len, nodelist = doc.getElementsByTagName('*'); + for (i = 0, len = nodelist.length; i < len; i++) { + node = nodelist[i]; + if (id === node.getAttribute('id')) { + return node; + } + } + } + + /** + * @private + */ + function parseUseDirectives(doc) { + var nodelist = _getMultipleNodes(doc, ['use', 'svg:use']), i = 0; + while (nodelist.length && i < nodelist.length) { + var el = nodelist[i], + xlink = (el.getAttribute('xlink:href') || el.getAttribute('href')).substr(1), + x = el.getAttribute('x') || 0, + y = el.getAttribute('y') || 0, + el2 = elementById(doc, xlink).cloneNode(true), + currentTrans = (el2.getAttribute('transform') || '') + ' translate(' + x + ', ' + y + ')', + parentNode, oldLength = nodelist.length, attr, j, attrs, len; + + applyViewboxTransform(el2); + if (/^svg$/i.test(el2.nodeName)) { + var el3 = el2.ownerDocument.createElement('g'); + for (j = 0, attrs = el2.attributes, len = attrs.length; j < len; j++) { + attr = attrs.item(j); + el3.setAttribute(attr.nodeName, attr.nodeValue); + } + // el2.firstChild != null + while (el2.firstChild) { + el3.appendChild(el2.firstChild); + } + el2 = el3; + } + + for (j = 0, attrs = el.attributes, len = attrs.length; j < len; j++) { + attr = attrs.item(j); + if (attr.nodeName === 'x' || attr.nodeName === 'y' || + attr.nodeName === 'xlink:href' || attr.nodeName === 'href') { + continue; + } + + if (attr.nodeName === 'transform') { + currentTrans = attr.nodeValue + ' ' + currentTrans; + } + else { + el2.setAttribute(attr.nodeName, attr.nodeValue); + } + } + + el2.setAttribute('transform', currentTrans); + el2.setAttribute('instantiated_by_use', '1'); + el2.removeAttribute('id'); + parentNode = el.parentNode; + parentNode.replaceChild(el2, el); + // some browsers do not shorten nodelist after replaceChild (IE8) + if (nodelist.length === oldLength) { + i++; + } + } + } + + // http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute + // matches, e.g.: +14.56e-12, etc. + var reViewBoxAttrValue = new RegExp( + '^' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*' + + '$' + ); + + /** + * Add a element that envelop all child elements and makes the viewbox transformMatrix descend on all elements + */ + function applyViewboxTransform(element) { + + var viewBoxAttr = element.getAttribute('viewBox'), + scaleX = 1, + scaleY = 1, + minX = 0, + minY = 0, + viewBoxWidth, viewBoxHeight, matrix, el, + widthAttr = element.getAttribute('width'), + heightAttr = element.getAttribute('height'), + x = element.getAttribute('x') || 0, + y = element.getAttribute('y') || 0, + preserveAspectRatio = element.getAttribute('preserveAspectRatio') || '', + missingViewBox = (!viewBoxAttr || !fabric.svgViewBoxElementsRegEx.test(element.nodeName) + || !(viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))), + missingDimAttr = (!widthAttr || !heightAttr || widthAttr === '100%' || heightAttr === '100%'), + toBeParsed = missingViewBox && missingDimAttr, + parsedDim = { }, translateMatrix = '', widthDiff = 0, heightDiff = 0; + + parsedDim.width = 0; + parsedDim.height = 0; + parsedDim.toBeParsed = toBeParsed; + + if (toBeParsed) { + return parsedDim; + } + + if (missingViewBox) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + return parsedDim; + } + minX = -parseFloat(viewBoxAttr[1]); + minY = -parseFloat(viewBoxAttr[2]); + viewBoxWidth = parseFloat(viewBoxAttr[3]); + viewBoxHeight = parseFloat(viewBoxAttr[4]); + parsedDim.minX = minX; + parsedDim.minY = minY; + parsedDim.viewBoxWidth = viewBoxWidth; + parsedDim.viewBoxHeight = viewBoxHeight; + if (!missingDimAttr) { + parsedDim.width = parseUnit(widthAttr); + parsedDim.height = parseUnit(heightAttr); + scaleX = parsedDim.width / viewBoxWidth; + scaleY = parsedDim.height / viewBoxHeight; + } + else { + parsedDim.width = viewBoxWidth; + parsedDim.height = viewBoxHeight; + } + + // default is to preserve aspect ratio + preserveAspectRatio = fabric.util.parsePreserveAspectRatioAttribute(preserveAspectRatio); + if (preserveAspectRatio.alignX !== 'none') { + //translate all container for the effect of Mid, Min, Max + if (preserveAspectRatio.meetOrSlice === 'meet') { + scaleY = scaleX = (scaleX > scaleY ? scaleY : scaleX); + // calculate additional translation to move the viewbox + } + if (preserveAspectRatio.meetOrSlice === 'slice') { + scaleY = scaleX = (scaleX > scaleY ? scaleX : scaleY); + // calculate additional translation to move the viewbox + } + widthDiff = parsedDim.width - viewBoxWidth * scaleX; + heightDiff = parsedDim.height - viewBoxHeight * scaleX; + if (preserveAspectRatio.alignX === 'Mid') { + widthDiff /= 2; + } + if (preserveAspectRatio.alignY === 'Mid') { + heightDiff /= 2; + } + if (preserveAspectRatio.alignX === 'Min') { + widthDiff = 0; + } + if (preserveAspectRatio.alignY === 'Min') { + heightDiff = 0; + } + } + + if (scaleX === 1 && scaleY === 1 && minX === 0 && minY === 0 && x === 0 && y === 0) { + return parsedDim; + } + + if (x || y) { + translateMatrix = ' translate(' + parseUnit(x) + ' ' + parseUnit(y) + ') '; + } + + matrix = translateMatrix + ' matrix(' + scaleX + + ' 0' + + ' 0 ' + + scaleY + ' ' + + (minX * scaleX + widthDiff) + ' ' + + (minY * scaleY + heightDiff) + ') '; + parsedDim.viewboxTransform = fabric.parseTransformAttribute(matrix); + if (element.nodeName === 'svg') { + el = element.ownerDocument.createElement('g'); + // element.firstChild != null + while (element.firstChild) { + el.appendChild(element.firstChild); + } + element.appendChild(el); + } + else { + el = element; + matrix = el.getAttribute('transform') + matrix; + } + el.setAttribute('transform', matrix); + return parsedDim; + } + + function hasAncestorWithNodeName(element, nodeName) { + while (element && (element = element.parentNode)) { + if (element.nodeName && nodeName.test(element.nodeName.replace('svg:', '')) + && !element.getAttribute('instantiated_by_use')) { + return true; + } + } + return false; + } + + /** + * Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @param {Function} callback Callback to call when parsing is finished; + * It's being passed an array of elements (parsed from a document). + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + * @param {Object} [parsingOptions] options for parsing document + * @param {String} [parsingOptions.crossOrigin] crossOrigin settings + */ + fabric.parseSVGDocument = function(doc, callback, reviver, parsingOptions) { + if (!doc) { + return; + } + + parseUseDirectives(doc); + + var svgUid = fabric.Object.__uid++, i, len, + options = applyViewboxTransform(doc), + descendants = fabric.util.toArray(doc.getElementsByTagName('*')); + options.crossOrigin = parsingOptions && parsingOptions.crossOrigin; + options.svgUid = svgUid; + + if (descendants.length === 0 && fabric.isLikelyNode) { + // we're likely in node, where "o3-xml" library fails to gEBTN("*") + // https://github.com/ajaxorg/node-o3-xml/issues/21 + descendants = doc.selectNodes('//*[name(.)!="svg"]'); + var arr = []; + for (i = 0, len = descendants.length; i < len; i++) { + arr[i] = descendants[i]; + } + descendants = arr; + } + + var elements = descendants.filter(function(el) { + applyViewboxTransform(el); + return fabric.svgValidTagNamesRegEx.test(el.nodeName.replace('svg:', '')) && + !hasAncestorWithNodeName(el, fabric.svgInvalidAncestorsRegEx); // http://www.w3.org/TR/SVG/struct.html#DefsElement + }); + + if (!elements || (elements && !elements.length)) { + callback && callback([], {}); + return; + } + var clipPaths = { }; + descendants.filter(function(el) { + return el.nodeName.replace('svg:', '') === 'clipPath'; + }).forEach(function(el) { + var id = el.getAttribute('id'); + clipPaths[id] = fabric.util.toArray(el.getElementsByTagName('*')).filter(function(el) { + return fabric.svgValidTagNamesRegEx.test(el.nodeName.replace('svg:', '')); + }); + }); + fabric.gradientDefs[svgUid] = fabric.getGradientDefs(doc); + fabric.cssRules[svgUid] = fabric.getCSSRules(doc); + fabric.clipPaths[svgUid] = clipPaths; + // Precedence of rules: style > class > attribute + fabric.parseElements(elements, function(instances, elements) { + if (callback) { + callback(instances, options, elements, descendants); + delete fabric.gradientDefs[svgUid]; + delete fabric.cssRules[svgUid]; + delete fabric.clipPaths[svgUid]; + } + }, clone(options), reviver, parsingOptions); + }; + + function recursivelyParseGradientsXlink(doc, gradient) { + var gradientsAttrs = ['gradientTransform', 'x1', 'x2', 'y1', 'y2', 'gradientUnits', 'cx', 'cy', 'r', 'fx', 'fy'], + xlinkAttr = 'xlink:href', + xLink = gradient.getAttribute(xlinkAttr).substr(1), + referencedGradient = elementById(doc, xLink); + if (referencedGradient && referencedGradient.getAttribute(xlinkAttr)) { + recursivelyParseGradientsXlink(doc, referencedGradient); + } + gradientsAttrs.forEach(function(attr) { + if (referencedGradient && !gradient.hasAttribute(attr) && referencedGradient.hasAttribute(attr)) { + gradient.setAttribute(attr, referencedGradient.getAttribute(attr)); + } + }); + if (!gradient.children.length) { + var referenceClone = referencedGradient.cloneNode(true); + while (referenceClone.firstChild) { + gradient.appendChild(referenceClone.firstChild); + } + } + gradient.removeAttribute(xlinkAttr); + } + + var reFontDeclaration = new RegExp( + '(normal|italic)?\\s*(normal|small-caps)?\\s*' + + '(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*(' + + fabric.reNum + + '(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|' + fabric.reNum + '))?\\s+(.*)'); + + extend(fabric, { + /** + * Parses a short font declaration, building adding its properties to a style object + * @static + * @function + * @memberOf fabric + * @param {String} value font declaration + * @param {Object} oStyle definition + */ + parseFontDeclaration: function(value, oStyle) { + var match = value.match(reFontDeclaration); + + if (!match) { + return; + } + var fontStyle = match[1], + // font variant is not used + // fontVariant = match[2], + fontWeight = match[3], + fontSize = match[4], + lineHeight = match[5], + fontFamily = match[6]; + + if (fontStyle) { + oStyle.fontStyle = fontStyle; + } + if (fontWeight) { + oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight); + } + if (fontSize) { + oStyle.fontSize = parseUnit(fontSize); + } + if (fontFamily) { + oStyle.fontFamily = fontFamily; + } + if (lineHeight) { + oStyle.lineHeight = lineHeight === 'normal' ? 1 : lineHeight; + } + }, + + /** + * Parses an SVG document, returning all of the gradient declarations found in it + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element + */ + getGradientDefs: function(doc) { + var tagArray = [ + 'linearGradient', + 'radialGradient', + 'svg:linearGradient', + 'svg:radialGradient'], + elList = _getMultipleNodes(doc, tagArray), + el, j = 0, gradientDefs = { }; + j = elList.length; + while (j--) { + el = elList[j]; + if (el.getAttribute('xlink:href')) { + recursivelyParseGradientsXlink(doc, el); + } + gradientDefs[el.getAttribute('id')] = el; + } + return gradientDefs; + }, + + /** + * Returns an object of attributes' name/value, given element and an array of attribute names; + * Parses parent "g" nodes recursively upwards. + * @static + * @memberOf fabric + * @param {DOMElement} element Element to parse + * @param {Array} attributes Array of attributes to parse + * @return {Object} object containing parsed attributes' names/values + */ + parseAttributes: function(element, attributes, svgUid) { + + if (!element) { + return; + } + + var value, + parentAttributes = { }, + fontSize, parentFontSize; + + if (typeof svgUid === 'undefined') { + svgUid = element.getAttribute('svgUid'); + } + // if there's a parent container (`g` or `a` or `symbol` node), parse its attributes recursively upwards + if (element.parentNode && fabric.svgValidParentsRegEx.test(element.parentNode.nodeName)) { + parentAttributes = fabric.parseAttributes(element.parentNode, attributes, svgUid); + } + + var ownAttributes = attributes.reduce(function(memo, attr) { + value = element.getAttribute(attr); + if (value) { // eslint-disable-line + memo[attr] = value; + } + return memo; + }, { }); + // add values parsed from style, which take precedence over attributes + // (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes) + ownAttributes = extend(ownAttributes, + extend(getGlobalStylesForElement(element, svgUid), fabric.parseStyleAttribute(element))); + + fontSize = parentFontSize = parentAttributes.fontSize || fabric.Text.DEFAULT_SVG_FONT_SIZE; + if (ownAttributes['font-size']) { + // looks like the minimum should be 9px when dealing with ems. this is what looks like in browsers. + ownAttributes['font-size'] = fontSize = parseUnit(ownAttributes['font-size'], parentFontSize); + } + + var normalizedAttr, normalizedValue, normalizedStyle = {}; + for (var attr in ownAttributes) { + normalizedAttr = normalizeAttr(attr); + normalizedValue = normalizeValue(normalizedAttr, ownAttributes[attr], parentAttributes, fontSize); + normalizedStyle[normalizedAttr] = normalizedValue; + } + if (normalizedStyle && normalizedStyle.font) { + fabric.parseFontDeclaration(normalizedStyle.font, normalizedStyle); + } + var mergedAttrs = extend(parentAttributes, normalizedStyle); + return fabric.svgValidParentsRegEx.test(element.nodeName) ? mergedAttrs : _setStrokeFillOpacity(mergedAttrs); + }, + + /** + * Transforms an array of svg elements to corresponding fabric.* instances + * @static + * @memberOf fabric + * @param {Array} elements Array of elements to parse + * @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements) + * @param {Object} [options] Options object + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + parseElements: function(elements, callback, options, reviver, parsingOptions) { + new fabric.ElementsParser(elements, callback, options, reviver, parsingOptions).parse(); + }, + + /** + * Parses "style" attribute, retuning an object with values + * @static + * @memberOf fabric + * @param {SVGElement} element Element to parse + * @return {Object} Objects with values parsed from style attribute of an element + */ + parseStyleAttribute: function(element) { + var oStyle = { }, + style = element.getAttribute('style'); + + if (!style) { + return oStyle; + } + + if (typeof style === 'string') { + parseStyleString(style, oStyle); + } + else { + parseStyleObject(style, oStyle); + } + + return oStyle; + }, + + /** + * Parses "points" attribute, returning an array of values + * @static + * @memberOf fabric + * @param {String} points points attribute string + * @return {Array} array of points + */ + parsePointsAttribute: function(points) { + + // points attribute is required and must not be empty + if (!points) { + return null; + } + + // replace commas with whitespace and remove bookending whitespace + points = points.replace(/,/g, ' ').trim(); + + points = points.split(/\s+/); + var parsedPoints = [], i, len; + + for (i = 0, len = points.length; i < len; i += 2) { + parsedPoints.push({ + x: parseFloat(points[i]), + y: parseFloat(points[i + 1]) + }); + } + + // odd number of points is an error + // if (parsedPoints.length % 2 !== 0) { + // return null; + // } + + return parsedPoints; + }, + + /** + * Returns CSS rules for a given SVG document + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} CSS rules of this document + */ + getCSSRules: function(doc) { + var styles = doc.getElementsByTagName('style'), i, len, + allRules = { }, rules; + + // very crude parsing of style contents + for (i = 0, len = styles.length; i < len; i++) { + // IE9 doesn't support textContent, but provides text instead. + var styleContents = styles[i].textContent || styles[i].text; + + // remove comments + styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, ''); + if (styleContents.trim() === '') { + continue; + } + rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g); + rules = rules.map(function(rule) { return rule.trim(); }); + // eslint-disable-next-line no-loop-func + rules.forEach(function(rule) { + + var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/), + ruleObj = { }, declaration = match[2].trim(), + propertyValuePairs = declaration.replace(/;$/, '').split(/\s*;\s*/); + + for (i = 0, len = propertyValuePairs.length; i < len; i++) { + var pair = propertyValuePairs[i].split(/\s*:\s*/), + property = pair[0], + value = pair[1]; + ruleObj[property] = value; + } + rule = match[1]; + rule.split(',').forEach(function(_rule) { + _rule = _rule.replace(/^svg/i, '').trim(); + if (_rule === '') { + return; + } + if (allRules[_rule]) { + fabric.util.object.extend(allRules[_rule], ruleObj); + } + else { + allRules[_rule] = fabric.util.object.clone(ruleObj); + } + }); + }); + } + return allRules; + }, + + /** + * Takes url corresponding to an SVG document, and parses it into a set of fabric objects. + * Note that SVG is fetched via XMLHttpRequest, so it needs to conform to SOP (Same Origin Policy) + * @memberOf fabric + * @param {String} url + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + * @param {Object} [options] Object containing options for parsing + * @param {String} [options.crossOrigin] crossOrigin crossOrigin setting to use for external resources + */ + loadSVGFromURL: function(url, callback, reviver, options) { + + url = url.replace(/^\n\s*/, '').trim(); + new fabric.util.request(url, { + method: 'get', + onComplete: onComplete + }); + + function onComplete(r) { + + var xml = r.responseXML; + if (xml && !xml.documentElement && fabric.window.ActiveXObject && r.responseText) { + xml = new ActiveXObject('Microsoft.XMLDOM'); + xml.async = 'false'; + //IE chokes on DOCTYPE + xml.loadXML(r.responseText.replace(//i, '')); + } + if (!xml || !xml.documentElement) { + callback && callback(null); + return false; + } + + fabric.parseSVGDocument(xml.documentElement, function (results, _options, elements, allElements) { + callback && callback(results, _options, elements, allElements); + }, reviver, options); + } + }, + + /** + * Takes string corresponding to an SVG document, and parses it into a set of fabric objects + * @memberOf fabric + * @param {String} string + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + * @param {Object} [options] Object containing options for parsing + * @param {String} [options.crossOrigin] crossOrigin crossOrigin setting to use for external resources + */ + loadSVGFromString: function(string, callback, reviver, options) { + string = string.trim(); + var doc; + if (typeof fabric.window.DOMParser !== 'undefined') { + var parser = new fabric.window.DOMParser(); + if (parser && parser.parseFromString) { + doc = parser.parseFromString(string, 'text/xml'); + } + } + else if (fabric.window.ActiveXObject) { + doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + // IE chokes on DOCTYPE + doc.loadXML(string.replace(//i, '')); + } + + fabric.parseSVGDocument(doc.documentElement, function (results, _options, elements, allElements) { + callback(results, _options, elements, allElements); + }, reviver, options); + } + }); + +})(typeof exports !== 'undefined' ? exports : this); +fabric.ElementsParser = function(elements, callback, options, reviver, parsingOptions) { + this.elements = elements; + this.callback = callback; + this.options = options; + this.reviver = reviver; + this.svgUid = (options && options.svgUid) || 0; + this.parsingOptions = parsingOptions; + this.regexUrl = /^url\(['"]?#([^'"]+)['"]?\)/g; +}; + +(function(proto) { + proto.parse = function() { + this.instances = new Array(this.elements.length); + this.numElements = this.elements.length; + this.createObjects(); + }; + + proto.createObjects = function() { + var _this = this; + this.elements.forEach(function(element, i) { + element.setAttribute('svgUid', _this.svgUid); + _this.createObject(element, i); + }); + }; + + proto.findTag = function(el) { + return fabric[fabric.util.string.capitalize(el.tagName.replace('svg:', ''))]; + }; + + proto.createObject = function(el, index) { + var klass = this.findTag(el); + if (klass && klass.fromElement) { + try { + klass.fromElement(el, this.createCallback(index, el), this.options); + } + catch (err) { + fabric.log(err); + } + } + else { + this.checkIfDone(); + } + }; + + proto.createCallback = function(index, el) { + var _this = this; + return function(obj) { + var _options; + _this.resolveGradient(obj, el, 'fill'); + _this.resolveGradient(obj, el, 'stroke'); + if (obj instanceof fabric.Image && obj._originalElement) { + _options = obj.parsePreserveAspectRatioAttribute(el); + } + obj._removeTransformMatrix(_options); + _this.resolveClipPath(obj); + _this.reviver && _this.reviver(el, obj); + _this.instances[index] = obj; + _this.checkIfDone(); + }; + }; + + proto.extractPropertyDefinition = function(obj, property, storage) { + var value = obj[property]; + if (!(/^url\(/).test(value)) { + return; + } + var id = this.regexUrl.exec(value)[1]; + this.regexUrl.lastIndex = 0; + return fabric[storage][this.svgUid][id]; + }; + + proto.resolveGradient = function(obj, el, property) { + var gradientDef = this.extractPropertyDefinition(obj, property, 'gradientDefs'); + if (gradientDef) { + var opacityAttr = el.getAttribute(property + '-opacity'); + var gradient = fabric.Gradient.fromElement(gradientDef, obj, opacityAttr, this.options); + obj.set(property, gradient); + } + }; + + proto.createClipPathCallback = function(obj, container) { + return function(_newObj) { + _newObj._removeTransformMatrix(); + _newObj.fillRule = _newObj.clipRule; + container.push(_newObj); + }; + }; + + proto.resolveClipPath = function(obj) { + var clipPath = this.extractPropertyDefinition(obj, 'clipPath', 'clipPaths'), + element, klass, objTransformInv, container, gTransform, options; + if (clipPath) { + container = []; + objTransformInv = fabric.util.invertTransform(obj.calcTransformMatrix()); + for (var i = 0; i < clipPath.length; i++) { + element = clipPath[i]; + klass = this.findTag(element); + klass.fromElement( + element, + this.createClipPathCallback(obj, container), + this.options + ); + } + if (container.length === 1) { + clipPath = container[0]; + } + else { + clipPath = new fabric.Group(container); + } + gTransform = fabric.util.multiplyTransformMatrices( + objTransformInv, + clipPath.calcTransformMatrix() + ); + var options = fabric.util.qrDecompose(gTransform); + clipPath.flipX = false; + clipPath.flipY = false; + clipPath.set('scaleX', options.scaleX); + clipPath.set('scaleY', options.scaleY); + clipPath.angle = options.angle; + clipPath.skewX = options.skewX; + clipPath.skewY = 0; + clipPath.setPositionByOrigin({ x: options.translateX, y: options.translateY }, 'center', 'center'); + obj.clipPath = clipPath; + } + }; + + proto.checkIfDone = function() { + if (--this.numElements === 0) { + this.instances = this.instances.filter(function(el) { + // eslint-disable-next-line no-eq-null, eqeqeq + return el != null; + }); + this.callback(this.instances, this.elements); + } + }; +})(fabric.ElementsParser.prototype); +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Point) { + fabric.warn('fabric.Point is already defined'); + return; + } + + fabric.Point = Point; + + /** + * Point class + * @class fabric.Point + * @memberOf fabric + * @constructor + * @param {Number} x + * @param {Number} y + * @return {fabric.Point} thisArg + */ + function Point(x, y) { + this.x = x; + this.y = y; + } + + Point.prototype = /** @lends fabric.Point.prototype */ { + + type: 'point', + + constructor: Point, + + /** + * Adds another point to this one and returns another one + * @param {fabric.Point} that + * @return {fabric.Point} new Point instance with added values + */ + add: function (that) { + return new Point(this.x + that.x, this.y + that.y); + }, + + /** + * Adds another point to this one + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + * @chainable + */ + addEquals: function (that) { + this.x += that.x; + this.y += that.y; + return this; + }, + + /** + * Adds value to this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} new Point with added value + */ + scalarAdd: function (scalar) { + return new Point(this.x + scalar, this.y + scalar); + }, + + /** + * Adds value to this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + scalarAddEquals: function (scalar) { + this.x += scalar; + this.y += scalar; + return this; + }, + + /** + * Subtracts another point from this point and returns a new one + * @param {fabric.Point} that + * @return {fabric.Point} new Point object with subtracted values + */ + subtract: function (that) { + return new Point(this.x - that.x, this.y - that.y); + }, + + /** + * Subtracts another point from this point + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + * @chainable + */ + subtractEquals: function (that) { + this.x -= that.x; + this.y -= that.y; + return this; + }, + + /** + * Subtracts value from this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + scalarSubtract: function (scalar) { + return new Point(this.x - scalar, this.y - scalar); + }, + + /** + * Subtracts value from this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + scalarSubtractEquals: function (scalar) { + this.x -= scalar; + this.y -= scalar; + return this; + }, + + /** + * Multiplies this point by a value and returns a new one + * TODO: rename in scalarMultiply in 2.0 + * @param {Number} scalar + * @return {fabric.Point} + */ + multiply: function (scalar) { + return new Point(this.x * scalar, this.y * scalar); + }, + + /** + * Multiplies this point by a value + * TODO: rename in scalarMultiplyEquals in 2.0 + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + multiplyEquals: function (scalar) { + this.x *= scalar; + this.y *= scalar; + return this; + }, + + /** + * Divides this point by a value and returns a new one + * TODO: rename in scalarDivide in 2.0 + * @param {Number} scalar + * @return {fabric.Point} + */ + divide: function (scalar) { + return new Point(this.x / scalar, this.y / scalar); + }, + + /** + * Divides this point by a value + * TODO: rename in scalarDivideEquals in 2.0 + * @param {Number} scalar + * @return {fabric.Point} thisArg + * @chainable + */ + divideEquals: function (scalar) { + this.x /= scalar; + this.y /= scalar; + return this; + }, + + /** + * Returns true if this point is equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + eq: function (that) { + return (this.x === that.x && this.y === that.y); + }, + + /** + * Returns true if this point is less than another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lt: function (that) { + return (this.x < that.x && this.y < that.y); + }, + + /** + * Returns true if this point is less than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lte: function (that) { + return (this.x <= that.x && this.y <= that.y); + }, + + /** + + * Returns true if this point is greater another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gt: function (that) { + return (this.x > that.x && this.y > that.y); + }, + + /** + * Returns true if this point is greater than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gte: function (that) { + return (this.x >= that.x && this.y >= that.y); + }, + + /** + * Returns new point which is the result of linear interpolation with this one and another one + * @param {fabric.Point} that + * @param {Number} t , position of interpolation, between 0 and 1 default 0.5 + * @return {fabric.Point} + */ + lerp: function (that, t) { + if (typeof t === 'undefined') { + t = 0.5; + } + t = Math.max(Math.min(1, t), 0); + return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t); + }, + + /** + * Returns distance from this point and another one + * @param {fabric.Point} that + * @return {Number} + */ + distanceFrom: function (that) { + var dx = this.x - that.x, + dy = this.y - that.y; + return Math.sqrt(dx * dx + dy * dy); + }, + + /** + * Returns the point between this point and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + midPointFrom: function (that) { + return this.lerp(that); + }, + + /** + * Returns a new point which is the min of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + min: function (that) { + return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y)); + }, + + /** + * Returns a new point which is the max of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + max: function (that) { + return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y)); + }, + + /** + * Returns string representation of this point + * @return {String} + */ + toString: function () { + return this.x + ',' + this.y; + }, + + /** + * Sets x/y of this point + * @param {Number} x + * @param {Number} y + * @chainable + */ + setXY: function (x, y) { + this.x = x; + this.y = y; + return this; + }, + + /** + * Sets x of this point + * @param {Number} x + * @chainable + */ + setX: function (x) { + this.x = x; + return this; + }, + + /** + * Sets y of this point + * @param {Number} y + * @chainable + */ + setY: function (y) { + this.y = y; + return this; + }, + + /** + * Sets x/y of this point from another point + * @param {fabric.Point} that + * @chainable + */ + setFromPoint: function (that) { + this.x = that.x; + this.y = that.y; + return this; + }, + + /** + * Swaps x/y of this point and another point + * @param {fabric.Point} that + */ + swap: function (that) { + var x = this.x, + y = this.y; + this.x = that.x; + this.y = that.y; + that.x = x; + that.y = y; + }, + + /** + * return a cloned instance of the point + * @return {fabric.Point} + */ + clone: function () { + return new Point(this.x, this.y); + } + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Intersection) { + fabric.warn('fabric.Intersection is already defined'); + return; + } + + /** + * Intersection class + * @class fabric.Intersection + * @memberOf fabric + * @constructor + */ + function Intersection(status) { + this.status = status; + this.points = []; + } + + fabric.Intersection = Intersection; + + fabric.Intersection.prototype = /** @lends fabric.Intersection.prototype */ { + + constructor: Intersection, + + /** + * Appends a point to intersection + * @param {fabric.Point} point + * @return {fabric.Intersection} thisArg + * @chainable + */ + appendPoint: function (point) { + this.points.push(point); + return this; + }, + + /** + * Appends points to intersection + * @param {Array} points + * @return {fabric.Intersection} thisArg + * @chainable + */ + appendPoints: function (points) { + this.points = this.points.concat(points); + return this; + } + }; + + /** + * Checks if one line intersects another + * TODO: rename in intersectSegmentSegment + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {fabric.Point} b1 + * @param {fabric.Point} b2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLineLine = function (a1, a2, b1, b2) { + var result, + uaT = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x), + ubT = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x), + uB = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y); + if (uB !== 0) { + var ua = uaT / uB, + ub = ubT / uB; + if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) { + result = new Intersection('Intersection'); + result.appendPoint(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y))); + } + else { + result = new Intersection(); + } + } + else { + if (uaT === 0 || ubT === 0) { + result = new Intersection('Coincident'); + } + else { + result = new Intersection('Parallel'); + } + } + return result; + }; + + /** + * Checks if line intersects polygon + * TODO: rename in intersectSegmentPolygon + * fix detection of coincident + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {Array} points + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLinePolygon = function(a1, a2, points) { + var result = new Intersection(), + length = points.length, + b1, b2, inter, i; + + for (i = 0; i < length; i++) { + b1 = points[i]; + b2 = points[(i + 1) % length]; + inter = Intersection.intersectLineLine(a1, a2, b1, b2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects another polygon + * @static + * @param {Array} points1 + * @param {Array} points2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonPolygon = function (points1, points2) { + var result = new Intersection(), + length = points1.length, i; + + for (i = 0; i < length; i++) { + var a1 = points1[i], + a2 = points1[(i + 1) % length], + inter = Intersection.intersectLinePolygon(a1, a2, points2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects rectangle + * @static + * @param {Array} points + * @param {fabric.Point} r1 + * @param {fabric.Point} r2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonRectangle = function (points, r1, r2) { + var min = r1.min(r2), + max = r1.max(r2), + topRight = new fabric.Point(max.x, min.y), + bottomLeft = new fabric.Point(min.x, max.y), + inter1 = Intersection.intersectLinePolygon(min, topRight, points), + inter2 = Intersection.intersectLinePolygon(topRight, max, points), + inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points), + inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points), + result = new Intersection(); + + result.appendPoints(inter1.points); + result.appendPoints(inter2.points); + result.appendPoints(inter3.points); + result.appendPoints(inter4.points); + + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Color) { + fabric.warn('fabric.Color is already defined.'); + return; + } + + /** + * Color class + * The purpose of {@link fabric.Color} is to abstract and encapsulate common color operations; + * {@link fabric.Color} is a constructor and creates instances of {@link fabric.Color} objects. + * + * @class fabric.Color + * @param {String} color optional in hex or rgb(a) or hsl format or from known color list + * @return {fabric.Color} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#colors} + */ + function Color(color) { + if (!color) { + this.setSource([0, 0, 0, 1]); + } + else { + this._tryParsingColor(color); + } + } + + fabric.Color = Color; + + fabric.Color.prototype = /** @lends fabric.Color.prototype */ { + + /** + * @private + * @param {String|Array} color Color value to parse + */ + _tryParsingColor: function(color) { + var source; + + if (color in Color.colorNameMap) { + color = Color.colorNameMap[color]; + } + + if (color === 'transparent') { + source = [255, 255, 255, 0]; + } + + if (!source) { + source = Color.sourceFromHex(color); + } + if (!source) { + source = Color.sourceFromRgb(color); + } + if (!source) { + source = Color.sourceFromHsl(color); + } + if (!source) { + //if color is not recognize let's make black as canvas does + source = [0, 0, 0, 1]; + } + if (source) { + this.setSource(source); + } + }, + + /** + * Adapted from https://github.com/mjijackson + * @private + * @param {Number} r Red color value + * @param {Number} g Green color value + * @param {Number} b Blue color value + * @return {Array} Hsl color + */ + _rgbToHsl: function(r, g, b) { + r /= 255; g /= 255; b /= 255; + + var h, s, l, + max = fabric.util.array.max([r, g, b]), + min = fabric.util.array.min([r, g, b]); + + l = (max + min) / 2; + + if (max === min) { + h = s = 0; // achromatic + } + else { + var d = max - min; + s = l > 0.5 ? d / (2 - max - min) : d / (max + min); + switch (max) { + case r: + h = (g - b) / d + (g < b ? 6 : 0); + break; + case g: + h = (b - r) / d + 2; + break; + case b: + h = (r - g) / d + 4; + break; + } + h /= 6; + } + + return [ + Math.round(h * 360), + Math.round(s * 100), + Math.round(l * 100) + ]; + }, + + /** + * Returns source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @return {Array} + */ + getSource: function() { + return this._source; + }, + + /** + * Sets source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @param {Array} source + */ + setSource: function(source) { + this._source = source; + }, + + /** + * Returns color representation in RGB format + * @return {String} ex: rgb(0-255,0-255,0-255) + */ + toRgb: function() { + var source = this.getSource(); + return 'rgb(' + source[0] + ',' + source[1] + ',' + source[2] + ')'; + }, + + /** + * Returns color representation in RGBA format + * @return {String} ex: rgba(0-255,0-255,0-255,0-1) + */ + toRgba: function() { + var source = this.getSource(); + return 'rgba(' + source[0] + ',' + source[1] + ',' + source[2] + ',' + source[3] + ')'; + }, + + /** + * Returns color representation in HSL format + * @return {String} ex: hsl(0-360,0%-100%,0%-100%) + */ + toHsl: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsl(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%)'; + }, + + /** + * Returns color representation in HSLA format + * @return {String} ex: hsla(0-360,0%-100%,0%-100%,0-1) + */ + toHsla: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsla(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%,' + source[3] + ')'; + }, + + /** + * Returns color representation in HEX format + * @return {String} ex: FF5555 + */ + toHex: function() { + var source = this.getSource(), r, g, b; + + r = source[0].toString(16); + r = (r.length === 1) ? ('0' + r) : r; + + g = source[1].toString(16); + g = (g.length === 1) ? ('0' + g) : g; + + b = source[2].toString(16); + b = (b.length === 1) ? ('0' + b) : b; + + return r.toUpperCase() + g.toUpperCase() + b.toUpperCase(); + }, + + /** + * Returns color representation in HEXA format + * @return {String} ex: FF5555CC + */ + toHexa: function() { + var source = this.getSource(), a; + + a = Math.round(source[3] * 255); + a = a.toString(16); + a = (a.length === 1) ? ('0' + a) : a; + + return this.toHex() + a.toUpperCase(); + }, + + /** + * Gets value of alpha channel for this color + * @return {Number} 0-1 + */ + getAlpha: function() { + return this.getSource()[3]; + }, + + /** + * Sets value of alpha channel for this color + * @param {Number} alpha Alpha value 0-1 + * @return {fabric.Color} thisArg + */ + setAlpha: function(alpha) { + var source = this.getSource(); + source[3] = alpha; + this.setSource(source); + return this; + }, + + /** + * Transforms color to its grayscale representation + * @return {fabric.Color} thisArg + */ + toGrayscale: function() { + var source = this.getSource(), + average = parseInt((source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), 10), + currentAlpha = source[3]; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Transforms color to its black and white representation + * @param {Number} threshold + * @return {fabric.Color} thisArg + */ + toBlackWhite: function(threshold) { + var source = this.getSource(), + average = (source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), + currentAlpha = source[3]; + + threshold = threshold || 127; + + average = (Number(average) < Number(threshold)) ? 0 : 255; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Overlays color with another color + * @param {String|fabric.Color} otherColor + * @return {fabric.Color} thisArg + */ + overlayWith: function(otherColor) { + if (!(otherColor instanceof Color)) { + otherColor = new Color(otherColor); + } + + var result = [], + alpha = this.getAlpha(), + otherAlpha = 0.5, + source = this.getSource(), + otherSource = otherColor.getSource(), i; + + for (i = 0; i < 3; i++) { + result.push(Math.round((source[i] * (1 - otherAlpha)) + (otherSource[i] * otherAlpha))); + } + + result[3] = alpha; + this.setSource(result); + return this; + } + }; + + /** + * Regex matching color in RGB or RGBA formats (ex: rgb(0, 0, 0), rgba(255, 100, 10, 0.5), rgba( 255 , 100 , 10 , 0.5 ), rgb(1,1,1), rgba(100%, 60%, 10%, 0.5)) + * @static + * @field + * @memberOf fabric.Color + */ + // eslint-disable-next-line max-len + fabric.Color.reRGBa = /^rgba?\(\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*(?:\s*,\s*((?:\d*\.?\d+)?)\s*)?\)$/i; + + /** + * Regex matching color in HSL or HSLA formats (ex: hsl(200, 80%, 10%), hsla(300, 50%, 80%, 0.5), hsla( 300 , 50% , 80% , 0.5 )) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHSLa = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3}\%)\s*,\s*(\d{1,3}\%)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/i; + + /** + * Regex matching color in HEX format (ex: #FF5544CC, #FF5555, 010155, aff) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHex = /^#?([0-9a-f]{8}|[0-9a-f]{6}|[0-9a-f]{4}|[0-9a-f]{3})$/i; + + /** + * Map of the 148 color names with HEX code + * @static + * @field + * @memberOf fabric.Color + * @see: https://www.w3.org/TR/css3-color/#svg-color + */ + fabric.Color.colorNameMap = { + aliceblue: '#F0F8FF', + antiquewhite: '#FAEBD7', + aqua: '#00FFFF', + aquamarine: '#7FFFD4', + azure: '#F0FFFF', + beige: '#F5F5DC', + bisque: '#FFE4C4', + black: '#000000', + blanchedalmond: '#FFEBCD', + blue: '#0000FF', + blueviolet: '#8A2BE2', + brown: '#A52A2A', + burlywood: '#DEB887', + cadetblue: '#5F9EA0', + chartreuse: '#7FFF00', + chocolate: '#D2691E', + coral: '#FF7F50', + cornflowerblue: '#6495ED', + cornsilk: '#FFF8DC', + crimson: '#DC143C', + cyan: '#00FFFF', + darkblue: '#00008B', + darkcyan: '#008B8B', + darkgoldenrod: '#B8860B', + darkgray: '#A9A9A9', + darkgrey: '#A9A9A9', + darkgreen: '#006400', + darkkhaki: '#BDB76B', + darkmagenta: '#8B008B', + darkolivegreen: '#556B2F', + darkorange: '#FF8C00', + darkorchid: '#9932CC', + darkred: '#8B0000', + darksalmon: '#E9967A', + darkseagreen: '#8FBC8F', + darkslateblue: '#483D8B', + darkslategray: '#2F4F4F', + darkslategrey: '#2F4F4F', + darkturquoise: '#00CED1', + darkviolet: '#9400D3', + deeppink: '#FF1493', + deepskyblue: '#00BFFF', + dimgray: '#696969', + dimgrey: '#696969', + dodgerblue: '#1E90FF', + firebrick: '#B22222', + floralwhite: '#FFFAF0', + forestgreen: '#228B22', + fuchsia: '#FF00FF', + gainsboro: '#DCDCDC', + ghostwhite: '#F8F8FF', + gold: '#FFD700', + goldenrod: '#DAA520', + gray: '#808080', + grey: '#808080', + green: '#008000', + greenyellow: '#ADFF2F', + honeydew: '#F0FFF0', + hotpink: '#FF69B4', + indianred: '#CD5C5C', + indigo: '#4B0082', + ivory: '#FFFFF0', + khaki: '#F0E68C', + lavender: '#E6E6FA', + lavenderblush: '#FFF0F5', + lawngreen: '#7CFC00', + lemonchiffon: '#FFFACD', + lightblue: '#ADD8E6', + lightcoral: '#F08080', + lightcyan: '#E0FFFF', + lightgoldenrodyellow: '#FAFAD2', + lightgray: '#D3D3D3', + lightgrey: '#D3D3D3', + lightgreen: '#90EE90', + lightpink: '#FFB6C1', + lightsalmon: '#FFA07A', + lightseagreen: '#20B2AA', + lightskyblue: '#87CEFA', + lightslategray: '#778899', + lightslategrey: '#778899', + lightsteelblue: '#B0C4DE', + lightyellow: '#FFFFE0', + lime: '#00FF00', + limegreen: '#32CD32', + linen: '#FAF0E6', + magenta: '#FF00FF', + maroon: '#800000', + mediumaquamarine: '#66CDAA', + mediumblue: '#0000CD', + mediumorchid: '#BA55D3', + mediumpurple: '#9370DB', + mediumseagreen: '#3CB371', + mediumslateblue: '#7B68EE', + mediumspringgreen: '#00FA9A', + mediumturquoise: '#48D1CC', + mediumvioletred: '#C71585', + midnightblue: '#191970', + mintcream: '#F5FFFA', + mistyrose: '#FFE4E1', + moccasin: '#FFE4B5', + navajowhite: '#FFDEAD', + navy: '#000080', + oldlace: '#FDF5E6', + olive: '#808000', + olivedrab: '#6B8E23', + orange: '#FFA500', + orangered: '#FF4500', + orchid: '#DA70D6', + palegoldenrod: '#EEE8AA', + palegreen: '#98FB98', + paleturquoise: '#AFEEEE', + palevioletred: '#DB7093', + papayawhip: '#FFEFD5', + peachpuff: '#FFDAB9', + peru: '#CD853F', + pink: '#FFC0CB', + plum: '#DDA0DD', + powderblue: '#B0E0E6', + purple: '#800080', + rebeccapurple: '#663399', + red: '#FF0000', + rosybrown: '#BC8F8F', + royalblue: '#4169E1', + saddlebrown: '#8B4513', + salmon: '#FA8072', + sandybrown: '#F4A460', + seagreen: '#2E8B57', + seashell: '#FFF5EE', + sienna: '#A0522D', + silver: '#C0C0C0', + skyblue: '#87CEEB', + slateblue: '#6A5ACD', + slategray: '#708090', + slategrey: '#708090', + snow: '#FFFAFA', + springgreen: '#00FF7F', + steelblue: '#4682B4', + tan: '#D2B48C', + teal: '#008080', + thistle: '#D8BFD8', + tomato: '#FF6347', + turquoise: '#40E0D0', + violet: '#EE82EE', + wheat: '#F5DEB3', + white: '#FFFFFF', + whitesmoke: '#F5F5F5', + yellow: '#FFFF00', + yellowgreen: '#9ACD32' + }; + + /** + * @private + * @param {Number} p + * @param {Number} q + * @param {Number} t + * @return {Number} + */ + function hue2rgb(p, q, t) { + if (t < 0) { + t += 1; + } + if (t > 1) { + t -= 1; + } + if (t < 1 / 6) { + return p + (q - p) * 6 * t; + } + if (t < 1 / 2) { + return q; + } + if (t < 2 / 3) { + return p + (q - p) * (2 / 3 - t) * 6; + } + return p; + } + + /** + * Returns new color object, when given a color in RGB format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255) + * @return {fabric.Color} + */ + fabric.Color.fromRgb = function(color) { + return Color.fromSource(Color.sourceFromRgb(color)); + }; + + /** + * Returns array representation (ex: [100, 100, 200, 1]) of a color that's in RGB or RGBA format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255), rgb(0%-100%,0%-100%,0%-100%) + * @return {Array} source + */ + fabric.Color.sourceFromRgb = function(color) { + var match = color.match(Color.reRGBa); + if (match) { + var r = parseInt(match[1], 10) / (/%$/.test(match[1]) ? 100 : 1) * (/%$/.test(match[1]) ? 255 : 1), + g = parseInt(match[2], 10) / (/%$/.test(match[2]) ? 100 : 1) * (/%$/.test(match[2]) ? 255 : 1), + b = parseInt(match[3], 10) / (/%$/.test(match[3]) ? 100 : 1) * (/%$/.test(match[3]) ? 255 : 1); + + return [ + parseInt(r, 10), + parseInt(g, 10), + parseInt(b, 10), + match[4] ? parseFloat(match[4]) : 1 + ]; + } + }; + + /** + * Returns new color object, when given a color in RGBA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromRgba = Color.fromRgb; + + /** + * Returns new color object, when given a color in HSL format + * @param {String} color Color value ex: hsl(0-260,0%-100%,0%-100%) + * @memberOf fabric.Color + * @return {fabric.Color} + */ + fabric.Color.fromHsl = function(color) { + return Color.fromSource(Color.sourceFromHsl(color)); + }; + + /** + * Returns array representation (ex: [100, 100, 200, 1]) of a color that's in HSL or HSLA format. + * Adapted from https://github.com/mjijackson + * @memberOf fabric.Color + * @param {String} color Color value ex: hsl(0-360,0%-100%,0%-100%) or hsla(0-360,0%-100%,0%-100%, 0-1) + * @return {Array} source + * @see http://http://www.w3.org/TR/css3-color/#hsl-color + */ + fabric.Color.sourceFromHsl = function(color) { + var match = color.match(Color.reHSLa); + if (!match) { + return; + } + + var h = (((parseFloat(match[1]) % 360) + 360) % 360) / 360, + s = parseFloat(match[2]) / (/%$/.test(match[2]) ? 100 : 1), + l = parseFloat(match[3]) / (/%$/.test(match[3]) ? 100 : 1), + r, g, b; + + if (s === 0) { + r = g = b = l; + } + else { + var q = l <= 0.5 ? l * (s + 1) : l + s - l * s, + p = l * 2 - q; + + r = hue2rgb(p, q, h + 1 / 3); + g = hue2rgb(p, q, h); + b = hue2rgb(p, q, h - 1 / 3); + } + + return [ + Math.round(r * 255), + Math.round(g * 255), + Math.round(b * 255), + match[4] ? parseFloat(match[4]) : 1 + ]; + }; + + /** + * Returns new color object, when given a color in HSLA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromHsla = Color.fromHsl; + + /** + * Returns new color object, when given a color in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color Color value ex: FF5555 + * @return {fabric.Color} + */ + fabric.Color.fromHex = function(color) { + return Color.fromSource(Color.sourceFromHex(color)); + }; + + /** + * Returns array representation (ex: [100, 100, 200, 1]) of a color that's in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color ex: FF5555 or FF5544CC (RGBa) + * @return {Array} source + */ + fabric.Color.sourceFromHex = function(color) { + if (color.match(Color.reHex)) { + var value = color.slice(color.indexOf('#') + 1), + isShortNotation = (value.length === 3 || value.length === 4), + isRGBa = (value.length === 8 || value.length === 4), + r = isShortNotation ? (value.charAt(0) + value.charAt(0)) : value.substring(0, 2), + g = isShortNotation ? (value.charAt(1) + value.charAt(1)) : value.substring(2, 4), + b = isShortNotation ? (value.charAt(2) + value.charAt(2)) : value.substring(4, 6), + a = isRGBa ? (isShortNotation ? (value.charAt(3) + value.charAt(3)) : value.substring(6, 8)) : 'FF'; + + return [ + parseInt(r, 16), + parseInt(g, 16), + parseInt(b, 16), + parseFloat((parseInt(a, 16) / 255).toFixed(2)) + ]; + } + }; + + /** + * Returns new color object, when given color in array representation (ex: [200, 100, 100, 0.5]) + * @static + * @memberOf fabric.Color + * @param {Array} source + * @return {fabric.Color} + */ + fabric.Color.fromSource = function(source) { + var oColor = new Color(); + oColor.setSource(source); + return oColor; + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + /* _FROM_SVG_START_ */ + function getColorStop(el, multiplier) { + var style = el.getAttribute('style'), + offset = el.getAttribute('offset') || 0, + color, colorAlpha, opacity, i; + + // convert percents to absolute values + offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1); + offset = offset < 0 ? 0 : offset > 1 ? 1 : offset; + if (style) { + var keyValuePairs = style.split(/\s*;\s*/); + + if (keyValuePairs[keyValuePairs.length - 1] === '') { + keyValuePairs.pop(); + } + + for (i = keyValuePairs.length; i--; ) { + + var split = keyValuePairs[i].split(/\s*:\s*/), + key = split[0].trim(), + value = split[1].trim(); + + if (key === 'stop-color') { + color = value; + } + else if (key === 'stop-opacity') { + opacity = value; + } + } + } + + if (!color) { + color = el.getAttribute('stop-color') || 'rgb(0,0,0)'; + } + if (!opacity) { + opacity = el.getAttribute('stop-opacity'); + } + + color = new fabric.Color(color); + colorAlpha = color.getAlpha(); + opacity = isNaN(parseFloat(opacity)) ? 1 : parseFloat(opacity); + opacity *= colorAlpha * multiplier; + + return { + offset: offset, + color: color.toRgb(), + opacity: opacity + }; + } + + function getLinearCoords(el) { + return { + x1: el.getAttribute('x1') || 0, + y1: el.getAttribute('y1') || 0, + x2: el.getAttribute('x2') || '100%', + y2: el.getAttribute('y2') || 0 + }; + } + + function getRadialCoords(el) { + return { + x1: el.getAttribute('fx') || el.getAttribute('cx') || '50%', + y1: el.getAttribute('fy') || el.getAttribute('cy') || '50%', + r1: 0, + x2: el.getAttribute('cx') || '50%', + y2: el.getAttribute('cy') || '50%', + r2: el.getAttribute('r') || '50%' + }; + } + /* _FROM_SVG_END_ */ + + var clone = fabric.util.object.clone; + + /** + * Gradient class + * @class fabric.Gradient + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#gradients} + * @see {@link fabric.Gradient#initialize} for constructor definition + */ + fabric.Gradient = fabric.util.createClass(/** @lends fabric.Gradient.prototype */ { + + /** + * Horizontal offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetX: 0, + + /** + * Vertical offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetY: 0, + + /** + * A transform matrix to apply to the gradient before painting. + * Imported from svg gradients, is not applied with the current transform in the center. + * Before this transform is applied, the origin point is at the top left corner of the object + * plus the addition of offsetY and offsetX. + * @type Array[Number] + * @default null + */ + gradientTransform: null, + + /** + * coordinates units for coords. + * If `pixels`, the number of coords are in the same unit of width / height. + * If set as `percentage` the coords are still a number, but 1 means 100% of width + * for the X and 100% of the height for the y. It can be bigger than 1 and negative. + * @type String pixels || percentage + * @default 'pixels' + */ + gradientUnits: 'pixels', + + /** + * Gradient type + * @type String linear || radial + * @default 'pixels' + */ + type: 'linear', + + /** + * Constructor + * @param {Object} options Options object with type, coords, gradientUnits and colorStops + * @param {Object} [options.type] gradient type linear or radial + * @param {Object} [options.gradientUnits] gradient units + * @param {Object} [options.offsetX] SVG import compatibility + * @param {Object} [options.offsetY] SVG import compatibility + * @param {Array[Object]} options.colorStops contains the colorstops. + * @param {Object} options.coords contains the coords of the gradient + * @param {Number} [options.coords.x1] X coordiante of the first point for linear or of the focal point for radial + * @param {Number} [options.coords.y1] Y coordiante of the first point for linear or of the focal point for radial + * @param {Number} [options.coords.x2] X coordiante of the second point for linear or of the center point for radial + * @param {Number} [options.coords.y2] Y coordiante of the second point for linear or of the center point for radial + * @param {Number} [options.coords.r1] only for radial gradient, radius of the inner circle + * @param {Number} [options.coords.r2] only for radial gradient, radius of the external circle + * @return {fabric.Gradient} thisArg + */ + initialize: function(options) { + options || (options = { }); + options.coords || (options.coords = { }); + + var coords, _this = this; + + // sets everything, then coords and colorstops get sets again + Object.keys(options).forEach(function(option) { + _this[option] = options[option]; + }); + + if (this.id) { + this.id += '_' + fabric.Object.__uid++; + } + else { + this.id = fabric.Object.__uid++; + } + + coords = { + x1: options.coords.x1 || 0, + y1: options.coords.y1 || 0, + x2: options.coords.x2 || 0, + y2: options.coords.y2 || 0 + }; + + if (this.type === 'radial') { + coords.r1 = options.coords.r1 || 0; + coords.r2 = options.coords.r2 || 0; + } + + this.coords = coords; + this.colorStops = options.colorStops.slice(); + }, + + /** + * Adds another colorStop + * @param {Object} colorStop Object with offset and color + * @return {fabric.Gradient} thisArg + */ + addColorStop: function(colorStops) { + for (var position in colorStops) { + var color = new fabric.Color(colorStops[position]); + this.colorStops.push({ + offset: parseFloat(position), + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + return this; + }, + + /** + * Returns object representation of a gradient + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} + */ + toObject: function(propertiesToInclude) { + var object = { + type: this.type, + coords: this.coords, + colorStops: this.colorStops, + offsetX: this.offsetX, + offsetY: this.offsetY, + gradientUnits: this.gradientUnits, + gradientTransform: this.gradientTransform ? this.gradientTransform.concat() : this.gradientTransform + }; + fabric.util.populateWithProperties(this, object, propertiesToInclude); + + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an gradient + * @param {Object} object Object to create a gradient for + * @return {String} SVG representation of an gradient (linear/radial) + */ + toSVG: function(object, options) { + var coords = clone(this.coords, true), i, len, options = options || {}, + markup, commonAttributes, colorStops = clone(this.colorStops, true), + needsSwap = coords.r1 > coords.r2, + transform = this.gradientTransform ? this.gradientTransform.concat() : fabric.iMatrix.concat(), + offsetX = -this.offsetX, offsetY = -this.offsetY, + withViewport = !!options.additionalTransform, + gradientUnits = this.gradientUnits === 'pixels' ? 'userSpaceOnUse' : 'objectBoundingBox'; + // colorStops must be sorted ascending + colorStops.sort(function(a, b) { + return a.offset - b.offset; + }); + + if (gradientUnits === 'objectBoundingBox') { + offsetX /= object.width; + offsetY /= object.height; + } + else { + offsetX += object.width / 2; + offsetY += object.height / 2; + } + if (object.type === 'path') { + offsetX -= object.pathOffset.x; + offsetY -= object.pathOffset.y; + } + + + transform[4] -= offsetX; + transform[5] -= offsetY; + + commonAttributes = 'id="SVGID_' + this.id + + '" gradientUnits="' + gradientUnits + '"'; + commonAttributes += ' gradientTransform="' + (withViewport ? + options.additionalTransform + ' ' : '') + fabric.util.matrixToSVG(transform) + '" '; + + if (this.type === 'linear') { + markup = [ + '\n' + ]; + } + else if (this.type === 'radial') { + // svg radial gradient has just 1 radius. the biggest. + markup = [ + '\n' + ]; + } + + if (this.type === 'radial') { + if (needsSwap) { + // svg goes from internal to external radius. if radius are inverted, swap color stops. + colorStops = colorStops.concat(); + colorStops.reverse(); + for (i = 0, len = colorStops.length; i < len; i++) { + colorStops[i].offset = 1 - colorStops[i].offset; + } + } + var minRadius = Math.min(coords.r1, coords.r2); + if (minRadius > 0) { + // i have to shift all colorStops and add new one in 0. + var maxRadius = Math.max(coords.r1, coords.r2), + percentageShift = minRadius / maxRadius; + for (i = 0, len = colorStops.length; i < len; i++) { + colorStops[i].offset += percentageShift * (1 - colorStops[i].offset); + } + } + } + + for (i = 0, len = colorStops.length; i < len; i++) { + var colorStop = colorStops[i]; + markup.push( + '\n' + ); + } + + markup.push((this.type === 'linear' ? '\n' : '\n')); + + return markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasGradient + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {CanvasGradient} + */ + toLive: function(ctx) { + var gradient, coords = fabric.util.object.clone(this.coords), i, len; + + if (!this.type) { + return; + } + + if (this.type === 'linear') { + gradient = ctx.createLinearGradient( + coords.x1, coords.y1, coords.x2, coords.y2); + } + else if (this.type === 'radial') { + gradient = ctx.createRadialGradient( + coords.x1, coords.y1, coords.r1, coords.x2, coords.y2, coords.r2); + } + + for (i = 0, len = this.colorStops.length; i < len; i++) { + var color = this.colorStops[i].color, + opacity = this.colorStops[i].opacity, + offset = this.colorStops[i].offset; + + if (typeof opacity !== 'undefined') { + color = new fabric.Color(color).setAlpha(opacity).toRgba(); + } + gradient.addColorStop(offset, color); + } + + return gradient; + } + }); + + fabric.util.object.extend(fabric.Gradient, { + + /* _FROM_SVG_START_ */ + /** + * Returns {@link fabric.Gradient} instance from an SVG element + * @static + * @memberOf fabric.Gradient + * @param {SVGGradientElement} el SVG gradient element + * @param {fabric.Object} instance + * @param {String} opacityAttr A fill-opacity or stroke-opacity attribute to multiply to each stop's opacity. + * @param {Object} svgOptions an object containing the size of the SVG in order to parse correctly graidents + * that uses gradientUnits as 'userSpaceOnUse' and percentages. + * @param {Object.number} viewBoxWidth width part of the viewBox attribute on svg + * @param {Object.number} viewBoxHeight height part of the viewBox attribute on svg + * @param {Object.number} width width part of the svg tag if viewBox is not specified + * @param {Object.number} height height part of the svg tag if viewBox is not specified + * @return {fabric.Gradient} Gradient instance + * @see http://www.w3.org/TR/SVG/pservers.html#LinearGradientElement + * @see http://www.w3.org/TR/SVG/pservers.html#RadialGradientElement + */ + fromElement: function(el, instance, opacityAttr, svgOptions) { + /** + * @example: + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + */ + + var multiplier = parseFloat(opacityAttr) / (/%$/.test(opacityAttr) ? 100 : 1); + multiplier = multiplier < 0 ? 0 : multiplier > 1 ? 1 : multiplier; + if (isNaN(multiplier)) { + multiplier = 1; + } + + var colorStopEls = el.getElementsByTagName('stop'), + type, + gradientUnits = el.getAttribute('gradientUnits') === 'userSpaceOnUse' ? + 'pixels' : 'percentage', + gradientTransform = el.getAttribute('gradientTransform') || '', + colorStops = [], + coords, i, offsetX = 0, offsetY = 0, + transformMatrix; + if (el.nodeName === 'linearGradient' || el.nodeName === 'LINEARGRADIENT') { + type = 'linear'; + coords = getLinearCoords(el); + } + else { + type = 'radial'; + coords = getRadialCoords(el); + } + + for (i = colorStopEls.length; i--; ) { + colorStops.push(getColorStop(colorStopEls[i], multiplier)); + } + + transformMatrix = fabric.parseTransformAttribute(gradientTransform); + + __convertPercentUnitsToValues(instance, coords, svgOptions, gradientUnits); + + if (gradientUnits === 'pixels') { + offsetX = -instance.left; + offsetY = -instance.top; + } + + var gradient = new fabric.Gradient({ + id: el.getAttribute('id'), + type: type, + coords: coords, + colorStops: colorStops, + gradientUnits: gradientUnits, + gradientTransform: transformMatrix, + offsetX: offsetX, + offsetY: offsetY, + }); + + return gradient; + }, + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Gradient} instance from its object representation + * this function is uniquely used by Object.setGradient and is deprecated with it. + * @static + * @deprecated since 3.4.0 + * @memberOf fabric.Gradient + * @param {Object} obj + * @param {Object} [options] Options object + */ + forObject: function(obj, options) { + options || (options = { }); + __convertPercentUnitsToValues(obj, options.coords, options.gradientUnits, { + // those values are to avoid errors. this function is uniquely used by + viewBoxWidth: 100, + viewBoxHeight: 100, + }); + return new fabric.Gradient(options); + } + }); + + /** + * @private + */ + function __convertPercentUnitsToValues(instance, options, svgOptions, gradientUnits) { + var propValue, finalValue; + Object.keys(options).forEach(function(prop) { + propValue = options[prop]; + if (propValue === 'Infinity') { + finalValue = 1; + } + else if (propValue === '-Infinity') { + finalValue = 0; + } + else { + finalValue = parseFloat(options[prop], 10); + if (typeof propValue === 'string' && /^(\d+\.\d+)%|(\d+)%$/.test(propValue)) { + finalValue *= 0.01; + if (gradientUnits === 'pixels') { + // then we need to fix those percentages here in svg parsing + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + finalValue *= svgOptions.viewBoxWidth || svgOptions.width; + } + if (prop === 'y1' || prop === 'y2') { + finalValue *= svgOptions.viewBoxHeight || svgOptions.height; + } + } + } + } + options[prop] = finalValue; + }); + } +})(); +(function() { + + 'use strict'; + + var toFixed = fabric.util.toFixed; + + /** + * Pattern class + * @class fabric.Pattern + * @see {@link http://fabricjs.com/patterns|Pattern demo} + * @see {@link http://fabricjs.com/dynamic-patterns|DynamicPattern demo} + * @see {@link fabric.Pattern#initialize} for constructor definition + */ + + + fabric.Pattern = fabric.util.createClass(/** @lends fabric.Pattern.prototype */ { + + /** + * Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @type String + * @default + */ + repeat: 'repeat', + + /** + * Pattern horizontal offset from object's left/top corner + * @type Number + * @default + */ + offsetX: 0, + + /** + * Pattern vertical offset from object's left/top corner + * @type Number + * @default + */ + offsetY: 0, + + /** + * crossOrigin value (one of "", "anonymous", "use-credentials") + * @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes + * @type String + * @default + */ + crossOrigin: '', + + /** + * transform matrix to change the pattern, imported from svgs. + * @type Array + * @default + */ + patternTransform: null, + + /** + * Constructor + * @param {Object} [options] Options object + * @param {Function} [callback] function to invoke after callback init. + * @return {fabric.Pattern} thisArg + */ + initialize: function(options, callback) { + options || (options = { }); + + this.id = fabric.Object.__uid++; + this.setOptions(options); + if (!options.source || (options.source && typeof options.source !== 'string')) { + callback && callback(this); + return; + } + // function string + if (typeof fabric.util.getFunctionBody(options.source) !== 'undefined') { + this.source = new Function(fabric.util.getFunctionBody(options.source)); + callback && callback(this); + } + else { + // img src string + var _this = this; + this.source = fabric.util.createImage(); + fabric.util.loadImage(options.source, function(img) { + _this.source = img; + callback && callback(_this); + }, null, this.crossOrigin); + } + }, + + /** + * Returns object representation of a pattern + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of a pattern instance + */ + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + source, object; + + // callback + if (typeof this.source === 'function') { + source = String(this.source); + } + // element + else if (typeof this.source.src === 'string') { + source = this.source.src; + } + // element + else if (typeof this.source === 'object' && this.source.toDataURL) { + source = this.source.toDataURL(); + } + + object = { + type: 'pattern', + source: source, + repeat: this.repeat, + crossOrigin: this.crossOrigin, + offsetX: toFixed(this.offsetX, NUM_FRACTION_DIGITS), + offsetY: toFixed(this.offsetY, NUM_FRACTION_DIGITS), + patternTransform: this.patternTransform ? this.patternTransform.concat() : null + }; + fabric.util.populateWithProperties(this, object, propertiesToInclude); + + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a pattern + * @param {fabric.Object} object + * @return {String} SVG representation of a pattern + */ + toSVG: function(object) { + var patternSource = typeof this.source === 'function' ? this.source() : this.source, + patternWidth = patternSource.width / object.width, + patternHeight = patternSource.height / object.height, + patternOffsetX = this.offsetX / object.width, + patternOffsetY = this.offsetY / object.height, + patternImgSrc = ''; + if (this.repeat === 'repeat-x' || this.repeat === 'no-repeat') { + patternHeight = 1; + if (patternOffsetY) { + patternHeight += Math.abs(patternOffsetY); + } + } + if (this.repeat === 'repeat-y' || this.repeat === 'no-repeat') { + patternWidth = 1; + if (patternOffsetX) { + patternWidth += Math.abs(patternOffsetX); + } + + } + if (patternSource.src) { + patternImgSrc = patternSource.src; + } + else if (patternSource.toDataURL) { + patternImgSrc = patternSource.toDataURL(); + } + + return '\n' + + '\n' + + '\n'; + }, + /* _TO_SVG_END_ */ + + setOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + }, + + /** + * Returns an instance of CanvasPattern + * @param {CanvasRenderingContext2D} ctx Context to create pattern + * @return {CanvasPattern} + */ + toLive: function(ctx) { + var source = typeof this.source === 'function' ? this.source() : this.source; + + // if the image failed to load, return, and allow rest to continue loading + if (!source) { + return ''; + } + + // if an image + if (typeof source.src !== 'undefined') { + if (!source.complete) { + return ''; + } + if (source.naturalWidth === 0 || source.naturalHeight === 0) { + return ''; + } + } + return ctx.createPattern(source, this.repeat); + } + }); +})(); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + toFixed = fabric.util.toFixed; + + if (fabric.Shadow) { + fabric.warn('fabric.Shadow is already defined.'); + return; + } + + /** + * Shadow class + * @class fabric.Shadow + * @see {@link http://fabricjs.com/shadows|Shadow demo} + * @see {@link fabric.Shadow#initialize} for constructor definition + */ + fabric.Shadow = fabric.util.createClass(/** @lends fabric.Shadow.prototype */ { + + /** + * Shadow color + * @type String + * @default + */ + color: 'rgb(0,0,0)', + + /** + * Shadow blur + * @type Number + */ + blur: 0, + + /** + * Shadow horizontal offset + * @type Number + * @default + */ + offsetX: 0, + + /** + * Shadow vertical offset + * @type Number + * @default + */ + offsetY: 0, + + /** + * Whether the shadow should affect stroke operations + * @type Boolean + * @default + */ + affectStroke: false, + + /** + * Indicates whether toObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * When `false`, the shadow will scale with the object. + * When `true`, the shadow's offsetX, offsetY, and blur will not be affected by the object's scale. + * default to false + * @type Boolean + * @default + */ + nonScaling: false, + + /** + * Constructor + * @param {Object|String} [options] Options object with any of color, blur, offsetX, offsetY properties or string (e.g. "rgba(0,0,0,0.2) 2px 2px 10px") + * @return {fabric.Shadow} thisArg + */ + initialize: function(options) { + + if (typeof options === 'string') { + options = this._parseShadow(options); + } + + for (var prop in options) { + this[prop] = options[prop]; + } + + this.id = fabric.Object.__uid++; + }, + + /** + * @private + * @param {String} shadow Shadow value to parse + * @return {Object} Shadow object with color, offsetX, offsetY and blur + */ + _parseShadow: function(shadow) { + var shadowStr = shadow.trim(), + offsetsAndBlur = fabric.Shadow.reOffsetsAndBlur.exec(shadowStr) || [], + color = shadowStr.replace(fabric.Shadow.reOffsetsAndBlur, '') || 'rgb(0,0,0)'; + + return { + color: color.trim(), + offsetX: parseInt(offsetsAndBlur[1], 10) || 0, + offsetY: parseInt(offsetsAndBlur[2], 10) || 0, + blur: parseInt(offsetsAndBlur[3], 10) || 0 + }; + }, + + /** + * Returns a string representation of an instance + * @see http://www.w3.org/TR/css-text-decor-3/#text-shadow + * @return {String} Returns CSS3 text-shadow declaration + */ + toString: function() { + return [this.offsetX, this.offsetY, this.blur, this.color].join('px '); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a shadow + * @param {fabric.Object} object + * @return {String} SVG representation of a shadow + */ + toSVG: function(object) { + var fBoxX = 40, fBoxY = 40, NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + offset = fabric.util.rotateVector( + { x: this.offsetX, y: this.offsetY }, + fabric.util.degreesToRadians(-object.angle)), + BLUR_BOX = 20, color = new fabric.Color(this.color); + + if (object.width && object.height) { + //http://www.w3.org/TR/SVG/filters.html#FilterEffectsRegion + // we add some extra space to filter box to contain the blur ( 20 ) + fBoxX = toFixed((Math.abs(offset.x) + this.blur) / object.width, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX; + fBoxY = toFixed((Math.abs(offset.y) + this.blur) / object.height, NUM_FRACTION_DIGITS) * 100 + BLUR_BOX; + } + if (object.flipX) { + offset.x *= -1; + } + if (object.flipY) { + offset.y *= -1; + } + + return ( + '\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\t\n' + + '\t\t\n' + + '\t\n' + + '\n'); + }, + /* _TO_SVG_END_ */ + + /** + * Returns object representation of a shadow + * @return {Object} Object representation of a shadow instance + */ + toObject: function() { + if (this.includeDefaultValues) { + return { + color: this.color, + blur: this.blur, + offsetX: this.offsetX, + offsetY: this.offsetY, + affectStroke: this.affectStroke, + nonScaling: this.nonScaling + }; + } + var obj = { }, proto = fabric.Shadow.prototype; + + ['color', 'blur', 'offsetX', 'offsetY', 'affectStroke', 'nonScaling'].forEach(function(prop) { + if (this[prop] !== proto[prop]) { + obj[prop] = this[prop]; + } + }, this); + + return obj; + } + }); + + /** + * Regex matching shadow offsetX, offsetY and blur (ex: "2px 2px 10px rgba(0,0,0,0.2)", "rgb(0,255,0) 2px 2px") + * @static + * @field + * @memberOf fabric.Shadow + */ + // eslint-disable-next-line max-len + fabric.Shadow.reOffsetsAndBlur = /(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/; + +})(typeof exports !== 'undefined' ? exports : this); +(function () { + + 'use strict'; + + if (fabric.StaticCanvas) { + fabric.warn('fabric.StaticCanvas is already defined.'); + return; + } + + // aliases for faster resolution + var extend = fabric.util.object.extend, + getElementOffset = fabric.util.getElementOffset, + removeFromArray = fabric.util.removeFromArray, + toFixed = fabric.util.toFixed, + transformPoint = fabric.util.transformPoint, + invertTransform = fabric.util.invertTransform, + getNodeCanvas = fabric.util.getNodeCanvas, + createCanvasElement = fabric.util.createCanvasElement, + + CANVAS_INIT_ERROR = new Error('Could not initialize `canvas` element'); + + /** + * Static canvas class + * @class fabric.StaticCanvas + * @mixes fabric.Collection + * @mixes fabric.Observable + * @see {@link http://fabricjs.com/static_canvas|StaticCanvas demo} + * @see {@link fabric.StaticCanvas#initialize} for constructor definition + * @fires before:render + * @fires after:render + * @fires canvas:cleared + * @fires object:added + * @fires object:removed + */ + fabric.StaticCanvas = fabric.util.createClass(fabric.CommonMethods, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + this.renderAndResetBound = this.renderAndReset.bind(this); + this.requestRenderAllBound = this.requestRenderAll.bind(this); + this._initStatic(el, options); + }, + + /** + * Background color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundColor}. + * @type {(String|fabric.Pattern)} + * @default + */ + backgroundColor: '', + + /** + * Background image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundImage}. + * Backwards incompatibility note: The "backgroundImageOpacity" + * and "backgroundImageStretch" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#opacity}, {@link fabric.Image#width} and {@link fabric.Image#height}. + * since 2.4.0 image caching is active, please when putting an image as background, add to the + * canvas property a reference to the canvas it is on. Otherwise the image cannot detect the zoom + * vale. As an alternative you can disable image objectCaching + * @type fabric.Image + * @default + */ + backgroundImage: null, + + /** + * Overlay color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayColor} + * @since 1.3.9 + * @type {(String|fabric.Pattern)} + * @default + */ + overlayColor: '', + + /** + * Overlay image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayImage}. + * Backwards incompatibility note: The "overlayImageLeft" + * and "overlayImageTop" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#left} and {@link fabric.Image#top}. + * since 2.4.0 image caching is active, please when putting an image as overlay, add to the + * canvas property a reference to the canvas it is on. Otherwise the image cannot detect the zoom + * vale. As an alternative you can disable image objectCaching + * @type fabric.Image + * @default + */ + overlayImage: null, + + /** + * Indicates whether toObject/toDatalessObject should include default values + * if set to false, takes precedence over the object value. + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Indicates whether objects' state should be saved + * @type Boolean + * @default + */ + stateful: false, + + /** + * Indicates whether {@link fabric.Collection.add}, {@link fabric.Collection.insertAt} and {@link fabric.Collection.remove}, + * {@link fabric.StaticCanvas.moveTo}, {@link fabric.StaticCanvas.clear} and many more, should also re-render canvas. + * Disabling this option will not give a performance boost when adding/removing a lot of objects to/from canvas at once + * since the renders are quequed and executed one per frame. + * Disabling is suggested anyway and managing the renders of the app manually is not a big effort ( canvas.requestRenderAll() ) + * Left default to true to do not break documentation and old app, fiddles. + * @type Boolean + * @default + */ + renderOnAddRemove: true, + + /** + * Function that determines clipping of entire canvas area + * Being passed context as first argument. + * If you are using code minification, ctx argument can be minified/manglied you should use + * as a workaround `var ctx = arguments[0];` in the function; + * See clipping canvas area in {@link https://github.com/kangax/fabric.js/wiki/FAQ} + * @deprecated since 2.0.0 + * @type Function + * @default + */ + clipTo: null, + + /** + * Indicates whether object controls (borders/controls) are rendered above overlay image + * @type Boolean + * @default + */ + controlsAboveOverlay: false, + + /** + * Indicates whether the browser can be scrolled when using a touchscreen and dragging on the canvas + * @type Boolean + * @default + */ + allowTouchScrolling: false, + + /** + * Indicates whether this canvas will use image smoothing, this is on by default in browsers + * @type Boolean + * @default + */ + imageSmoothingEnabled: true, + + /** + * The transformation (in the format of Canvas transform) which focuses the viewport + * @type Array + * @default + */ + viewportTransform: fabric.iMatrix.concat(), + + /** + * if set to false background image is not affected by viewport transform + * @since 1.6.3 + * @type Boolean + * @default + */ + backgroundVpt: true, + + /** + * if set to false overlya image is not affected by viewport transform + * @since 1.6.3 + * @type Boolean + * @default + */ + overlayVpt: true, + + /** + * Callback; invoked right before object is about to be scaled/rotated + * @deprecated since 2.3.0 + * Use before:transform event + */ + onBeforeScaleRotate: function () { + /* NOOP */ + }, + + /** + * When true, canvas is scaled by devicePixelRatio for better rendering on retina screens + * @type Boolean + * @default + */ + enableRetinaScaling: true, + + /** + * Describe canvas element extension over design + * properties are tl,tr,bl,br. + * if canvas is not zoomed/panned those points are the four corner of canvas + * if canvas is viewportTransformed you those points indicate the extension + * of canvas element in plain untrasformed coordinates + * The coordinates get updated with @method calcViewportBoundaries. + * @memberOf fabric.StaticCanvas.prototype + */ + vptCoords: { }, + + /** + * Based on vptCoords and object.aCoords, skip rendering of objects that + * are not included in current viewport. + * May greatly help in applications with crowded canvas and use of zoom/pan + * If One of the corner of the bounding box of the object is on the canvas + * the objects get rendered. + * @memberOf fabric.StaticCanvas.prototype + * @type Boolean + * @default + */ + skipOffscreen: true, + + /** + * a fabricObject that, without stroke define a clipping area with their shape. filled in black + * the clipPath object gets used when the canvas has rendered, and the context is placed in the + * top left corner of the canvas. + * clipPath will clip away controls, if you do not want this to happen use controlsAboveOverlay = true + * @type fabric.Object + */ + clipPath: undefined, + + /** + * @private + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + */ + _initStatic: function(el, options) { + var cb = this.requestRenderAllBound; + this._objects = []; + this._createLowerCanvas(el); + this._initOptions(options); + this._setImageSmoothing(); + // only initialize retina scaling once + if (!this.interactive) { + this._initRetinaScaling(); + } + + if (options.overlayImage) { + this.setOverlayImage(options.overlayImage, cb); + } + if (options.backgroundImage) { + this.setBackgroundImage(options.backgroundImage, cb); + } + if (options.backgroundColor) { + this.setBackgroundColor(options.backgroundColor, cb); + } + if (options.overlayColor) { + this.setOverlayColor(options.overlayColor, cb); + } + this.calcOffset(); + }, + + /** + * @private + */ + _isRetinaScaling: function() { + return (fabric.devicePixelRatio !== 1 && this.enableRetinaScaling); + }, + + /** + * @private + * @return {Number} retinaScaling if applied, otherwise 1; + */ + getRetinaScaling: function() { + return this._isRetinaScaling() ? fabric.devicePixelRatio : 1; + }, + + /** + * @private + */ + _initRetinaScaling: function() { + if (!this._isRetinaScaling()) { + return; + } + this.lowerCanvasEl.setAttribute('width', this.width * fabric.devicePixelRatio); + this.lowerCanvasEl.setAttribute('height', this.height * fabric.devicePixelRatio); + + this.contextContainer.scale(fabric.devicePixelRatio, fabric.devicePixelRatio); + }, + + /** + * Calculates canvas element offset relative to the document + * This method is also attached as "resize" event handler of window + * @return {fabric.Canvas} instance + * @chainable + */ + calcOffset: function () { + this._offset = getElementOffset(this.lowerCanvasEl); + return this; + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayImage|overlay image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set overlay to + * @param {Function} callback callback to invoke when image is loaded and set as an overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|overlay image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/MnzHT/|jsFiddle demo} + * @example Normal overlayImage with left/top = 0 + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage with different properties + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched overlayImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/jail_cell_bars.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setOverlayImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched overlayImage #2 - width/height correspond to canvas width/height + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage loaded from cross-origin + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top', + * crossOrigin: 'anonymous' + * }); + */ + setOverlayImage: function (image, callback, options) { + return this.__setBgOverlayImage('overlayImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundImage|background image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set background to + * @param {Function} callback Callback to invoke when image is loaded and set as background + * @param {Object} [options] Optional options to set for the {@link fabric.Image|background image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/djnr8o7a/28/|jsFiddle demo} + * @example Normal backgroundImage with left/top = 0 + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage with different properties + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched backgroundImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/honey_im_subtle.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setBackgroundImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched backgroundImage #2 - width/height correspond to canvas width/height + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage loaded from cross-origin + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top', + * crossOrigin: 'anonymous' + * }); + */ + // TODO: fix stretched examples + setBackgroundImage: function (image, callback, options) { + return this.__setBgOverlayImage('backgroundImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayColor|foreground color} for this canvas + * @param {(String|fabric.Pattern)} overlayColor Color or pattern to set foreground color to + * @param {Function} callback Callback to invoke when foreground color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/pB55h/|jsFiddle demo} + * @example Normal overlayColor - color value + * canvas.setOverlayColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor with repeat and offset + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setOverlayColor: function(overlayColor, callback) { + return this.__setBgOverlayColor('overlayColor', overlayColor, callback); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundColor|background color} for this canvas + * @param {(String|fabric.Pattern)} backgroundColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/hXzvk/|jsFiddle demo} + * @example Normal backgroundColor - color value + * canvas.setBackgroundColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor with repeat and offset + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setBackgroundColor: function(backgroundColor, callback) { + return this.__setBgOverlayColor('backgroundColor', backgroundColor, callback); + }, + + /** + * @private + * @see {@link http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-imagesmoothingenabled|WhatWG Canvas Standard} + */ + _setImageSmoothing: function() { + var ctx = this.getContext(); + + ctx.imageSmoothingEnabled = ctx.imageSmoothingEnabled || ctx.webkitImageSmoothingEnabled + || ctx.mozImageSmoothingEnabled || ctx.msImageSmoothingEnabled || ctx.oImageSmoothingEnabled; + ctx.imageSmoothingEnabled = this.imageSmoothingEnabled; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundImage|backgroundImage} + * or {@link fabric.StaticCanvas#overlayImage|overlayImage}) + * @param {(fabric.Image|String|null)} image fabric.Image instance, URL of an image or null to set background or overlay to + * @param {Function} callback Callback to invoke when image is loaded and set as background or overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|image}. + */ + __setBgOverlayImage: function(property, image, callback, options) { + if (typeof image === 'string') { + fabric.util.loadImage(image, function(img) { + if (img) { + var instance = new fabric.Image(img, options); + this[property] = instance; + instance.canvas = this; + } + callback && callback(img); + }, this, options && options.crossOrigin); + } + else { + options && image.setOptions(options); + this[property] = image; + image && (image.canvas = this); + callback && callback(image); + } + + return this; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundColor|backgroundColor} + * or {@link fabric.StaticCanvas#overlayColor|overlayColor}) + * @param {(Object|String|null)} color Object with pattern information, color value or null + * @param {Function} [callback] Callback is invoked when color is set + */ + __setBgOverlayColor: function(property, color, callback) { + this[property] = color; + this._initGradient(color, property); + this._initPattern(color, property, callback); + return this; + }, + + /** + * @private + */ + _createCanvasElement: function() { + var element = createCanvasElement(); + if (!element) { + throw CANVAS_INIT_ERROR; + } + if (!element.style) { + element.style = { }; + } + if (typeof element.getContext === 'undefined') { + throw CANVAS_INIT_ERROR; + } + return element; + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initOptions: function (options) { + var lowerCanvasEl = this.lowerCanvasEl; + this._setOptions(options); + + this.width = this.width || parseInt(lowerCanvasEl.width, 10) || 0; + this.height = this.height || parseInt(lowerCanvasEl.height, 10) || 0; + + if (!this.lowerCanvasEl.style) { + return; + } + + lowerCanvasEl.width = this.width; + lowerCanvasEl.height = this.height; + + lowerCanvasEl.style.width = this.width + 'px'; + lowerCanvasEl.style.height = this.height + 'px'; + + this.viewportTransform = this.viewportTransform.slice(); + }, + + /** + * Creates a bottom canvas + * @private + * @param {HTMLElement} [canvasEl] + */ + _createLowerCanvas: function (canvasEl) { + // canvasEl === 'HTMLCanvasElement' does not work on jsdom/node + if (canvasEl && canvasEl.getContext) { + this.lowerCanvasEl = canvasEl; + } + else { + this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement(); + } + + fabric.util.addClass(this.lowerCanvasEl, 'lower-canvas'); + + if (this.interactive) { + this._applyCanvasStyle(this.lowerCanvasEl); + } + + this.contextContainer = this.lowerCanvasEl.getContext('2d'); + }, + + /** + * Returns canvas width (in px) + * @return {Number} + */ + getWidth: function () { + return this.width; + }, + + /** + * Returns canvas height (in px) + * @return {Number} + */ + getHeight: function () { + return this.height; + }, + + /** + * Sets width of this canvas instance + * @param {Number|String} value Value to set width to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setWidth: function (value, options) { + return this.setDimensions({ width: value }, options); + }, + + /** + * Sets height of this canvas instance + * @param {Number|String} value Value to set height to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setHeight: function (value, options) { + return this.setDimensions({ height: value }, options); + }, + + /** + * Sets dimensions (width, height) of this canvas instance. when options.cssOnly flag active you should also supply the unit of measure (px/%/em) + * @param {Object} dimensions Object with width/height properties + * @param {Number|String} [dimensions.width] Width of canvas element + * @param {Number|String} [dimensions.height] Height of canvas element + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} thisArg + * @chainable + */ + setDimensions: function (dimensions, options) { + var cssValue; + + options = options || {}; + + for (var prop in dimensions) { + cssValue = dimensions[prop]; + + if (!options.cssOnly) { + this._setBackstoreDimension(prop, dimensions[prop]); + cssValue += 'px'; + this.hasLostContext = true; + } + + if (!options.backstoreOnly) { + this._setCssDimension(prop, cssValue); + } + } + if (this._isCurrentlyDrawing) { + this.freeDrawingBrush && this.freeDrawingBrush._setBrushStyles(); + } + this._initRetinaScaling(); + this._setImageSmoothing(); + this.calcOffset(); + + if (!options.cssOnly) { + this.requestRenderAll(); + } + + return this; + }, + + /** + * Helper for setting width/height + * @private + * @param {String} prop property (width|height) + * @param {Number} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setBackstoreDimension: function (prop, value) { + this.lowerCanvasEl[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl[prop] = value; + } + + if (this.cacheCanvasEl) { + this.cacheCanvasEl[prop] = value; + } + + this[prop] = value; + + return this; + }, + + /** + * Helper for setting css width/height + * @private + * @param {String} prop property (width|height) + * @param {String} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setCssDimension: function (prop, value) { + this.lowerCanvasEl.style[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl.style[prop] = value; + } + + if (this.wrapperEl) { + this.wrapperEl.style[prop] = value; + } + + return this; + }, + + /** + * Returns canvas zoom level + * @return {Number} + */ + getZoom: function () { + return this.viewportTransform[0]; + }, + + /** + * Sets viewport transform of this canvas instance + * @param {Array} vpt the transform in the form of context.transform + * @return {fabric.Canvas} instance + * @chainable true + */ + setViewportTransform: function (vpt) { + var activeObject = this._activeObject, object, ignoreVpt = false, skipAbsolute = true, i, len; + this.viewportTransform = vpt; + for (i = 0, len = this._objects.length; i < len; i++) { + object = this._objects[i]; + object.group || object.setCoords(ignoreVpt, skipAbsolute); + } + if (activeObject && activeObject.type === 'activeSelection') { + activeObject.setCoords(ignoreVpt, skipAbsolute); + } + this.calcViewportBoundaries(); + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Sets zoom level of this canvas instance, zoom centered around point + * @param {fabric.Point} point to zoom with respect to + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + zoomToPoint: function (point, value) { + // TODO: just change the scale, preserve other transformations + var before = point, vpt = this.viewportTransform.slice(0); + point = transformPoint(point, invertTransform(this.viewportTransform)); + vpt[0] = value; + vpt[3] = value; + var after = transformPoint(point, vpt); + vpt[4] += before.x - after.x; + vpt[5] += before.y - after.y; + return this.setViewportTransform(vpt); + }, + + /** + * Sets zoom level of this canvas instance + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + setZoom: function (value) { + this.zoomToPoint(new fabric.Point(0, 0), value); + return this; + }, + + /** + * Pan viewport so as to place point at top left corner of canvas + * @param {fabric.Point} point to move to + * @return {fabric.Canvas} instance + * @chainable true + */ + absolutePan: function (point) { + var vpt = this.viewportTransform.slice(0); + vpt[4] = -point.x; + vpt[5] = -point.y; + return this.setViewportTransform(vpt); + }, + + /** + * Pans viewpoint relatively + * @param {fabric.Point} point (position vector) to move by + * @return {fabric.Canvas} instance + * @chainable true + */ + relativePan: function (point) { + return this.absolutePan(new fabric.Point( + -point.x - this.viewportTransform[4], + -point.y - this.viewportTransform[5] + )); + }, + + /** + * Returns <canvas> element corresponding to this instance + * @return {HTMLCanvasElement} + */ + getElement: function () { + return this.lowerCanvasEl; + }, + + /** + * @private + * @param {fabric.Object} obj Object that was added + */ + _onObjectAdded: function(obj) { + this.stateful && obj.setupState(); + obj._set('canvas', this); + obj.setCoords(); + this.fire('object:added', { target: obj }); + obj.fire('added'); + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + this.fire('object:removed', { target: obj }); + obj.fire('removed'); + delete obj.canvas; + }, + + /** + * Clears specified context of canvas element + * @param {CanvasRenderingContext2D} ctx Context to clear + * @return {fabric.Canvas} thisArg + * @chainable + */ + clearContext: function(ctx) { + ctx.clearRect(0, 0, this.width, this.height); + return this; + }, + + /** + * Returns context of canvas where objects are drawn + * @return {CanvasRenderingContext2D} + */ + getContext: function () { + return this.contextContainer; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + this._objects.length = 0; + this.backgroundImage = null; + this.overlayImage = null; + this.backgroundColor = ''; + this.overlayColor = ''; + if (this._hasITextHandlers) { + this.off('mouse:up', this._mouseUpITextHandler); + this._iTextInstances = null; + this._hasITextHandlers = false; + } + this.clearContext(this.contextContainer); + this.fire('canvas:cleared'); + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Renders the canvas + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function () { + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._objects); + return this; + }, + + /** + * Function created to be instance bound at initialization + * used in requestAnimationFrame rendering + * Let the fabricJS call it. If you call it manually you could have more + * animationFrame stacking on to of each other + * for an imperative rendering, use canvas.renderAll + * @private + * @return {fabric.Canvas} instance + * @chainable + */ + renderAndReset: function() { + this.isRendering = 0; + this.renderAll(); + }, + + /** + * Append a renderAll request to next animation frame. + * unless one is already in progress, in that case nothing is done + * a boolean flag will avoid appending more. + * @return {fabric.Canvas} instance + * @chainable + */ + requestRenderAll: function () { + if (!this.isRendering) { + this.isRendering = fabric.util.requestAnimFrame(this.renderAndResetBound); + } + return this; + }, + + /** + * Calculate the position of the 4 corner of canvas with current viewportTransform. + * helps to determinate when an object is in the current rendering viewport using + * object absolute coordinates ( aCoords ) + * @return {Object} points.tl + * @chainable + */ + calcViewportBoundaries: function() { + var points = { }, width = this.width, height = this.height, + iVpt = invertTransform(this.viewportTransform); + points.tl = transformPoint({ x: 0, y: 0 }, iVpt); + points.br = transformPoint({ x: width, y: height }, iVpt); + points.tr = new fabric.Point(points.br.x, points.tl.y); + points.bl = new fabric.Point(points.tl.x, points.br.y); + this.vptCoords = points; + return points; + }, + + cancelRequestedRender: function() { + if (this.isRendering) { + fabric.util.cancelAnimFrame(this.isRendering); + this.isRendering = 0; + } + }, + + /** + * Renders background, objects, overlay and controls. + * @param {CanvasRenderingContext2D} ctx + * @param {Array} objects to render + * @return {fabric.Canvas} instance + * @chainable + */ + renderCanvas: function(ctx, objects) { + var v = this.viewportTransform, path = this.clipPath; + this.cancelRequestedRender(); + this.calcViewportBoundaries(); + this.clearContext(ctx); + this.fire('before:render', { ctx: ctx, }); + if (this.clipTo) { + fabric.util.clipContext(this, ctx); + } + this._renderBackground(ctx); + + ctx.save(); + //apply viewport transform once for all rendering process + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + this._renderObjects(ctx, objects); + ctx.restore(); + if (!this.controlsAboveOverlay && this.interactive) { + this.drawControls(ctx); + } + if (this.clipTo) { + ctx.restore(); + } + if (path) { + path.canvas = this; + // needed to setup a couple of variables + path.shouldCache(); + path._transformDone = true; + path.renderCache({ forClipping: true }); + this.drawClipPathOnCanvas(ctx); + } + this._renderOverlay(ctx); + if (this.controlsAboveOverlay && this.interactive) { + this.drawControls(ctx); + } + this.fire('after:render', { ctx: ctx, }); + }, + + /** + * Paint the cached clipPath on the lowerCanvasEl + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawClipPathOnCanvas: function(ctx) { + var v = this.viewportTransform, path = this.clipPath; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + // DEBUG: uncomment this line, comment the following + // ctx.globalAlpha = 0.4; + ctx.globalCompositeOperation = 'destination-in'; + path.transform(ctx); + ctx.scale(1 / path.zoomX, 1 / path.zoomY); + ctx.drawImage(path._cacheCanvas, -path.cacheTranslationX, -path.cacheTranslationY); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Array} objects to render + */ + _renderObjects: function(ctx, objects) { + var i, len; + for (i = 0, len = objects.length; i < len; ++i) { + objects[i] && objects[i].render(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {string} property 'background' or 'overlay' + */ + _renderBackgroundOrOverlay: function(ctx, property) { + var fill = this[property + 'Color'], object = this[property + 'Image'], + v = this.viewportTransform, needsVpt = this[property + 'Vpt']; + if (!fill && !object) { + return; + } + if (fill) { + ctx.save(); + ctx.beginPath(); + ctx.moveTo(0, 0); + ctx.lineTo(this.width, 0); + ctx.lineTo(this.width, this.height); + ctx.lineTo(0, this.height); + ctx.closePath(); + ctx.fillStyle = fill.toLive + ? fill.toLive(ctx, this) + : fill; + if (needsVpt) { + ctx.transform( + v[0], v[1], v[2], v[3], + v[4] + (fill.offsetX || 0), + v[5] + (fill.offsetY || 0) + ); + } + var m = fill.gradientTransform || fill.patternTransform; + m && ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + ctx.fill(); + ctx.restore(); + } + if (object) { + ctx.save(); + if (needsVpt) { + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + } + object.render(ctx); + ctx.restore(); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + this._renderBackgroundOrOverlay(ctx, 'background'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderOverlay: function(ctx) { + this._renderBackgroundOrOverlay(ctx, 'overlay'); + }, + + /** + * Returns coordinates of a center of canvas. + * Returned value is an object with top and left properties + * @return {Object} object with "top" and "left" number values + */ + getCenter: function () { + return { + top: this.height / 2, + left: this.width / 2 + }; + }, + + /** + * Centers object horizontally in the canvas + * @param {fabric.Object} object Object to center horizontally + * @return {fabric.Canvas} thisArg + */ + centerObjectH: function (object) { + return this._centerObject(object, new fabric.Point(this.getCenter().left, object.getCenterPoint().y)); + }, + + /** + * Centers object vertically in the canvas + * @param {fabric.Object} object Object to center vertically + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObjectV: function (object) { + return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, this.getCenter().top)); + }, + + /** + * Centers object vertically and horizontally in the canvas + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObject: function(object) { + var center = this.getCenter(); + + return this._centerObject(object, new fabric.Point(center.left, center.top)); + }, + + /** + * Centers object vertically and horizontally in the viewport + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + viewportCenterObject: function(object) { + var vpCenter = this.getVpCenter(); + + return this._centerObject(object, vpCenter); + }, + + /** + * Centers object horizontally in the viewport, object.top is unchanged + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + viewportCenterObjectH: function(object) { + var vpCenter = this.getVpCenter(); + this._centerObject(object, new fabric.Point(vpCenter.x, object.getCenterPoint().y)); + return this; + }, + + /** + * Centers object Vertically in the viewport, object.top is unchanged + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + viewportCenterObjectV: function(object) { + var vpCenter = this.getVpCenter(); + + return this._centerObject(object, new fabric.Point(object.getCenterPoint().x, vpCenter.y)); + }, + + /** + * Calculate the point in canvas that correspond to the center of actual viewport. + * @return {fabric.Point} vpCenter, viewport center + * @chainable + */ + getVpCenter: function() { + var center = this.getCenter(), + iVpt = invertTransform(this.viewportTransform); + return transformPoint({ x: center.left, y: center.top }, iVpt); + }, + + /** + * @private + * @param {fabric.Object} object Object to center + * @param {fabric.Point} center Center point + * @return {fabric.Canvas} thisArg + * @chainable + */ + _centerObject: function(object, center) { + object.setPositionByOrigin(center, 'center', 'center'); + object.setCoords(); + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Returs dataless JSON representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} json string + */ + toDatalessJSON: function (propertiesToInclude) { + return this.toDatalessObject(propertiesToInclude); + }, + + /** + * Returns object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function (propertiesToInclude) { + return this._toObjectMethod('toObject', propertiesToInclude); + }, + + /** + * Returns dataless object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function (propertiesToInclude) { + return this._toObjectMethod('toDatalessObject', propertiesToInclude); + }, + + /** + * @private + */ + _toObjectMethod: function (methodName, propertiesToInclude) { + + var clipPath = this.clipPath, data = { + version: fabric.version, + objects: this._toObjects(methodName, propertiesToInclude), + }; + if (clipPath) { + data.clipPath = this._toObject(this.clipPath, methodName, propertiesToInclude); + } + extend(data, this.__serializeBgOverlay(methodName, propertiesToInclude)); + + fabric.util.populateWithProperties(this, data, propertiesToInclude); + + return data; + }, + + /** + * @private + */ + _toObjects: function(methodName, propertiesToInclude) { + return this._objects.filter(function(object) { + return !object.excludeFromExport; + }).map(function(instance) { + return this._toObject(instance, methodName, propertiesToInclude); + }, this); + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + var originalValue; + + if (!this.includeDefaultValues) { + originalValue = instance.includeDefaultValues; + instance.includeDefaultValues = false; + } + + var object = instance[methodName](propertiesToInclude); + if (!this.includeDefaultValues) { + instance.includeDefaultValues = originalValue; + } + return object; + }, + + /** + * @private + */ + __serializeBgOverlay: function(methodName, propertiesToInclude) { + var data = { }, bgImage = this.backgroundImage, overlay = this.overlayImage; + + if (this.backgroundColor) { + data.background = this.backgroundColor.toObject + ? this.backgroundColor.toObject(propertiesToInclude) + : this.backgroundColor; + } + + if (this.overlayColor) { + data.overlay = this.overlayColor.toObject + ? this.overlayColor.toObject(propertiesToInclude) + : this.overlayColor; + } + if (bgImage && !bgImage.excludeFromExport) { + data.backgroundImage = this._toObject(bgImage, methodName, propertiesToInclude); + } + if (overlay && !overlay.excludeFromExport) { + data.overlayImage = this._toObject(overlay, methodName, propertiesToInclude); + } + + return data; + }, + + /* _TO_SVG_START_ */ + /** + * When true, getSvgTransform() will apply the StaticCanvas.viewportTransform to the SVG transformation. When true, + * a zoomed canvas will then produce zoomed SVG output. + * @type Boolean + * @default + */ + svgViewportTransformation: true, + + /** + * Returns SVG representation of canvas + * @function + * @param {Object} [options] Options object for SVG output + * @param {Boolean} [options.suppressPreamble=false] If true xml tag is not included + * @param {Object} [options.viewBox] SVG viewbox object + * @param {Number} [options.viewBox.x] x-cooridnate of viewbox + * @param {Number} [options.viewBox.y] y-coordinate of viewbox + * @param {Number} [options.viewBox.width] Width of viewbox + * @param {Number} [options.viewBox.height] Height of viewbox + * @param {String} [options.encoding=UTF-8] Encoding of SVG output + * @param {String} [options.width] desired width of svg with or without units + * @param {String} [options.height] desired height of svg with or without units + * @param {Function} [reviver] Method for further parsing of svg elements, called after each fabric object converted into svg representation. + * @return {String} SVG string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization} + * @see {@link http://jsfiddle.net/fabricjs/jQ3ZZ/|jsFiddle demo} + * @example Normal SVG output + * var svg = canvas.toSVG(); + * @example SVG output without preamble (without <?xml ../>) + * var svg = canvas.toSVG({suppressPreamble: true}); + * @example SVG output with viewBox attribute + * var svg = canvas.toSVG({ + * viewBox: { + * x: 100, + * y: 100, + * width: 200, + * height: 300 + * } + * }); + * @example SVG output with different encoding (default: UTF-8) + * var svg = canvas.toSVG({encoding: 'ISO-8859-1'}); + * @example Modify SVG output with reviver function + * var svg = canvas.toSVG(null, function(svg) { + * return svg.replace('stroke-dasharray: ; stroke-linecap: butt; stroke-linejoin: miter; stroke-miterlimit: 10; ', ''); + * }); + */ + toSVG: function(options, reviver) { + options || (options = { }); + options.reviver = reviver; + var markup = []; + + this._setSVGPreamble(markup, options); + this._setSVGHeader(markup, options); + if (this.clipPath) { + markup.push('\n'); + } + this._setSVGBgOverlayColor(markup, 'background'); + this._setSVGBgOverlayImage(markup, 'backgroundImage', reviver); + this._setSVGObjects(markup, reviver); + if (this.clipPath) { + markup.push('\n'); + } + this._setSVGBgOverlayColor(markup, 'overlay'); + this._setSVGBgOverlayImage(markup, 'overlayImage', reviver); + + markup.push(''); + + return markup.join(''); + }, + + /** + * @private + */ + _setSVGPreamble: function(markup, options) { + if (options.suppressPreamble) { + return; + } + markup.push( + '\n', + '\n' + ); + }, + + /** + * @private + */ + _setSVGHeader: function(markup, options) { + var width = options.width || this.width, + height = options.height || this.height, + vpt, viewBox = 'viewBox="0 0 ' + this.width + ' ' + this.height + '" ', + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + + if (options.viewBox) { + viewBox = 'viewBox="' + + options.viewBox.x + ' ' + + options.viewBox.y + ' ' + + options.viewBox.width + ' ' + + options.viewBox.height + '" '; + } + else { + if (this.svgViewportTransformation) { + vpt = this.viewportTransform; + viewBox = 'viewBox="' + + toFixed(-vpt[4] / vpt[0], NUM_FRACTION_DIGITS) + ' ' + + toFixed(-vpt[5] / vpt[3], NUM_FRACTION_DIGITS) + ' ' + + toFixed(this.width / vpt[0], NUM_FRACTION_DIGITS) + ' ' + + toFixed(this.height / vpt[3], NUM_FRACTION_DIGITS) + '" '; + } + } + + markup.push( + '\n', + 'Created with Fabric.js ', fabric.version, '\n', + '\n', + this.createSVGFontFacesMarkup(), + this.createSVGRefElementsMarkup(), + this.createSVGClipPathMarkup(options), + '\n' + ); + }, + + createSVGClipPathMarkup: function(options) { + var clipPath = this.clipPath; + if (clipPath) { + clipPath.clipPathId = 'CLIPPATH_' + fabric.Object.__uid++; + return '\n' + + this.clipPath.toClipPathSVG(options.reviver) + + '\n'; + } + return ''; + }, + + /** + * Creates markup containing SVG referenced elements like patterns, gradients etc. + * @return {String} + */ + createSVGRefElementsMarkup: function() { + var _this = this, + markup = ['background', 'overlay'].map(function(prop) { + var fill = _this[prop + 'Color']; + if (fill && fill.toLive) { + var shouldTransform = _this[prop + 'Vpt'], vpt = _this.viewportTransform, + object = { + width: _this.width / (shouldTransform ? vpt[0] : 1), + height: _this.height / (shouldTransform ? vpt[3] : 1) + }; + return fill.toSVG( + object, + { additionalTransform: shouldTransform ? fabric.util.matrixToSVG(vpt) : '' } + ); + } + }); + return markup.join(''); + }, + + /** + * Creates markup containing SVG font faces, + * font URLs for font faces must be collected by developers + * and are not extracted from the DOM by fabricjs + * @param {Array} objects Array of fabric objects + * @return {String} + */ + createSVGFontFacesMarkup: function() { + var markup = '', fontList = { }, obj, fontFamily, + style, row, rowIndex, _char, charIndex, i, len, + fontPaths = fabric.fontPaths, objects = this._objects; + + for (i = 0, len = objects.length; i < len; i++) { + obj = objects[i]; + fontFamily = obj.fontFamily; + if (obj.type.indexOf('text') === -1 || fontList[fontFamily] || !fontPaths[fontFamily]) { + continue; + } + fontList[fontFamily] = true; + if (!obj.styles) { + continue; + } + style = obj.styles; + for (rowIndex in style) { + row = style[rowIndex]; + for (charIndex in row) { + _char = row[charIndex]; + fontFamily = _char.fontFamily; + if (!fontList[fontFamily] && fontPaths[fontFamily]) { + fontList[fontFamily] = true; + } + } + } + } + + for (var j in fontList) { + markup += [ + '\t\t@font-face {\n', + '\t\t\tfont-family: \'', j, '\';\n', + '\t\t\tsrc: url(\'', fontPaths[j], '\');\n', + '\t\t}\n' + ].join(''); + } + + if (markup) { + markup = [ + '\t\n' + ].join(''); + } + + return markup; + }, + + /** + * @private + */ + _setSVGObjects: function(markup, reviver) { + var instance, i, len, objects = this._objects; + for (i = 0, len = objects.length; i < len; i++) { + instance = objects[i]; + if (instance.excludeFromExport) { + continue; + } + this._setSVGObject(markup, instance, reviver); + } + }, + + /** + * @private + */ + _setSVGObject: function(markup, instance, reviver) { + markup.push(instance.toSVG(reviver)); + }, + + /** + * @private + */ + _setSVGBgOverlayImage: function(markup, property, reviver) { + if (this[property] && !this[property].excludeFromExport && this[property].toSVG) { + markup.push(this[property].toSVG(reviver)); + } + }, + + /** + * @private + */ + _setSVGBgOverlayColor: function(markup, property) { + var filler = this[property + 'Color'], vpt = this.viewportTransform, finalWidth = this.width, + finalHeight = this.height; + if (!filler) { + return; + } + if (filler.toLive) { + var repeat = filler.repeat, iVpt = fabric.util.invertTransform(vpt), shouldInvert = this[property + 'Vpt'], + additionalTransform = shouldInvert ? fabric.util.matrixToSVG(iVpt) : ''; + markup.push( + '\n' + ); + } + else { + markup.push( + '\n' + ); + } + }, + /* _TO_SVG_END_ */ + + /** + * Moves an object or the objects of a multiple selection + * to the bottom of the stack of drawn objects + * @param {fabric.Object} object Object to send to back + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendToBack: function (object) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, objs; + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = objs.length; i--;) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.unshift(obj); + } + } + else { + removeFromArray(this._objects, object); + this._objects.unshift(object); + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Moves an object or the objects of a multiple selection + * to the top of the stack of drawn objects + * @param {fabric.Object} object Object to send + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringToFront: function (object) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, objs; + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + removeFromArray(this._objects, obj); + this._objects.push(obj); + } + } + else { + removeFromArray(this._objects, object); + this._objects.push(object); + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * Moves an object or a selection down in stack of drawn objects + * An optional paramter, intersecting allowes to move the object in behind + * the first intersecting object. Where intersection is calculated with + * bounding box. If no intersection is found, there will not be change in the + * stack. + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendBackwards: function (object, intersecting) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, idx, newIdx, objs, objsMoved = 0; + + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = 0; i < objs.length; i++) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx > 0 + objsMoved) { + newIdx = idx - 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + objsMoved++; + } + } + else { + idx = this._objects.indexOf(object); + if (idx !== 0) { + // if object is not on the bottom of stack + newIdx = this._findNewLowerIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * @private + */ + _findNewLowerIndex: function(object, idx, intersecting) { + var newIdx, i; + + if (intersecting) { + newIdx = idx; + + // traverse down the stack looking for the nearest intersecting object + for (i = idx - 1; i >= 0; --i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx - 1; + } + + return newIdx; + }, + + /** + * Moves an object or a selection up in stack of drawn objects + * An optional paramter, intersecting allowes to move the object in front + * of the first intersecting object. Where intersection is calculated with + * bounding box. If no intersection is found, there will not be change in the + * stack. + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringForward: function (object, intersecting) { + if (!object) { + return this; + } + var activeSelection = this._activeObject, + i, obj, idx, newIdx, objs, objsMoved = 0; + + if (object === activeSelection && object.type === 'activeSelection') { + objs = activeSelection._objects; + for (i = objs.length; i--;) { + obj = objs[i]; + idx = this._objects.indexOf(obj); + if (idx < this._objects.length - 1 - objsMoved) { + newIdx = idx + 1; + removeFromArray(this._objects, obj); + this._objects.splice(newIdx, 0, obj); + } + objsMoved++; + } + } + else { + idx = this._objects.indexOf(object); + if (idx !== this._objects.length - 1) { + // if object is not on top of stack (last item in an array) + newIdx = this._findNewUpperIndex(object, idx, intersecting); + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + } + } + this.renderOnAddRemove && this.requestRenderAll(); + return this; + }, + + /** + * @private + */ + _findNewUpperIndex: function(object, idx, intersecting) { + var newIdx, i, len; + + if (intersecting) { + newIdx = idx; + + // traverse up the stack looking for the nearest intersecting object + for (i = idx + 1, len = this._objects.length; i < len; ++i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx + 1; + } + + return newIdx; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Number} index Position to move to + * @return {fabric.Canvas} thisArg + * @chainable + */ + moveTo: function (object, index) { + removeFromArray(this._objects, object); + this._objects.splice(index, 0, object); + return this.renderOnAddRemove && this.requestRenderAll(); + }, + + /** + * Clears a canvas element and dispose objects + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + // cancel eventually ongoing renders + if (this.isRendering) { + fabric.util.cancelAnimFrame(this.isRendering); + this.isRendering = 0; + } + this.forEachObject(function(object) { + object.dispose && object.dispose(); + }); + this._objects = []; + if (this.backgroundImage && this.backgroundImage.dispose) { + this.backgroundImage.dispose(); + } + this.backgroundImage = null; + if (this.overlayImage && this.overlayImage.dispose) { + this.overlayImage.dispose(); + } + this.overlayImage = null; + this._iTextInstances = null; + this.contextContainer = null; + fabric.util.cleanUpJsdomNode(this.lowerCanvasEl); + this.lowerCanvasEl = undefined; + return this; + }, + + /** + * Returns a string representation of an instance + * @return {String} string representation of an instance + */ + toString: function () { + return '#'; + } + }); + + extend(fabric.StaticCanvas.prototype, fabric.Observable); + extend(fabric.StaticCanvas.prototype, fabric.Collection); + extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter); + + extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ { + + /** + * @static + * @type String + * @default + */ + EMPTY_JSON: '{"objects": [], "background": "white"}', + + /** + * Provides a way to check support of some of the canvas methods + * (either those of HTMLCanvasElement itself, or rendering context) + * + * @param {String} methodName Method to check support for; + * Could be one of "setLineDash" + * @return {Boolean | null} `true` if method is supported (or at least exists), + * `null` if canvas element or context can not be initialized + */ + supports: function (methodName) { + var el = createCanvasElement(); + + if (!el || !el.getContext) { + return null; + } + + var ctx = el.getContext('2d'); + if (!ctx) { + return null; + } + + switch (methodName) { + + case 'setLineDash': + return typeof ctx.setLineDash !== 'undefined'; + + default: + return null; + } + } + }); + + /** + * Returns JSON representation of canvas + * @function + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} JSON string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#serialization} + * @see {@link http://jsfiddle.net/fabricjs/pec86/|jsFiddle demo} + * @example JSON without additional properties + * var json = canvas.toJSON(); + * @example JSON with additional properties included + * var json = canvas.toJSON(['lockMovementX', 'lockMovementY', 'lockRotation', 'lockScalingX', 'lockScalingY', 'lockUniScaling']); + * @example JSON without default values + * canvas.includeDefaultValues = false; + * var json = canvas.toJSON(); + */ + fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject; + + if (fabric.isLikelyNode) { + fabric.StaticCanvas.prototype.createPNGStream = function() { + var impl = getNodeCanvas(this.lowerCanvasEl); + return impl && impl.createPNGStream(); + }; + fabric.StaticCanvas.prototype.createJPEGStream = function(opts) { + var impl = getNodeCanvas(this.lowerCanvasEl); + return impl && impl.createJPEGStream(opts); + }; + } +})(); +/** + * BaseBrush class + * @class fabric.BaseBrush + * @see {@link http://fabricjs.com/freedrawing|Freedrawing demo} + */ +fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ { + + /** + * Color of a brush + * @type String + * @default + */ + color: 'rgb(0, 0, 0)', + + /** + * Width of a brush, has to be a Number, no string literals + * @type Number + * @default + */ + width: 1, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property replaces "shadowColor" (String), "shadowOffsetX" (Number), + * "shadowOffsetY" (Number) and "shadowBlur" (Number) since v1.2.12 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Line endings style of a brush (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'round', + + /** + * Corner style of a brush (one of "bevel", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'round', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of a brush's + * @type Number + * @default + */ + strokeMiterLimit: 10, + + /** + * Stroke Dash Array. + * @type Array + * @default + */ + strokeDashArray: null, + + /** + * Sets shadow of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Object} thisArg + * @chainable + */ + setShadow: function(options) { + this.shadow = new fabric.Shadow(options); + return this; + }, + + /** + * Sets brush styles + * @private + */ + _setBrushStyles: function() { + var ctx = this.canvas.contextTop; + ctx.strokeStyle = this.color; + ctx.lineWidth = this.width; + ctx.lineCap = this.strokeLineCap; + ctx.miterLimit = this.strokeMiterLimit; + ctx.lineJoin = this.strokeLineJoin; + if (fabric.StaticCanvas.supports('setLineDash')) { + ctx.setLineDash(this.strokeDashArray || []); + } + }, + + /** + * Sets the transformation on given context + * @param {RenderingContext2d} ctx context to render on + * @private + */ + _saveAndTransform: function(ctx) { + var v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + }, + + /** + * Sets brush shadow styles + * @private + */ + _setShadow: function() { + if (!this.shadow) { + return; + } + + var ctx = this.canvas.contextTop, + zoom = this.canvas.getZoom(); + + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur * zoom; + ctx.shadowOffsetX = this.shadow.offsetX * zoom; + ctx.shadowOffsetY = this.shadow.offsetY * zoom; + }, + + needsFullRender: function() { + var color = new fabric.Color(this.color); + return color.getAlpha() < 1 || !!this.shadow; + }, + + /** + * Removes brush shadow styles + * @private + */ + _resetShadow: function() { + var ctx = this.canvas.contextTop; + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + } +}); +(function() { + /** + * PencilBrush class + * @class fabric.PencilBrush + * @extends fabric.BaseBrush + */ + fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ { + + /** + * Discard points that are less than `decimate` pixel distant from each other + * @type Number + * @default 0.4 + */ + decimate: 0.4, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.PencilBrush} Instance of a pencil brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this._points = []; + }, + + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + _drawSegment: function (ctx, p1, p2) { + var midPoint = p1.midPointFrom(p2); + ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y); + return midPoint; + }, + + /** + * Inovoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer, options) { + if (!this.canvas._isMainEvent(options.e)) { + return; + } + this._prepareForDrawing(pointer); + // capture coordinates immediately + // this allows to draw dots (when movement never occurs) + this._captureDrawingPath(pointer); + this._render(); + }, + + /** + * Inovoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer, options) { + if (!this.canvas._isMainEvent(options.e)) { + return; + } + if (this._captureDrawingPath(pointer) && this._points.length > 1) { + if (this.needsFullRender()) { + // redraw curve + // clear top canvas + this.canvas.clearContext(this.canvas.contextTop); + this._render(); + } + else { + var points = this._points, length = points.length, ctx = this.canvas.contextTop; + // draw the curve update + this._saveAndTransform(ctx); + if (this.oldEnd) { + ctx.beginPath(); + ctx.moveTo(this.oldEnd.x, this.oldEnd.y); + } + this.oldEnd = this._drawSegment(ctx, points[length - 2], points[length - 1], true); + ctx.stroke(); + ctx.restore(); + } + } + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function(options) { + if (!this.canvas._isMainEvent(options.e)) { + return true; + } + this.oldEnd = undefined; + this._finalizeAndAddPath(); + return false; + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _prepareForDrawing: function(pointer) { + + var p = new fabric.Point(pointer.x, pointer.y); + + this._reset(); + this._addPoint(p); + this.canvas.contextTop.moveTo(p.x, p.y); + }, + + /** + * @private + * @param {fabric.Point} point Point to be added to points array + */ + _addPoint: function(point) { + if (this._points.length > 1 && point.eq(this._points[this._points.length - 1])) { + return false; + } + this._points.push(point); + return true; + }, + + /** + * Clear points array and set contextTop canvas style. + * @private + */ + _reset: function() { + this._points = []; + this._setBrushStyles(); + this._setShadow(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _captureDrawingPath: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y); + return this._addPoint(pointerPoint); + }, + + /** + * Draw a smooth path on the topCanvas using quadraticCurveTo + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, i, len, + p1 = this._points[0], + p2 = this._points[1]; + + this._saveAndTransform(ctx); + ctx.beginPath(); + //if we only have 2 points in the path and they are the same + //it means that the user only clicked the canvas without moving the mouse + //then we should be drawing a dot. A path isn't drawn between two identical dots + //that's why we set them apart a bit + if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) { + var width = this.width / 1000; + p1 = new fabric.Point(p1.x, p1.y); + p2 = new fabric.Point(p2.x, p2.y); + p1.x -= width; + p2.x += width; + } + ctx.moveTo(p1.x, p1.y); + + for (i = 1, len = this._points.length; i < len; i++) { + // we pick the point between pi + 1 & pi + 2 as the + // end point and p1 as our control point. + this._drawSegment(ctx, p1, p2); + p1 = this._points[i]; + p2 = this._points[i + 1]; + } + // Draw last line as a straight line while + // we wait for the next point to be able to calculate + // the bezier control point + ctx.lineTo(p1.x, p1.y); + ctx.stroke(); + ctx.restore(); + }, + + /** + * Converts points to SVG path + * @param {Array} points Array of points + * @return {String} SVG path + */ + convertPointsToSVGPath: function(points) { + var path = [], i, width = this.width / 1000, + p1 = new fabric.Point(points[0].x, points[0].y), + p2 = new fabric.Point(points[1].x, points[1].y), + len = points.length, multSignX = 1, multSignY = 0, manyPoints = len > 2; + + if (manyPoints) { + multSignX = points[2].x < p2.x ? -1 : points[2].x === p2.x ? 0 : 1; + multSignY = points[2].y < p2.y ? -1 : points[2].y === p2.y ? 0 : 1; + } + path.push('M ', p1.x - multSignX * width, ' ', p1.y - multSignY * width, ' '); + for (i = 1; i < len; i++) { + if (!p1.eq(p2)) { + var midPoint = p1.midPointFrom(p2); + // p1 is our bezier control point + // midpoint is our endpoint + // start point is p(i-1) value. + path.push('Q ', p1.x, ' ', p1.y, ' ', midPoint.x, ' ', midPoint.y, ' '); + } + p1 = points[i]; + if ((i + 1) < points.length) { + p2 = points[i + 1]; + } + } + if (manyPoints) { + multSignX = p1.x > points[i - 2].x ? 1 : p1.x === points[i - 2].x ? 0 : -1; + multSignY = p1.y > points[i - 2].y ? 1 : p1.y === points[i - 2].y ? 0 : -1; + } + path.push('L ', p1.x + multSignX * width, ' ', p1.y + multSignY * width); + return path; + }, + + /** + * Creates fabric.Path object to add on canvas + * @param {String} pathData Path data + * @return {fabric.Path} Path to add on canvas + */ + createPath: function(pathData) { + var path = new fabric.Path(pathData, { + fill: null, + stroke: this.color, + strokeWidth: this.width, + strokeLineCap: this.strokeLineCap, + strokeMiterLimit: this.strokeMiterLimit, + strokeLineJoin: this.strokeLineJoin, + strokeDashArray: this.strokeDashArray, + }); + if (this.shadow) { + this.shadow.affectStroke = true; + path.setShadow(this.shadow); + } + + return path; + }, + + /** + * Decimate poins array with the decimate value + */ + decimatePoints: function(points, distance) { + if (points.length <= 2) { + return points; + } + var zoom = this.canvas.getZoom(), adjustedDistance = Math.pow(distance / zoom, 2), + i, l = points.length - 1, lastPoint = points[0], newPoints = [lastPoint], + cDistance; + for (i = 1; i < l; i++) { + cDistance = Math.pow(lastPoint.x - points[i].x, 2) + Math.pow(lastPoint.y - points[i].y, 2); + if (cDistance >= adjustedDistance) { + lastPoint = points[i]; + newPoints.push(lastPoint); + } + } + if (newPoints.length === 1) { + newPoints.push(new fabric.Point(newPoints[0].x, newPoints[0].y)); + } + return newPoints; + }, + + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: function() { + var ctx = this.canvas.contextTop; + ctx.closePath(); + if (this.decimate) { + this._points = this.decimatePoints(this._points, this.decimate); + } + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.requestRenderAll(); + return; + } + + var path = this.createPath(pathData); + this.canvas.clearContext(this.canvas.contextTop); + this.canvas.add(path); + this.canvas.renderAll(); + path.setCoords(); + this._resetShadow(); + + + // fire event 'path' created + this.canvas.fire('path:created', { path: path }); + } + }); +})(); +/** + * CircleBrush class + * @class fabric.CircleBrush + */ +fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ { + + /** + * Width of a brush + * @type Number + * @default + */ + width: 10, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.CircleBrush} Instance of a circle brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.points = []; + }, + + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + drawDot: function(pointer) { + var point = this.addPoint(pointer), + ctx = this.canvas.contextTop; + this._saveAndTransform(ctx); + this.dot(ctx, point); + ctx.restore(); + }, + + dot: function(ctx, point) { + ctx.fillStyle = point.fill; + ctx.beginPath(); + ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false); + ctx.closePath(); + ctx.fill(); + }, + + /** + * Invoked on mouse down + */ + onMouseDown: function(pointer) { + this.points.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.drawDot(pointer); + }, + + /** + * Render the full state of the brush + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, i, len, + points = this.points; + this._saveAndTransform(ctx); + for (i = 0, len = points.length; i < len; i++) { + this.dot(ctx, points[i]); + } + ctx.restore(); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + if (this.needsFullRender()) { + this.canvas.clearContext(this.canvas.contextTop); + this.addPoint(pointer); + this._render(); + } + else { + this.drawDot(pointer); + } + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove, i, len; + this.canvas.renderOnAddRemove = false; + + var circles = []; + + for (i = 0, len = this.points.length; i < len; i++) { + var point = this.points[i], + circle = new fabric.Circle({ + radius: point.radius, + left: point.x, + top: point.y, + originX: 'center', + originY: 'center', + fill: point.fill + }); + + this.shadow && circle.setShadow(this.shadow); + + circles.push(circle); + } + var group = new fabric.Group(circles); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.requestRenderAll(); + }, + + /** + * @param {Object} pointer + * @return {fabric.Point} Just added pointer point + */ + addPoint: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y), + + circleRadius = fabric.util.getRandomInt( + Math.max(0, this.width - 20), this.width + 20) / 2, + + circleColor = new fabric.Color(this.color) + .setAlpha(fabric.util.getRandomInt(0, 100) / 100) + .toRgba(); + + pointerPoint.radius = circleRadius; + pointerPoint.fill = circleColor; + + this.points.push(pointerPoint); + + return pointerPoint; + } +}); +/** + * SprayBrush class + * @class fabric.SprayBrush + */ +fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ { + + /** + * Width of a spray + * @type Number + * @default + */ + width: 10, + + /** + * Density of a spray (number of dots per chunk) + * @type Number + * @default + */ + density: 20, + + /** + * Width of spray dots + * @type Number + * @default + */ + dotWidth: 1, + + /** + * Width variance of spray dots + * @type Number + * @default + */ + dotWidthVariance: 1, + + /** + * Whether opacity of a dot should be random + * @type Boolean + * @default + */ + randomOpacity: false, + + /** + * Whether overlapping dots (rectangles) should be removed (for performance reasons) + * @type Boolean + * @default + */ + optimizeOverlapping: true, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.SprayBrush} Instance of a spray brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.sprayChunks = []; + }, + + /** + * Invoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this.sprayChunks.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + + this.addSprayChunk(pointer); + this.render(this.sprayChunkPoints); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.addSprayChunk(pointer); + this.render(this.sprayChunkPoints); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var rects = []; + + for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + var sprayChunk = this.sprayChunks[i]; + + for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) { + + var rect = new fabric.Rect({ + width: sprayChunk[j].width, + height: sprayChunk[j].width, + left: sprayChunk[j].x + 1, + top: sprayChunk[j].y + 1, + originX: 'center', + originY: 'center', + fill: this.color + }); + rects.push(rect); + } + } + + if (this.optimizeOverlapping) { + rects = this._getOptimizedRects(rects); + } + + var group = new fabric.Group(rects); + this.shadow && group.setShadow(this.shadow); + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.requestRenderAll(); + }, + + /** + * @private + * @param {Array} rects + */ + _getOptimizedRects: function(rects) { + + // avoid creating duplicate rects at the same coordinates + var uniqueRects = { }, key, i, len; + + for (i = 0, len = rects.length; i < len; i++) { + key = rects[i].left + '' + rects[i].top; + if (!uniqueRects[key]) { + uniqueRects[key] = rects[i]; + } + } + var uniqueRectsArray = []; + for (key in uniqueRects) { + uniqueRectsArray.push(uniqueRects[key]); + } + + return uniqueRectsArray; + }, + + /** + * Render new chunk of spray brush + */ + render: function(sprayChunk) { + var ctx = this.canvas.contextTop, i, len; + ctx.fillStyle = this.color; + + this._saveAndTransform(ctx); + + for (i = 0, len = sprayChunk.length; i < len; i++) { + var point = sprayChunk[i]; + if (typeof point.opacity !== 'undefined') { + ctx.globalAlpha = point.opacity; + } + ctx.fillRect(point.x, point.y, point.width, point.width); + } + ctx.restore(); + }, + + /** + * Render all spray chunks + */ + _render: function() { + var ctx = this.canvas.contextTop, i, ilen; + ctx.fillStyle = this.color; + + this._saveAndTransform(ctx); + + for (i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + this.render(this.sprayChunks[i]); + } + ctx.restore(); + }, + + /** + * @param {Object} pointer + */ + addSprayChunk: function(pointer) { + this.sprayChunkPoints = []; + + var x, y, width, radius = this.width / 2, i; + + for (i = 0; i < this.density; i++) { + + x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius); + y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius); + + if (this.dotWidthVariance) { + width = fabric.util.getRandomInt( + // bottom clamp width to 1 + Math.max(1, this.dotWidth - this.dotWidthVariance), + this.dotWidth + this.dotWidthVariance); + } + else { + width = this.dotWidth; + } + + var point = new fabric.Point(x, y); + point.width = width; + + if (this.randomOpacity) { + point.opacity = fabric.util.getRandomInt(0, 100) / 100; + } + + this.sprayChunkPoints.push(point); + } + + this.sprayChunks.push(this.sprayChunkPoints); + } +}); +/** + * PatternBrush class + * @class fabric.PatternBrush + * @extends fabric.BaseBrush + */ +fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ { + + getPatternSrc: function() { + + var dotWidth = 20, + dotDistance = 5, + patternCanvas = fabric.util.createCanvasElement(), + patternCtx = patternCanvas.getContext('2d'); + + patternCanvas.width = patternCanvas.height = dotWidth + dotDistance; + + patternCtx.fillStyle = this.color; + patternCtx.beginPath(); + patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false); + patternCtx.closePath(); + patternCtx.fill(); + + return patternCanvas; + }, + + getPatternSrcFunction: function() { + return String(this.getPatternSrc).replace('this.color', '"' + this.color + '"'); + }, + + /** + * Creates "pattern" instance property + */ + getPattern: function() { + return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat'); + }, + + /** + * Sets brush styles + */ + _setBrushStyles: function() { + this.callSuper('_setBrushStyles'); + this.canvas.contextTop.strokeStyle = this.getPattern(); + }, + + /** + * Creates path + */ + createPath: function(pathData) { + var path = this.callSuper('createPath', pathData), + topLeft = path._getLeftTopCoords().scalarAdd(path.strokeWidth / 2); + + path.stroke = new fabric.Pattern({ + source: this.source || this.getPatternSrcFunction(), + offsetX: -topLeft.x, + offsetY: -topLeft.y + }); + return path; + } +}); +(function() { + + var getPointer = fabric.util.getPointer, + degreesToRadians = fabric.util.degreesToRadians, + radiansToDegrees = fabric.util.radiansToDegrees, + atan2 = Math.atan2, + abs = Math.abs, + supportLineDash = fabric.StaticCanvas.supports('setLineDash'), + + STROKE_OFFSET = 0.5; + + /** + * Canvas class + * @class fabric.Canvas + * @extends fabric.StaticCanvas + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#canvas} + * @see {@link fabric.Canvas#initialize} for constructor definition + * + * @fires object:modified + * @fires object:rotated + * @fires object:scaled + * @fires object:moved + * @fires object:skewed + * @fires object:rotating + * @fires object:scaling + * @fires object:moving + * @fires object:skewing + * @fires object:selected this event is deprecated. use selection:created + * + * @fires before:transform + * @fires before:selection:cleared + * @fires selection:cleared + * @fires selection:updated + * @fires selection:created + * + * @fires path:created + * @fires mouse:down + * @fires mouse:move + * @fires mouse:up + * @fires mouse:down:before + * @fires mouse:move:before + * @fires mouse:up:before + * @fires mouse:over + * @fires mouse:out + * @fires mouse:dblclick + * + * @fires dragover + * @fires dragenter + * @fires dragleave + * @fires drop + * + */ + fabric.Canvas = fabric.util.createClass(fabric.StaticCanvas, /** @lends fabric.Canvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + this.renderAndResetBound = this.renderAndReset.bind(this); + this.requestRenderAllBound = this.requestRenderAll.bind(this); + this._initStatic(el, options); + this._initInteractive(); + this._createCacheCanvas(); + }, + + /** + * When true, objects can be transformed by one side (unproportionally) + * @type Boolean + * @default + */ + uniScaleTransform: false, + + /** + * Indicates which key enable unproportional scaling + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled feature disabled. + * @since 1.6.2 + * @type String + * @default + */ + uniScaleKey: 'shiftKey', + + /** + * When true, objects use center point as the origin of scale transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, objects use center point as the origin of rotate transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: false, + + /** + * Indicates which key enable centered Transform + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled feature disabled. + * @since 1.6.2 + * @type String + * @default + */ + centeredKey: 'altKey', + + /** + * Indicates which key enable alternate action on corner + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled feature disabled. + * @since 1.6.2 + * @type String + * @default + */ + altActionKey: 'shiftKey', + + /** + * Indicates that canvas is interactive. This property should not be changed. + * @type Boolean + * @default + */ + interactive: true, + + /** + * Indicates whether group selection should be enabled + * @type Boolean + * @default + */ + selection: true, + + /** + * Indicates which key or keys enable multiple click selection + * Pass value as a string or array of strings + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * If `null` or empty or containing any other string that is not a modifier key + * feature is disabled. + * @since 1.6.2 + * @type String|Array + * @default + */ + selectionKey: 'shiftKey', + + /** + * Indicates which key enable alternative selection + * in case of target overlapping with active object + * values: 'altKey', 'shiftKey', 'ctrlKey'. + * For a series of reason that come from the general expectations on how + * things should work, this feature works only for preserveObjectStacking true. + * If `null` or 'none' or any other string that is not a modifier key + * feature is disabled. + * @since 1.6.5 + * @type null|String + * @default + */ + altSelectionKey: null, + + /** + * Color of selection + * @type String + * @default + */ + selectionColor: 'rgba(100, 100, 255, 0.3)', // blue + + /** + * Default dash array pattern + * If not empty the selection border is dashed + * @type Array + */ + selectionDashArray: [], + + /** + * Color of the border of selection (usually slightly darker than color of selection itself) + * @type String + * @default + */ + selectionBorderColor: 'rgba(255, 255, 255, 0.3)', + + /** + * Width of a line used in object/group selection + * @type Number + * @default + */ + selectionLineWidth: 1, + + /** + * Select only shapes that are fully contained in the dragged selection rectangle. + * @type Boolean + * @default + */ + selectionFullyContained: false, + + /** + * Default cursor value used when hovering over an object on canvas + * @type String + * @default + */ + hoverCursor: 'move', + + /** + * Default cursor value used when moving an object on canvas + * @type String + * @default + */ + moveCursor: 'move', + + /** + * Default cursor value used for the entire canvas + * @type String + * @default + */ + defaultCursor: 'default', + + /** + * Cursor value used during free drawing + * @type String + * @default + */ + freeDrawingCursor: 'crosshair', + + /** + * Cursor value used for rotation point + * @type String + * @default + */ + rotationCursor: 'crosshair', + + /** + * Cursor value used for disabled elements ( corners with disabled action ) + * @type String + * @since 2.0.0 + * @default + */ + notAllowedCursor: 'not-allowed', + + /** + * Default element class that's given to wrapper (div) element of canvas + * @type String + * @default + */ + containerClass: 'canvas-container', + + /** + * When true, object detection happens on per-pixel basis rather than on per-bounding-box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * Number of pixels around target pixel to tolerate (consider active) during object detection + * @type Number + * @default + */ + targetFindTolerance: 0, + + /** + * When true, target detection is skipped when hovering over canvas. This can be used to improve performance. + * @type Boolean + * @default + */ + skipTargetFind: false, + + /** + * When true, mouse events on canvas (mousedown/mousemove/mouseup) result in free drawing. + * After mousedown, mousemove creates a shape, + * and then mouseup finalizes it and adds an instance of `fabric.Path` onto canvas. + * @tutorial {@link http://fabricjs.com/fabric-intro-part-4#free_drawing} + * @type Boolean + * @default + */ + isDrawingMode: false, + + /** + * Indicates whether objects should remain in current stack position when selected. + * When false objects are brought to top and rendered as part of the selection group + * @type Boolean + * @default + */ + preserveObjectStacking: false, + + /** + * Indicates the angle that an object will lock to while rotating. + * @type Number + * @since 1.6.7 + * @default + */ + snapAngle: 0, + + /** + * Indicates the distance from the snapAngle the rotation will lock to the snapAngle. + * When `null`, the snapThreshold will default to the snapAngle. + * @type null|Number + * @since 1.6.7 + * @default + */ + snapThreshold: null, + + /** + * Indicates if the right click on canvas can output the context menu or not + * @type Boolean + * @since 1.6.5 + * @default + */ + stopContextMenu: false, + + /** + * Indicates if the canvas can fire right click events + * @type Boolean + * @since 1.6.5 + * @default + */ + fireRightClick: false, + + /** + * Indicates if the canvas can fire middle click events + * @type Boolean + * @since 1.7.8 + * @default + */ + fireMiddleClick: false, + + /** + * @private + */ + _initInteractive: function() { + this._currentTransform = null; + this._groupSelector = null; + this._initWrapperElement(); + this._createUpperCanvas(); + this._initEventListeners(); + + this._initRetinaScaling(); + + this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this); + + this.calcOffset(); + }, + + /** + * Divides objects in two groups, one to render immediately + * and one to render as activeGroup. + * @return {Array} objects to render immediately and pushes the other in the activeGroup. + */ + _chooseObjectsToRender: function() { + var activeObjects = this.getActiveObjects(), + object, objsToRender, activeGroupObjects; + + if (activeObjects.length > 0 && !this.preserveObjectStacking) { + objsToRender = []; + activeGroupObjects = []; + for (var i = 0, length = this._objects.length; i < length; i++) { + object = this._objects[i]; + if (activeObjects.indexOf(object) === -1 ) { + objsToRender.push(object); + } + else { + activeGroupObjects.push(object); + } + } + if (activeObjects.length > 1) { + this._activeObject._objects = activeGroupObjects; + } + objsToRender.push.apply(objsToRender, activeGroupObjects); + } + else { + objsToRender = this._objects; + } + return objsToRender; + }, + + /** + * Renders both the top canvas and the secondary container canvas. + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function () { + if (this.contextTopDirty && !this._groupSelector && !this.isDrawingMode) { + this.clearContext(this.contextTop); + this.contextTopDirty = false; + } + if (this.hasLostContext) { + this.renderTopLayer(this.contextTop); + } + var canvasToDrawOn = this.contextContainer; + this.renderCanvas(canvasToDrawOn, this._chooseObjectsToRender()); + return this; + }, + + renderTopLayer: function(ctx) { + ctx.save(); + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this.freeDrawingBrush && this.freeDrawingBrush._render(); + this.contextTopDirty = true; + } + // we render the top context - last object + if (this.selection && this._groupSelector) { + this._drawSelection(ctx); + this.contextTopDirty = true; + } + ctx.restore(); + }, + + /** + * Method to render only the top canvas. + * Also used to render the group selection box. + * @return {fabric.Canvas} thisArg + * @chainable + */ + renderTop: function () { + var ctx = this.contextTop; + this.clearContext(ctx); + this.renderTopLayer(ctx); + this.fire('after:render'); + return this; + }, + + /** + * Resets the current transform to its original values and chooses the type of resizing based on the event + * @private + */ + _resetCurrentTransform: function() { + var t = this._currentTransform; + + t.target.set({ + scaleX: t.original.scaleX, + scaleY: t.original.scaleY, + skewX: t.original.skewX, + skewY: t.original.skewY, + left: t.original.left, + top: t.original.top + }); + + if (this._shouldCenterTransform(t.target)) { + if (t.originX !== 'center') { + if (t.originX === 'right') { + t.mouseXSign = -1; + } + else { + t.mouseXSign = 1; + } + } + if (t.originY !== 'center') { + if (t.originY === 'bottom') { + t.mouseYSign = -1; + } + else { + t.mouseYSign = 1; + } + } + + t.originX = 'center'; + t.originY = 'center'; + } + else { + t.originX = t.original.originX; + t.originY = t.original.originY; + } + }, + + /** + * Checks if point is contained within an area of given object + * @param {Event} e Event object + * @param {fabric.Object} target Object to test against + * @param {Object} [point] x,y object of point coordinates we want to check. + * @return {Boolean} true if point is contained within an area of given object + */ + containsPoint: function (e, target, point) { + var ignoreZoom = true, + pointer = point || this.getPointer(e, ignoreZoom), + xy; + + if (target.group && target.group === this._activeObject && target.group.type === 'activeSelection') { + xy = this._normalizePointer(target.group, pointer); + } + else { + xy = { x: pointer.x, y: pointer.y }; + } + // http://www.geog.ubc.ca/courses/klink/gis.notes/ncgia/u32.html + // http://idav.ucdavis.edu/~okreylos/TAship/Spring2000/PointInPolygon.html + return (target.containsPoint(xy) || target._findTargetCorner(pointer)); + }, + + /** + * @private + */ + _normalizePointer: function (object, pointer) { + var m = object.calcTransformMatrix(), + invertedM = fabric.util.invertTransform(m), + vptPointer = this.restorePointerVpt(pointer); + return fabric.util.transformPoint(vptPointer, invertedM); + }, + + /** + * Returns true if object is transparent at a certain location + * @param {fabric.Object} target Object to check + * @param {Number} x Left coordinate + * @param {Number} y Top coordinate + * @return {Boolean} + */ + isTargetTransparent: function (target, x, y) { + // in case the target is the activeObject, we cannot execute this optimization + // because we need to draw controls too. + if (target.shouldCache() && target._cacheCanvas && target !== this._activeObject) { + var normalizedPointer = this._normalizePointer(target, {x: x, y: y}), + targetRelativeX = Math.max(target.cacheTranslationX + (normalizedPointer.x * target.zoomX), 0), + targetRelativeY = Math.max(target.cacheTranslationY + (normalizedPointer.y * target.zoomY), 0); + + var isTransparent = fabric.util.isTransparent( + target._cacheContext, Math.round(targetRelativeX), Math.round(targetRelativeY), this.targetFindTolerance); + + return isTransparent; + } + + var ctx = this.contextCache, + originalColor = target.selectionBackgroundColor, v = this.viewportTransform; + + target.selectionBackgroundColor = ''; + + this.clearContext(ctx); + + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + target.render(ctx); + ctx.restore(); + + target === this._activeObject && target._renderControls(ctx, { + hasBorders: false, + transparentCorners: false + }, { + hasBorders: false, + }); + + target.selectionBackgroundColor = originalColor; + + var isTransparent = fabric.util.isTransparent( + ctx, x, y, this.targetFindTolerance); + + return isTransparent; + }, + + /** + * takes an event and determins if selection key has been pressed + * @private + * @param {Event} e Event object + */ + _isSelectionKeyPressed: function(e) { + var selectionKeyPressed = false; + + if (Object.prototype.toString.call(this.selectionKey) === '[object Array]') { + selectionKeyPressed = !!this.selectionKey.find(function(key) { return e[key] === true; }); + } + else { + selectionKeyPressed = e[this.selectionKey]; + } + + return selectionKeyPressed; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _shouldClearSelection: function (e, target) { + var activeObjects = this.getActiveObjects(), + activeObject = this._activeObject; + + return ( + !target + || + (target && + activeObject && + activeObjects.length > 1 && + activeObjects.indexOf(target) === -1 && + activeObject !== target && + !this._isSelectionKeyPressed(e)) + || + (target && !target.evented) + || + (target && + !target.selectable && + activeObject && + activeObject !== target) + ); + }, + + /** + * centeredScaling from object can't override centeredScaling from canvas. + * this should be fixed, since object setting should take precedence over canvas. + * @private + * @param {fabric.Object} target + */ + _shouldCenterTransform: function (target) { + if (!target) { + return; + } + + var t = this._currentTransform, + centerTransform; + + if (t.action === 'scale' || t.action === 'scaleX' || t.action === 'scaleY') { + centerTransform = this.centeredScaling || target.centeredScaling; + } + else if (t.action === 'rotate') { + centerTransform = this.centeredRotation || target.centeredRotation; + } + + return centerTransform ? !t.altKey : t.altKey; + }, + + /** + * @private + */ + _getOriginFromCorner: function(target, corner) { + var origin = { + x: target.originX, + y: target.originY + }; + + if (corner === 'ml' || corner === 'tl' || corner === 'bl') { + origin.x = 'right'; + } + else if (corner === 'mr' || corner === 'tr' || corner === 'br') { + origin.x = 'left'; + } + + if (corner === 'tl' || corner === 'mt' || corner === 'tr') { + origin.y = 'bottom'; + } + else if (corner === 'bl' || corner === 'mb' || corner === 'br') { + origin.y = 'top'; + } + + return origin; + }, + + /** + * @private + * @param {Boolean} alreadySelected true if target is already selected + * @param {String} corner a string representing the corner ml, mr, tl ... + * @param {Event} e Event object + * @param {fabric.Object} [target] inserted back to help overriding. Unused + */ + _getActionFromCorner: function(alreadySelected, corner, e /* target */) { + if (!corner || !alreadySelected) { + return 'drag'; + } + + switch (corner) { + case 'mtr': + return 'rotate'; + case 'ml': + case 'mr': + return e[this.altActionKey] ? 'skewY' : 'scaleX'; + case 'mt': + case 'mb': + return e[this.altActionKey] ? 'skewX' : 'scaleY'; + default: + return 'scale'; + } + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _setupCurrentTransform: function (e, target, alreadySelected) { + if (!target) { + return; + } + + var pointer = this.getPointer(e), + corner = target._findTargetCorner(this.getPointer(e, true)), + action = this._getActionFromCorner(alreadySelected, corner, e, target), + origin = this._getOriginFromCorner(target, corner); + + this._currentTransform = { + target: target, + action: action, + corner: corner, + scaleX: target.scaleX, + scaleY: target.scaleY, + skewX: target.skewX, + skewY: target.skewY, + // used by transation + offsetX: pointer.x - target.left, + offsetY: pointer.y - target.top, + originX: origin.x, + originY: origin.y, + ex: pointer.x, + ey: pointer.y, + lastX: pointer.x, + lastY: pointer.y, + // unsure they are usefull anymore. + // left: target.left, + // top: target.top, + theta: degreesToRadians(target.angle), + // end of unsure + width: target.width * target.scaleX, + mouseXSign: 1, + mouseYSign: 1, + shiftKey: e.shiftKey, + altKey: e[this.centeredKey], + original: fabric.util.saveObjectTransform(target), + }; + + this._currentTransform.original.originX = origin.x; + this._currentTransform.original.originY = origin.y; + + this._resetCurrentTransform(); + this._beforeTransform(e); + }, + + /** + * Translates object by "setting" its left/top + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @return {Boolean} true if the translation occurred + */ + _translateObject: function (x, y) { + var transform = this._currentTransform, + target = transform.target, + newLeft = x - transform.offsetX, + newTop = y - transform.offsetY, + moveX = !target.get('lockMovementX') && target.left !== newLeft, + moveY = !target.get('lockMovementY') && target.top !== newTop; + + moveX && target.set('left', newLeft); + moveY && target.set('top', newTop); + return moveX || moveY; + }, + + /** + * Check if we are increasing a positive skew or lower it, + * checking mouse direction and pressed corner. + * @private + */ + _changeSkewTransformOrigin: function(mouseMove, t, by) { + var property = 'originX', origins = { 0: 'center' }, + skew = t.target.skewX, originA = 'left', originB = 'right', + corner = t.corner === 'mt' || t.corner === 'ml' ? 1 : -1, + flipSign = 1; + + mouseMove = mouseMove > 0 ? 1 : -1; + if (by === 'y') { + skew = t.target.skewY; + originA = 'top'; + originB = 'bottom'; + property = 'originY'; + } + origins[-1] = originA; + origins[1] = originB; + + t.target.flipX && (flipSign *= -1); + t.target.flipY && (flipSign *= -1); + + if (skew === 0) { + t.skewSign = -corner * mouseMove * flipSign; + t[property] = origins[-mouseMove]; + } + else { + skew = skew > 0 ? 1 : -1; + t.skewSign = skew; + t[property] = origins[skew * corner * flipSign]; + } + }, + + /** + * Skew object by mouse events + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @param {String} by Either 'x' or 'y' + * @return {Boolean} true if the skewing occurred + */ + _skewObject: function (x, y, by) { + var t = this._currentTransform, + target = t.target, skewed = false, + lockSkewingX = target.get('lockSkewingX'), + lockSkewingY = target.get('lockSkewingY'); + + if ((lockSkewingX && by === 'x') || (lockSkewingY && by === 'y')) { + return false; + } + + // Get the constraint point + var center = target.getCenterPoint(), + actualMouseByCenter = target.toLocalPoint(new fabric.Point(x, y), 'center', 'center')[by], + lastMouseByCenter = target.toLocalPoint(new fabric.Point(t.lastX, t.lastY), 'center', 'center')[by], + actualMouseByOrigin, constraintPosition, dim = target._getTransformedDimensions(); + + this._changeSkewTransformOrigin(actualMouseByCenter - lastMouseByCenter, t, by); + actualMouseByOrigin = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY)[by]; + constraintPosition = target.translateToOriginPoint(center, t.originX, t.originY); + // Actually skew the object + skewed = this._setObjectSkew(actualMouseByOrigin, t, by, dim); + t.lastX = x; + t.lastY = y; + // Make sure the constraints apply + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + return skewed; + }, + + /** + * Set object skew + * @private + * @return {Boolean} true if the skewing occurred + */ + _setObjectSkew: function(localMouse, transform, by, _dim) { + var target = transform.target, newValue, skewed = false, + skewSign = transform.skewSign, newDim, dimNoSkew, + otherBy, _otherBy, _by, newDimMouse, skewX, skewY; + + if (by === 'x') { + otherBy = 'y'; + _otherBy = 'Y'; + _by = 'X'; + skewX = 0; + skewY = target.skewY; + } + else { + otherBy = 'x'; + _otherBy = 'X'; + _by = 'Y'; + skewX = target.skewX; + skewY = 0; + } + + dimNoSkew = target._getTransformedDimensions(skewX, skewY); + newDimMouse = 2 * Math.abs(localMouse) - dimNoSkew[by]; + if (newDimMouse <= 2) { + newValue = 0; + } + else { + newValue = skewSign * Math.atan((newDimMouse / target['scale' + _by]) / + (dimNoSkew[otherBy] / target['scale' + _otherBy])); + newValue = fabric.util.radiansToDegrees(newValue); + } + skewed = target['skew' + _by] !== newValue; + target.set('skew' + _by, newValue); + if (target['skew' + _otherBy] !== 0) { + newDim = target._getTransformedDimensions(); + newValue = (_dim[otherBy] / newDim[otherBy]) * target['scale' + _otherBy]; + target.set('scale' + _otherBy, newValue); + } + return skewed; + }, + + /** + * Scales object by invoking its scaleX/scaleY methods + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @param {String} by Either 'x' or 'y' - specifies dimension constraint by which to scale an object. + * When not provided, an object is scaled by both dimensions equally + * @return {Boolean} true if the scaling occurred + */ + _scaleObject: function (x, y, by) { + var t = this._currentTransform, + target = t.target, + lockScalingX = target.lockScalingX, + lockScalingY = target.lockScalingY, + lockScalingFlip = target.lockScalingFlip; + + if (lockScalingX && lockScalingY) { + return false; + } + + // Get the constraint point + var constraintPosition = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY), + localMouse = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY), + dim = target._getTransformedDimensions(), scaled = false; + + this._setLocalMouse(localMouse, t); + + // Actually scale the object + scaled = this._setObjectScale(localMouse, t, lockScalingX, lockScalingY, by, lockScalingFlip, dim); + + // Make sure the constraints apply + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + return scaled; + }, + + /** + * @private + * @return {Boolean} true if the scaling occurred + */ + _setObjectScale: function(localMouse, transform, lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + var target = transform.target, forbidScalingX = false, forbidScalingY = false, scaled = false, + scaleX = localMouse.x * target.scaleX / _dim.x, + scaleY = localMouse.y * target.scaleY / _dim.y, + changeX = target.scaleX !== scaleX, + changeY = target.scaleY !== scaleY; + + transform.newScaleX = scaleX; + transform.newScaleY = scaleY; + if (by === 'x' && target instanceof fabric.Textbox) { + var w = target.width * (localMouse.x / _dim.x); + if (w >= target.getMinWidth()) { + scaled = w !== target.width; + target.set('width', w); + return scaled; + } + return false; + } + + if (lockScalingFlip && scaleX <= 0 && scaleX < target.scaleX) { + forbidScalingX = true; + localMouse.x = 0; + } + + if (lockScalingFlip && scaleY <= 0 && scaleY < target.scaleY) { + forbidScalingY = true; + localMouse.y = 0; + } + + if (by === 'equally' && !lockScalingX && !lockScalingY) { + scaled = this._scaleObjectEqually(localMouse, target, transform, _dim); + } + else if (!by) { + forbidScalingX || lockScalingX || (target.set('scaleX', scaleX) && (scaled = scaled || changeX)); + forbidScalingY || lockScalingY || (target.set('scaleY', scaleY) && (scaled = scaled || changeY)); + } + else if (by === 'x' && !target.get('lockUniScaling')) { + forbidScalingX || lockScalingX || (target.set('scaleX', scaleX) && (scaled = changeX)); + } + else if (by === 'y' && !target.get('lockUniScaling')) { + forbidScalingY || lockScalingY || (target.set('scaleY', scaleY) && (scaled = changeY)); + } + forbidScalingX || forbidScalingY || this._flipObject(transform, by); + return scaled; + }, + + /** + * @private + * @return {Boolean} true if the scaling occurred + */ + _scaleObjectEqually: function(localMouse, target, transform, _dim) { + + var dist = localMouse.y + localMouse.x, + lastDist = _dim.y * transform.original.scaleY / target.scaleY + + _dim.x * transform.original.scaleX / target.scaleX, + scaled, signX = localMouse.x < 0 ? -1 : 1, + signY = localMouse.y < 0 ? -1 : 1, newScaleX, newScaleY; + + // We use transform.scaleX/Y instead of target.scaleX/Y + // because the object may have a min scale and we'll loose the proportions + newScaleX = signX * Math.abs(transform.original.scaleX * dist / lastDist); + newScaleY = signY * Math.abs(transform.original.scaleY * dist / lastDist); + scaled = newScaleX !== target.scaleX || newScaleY !== target.scaleY; + target.set('scaleX', newScaleX); + target.set('scaleY', newScaleY); + return scaled; + }, + + /** + * @private + */ + _flipObject: function(transform, by) { + if (transform.newScaleX < 0 && by !== 'y') { + if (transform.originX === 'left') { + transform.originX = 'right'; + } + else if (transform.originX === 'right') { + transform.originX = 'left'; + } + } + + if (transform.newScaleY < 0 && by !== 'x') { + if (transform.originY === 'top') { + transform.originY = 'bottom'; + } + else if (transform.originY === 'bottom') { + transform.originY = 'top'; + } + } + }, + + /** + * @private + */ + _setLocalMouse: function(localMouse, t) { + var target = t.target, zoom = this.getZoom(), + padding = target.padding / zoom; + + if (t.originX === 'right') { + localMouse.x *= -1; + } + else if (t.originX === 'center') { + localMouse.x *= t.mouseXSign * 2; + if (localMouse.x < 0) { + t.mouseXSign = -t.mouseXSign; + } + } + + if (t.originY === 'bottom') { + localMouse.y *= -1; + } + else if (t.originY === 'center') { + localMouse.y *= t.mouseYSign * 2; + if (localMouse.y < 0) { + t.mouseYSign = -t.mouseYSign; + } + } + + // adjust the mouse coordinates when dealing with padding + if (abs(localMouse.x) > padding) { + if (localMouse.x < 0) { + localMouse.x += padding; + } + else { + localMouse.x -= padding; + } + } + else { // mouse is within the padding, set to 0 + localMouse.x = 0; + } + + if (abs(localMouse.y) > padding) { + if (localMouse.y < 0) { + localMouse.y += padding; + } + else { + localMouse.y -= padding; + } + } + else { + localMouse.y = 0; + } + }, + + /** + * Rotates object by invoking its rotate method + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @return {Boolean} true if the rotation occurred + */ + _rotateObject: function (x, y) { + + var t = this._currentTransform, + target = t.target, constraintPosition, + constraintPosition = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY); + + if (target.lockRotation) { + return false; + } + + var lastAngle = atan2(t.ey - constraintPosition.y, t.ex - constraintPosition.x), + curAngle = atan2(y - constraintPosition.y, x - constraintPosition.x), + angle = radiansToDegrees(curAngle - lastAngle + t.theta), + hasRotated = true; + + if (target.snapAngle > 0) { + var snapAngle = target.snapAngle, + snapThreshold = target.snapThreshold || snapAngle, + rightAngleLocked = Math.ceil(angle / snapAngle) * snapAngle, + leftAngleLocked = Math.floor(angle / snapAngle) * snapAngle; + + if (Math.abs(angle - leftAngleLocked) < snapThreshold) { + angle = leftAngleLocked; + } + else if (Math.abs(angle - rightAngleLocked) < snapThreshold) { + angle = rightAngleLocked; + } + } + + // normalize angle to positive value + if (angle < 0) { + angle = 360 + angle; + } + angle %= 360; + + if (target.angle === angle) { + hasRotated = false; + } + else { + // rotation only happen here + target.angle = angle; + // Make sure the constraints apply + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + } + + return hasRotated; + }, + + /** + * Set the cursor type of the canvas element + * @param {String} value Cursor type of the canvas element. + * @see http://www.w3.org/TR/css3-ui/#cursor + */ + setCursor: function (value) { + this.upperCanvasEl.style.cursor = value; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx to draw the selection on + */ + _drawSelection: function (ctx) { + var groupSelector = this._groupSelector, + left = groupSelector.left, + top = groupSelector.top, + aleft = abs(left), + atop = abs(top); + + if (this.selectionColor) { + ctx.fillStyle = this.selectionColor; + + ctx.fillRect( + groupSelector.ex - ((left > 0) ? 0 : -left), + groupSelector.ey - ((top > 0) ? 0 : -top), + aleft, + atop + ); + } + + if (!this.selectionLineWidth || !this.selectionBorderColor) { + return; + } + ctx.lineWidth = this.selectionLineWidth; + ctx.strokeStyle = this.selectionBorderColor; + + // selection border + if (this.selectionDashArray.length > 1 && !supportLineDash) { + + var px = groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + py = groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop); + + ctx.beginPath(); + + fabric.util.drawDashedLine(ctx, px, py, px + aleft, py, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py + atop - 1, px + aleft, py + atop - 1, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py, px, py + atop, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px + aleft - 1, py, px + aleft - 1, py + atop, this.selectionDashArray); + + ctx.closePath(); + ctx.stroke(); + } + else { + fabric.Object.prototype._setLineDash.call(this, ctx, this.selectionDashArray); + ctx.strokeRect( + groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop), + aleft, + atop + ); + } + }, + + /** + * Method that determines what object we are clicking on + * the skipGroup parameter is for internal use, is needed for shift+click action + * 11/09/2018 TODO: would be cool if findTarget could discern between being a full target + * or the outside part of the corner. + * @param {Event} e mouse event + * @param {Boolean} skipGroup when true, activeGroup is skipped and only objects are traversed through + * @return {fabric.Object} the target found + */ + findTarget: function (e, skipGroup) { + if (this.skipTargetFind) { + return; + } + + var ignoreZoom = true, + pointer = this.getPointer(e, ignoreZoom), + activeObject = this._activeObject, + aObjects = this.getActiveObjects(), + activeTarget, activeTargetSubs; + + // first check current group (if one exists) + // active group does not check sub targets like normal groups. + // if active group just exits. + this.targets = []; + + if (aObjects.length > 1 && !skipGroup && activeObject === this._searchPossibleTargets([activeObject], pointer)) { + return activeObject; + } + // if we hit the corner of an activeObject, let's return that. + if (aObjects.length === 1 && activeObject._findTargetCorner(pointer)) { + return activeObject; + } + if (aObjects.length === 1 && + activeObject === this._searchPossibleTargets([activeObject], pointer)) { + if (!this.preserveObjectStacking) { + return activeObject; + } + else { + activeTarget = activeObject; + activeTargetSubs = this.targets; + this.targets = []; + } + } + var target = this._searchPossibleTargets(this._objects, pointer); + if (e[this.altSelectionKey] && target && activeTarget && target !== activeTarget) { + target = activeTarget; + this.targets = activeTargetSubs; + } + return target; + }, + + /** + * Checks point is inside the object. + * @param {Object} [pointer] x,y object of point coordinates we want to check. + * @param {fabric.Object} obj Object to test against + * @param {Object} [globalPointer] x,y object of point coordinates relative to canvas used to search per pixel target. + * @return {Boolean} true if point is contained within an area of given object + * @private + */ + _checkTarget: function(pointer, obj, globalPointer) { + if (obj && + obj.visible && + obj.evented && + this.containsPoint(null, obj, pointer)){ + if ((this.perPixelTargetFind || obj.perPixelTargetFind) && !obj.isEditing) { + var isTransparent = this.isTargetTransparent(obj, globalPointer.x, globalPointer.y); + if (!isTransparent) { + return true; + } + } + else { + return true; + } + } + }, + + /** + * Function used to search inside objects an object that contains pointer in bounding box or that contains pointerOnCanvas when painted + * @param {Array} [objects] objects array to look into + * @param {Object} [pointer] x,y object of point coordinates we want to check. + * @return {fabric.Object} object that contains pointer + * @private + */ + _searchPossibleTargets: function(objects, pointer) { + // Cache all targets where their bounding box contains point. + var target, i = objects.length, subTarget; + // Do not check for currently grouped objects, since we check the parent group itself. + // until we call this function specifically to search inside the activeGroup + while (i--) { + var objToCheck = objects[i]; + var pointerToUse = objToCheck.group && objToCheck.group.type !== 'activeSelection' ? + this._normalizePointer(objToCheck.group, pointer) : pointer; + if (this._checkTarget(pointerToUse, objToCheck, pointer)) { + target = objects[i]; + if (target.subTargetCheck && target instanceof fabric.Group) { + subTarget = this._searchPossibleTargets(target._objects, pointer); + subTarget && this.targets.push(subTarget); + } + break; + } + } + return target; + }, + + /** + * Returns pointer coordinates without the effect of the viewport + * @param {Object} pointer with "x" and "y" number values + * @return {Object} object with "x" and "y" number values + */ + restorePointerVpt: function(pointer) { + return fabric.util.transformPoint( + pointer, + fabric.util.invertTransform(this.viewportTransform) + ); + }, + + /** + * Returns pointer coordinates relative to canvas. + * Can return coordinates with or without viewportTransform. + * ignoreZoom false gives back coordinates that represent + * the point clicked on canvas element. + * ignoreZoom true gives back coordinates after being processed + * by the viewportTransform ( sort of coordinates of what is displayed + * on the canvas where you are clicking. + * ignoreZoom true = HTMLElement coordinates relative to top,left + * ignoreZoom false, default = fabric space coordinates, the same used for shape position + * To interact with your shapes top and left you want to use ignoreZoom true + * most of the time, while ignoreZoom false will give you coordinates + * compatible with the object.oCoords system. + * of the time. + * @param {Event} e + * @param {Boolean} ignoreZoom + * @return {Object} object with "x" and "y" number values + */ + getPointer: function (e, ignoreZoom) { + // return cached values if we are in the event processing chain + if (this._absolutePointer && !ignoreZoom) { + return this._absolutePointer; + } + if (this._pointer && ignoreZoom) { + return this._pointer; + } + + var pointer = getPointer(e), + upperCanvasEl = this.upperCanvasEl, + bounds = upperCanvasEl.getBoundingClientRect(), + boundsWidth = bounds.width || 0, + boundsHeight = bounds.height || 0, + cssScale; + + if (!boundsWidth || !boundsHeight ) { + if ('top' in bounds && 'bottom' in bounds) { + boundsHeight = Math.abs( bounds.top - bounds.bottom ); + } + if ('right' in bounds && 'left' in bounds) { + boundsWidth = Math.abs( bounds.right - bounds.left ); + } + } + + this.calcOffset(); + pointer.x = pointer.x - this._offset.left; + pointer.y = pointer.y - this._offset.top; + if (!ignoreZoom) { + pointer = this.restorePointerVpt(pointer); + } + + if (boundsWidth === 0 || boundsHeight === 0) { + // If bounds are not available (i.e. not visible), do not apply scale. + cssScale = { width: 1, height: 1 }; + } + else { + cssScale = { + width: upperCanvasEl.width / boundsWidth, + height: upperCanvasEl.height / boundsHeight + }; + } + + return { + x: pointer.x * cssScale.width, + y: pointer.y * cssScale.height + }; + }, + + /** + * @private + * @throws {CANVAS_INIT_ERROR} If canvas can not be initialized + */ + _createUpperCanvas: function () { + var lowerCanvasClass = this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/, ''); + + // there is no need to create a new upperCanvas element if we have already one. + if (this.upperCanvasEl) { + this.upperCanvasEl.className = ''; + } + else { + this.upperCanvasEl = this._createCanvasElement(); + } + fabric.util.addClass(this.upperCanvasEl, 'upper-canvas ' + lowerCanvasClass); + + this.wrapperEl.appendChild(this.upperCanvasEl); + + this._copyCanvasStyle(this.lowerCanvasEl, this.upperCanvasEl); + this._applyCanvasStyle(this.upperCanvasEl); + this.contextTop = this.upperCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _createCacheCanvas: function () { + this.cacheCanvasEl = this._createCanvasElement(); + this.cacheCanvasEl.setAttribute('width', this.width); + this.cacheCanvasEl.setAttribute('height', this.height); + this.contextCache = this.cacheCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _initWrapperElement: function () { + this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, 'div', { + 'class': this.containerClass + }); + fabric.util.setStyle(this.wrapperEl, { + width: this.width + 'px', + height: this.height + 'px', + position: 'relative' + }); + fabric.util.makeElementUnselectable(this.wrapperEl); + }, + + /** + * @private + * @param {HTMLElement} element canvas element to apply styles on + */ + _applyCanvasStyle: function (element) { + var width = this.width || element.width, + height = this.height || element.height; + + fabric.util.setStyle(element, { + position: 'absolute', + width: width + 'px', + height: height + 'px', + left: 0, + top: 0, + 'touch-action': this.allowTouchScrolling ? 'manipulation' : 'none', + '-ms-touch-action': this.allowTouchScrolling ? 'manipulation' : 'none' + }); + element.width = width; + element.height = height; + fabric.util.makeElementUnselectable(element); + }, + + /** + * Copy the entire inline style from one element (fromEl) to another (toEl) + * @private + * @param {Element} fromEl Element style is copied from + * @param {Element} toEl Element copied style is applied to + */ + _copyCanvasStyle: function (fromEl, toEl) { + toEl.style.cssText = fromEl.style.cssText; + }, + + /** + * Returns context of canvas where object selection is drawn + * @return {CanvasRenderingContext2D} + */ + getSelectionContext: function() { + return this.contextTop; + }, + + /** + * Returns <canvas> element on which object selection is drawn + * @return {HTMLCanvasElement} + */ + getSelectionElement: function () { + return this.upperCanvasEl; + }, + + /** + * Returns currently active object + * @return {fabric.Object} active object + */ + getActiveObject: function () { + return this._activeObject; + }, + + /** + * Returns an array with the current selected objects + * @return {fabric.Object} active object + */ + getActiveObjects: function () { + var active = this._activeObject; + if (active) { + if (active.type === 'activeSelection' && active._objects) { + return active._objects.slice(0); + } + else { + return [active]; + } + } + return []; + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + // removing active object should fire "selection:cleared" events + if (obj === this._activeObject) { + this.fire('before:selection:cleared', { target: obj }); + this._discardActiveObject(); + this.fire('selection:cleared', { target: obj }); + obj.fire('deselected'); + } + if (this._hoveredTarget === obj) { + this._hoveredTarget = null; + } + this.callSuper('_onObjectRemoved', obj); + }, + + /** + * @private + * Compares the old activeObject with the current one and fires correct events + * @param {fabric.Object} obj old activeObject + */ + _fireSelectionEvents: function(oldObjects, e) { + var somethingChanged = false, objects = this.getActiveObjects(), + added = [], removed = [], opt = { e: e }; + oldObjects.forEach(function(oldObject) { + if (objects.indexOf(oldObject) === -1) { + somethingChanged = true; + oldObject.fire('deselected', opt); + removed.push(oldObject); + } + }); + objects.forEach(function(object) { + if (oldObjects.indexOf(object) === -1) { + somethingChanged = true; + object.fire('selected', opt); + added.push(object); + } + }); + if (oldObjects.length > 0 && objects.length > 0) { + opt.selected = added; + opt.deselected = removed; + // added for backward compatibility + opt.updated = added[0] || removed[0]; + opt.target = this._activeObject; + somethingChanged && this.fire('selection:updated', opt); + } + else if (objects.length > 0) { + // deprecated event + if (objects.length === 1) { + opt.target = added[0]; + this.fire('object:selected', opt); + } + opt.selected = added; + // added for backward compatibility + opt.target = this._activeObject; + this.fire('selection:created', opt); + } + else if (oldObjects.length > 0) { + opt.deselected = removed; + this.fire('selection:cleared', opt); + } + }, + + /** + * Sets given object as the only active object on canvas + * @param {fabric.Object} object Object to set as an active one + * @param {Event} [e] Event (passed along when firing "object:selected") + * @return {fabric.Canvas} thisArg + * @chainable + */ + setActiveObject: function (object, e) { + var currentActives = this.getActiveObjects(); + this._setActiveObject(object, e); + this._fireSelectionEvents(currentActives, e); + return this; + }, + + /** + * @private + * @param {Object} object to set as active + * @param {Event} [e] Event (passed along when firing "object:selected") + * @return {Boolean} true if the selection happened + */ + _setActiveObject: function(object, e) { + if (this._activeObject === object) { + return false; + } + if (!this._discardActiveObject(e, object)) { + return false; + } + if (object.onSelect({ e: e })) { + return false; + } + this._activeObject = object; + return true; + }, + + /** + * @private + */ + _discardActiveObject: function(e, object) { + var obj = this._activeObject; + if (obj) { + // onDeselect return TRUE to cancel selection; + if (obj.onDeselect({ e: e, object: object })) { + return false; + } + this._activeObject = null; + } + return true; + }, + + /** + * Discards currently active object and fire events. If the function is called by fabric + * as a consequence of a mouse event, the event is passed as a parameter and + * sent to the fire function for the custom events. When used as a method the + * e param does not have any application. + * @param {event} e + * @return {fabric.Canvas} thisArg + * @chainable + */ + discardActiveObject: function (e) { + var currentActives = this.getActiveObjects(), activeObject = this.getActiveObject(); + if (currentActives.length) { + this.fire('before:selection:cleared', { target: activeObject, e: e }); + } + this._discardActiveObject(e); + this._fireSelectionEvents(currentActives, e); + return this; + }, + + /** + * Clears a canvas element and removes all event listeners + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + var wrapper = this.wrapperEl; + this.removeListeners(); + wrapper.removeChild(this.upperCanvasEl); + wrapper.removeChild(this.lowerCanvasEl); + this.contextCache = null; + this.contextTop = null; + ['upperCanvasEl', 'cacheCanvasEl'].forEach((function(element) { + fabric.util.cleanUpJsdomNode(this[element]); + this[element] = undefined; + }).bind(this)); + if (wrapper.parentNode) { + wrapper.parentNode.replaceChild(this.lowerCanvasEl, this.wrapperEl); + } + delete this.wrapperEl; + fabric.StaticCanvas.prototype.dispose.call(this); + return this; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + // this.discardActiveGroup(); + this.discardActiveObject(); + this.clearContext(this.contextTop); + return this.callSuper('clear'); + }, + + /** + * Draws objects' controls (borders/controls) + * @param {CanvasRenderingContext2D} ctx Context to render controls on + */ + drawControls: function(ctx) { + var activeObject = this._activeObject; + + if (activeObject) { + activeObject._renderControls(ctx); + } + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + //If the object is part of the current selection group, it should + //be transformed appropriately + //i.e. it should be serialised as it would appear if the selection group + //were to be destroyed. + var originalProperties = this._realizeGroupTransformOnObject(instance), + object = this.callSuper('_toObject', instance, methodName, propertiesToInclude); + //Undo the damage we did by changing all of its properties + this._unwindGroupTransformOnObject(instance, originalProperties); + return object; + }, + + /** + * Realises an object's group transformation on it + * @private + * @param {fabric.Object} [instance] the object to transform (gets mutated) + * @returns the original values of instance which were changed + */ + _realizeGroupTransformOnObject: function(instance) { + if (instance.group && instance.group.type === 'activeSelection' && this._activeObject === instance.group) { + var layoutProps = ['angle', 'flipX', 'flipY', 'left', 'scaleX', 'scaleY', 'skewX', 'skewY', 'top']; + //Copy all the positionally relevant properties across now + var originalValues = {}; + layoutProps.forEach(function(prop) { + originalValues[prop] = instance[prop]; + }); + this._activeObject.realizeTransform(instance); + return originalValues; + } + else { + return null; + } + }, + + /** + * Restores the changed properties of instance + * @private + * @param {fabric.Object} [instance] the object to un-transform (gets mutated) + * @param {Object} [originalValues] the original values of instance, as returned by _realizeGroupTransformOnObject + */ + _unwindGroupTransformOnObject: function(instance, originalValues) { + if (originalValues) { + instance.set(originalValues); + } + }, + + /** + * @private + */ + _setSVGObject: function(markup, instance, reviver) { + //If the object is in a selection group, simulate what would happen to that + //object when the group is deselected + var originalProperties = this._realizeGroupTransformOnObject(instance); + this.callSuper('_setSVGObject', markup, instance, reviver); + this._unwindGroupTransformOnObject(instance, originalProperties); + }, + + setViewportTransform: function (vpt) { + if (this.renderOnAddRemove && this._activeObject && this._activeObject.isEditing) { + this._activeObject.clearContextTop(); + } + fabric.StaticCanvas.prototype.setViewportTransform.call(this, vpt); + } + }); + + // copying static properties manually to work around Opera's bug, + // where "prototype" property is enumerable and overrides existing prototype + for (var prop in fabric.StaticCanvas) { + if (prop !== 'prototype') { + fabric.Canvas[prop] = fabric.StaticCanvas[prop]; + } + } +})(); +(function() { + + var cursorOffset = { + mt: 0, // n + tr: 1, // ne + mr: 2, // e + br: 3, // se + mb: 4, // s + bl: 5, // sw + ml: 6, // w + tl: 7 // nw + }, + addListener = fabric.util.addListener, + removeListener = fabric.util.removeListener, + RIGHT_CLICK = 3, MIDDLE_CLICK = 2, LEFT_CLICK = 1, + addEventOptions = { passive: false }; + + function checkClick(e, value) { + return e.button && (e.button === value - 1); + } + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * Map of cursor style values for each of the object controls + * @private + */ + cursorMap: [ + 'n-resize', + 'ne-resize', + 'e-resize', + 'se-resize', + 's-resize', + 'sw-resize', + 'w-resize', + 'nw-resize' + ], + + /** + * Contains the id of the touch event that owns the fabric transform + * @type Number + * @private + */ + mainTouchId: null, + + /** + * Adds mouse listeners to canvas + * @private + */ + _initEventListeners: function () { + // in case we initialized the class twice. This should not happen normally + // but in some kind of applications where the canvas element may be changed + // this is a workaround to having double listeners. + this.removeListeners(); + this._bindEvents(); + this.addOrRemove(addListener, 'add'); + }, + + /** + * return an event prefix pointer or mouse. + * @private + */ + _getEventPrefix: function () { + return this.enablePointerEvents ? 'pointer' : 'mouse'; + }, + + addOrRemove: function(functor, eventjsFunctor) { + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + functor(fabric.window, 'resize', this._onResize); + functor(canvasElement, eventTypePrefix + 'down', this._onMouseDown); + functor(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + functor(canvasElement, eventTypePrefix + 'out', this._onMouseOut); + functor(canvasElement, eventTypePrefix + 'enter', this._onMouseEnter); + functor(canvasElement, 'wheel', this._onMouseWheel); + functor(canvasElement, 'contextmenu', this._onContextMenu); + functor(canvasElement, 'dblclick', this._onDoubleClick); + functor(canvasElement, 'dragover', this._onDragOver); + functor(canvasElement, 'dragenter', this._onDragEnter); + functor(canvasElement, 'dragleave', this._onDragLeave); + functor(canvasElement, 'drop', this._onDrop); + if (!this.enablePointerEvents) { + functor(canvasElement, 'touchstart', this._onTouchStart, addEventOptions); + } + if (typeof eventjs !== 'undefined' && eventjsFunctor in eventjs) { + eventjs[eventjsFunctor](canvasElement, 'gesture', this._onGesture); + eventjs[eventjsFunctor](canvasElement, 'drag', this._onDrag); + eventjs[eventjsFunctor](canvasElement, 'orientation', this._onOrientationChange); + eventjs[eventjsFunctor](canvasElement, 'shake', this._onShake); + eventjs[eventjsFunctor](canvasElement, 'longpress', this._onLongPress); + } + }, + + /** + * Removes all event listeners + */ + removeListeners: function() { + this.addOrRemove(removeListener, 'remove'); + // if you dispose on a mouseDown, before mouse up, you need to clean document to... + var eventTypePrefix = this._getEventPrefix(); + removeListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp); + removeListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions); + removeListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + removeListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions); + }, + + /** + * @private + */ + _bindEvents: function() { + if (this.eventsBound) { + // for any reason we pass here twice we do not want to bind events twice. + return; + } + this._onMouseDown = this._onMouseDown.bind(this); + this._onTouchStart = this._onTouchStart.bind(this); + this._onMouseMove = this._onMouseMove.bind(this); + this._onMouseUp = this._onMouseUp.bind(this); + this._onTouchEnd = this._onTouchEnd.bind(this); + this._onResize = this._onResize.bind(this); + this._onGesture = this._onGesture.bind(this); + this._onDrag = this._onDrag.bind(this); + this._onShake = this._onShake.bind(this); + this._onLongPress = this._onLongPress.bind(this); + this._onOrientationChange = this._onOrientationChange.bind(this); + this._onMouseWheel = this._onMouseWheel.bind(this); + this._onMouseOut = this._onMouseOut.bind(this); + this._onMouseEnter = this._onMouseEnter.bind(this); + this._onContextMenu = this._onContextMenu.bind(this); + this._onDoubleClick = this._onDoubleClick.bind(this); + this._onDragOver = this._onDragOver.bind(this); + this._onDragEnter = this._simpleEventHandler.bind(this, 'dragenter'); + this._onDragLeave = this._simpleEventHandler.bind(this, 'dragleave'); + this._onDrop = this._simpleEventHandler.bind(this, 'drop'); + this.eventsBound = true; + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js gesture + * @param {Event} [self] Inner Event object + */ + _onGesture: function(e, self) { + this.__onTransformGesture && this.__onTransformGesture(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js drag + * @param {Event} [self] Inner Event object + */ + _onDrag: function(e, self) { + this.__onDrag && this.__onDrag(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on wheel event + */ + _onMouseWheel: function(e) { + this.__onMouseWheel(e); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseOut: function(e) { + var target = this._hoveredTarget; + this.fire('mouse:out', { target: target, e: e }); + this._hoveredTarget = null; + target && target.fire('mouseout', { e: e }); + if (this._iTextInstances) { + this._iTextInstances.forEach(function(obj) { + if (obj.isEditing) { + obj.hiddenTextarea.focus(); + } + }); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mouseenter + */ + _onMouseEnter: function(e) { + // This find target and consequent 'mouse:over' is used to + // clear old instances on hovered target. + // calling findTarget has the side effect of killing target.__corner. + // as a short term fix we are not firing this if we are currently transforming. + // as a long term fix we need to separate the action of finding a target with the + // side effects we added to it. + if (!this.currentTransform && !this.findTarget(e)) { + this.fire('mouse:over', { target: null, e: e }); + this._hoveredTarget = null; + } + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js orientation change + * @param {Event} [self] Inner Event object + */ + _onOrientationChange: function(e, self) { + this.__onOrientationChange && this.__onOrientationChange(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onShake: function(e, self) { + this.__onShake && this.__onShake(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onLongPress: function(e, self) { + this.__onLongPress && this.__onLongPress(e, self); + }, + + /** + * prevent default to allow drop event to be fired + * @private + * @param {Event} [e] Event object fired on Event.js shake + */ + _onDragOver: function(e) { + e.preventDefault(); + var target = this._simpleEventHandler('dragover', e); + this._fireEnterLeaveEvents(target, e); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onContextMenu: function (e) { + if (this.stopContextMenu) { + e.stopPropagation(); + e.preventDefault(); + } + return false; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onDoubleClick: function (e) { + this._cacheTransformEventData(e); + this._handleEvent(e, 'dblclick'); + this._resetTransformEventData(e); + }, + + /** + * Return a the id of an event. + * returns either the pointerId or the identifier or 0 for the mouse event + * @private + * @param {Event} evt Event object + */ + getPointerId: function(evt) { + var changedTouches = evt.changedTouches; + + if (changedTouches) { + return changedTouches[0] && changedTouches[0].identifier; + } + + if (this.enablePointerEvents) { + return evt.pointerId; + } + + return -1; + }, + + /** + * Determines if an event has the id of the event that is considered main + * @private + * @param {evt} event Event object + */ + _isMainEvent: function(evt) { + if (evt.isPrimary === true) { + return true; + } + if (evt.isPrimary === false) { + return false; + } + if (evt.type === 'touchend' && evt.touches.length === 0) { + return true; + } + if (evt.changedTouches) { + return evt.changedTouches[0].identifier === this.mainTouchId; + } + return true; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onTouchStart: function(e) { + e.preventDefault(); + if (this.mainTouchId === null) { + this.mainTouchId = this.getPointerId(e); + } + this.__onMouseDown(e); + this._resetTransformEventData(); + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + addListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions); + addListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions); + // Unbind mousedown to prevent double triggers from touch devices + removeListener(canvasElement, eventTypePrefix + 'down', this._onMouseDown); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDown: function (e) { + this.__onMouseDown(e); + this._resetTransformEventData(); + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + removeListener(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + addListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp); + addListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onTouchEnd: function(e) { + if (e.touches.length > 0) { + // if there are still touches stop here + return; + } + this.__onMouseUp(e); + this._resetTransformEventData(); + this.mainTouchId = null; + var eventTypePrefix = this._getEventPrefix(); + removeListener(fabric.document, 'touchend', this._onTouchEnd, addEventOptions); + removeListener(fabric.document, 'touchmove', this._onMouseMove, addEventOptions); + var _this = this; + if (this._willAddMouseDown) { + clearTimeout(this._willAddMouseDown); + } + this._willAddMouseDown = setTimeout(function() { + // Wait 400ms before rebinding mousedown to prevent double triggers + // from touch devices + addListener(_this.upperCanvasEl, eventTypePrefix + 'down', _this._onMouseDown); + _this._willAddMouseDown = 0; + }, 400); + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUp: function (e) { + this.__onMouseUp(e); + this._resetTransformEventData(); + var canvasElement = this.upperCanvasEl, + eventTypePrefix = this._getEventPrefix(); + if (this._isMainEvent(e)) { + removeListener(fabric.document, eventTypePrefix + 'up', this._onMouseUp); + removeListener(fabric.document, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + addListener(canvasElement, eventTypePrefix + 'move', this._onMouseMove, addEventOptions); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMove: function (e) { + !this.allowTouchScrolling && e.preventDefault && e.preventDefault(); + this.__onMouseMove(e); + }, + + /** + * @private + */ + _onResize: function () { + this.calcOffset(); + }, + + /** + * Decides whether the canvas should be redrawn in mouseup and mousedown events. + * @private + * @param {Object} target + */ + _shouldRender: function(target) { + var activeObject = this._activeObject; + + if ( + !!activeObject !== !!target || + (activeObject && target && (activeObject !== target)) + ) { + // this covers: switch of target, from target to no target, selection of target + // multiSelection with key and mouse + return true; + } + else if (activeObject && activeObject.isEditing) { + // if we mouse up/down over a editing textbox a cursor change, + // there is no need to re render + return false; + } + return false; + }, + + /** + * Method that defines the actions when mouse is released on canvas. + * The method resets the currentTransform parameters, store the image corner + * position in the image object and render the canvas on top. + * @private + * @param {Event} e Event object fired on mouseup + */ + __onMouseUp: function (e) { + var target, transform = this._currentTransform, + groupSelector = this._groupSelector, shouldRender = false, + isClick = (!groupSelector || (groupSelector.left === 0 && groupSelector.top === 0)); + this._cacheTransformEventData(e); + target = this._target; + this._handleEvent(e, 'up:before'); + // if right/middle click just fire events and return + // target undefined will make the _handleEvent search the target + if (checkClick(e, RIGHT_CLICK)) { + if (this.fireRightClick) { + this._handleEvent(e, 'up', RIGHT_CLICK, isClick); + } + return; + } + + if (checkClick(e, MIDDLE_CLICK)) { + if (this.fireMiddleClick) { + this._handleEvent(e, 'up', MIDDLE_CLICK, isClick); + } + this._resetTransformEventData(); + return; + } + + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this._onMouseUpInDrawingMode(e); + return; + } + + if (!this._isMainEvent(e)) { + return; + } + if (transform) { + this._finalizeCurrentTransform(e); + shouldRender = transform.actionPerformed; + } + + if (!isClick) { + this._maybeGroupObjects(e); + shouldRender || (shouldRender = this._shouldRender(target)); + } + if (target) { + target.isMoving = false; + } + this._setCursorFromEvent(e, target); + this._handleEvent(e, 'up', LEFT_CLICK, isClick); + this._groupSelector = null; + this._currentTransform = null; + // reset the target information about which corner is selected + target && (target.__corner = 0); + if (shouldRender) { + this.requestRenderAll(); + } + else if (!isClick) { + this.renderTop(); + } + }, + + /** + * @private + * Handle event firing for target and subtargets + * @param {Event} e event from mouse + * @param {String} eventType event to fire (up, down or move) + * @return {Fabric.Object} target return the the target found, for internal reasons. + */ + _simpleEventHandler: function(eventType, e) { + var target = this.findTarget(e), + targets = this.targets, + options = { + e: e, + target: target, + subTargets: targets, + }; + this.fire(eventType, options); + target && target.fire(eventType, options); + if (!targets) { + return target; + } + for (var i = 0; i < targets.length; i++) { + targets[i].fire(eventType, options); + } + return target; + }, + + /** + * @private + * Handle event firing for target and subtargets + * @param {Event} e event from mouse + * @param {String} eventType event to fire (up, down or move) + * @param {fabric.Object} targetObj receiving event + * @param {Number} [button] button used in the event 1 = left, 2 = middle, 3 = right + * @param {Boolean} isClick for left button only, indicates that the mouse up happened without move. + */ + _handleEvent: function(e, eventType, button, isClick) { + var target = this._target, + targets = this.targets || [], + options = { + e: e, + target: target, + subTargets: targets, + button: button || LEFT_CLICK, + isClick: isClick || false, + pointer: this._pointer, + absolutePointer: this._absolutePointer, + transform: this._currentTransform + }; + this.fire('mouse:' + eventType, options); + target && target.fire('mouse' + eventType, options); + for (var i = 0; i < targets.length; i++) { + targets[i].fire('mouse' + eventType, options); + } + }, + + /** + * @private + * @param {Event} e send the mouse event that generate the finalize down, so it can be used in the event + */ + _finalizeCurrentTransform: function(e) { + + var transform = this._currentTransform, + target = transform.target, + eventName, + options = { + e: e, + target: target, + transform: transform, + }; + + if (target._scaling) { + target._scaling = false; + } + + target.setCoords(); + + if (transform.actionPerformed || (this.stateful && target.hasStateChanged())) { + if (transform.actionPerformed) { + eventName = this._addEventOptions(options, transform); + this._fire(eventName, options); + } + this._fire('modified', options); + } + }, + + /** + * Mutate option object in order to add by property and give back the event name. + * @private + * @param {Object} options to mutate + * @param {Object} transform to inspect action from + */ + _addEventOptions: function(options, transform) { + // we can probably add more details at low cost + // scale change, rotation changes, translation changes + var eventName, by; + switch (transform.action) { + case 'scaleX': + eventName = 'scaled'; + by = 'x'; + break; + case 'scaleY': + eventName = 'scaled'; + by = 'y'; + break; + case 'skewX': + eventName = 'skewed'; + by = 'x'; + break; + case 'skewY': + eventName = 'skewed'; + by = 'y'; + break; + case 'scale': + eventName = 'scaled'; + by = 'equally'; + break; + case 'rotate': + eventName = 'rotated'; + break; + case 'drag': + eventName = 'moved'; + break; + } + options.by = by; + return eventName; + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDownInDrawingMode: function(e) { + this._isCurrentlyDrawing = true; + if (this.getActiveObject()) { + this.discardActiveObject(e).requestRenderAll(); + } + if (this.clipTo) { + fabric.util.clipContext(this, this.contextTop); + } + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseDown(pointer, { e: e, pointer: pointer }); + this._handleEvent(e, 'down'); + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMoveInDrawingMode: function(e) { + if (this._isCurrentlyDrawing) { + var pointer = this.getPointer(e); + this.freeDrawingBrush.onMouseMove(pointer, { e: e, pointer: pointer }); + } + this.setCursor(this.freeDrawingCursor); + this._handleEvent(e, 'move'); + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUpInDrawingMode: function(e) { + if (this.clipTo) { + this.contextTop.restore(); + } + var pointer = this.getPointer(e); + this._isCurrentlyDrawing = this.freeDrawingBrush.onMouseUp({ e: e, pointer: pointer }); + this._handleEvent(e, 'up'); + }, + + /** + * Method that defines the actions when mouse is clicked on canvas. + * The method inits the currentTransform parameters and renders all the + * canvas so the current image can be placed on the top canvas and the rest + * in on the container one. + * @private + * @param {Event} e Event object fired on mousedown + */ + __onMouseDown: function (e) { + this._cacheTransformEventData(e); + this._handleEvent(e, 'down:before'); + var target = this._target; + // if right click just fire events + if (checkClick(e, RIGHT_CLICK)) { + if (this.fireRightClick) { + this._handleEvent(e, 'down', RIGHT_CLICK); + } + return; + } + + if (checkClick(e, MIDDLE_CLICK)) { + if (this.fireMiddleClick) { + this._handleEvent(e, 'down', MIDDLE_CLICK); + } + return; + } + + if (this.isDrawingMode) { + this._onMouseDownInDrawingMode(e); + return; + } + + if (!this._isMainEvent(e)) { + return; + } + + // ignore if some object is being transformed at this moment + if (this._currentTransform) { + return; + } + + var pointer = this._pointer; + // save pointer for check in __onMouseUp event + this._previousPointer = pointer; + var shouldRender = this._shouldRender(target), + shouldGroup = this._shouldGroup(e, target); + if (this._shouldClearSelection(e, target)) { + this.discardActiveObject(e); + } + else if (shouldGroup) { + this._handleGrouping(e, target); + target = this._activeObject; + } + + if (this.selection && (!target || + (!target.selectable && !target.isEditing && target !== this._activeObject))) { + this._groupSelector = { + ex: pointer.x, + ey: pointer.y, + top: 0, + left: 0 + }; + } + + if (target) { + var alreadySelected = target === this._activeObject; + if (target.selectable) { + this.setActiveObject(target, e); + } + if (target === this._activeObject && (target.__corner || !shouldGroup)) { + this._setupCurrentTransform(e, target, alreadySelected); + } + } + this._handleEvent(e, 'down'); + // we must renderAll so that we update the visuals + (shouldRender || shouldGroup) && this.requestRenderAll(); + }, + + /** + * reset cache form common information needed during event processing + * @private + */ + _resetTransformEventData: function() { + this._target = null; + this._pointer = null; + this._absolutePointer = null; + }, + + /** + * Cache common information needed during event processing + * @private + * @param {Event} e Event object fired on event + */ + _cacheTransformEventData: function(e) { + // reset in order to avoid stale caching + this._resetTransformEventData(); + this._pointer = this.getPointer(e, true); + this._absolutePointer = this.restorePointerVpt(this._pointer); + this._target = this._currentTransform ? this._currentTransform.target : this.findTarget(e) || null; + }, + + /** + * @private + */ + _beforeTransform: function(e) { + var t = this._currentTransform; + this.stateful && t.target.saveState(); + this.fire('before:transform', { + e: e, + transform: t, + }); + // determine if it's a drag or rotate case + if (t.corner) { + this.onBeforeScaleRotate(t.target); + } + }, + + /** + * Method that defines the actions when mouse is hovering the canvas. + * The currentTransform parameter will define whether the user is rotating/scaling/translating + * an image or neither of them (only hovering). A group selection is also possible and would cancel + * all any other type of action. + * In case of an image transformation only the top canvas will be rendered. + * @private + * @param {Event} e Event object fired on mousemove + */ + __onMouseMove: function (e) { + this._handleEvent(e, 'move:before'); + this._cacheTransformEventData(e); + var target, pointer; + + if (this.isDrawingMode) { + this._onMouseMoveInDrawingMode(e); + return; + } + + if (!this._isMainEvent(e)) { + return; + } + + var groupSelector = this._groupSelector; + + // We initially clicked in an empty area, so we draw a box for multiple selection + if (groupSelector) { + pointer = this._pointer; + + groupSelector.left = pointer.x - groupSelector.ex; + groupSelector.top = pointer.y - groupSelector.ey; + + this.renderTop(); + } + else if (!this._currentTransform) { + target = this.findTarget(e) || null; + this._setCursorFromEvent(e, target); + this._fireOverOutEvents(target, e); + } + else { + this._transformObject(e); + } + this._handleEvent(e, 'move'); + this._resetTransformEventData(); + }, + + /** + * Manage the mouseout, mouseover events for the fabric object on the canvas + * @param {Fabric.Object} target the target where the target from the mousemove event + * @param {Event} e Event object fired on mousemove + * @private + */ + _fireOverOutEvents: function(target, e) { + this.fireSyntheticInOutEvents(target, e, { + targetName: '_hoveredTarget', + canvasEvtOut: 'mouse:out', + evtOut: 'mouseout', + canvasEvtIn: 'mouse:over', + evtIn: 'mouseover', + }); + }, + + /** + * Manage the dragEnter, dragLeave events for the fabric objects on the canvas + * @param {Fabric.Object} target the target where the target from the onDrag event + * @param {Event} e Event object fired on ondrag + * @private + */ + _fireEnterLeaveEvents: function(target, e) { + this.fireSyntheticInOutEvents(target, e, { + targetName: '_draggedoverTarget', + evtOut: 'dragleave', + evtIn: 'dragenter', + }); + }, + + /** + * Manage the synthetic in/out events for the fabric objects on the canvas + * @param {Fabric.Object} target the target where the target from the supported events + * @param {Event} e Event object fired + * @param {Object} config configuration for the function to work + * @param {String} config.targetName property on the canvas where the old target is stored + * @param {String} [config.canvasEvtOut] name of the event to fire at canvas level for out + * @param {String} config.evtOut name of the event to fire for out + * @param {String} [config.canvasEvtIn] name of the event to fire at canvas level for in + * @param {String} config.evtIn name of the event to fire for in + * @private + */ + fireSyntheticInOutEvents: function(target, e, config) { + var inOpt, outOpt, oldTarget = this[config.targetName], outFires, inFires, + targetChanged = oldTarget !== target, canvasEvtIn = config.canvasEvtIn, canvasEvtOut = config.canvasEvtOut; + if (targetChanged) { + inOpt = { e: e, target: target, previousTarget: oldTarget }; + outOpt = { e: e, target: oldTarget, nextTarget: target }; + this[config.targetName] = target; + } + inFires = target && targetChanged; + outFires = oldTarget && targetChanged; + if (outFires) { + canvasEvtOut && this.fire(canvasEvtOut, outOpt); + oldTarget.fire(config.evtOut, outOpt); + } + if (inFires) { + canvasEvtIn && this.fire(canvasEvtIn, inOpt); + target.fire(config.evtIn, inOpt); + } + }, + + /** + * Method that defines actions when an Event Mouse Wheel + * @param {Event} e Event object fired on mouseup + */ + __onMouseWheel: function(e) { + this._cacheTransformEventData(e); + this._handleEvent(e, 'wheel'); + this._resetTransformEventData(); + }, + + /** + * @private + * @param {Event} e Event fired on mousemove + */ + _transformObject: function(e) { + var pointer = this.getPointer(e), + transform = this._currentTransform; + + transform.reset = false; + transform.target.isMoving = true; + transform.shiftKey = e.shiftKey; + transform.altKey = e[this.centeredKey]; + + this._beforeScaleTransform(e, transform); + this._performTransformAction(e, transform, pointer); + + transform.actionPerformed && this.requestRenderAll(); + }, + + /** + * @private + */ + _performTransformAction: function(e, transform, pointer) { + var x = pointer.x, + y = pointer.y, + action = transform.action, + actionPerformed = false, + options = { + target: transform.target, + e: e, + transform: transform, + pointer: pointer + }; + + if (action === 'rotate') { + (actionPerformed = this._rotateObject(x, y)) && this._fire('rotating', options); + } + else if (action === 'scale') { + (actionPerformed = this._onScale(e, transform, x, y)) && this._fire('scaling', options); + } + else if (action === 'scaleX') { + (actionPerformed = this._scaleObject(x, y, 'x')) && this._fire('scaling', options); + } + else if (action === 'scaleY') { + (actionPerformed = this._scaleObject(x, y, 'y')) && this._fire('scaling', options); + } + else if (action === 'skewX') { + (actionPerformed = this._skewObject(x, y, 'x')) && this._fire('skewing', options); + } + else if (action === 'skewY') { + (actionPerformed = this._skewObject(x, y, 'y')) && this._fire('skewing', options); + } + else { + actionPerformed = this._translateObject(x, y); + if (actionPerformed) { + this._fire('moving', options); + this.setCursor(options.target.moveCursor || this.moveCursor); + } + } + transform.actionPerformed = transform.actionPerformed || actionPerformed; + }, + + /** + * @private + */ + _fire: function(eventName, options) { + this.fire('object:' + eventName, options); + options.target.fire(eventName, options); + }, + + /** + * @private + */ + _beforeScaleTransform: function(e, transform) { + if (transform.action === 'scale' || transform.action === 'scaleX' || transform.action === 'scaleY') { + var centerTransform = this._shouldCenterTransform(transform.target); + + // Switch from a normal resize to center-based + if ((centerTransform && (transform.originX !== 'center' || transform.originY !== 'center')) || + // Switch from center-based resize to normal one + (!centerTransform && transform.originX === 'center' && transform.originY === 'center') + ) { + this._resetCurrentTransform(); + transform.reset = true; + } + } + }, + + /** + * @private + * @param {Event} e Event object + * @param {Object} transform current transform + * @param {Number} x mouse position x from origin + * @param {Number} y mouse position y from origin + * @return {Boolean} true if the scaling occurred + */ + _onScale: function(e, transform, x, y) { + if (this._isUniscalePossible(e, transform.target)) { + transform.currentAction = 'scale'; + return this._scaleObject(x, y); + } + else { + // Switch from a normal resize to proportional + if (!transform.reset && transform.currentAction === 'scale') { + this._resetCurrentTransform(); + } + + transform.currentAction = 'scaleEqually'; + return this._scaleObject(x, y, 'equally'); + } + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target current target + * @return {Boolean} true if unproportional scaling is possible + */ + _isUniscalePossible: function(e, target) { + return (e[this.uniScaleKey] || this.uniScaleTransform) && !target.get('lockUniScaling'); + }, + + /** + * Sets the cursor depending on where the canvas is being hovered. + * Note: very buggy in Opera + * @param {Event} e Event object + * @param {Object} target Object that the mouse is hovering, if so. + */ + _setCursorFromEvent: function (e, target) { + if (!target) { + this.setCursor(this.defaultCursor); + return false; + } + var hoverCursor = target.hoverCursor || this.hoverCursor, + activeSelection = this._activeObject && this._activeObject.type === 'activeSelection' ? + this._activeObject : null, + // only show proper corner when group selection is not active + corner = (!activeSelection || !activeSelection.contains(target)) + && target._findTargetCorner(this.getPointer(e, true)); + + if (!corner) { + this.setCursor(hoverCursor); + } + else { + this.setCursor(this.getCornerCursor(corner, target, e)); + } + }, + + /** + * @private + */ + getCornerCursor: function(corner, target, e) { + if (this.actionIsDisabled(corner, target, e)) { + return this.notAllowedCursor; + } + else if (corner in cursorOffset) { + return this._getRotatedCornerCursor(corner, target, e); + } + else if (corner === 'mtr' && target.hasRotatingPoint) { + return this.rotationCursor; + } + else { + return this.defaultCursor; + } + }, + + actionIsDisabled: function(corner, target, e) { + if (corner === 'mt' || corner === 'mb') { + return e[this.altActionKey] ? target.lockSkewingX : target.lockScalingY; + } + else if (corner === 'ml' || corner === 'mr') { + return e[this.altActionKey] ? target.lockSkewingY : target.lockScalingX; + } + else if (corner === 'mtr') { + return target.lockRotation; + } + else { + return this._isUniscalePossible(e, target) ? + target.lockScalingX && target.lockScalingY : target.lockScalingX || target.lockScalingY; + } + }, + + /** + * @private + */ + _getRotatedCornerCursor: function(corner, target, e) { + var n = Math.round((target.angle % 360) / 45); + + if (n < 0) { + n += 8; // full circle ahead + } + n += cursorOffset[corner]; + if (e[this.altActionKey] && cursorOffset[corner] % 2 === 0) { + //if we are holding shift and we are on a mx corner... + n += 2; + } + // normalize n to be from 0 to 7 + n %= 8; + + return this.cursorMap[n]; + } + }); +})(); +(function() { + + var min = Math.min, + max = Math.max; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + * @return {Boolean} + */ + _shouldGroup: function(e, target) { + var activeObject = this._activeObject; + return activeObject && this._isSelectionKeyPressed(e) && target && target.selectable && this.selection && + (activeObject !== target || activeObject.type === 'activeSelection') && !target.onSelect({ e: e }); + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _handleGrouping: function (e, target) { + var activeObject = this._activeObject; + // avoid multi select when shift click on a corner + if (activeObject.__corner) { + return; + } + if (target === activeObject) { + // if it's a group, find target again, using activeGroup objects + target = this.findTarget(e, true); + // if even object is not found or we are on activeObjectCorner, bail out + if (!target || !target.selectable) { + return; + } + } + if (activeObject && activeObject.type === 'activeSelection') { + this._updateActiveSelection(target, e); + } + else { + this._createActiveSelection(target, e); + } + }, + + /** + * @private + */ + _updateActiveSelection: function(target, e) { + var activeSelection = this._activeObject, + currentActiveObjects = activeSelection._objects.slice(0); + if (activeSelection.contains(target)) { + activeSelection.removeWithUpdate(target); + this._hoveredTarget = target; + if (activeSelection.size() === 1) { + // activate last remaining object + this._setActiveObject(activeSelection.item(0), e); + } + } + else { + activeSelection.addWithUpdate(target); + this._hoveredTarget = activeSelection; + } + this._fireSelectionEvents(currentActiveObjects, e); + }, + + /** + * @private + */ + _createActiveSelection: function(target, e) { + var currentActives = this.getActiveObjects(), group = this._createGroup(target); + this._hoveredTarget = group; + this._setActiveObject(group, e); + this._fireSelectionEvents(currentActives, e); + }, + + /** + * @private + * @param {Object} target + */ + _createGroup: function(target) { + var objects = this._objects, + isActiveLower = objects.indexOf(this._activeObject) < objects.indexOf(target), + groupObjects = isActiveLower + ? [this._activeObject, target] + : [target, this._activeObject]; + this._activeObject.isEditing && this._activeObject.exitEditing(); + return new fabric.ActiveSelection(groupObjects, { + canvas: this + }); + }, + + /** + * @private + * @param {Event} e mouse event + */ + _groupSelectedObjects: function (e) { + + var group = this._collectObjects(e), + aGroup; + + // do not create group for 1 element only + if (group.length === 1) { + this.setActiveObject(group[0], e); + } + else if (group.length > 1) { + aGroup = new fabric.ActiveSelection(group.reverse(), { + canvas: this + }); + this.setActiveObject(aGroup, e); + } + }, + + /** + * @private + */ + _collectObjects: function(e) { + var group = [], + currentObject, + x1 = this._groupSelector.ex, + y1 = this._groupSelector.ey, + x2 = x1 + this._groupSelector.left, + y2 = y1 + this._groupSelector.top, + selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)), + selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2)), + allowIntersect = !this.selectionFullyContained, + isClick = x1 === x2 && y1 === y2; + // we iterate reverse order to collect top first in case of click. + for (var i = this._objects.length; i--; ) { + currentObject = this._objects[i]; + + if (!currentObject || !currentObject.selectable || !currentObject.visible) { + continue; + } + + if ((allowIntersect && currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2)) || + currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2) || + (allowIntersect && currentObject.containsPoint(selectionX1Y1)) || + (allowIntersect && currentObject.containsPoint(selectionX2Y2)) + ) { + group.push(currentObject); + // only add one object if it's a click + if (isClick) { + break; + } + } + } + + if (group.length > 1) { + group = group.filter(function(object) { + return !object.onSelect({ e: e }); + }); + } + + return group; + }, + + /** + * @private + */ + _maybeGroupObjects: function(e) { + if (this.selection && this._groupSelector) { + this._groupSelectedObjects(e); + } + this.setCursor(this.defaultCursor); + // clear selection and current transformation + this._groupSelector = null; + } + }); + +})(); +(function () { + fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Exports canvas element to a dataurl image. Note that when multiplier is used, cropping is scaled appropriately + * @param {Object} [options] Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by, to have consistent + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 2.0.0 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + * @see {@link http://jsfiddle.net/fabricjs/NfZVb/|jsFiddle demo} + * @example Generate jpeg dataURL with lower quality + * var dataURL = canvas.toDataURL({ + * format: 'jpeg', + * quality: 0.8 + * }); + * @example Generate cropped png dataURL (clipping of canvas) + * var dataURL = canvas.toDataURL({ + * format: 'png', + * left: 100, + * top: 100, + * width: 200, + * height: 200 + * }); + * @example Generate double scaled png dataURL + * var dataURL = canvas.toDataURL({ + * format: 'png', + * multiplier: 2 + * }); + */ + toDataURL: function (options) { + options || (options = { }); + + var format = options.format || 'png', + quality = options.quality || 1, + multiplier = (options.multiplier || 1) * (options.enableRetinaScaling ? this.getRetinaScaling() : 1), + canvasEl = this.toCanvasElement(multiplier, options); + return fabric.util.toDataURL(canvasEl, format, quality); + }, + + /** + * Create a new HTMLCanvas element painted with the current canvas content. + * No need to resize the actual one or repaint it. + * Will transfer object ownership to a new canvas, paint it, and set everything back. + * This is an intermediary step used to get to a dataUrl but also it is useful to + * create quick image copies of a canvas without passing for the dataUrl string + * @param {Number} [multiplier] a zoom factor. + * @param {Object} [cropping] Cropping informations + * @param {Number} [cropping.left] Cropping left offset. + * @param {Number} [cropping.top] Cropping top offset. + * @param {Number} [cropping.width] Cropping width. + * @param {Number} [cropping.height] Cropping height. + */ + toCanvasElement: function(multiplier, cropping) { + multiplier = multiplier || 1; + cropping = cropping || { }; + var scaledWidth = (cropping.width || this.width) * multiplier, + scaledHeight = (cropping.height || this.height) * multiplier, + zoom = this.getZoom(), + originalWidth = this.width, + originalHeight = this.height, + newZoom = zoom * multiplier, + vp = this.viewportTransform, + translateX = (vp[4] - (cropping.left || 0)) * multiplier, + translateY = (vp[5] - (cropping.top || 0)) * multiplier, + originalInteractive = this.interactive, + newVp = [newZoom, 0, 0, newZoom, translateX, translateY], + originalRetina = this.enableRetinaScaling, + canvasEl = fabric.util.createCanvasElement(), + originalContextTop = this.contextTop; + canvasEl.width = scaledWidth; + canvasEl.height = scaledHeight; + this.contextTop = null; + this.enableRetinaScaling = false; + this.interactive = false; + this.viewportTransform = newVp; + this.width = scaledWidth; + this.height = scaledHeight; + this.calcViewportBoundaries(); + this.renderCanvas(canvasEl.getContext('2d'), this._objects); + this.viewportTransform = vp; + this.width = originalWidth; + this.height = originalHeight; + this.calcViewportBoundaries(); + this.interactive = originalInteractive; + this.enableRetinaScaling = originalRetina; + this.contextTop = originalContextTop; + return canvasEl; + }, + }); + +})(); +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Populates canvas with data from the specified dataless JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toDatalessJSON} + * @deprecated since 1.2.2 + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#deserialization} + */ + loadFromDatalessJSON: function (json, callback, reviver) { + return this.loadFromJSON(json, callback, reviver); + }, + + /** + * Populates canvas with data from the specified JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toJSON} + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#deserialization} + * @see {@link http://jsfiddle.net/fabricjs/fmgXt/|jsFiddle demo} + * @example loadFromJSON + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas)); + * @example loadFromJSON with reviver + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas), function(o, object) { + * // `o` = json object + * // `object` = fabric.Object instance + * // ... do some stuff ... + * }); + */ + loadFromJSON: function (json, callback, reviver) { + if (!json) { + return; + } + + // serialize if it wasn't already + var serialized = (typeof json === 'string') + ? JSON.parse(json) + : fabric.util.object.clone(json); + + var _this = this, + clipPath = serialized.clipPath, + renderOnAddRemove = this.renderOnAddRemove; + + this.renderOnAddRemove = false; + + delete serialized.clipPath; + + this._enlivenObjects(serialized.objects, function (enlivenedObjects) { + _this.clear(); + _this._setBgOverlay(serialized, function () { + if (clipPath) { + _this._enlivenObjects([clipPath], function (enlivenedCanvasClip) { + _this.clipPath = enlivenedCanvasClip[0]; + _this.__setupCanvas.call(_this, serialized, enlivenedObjects, renderOnAddRemove, callback); + }); + } + else { + _this.__setupCanvas.call(_this, serialized, enlivenedObjects, renderOnAddRemove, callback); + } + }); + }, reviver); + return this; + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Array} restored canvas objects + * @param {Function} cached renderOnAddRemove callback + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + __setupCanvas: function(serialized, enlivenedObjects, renderOnAddRemove, callback) { + var _this = this; + enlivenedObjects.forEach(function(obj, index) { + // we splice the array just in case some custom classes restored from JSON + // will add more object to canvas at canvas init. + _this.insertAt(obj, index); + }); + this.renderOnAddRemove = renderOnAddRemove; + // remove parts i cannot set as options + delete serialized.objects; + delete serialized.backgroundImage; + delete serialized.overlayImage; + delete serialized.background; + delete serialized.overlay; + // this._initOptions does too many things to just + // call it. Normally loading an Object from JSON + // create the Object instance. Here the Canvas is + // already an instance and we are just loading things over it + this._setOptions(serialized); + this.renderAll(); + callback && callback(); + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + _setBgOverlay: function(serialized, callback) { + var loaded = { + backgroundColor: false, + overlayColor: false, + backgroundImage: false, + overlayImage: false + }; + + if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) { + callback && callback(); + return; + } + + var cbIfLoaded = function () { + if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) { + callback && callback(); + } + }; + + this.__setBgOverlay('backgroundImage', serialized.backgroundImage, loaded, cbIfLoaded); + this.__setBgOverlay('overlayImage', serialized.overlayImage, loaded, cbIfLoaded); + this.__setBgOverlay('backgroundColor', serialized.background, loaded, cbIfLoaded); + this.__setBgOverlay('overlayColor', serialized.overlay, loaded, cbIfLoaded); + }, + + /** + * @private + * @param {String} property Property to set (backgroundImage, overlayImage, backgroundColor, overlayColor) + * @param {(Object|String)} value Value to set + * @param {Object} loaded Set loaded property to true if property is set + * @param {Object} callback Callback function to invoke after property is set + */ + __setBgOverlay: function(property, value, loaded, callback) { + var _this = this; + + if (!value) { + loaded[property] = true; + callback && callback(); + return; + } + + if (property === 'backgroundImage' || property === 'overlayImage') { + fabric.util.enlivenObjects([value], function(enlivedObject){ + _this[property] = enlivedObject[0]; + loaded[property] = true; + callback && callback(); + }); + } + else { + this['set' + fabric.util.string.capitalize(property, true)](value, function() { + loaded[property] = true; + callback && callback(); + }); + } + }, + + /** + * @private + * @param {Array} objects + * @param {Function} callback + * @param {Function} [reviver] + */ + _enlivenObjects: function (objects, callback, reviver) { + if (!objects || objects.length === 0) { + callback && callback([]); + return; + } + + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, null, reviver); + }, + + /** + * @private + * @param {String} format + * @param {Function} callback + */ + _toDataURL: function (format, callback) { + this.clone(function (clone) { + callback(clone.toDataURL(format)); + }); + }, + + /** + * @private + * @param {String} format + * @param {Number} multiplier + * @param {Function} callback + */ + _toDataURLWithMultiplier: function (format, multiplier, callback) { + this.clone(function (clone) { + callback(clone.toDataURLWithMultiplier(format, multiplier)); + }); + }, + + /** + * Clones canvas instance + * @param {Object} [callback] Receives cloned instance as a first argument + * @param {Array} [properties] Array of properties to include in the cloned canvas and children + */ + clone: function (callback, properties) { + var data = JSON.stringify(this.toJSON(properties)); + this.cloneWithoutData(function(clone) { + clone.loadFromJSON(data, function() { + callback && callback(clone); + }); + }); + }, + + /** + * Clones canvas instance without cloning existing data. + * This essentially copies canvas dimensions, clipping properties, etc. + * but leaves data empty (so that you can populate it with your own) + * @param {Object} [callback] Receives cloned instance as a first argument + */ + cloneWithoutData: function(callback) { + var el = fabric.util.createCanvasElement(); + + el.width = this.width; + el.height = this.height; + + var clone = new fabric.Canvas(el); + clone.clipTo = this.clipTo; + if (this.backgroundImage) { + clone.setBackgroundImage(this.backgroundImage.src, function() { + clone.renderAll(); + callback && callback(clone); + }); + clone.backgroundImageOpacity = this.backgroundImageOpacity; + clone.backgroundImageStretch = this.backgroundImageStretch; + } + else { + callback && callback(clone); + } + } +}); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + capitalize = fabric.util.string.capitalize, + degreesToRadians = fabric.util.degreesToRadians, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'), + objectCaching = !fabric.isLikelyNode, + ALIASING_LIMIT = 2; + + if (fabric.Object) { + return; + } + + /** + * Root object class from which all 2d shape classes inherit from + * @class fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#objects} + * @see {@link fabric.Object#initialize} for constructor definition + * + * @fires added + * @fires removed + * + * @fires selected + * @fires deselected + * @fires modified + * @fires modified + * @fires moved + * @fires scaled + * @fires rotated + * @fires skewed + * + * @fires rotating + * @fires scaling + * @fires moving + * @fires skewing + * + * @fires mousedown + * @fires mouseup + * @fires mouseover + * @fires mouseout + * @fires mousewheel + * @fires mousedblclick + * + * @fires dragover + * @fires dragenter + * @fires dragleave + * @fires drop + */ + fabric.Object = fabric.util.createClass(fabric.CommonMethods, /** @lends fabric.Object.prototype */ { + + /** + * Type of an object (rect, circle, path, etc.). + * Note that this property is meant to be read-only and not meant to be modified. + * If you modify, certain parts of Fabric (such as JSON loading) won't work correctly. + * @type String + * @default + */ + type: 'object', + + /** + * Horizontal origin of transformation of an object (one of "left", "right", "center") + * See http://jsfiddle.net/1ow02gea/244/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originX: 'left', + + /** + * Vertical origin of transformation of an object (one of "top", "bottom", "center") + * See http://jsfiddle.net/1ow02gea/244/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originY: 'top', + + /** + * Top position of an object. Note that by default it's relative to object top. You can change this by setting originY={top/center/bottom} + * @type Number + * @default + */ + top: 0, + + /** + * Left position of an object. Note that by default it's relative to object left. You can change this by setting originX={left/center/right} + * @type Number + * @default + */ + left: 0, + + /** + * Object width + * @type Number + * @default + */ + width: 0, + + /** + * Object height + * @type Number + * @default + */ + height: 0, + + /** + * Object scale factor (horizontal) + * @type Number + * @default + */ + scaleX: 1, + + /** + * Object scale factor (vertical) + * @type Number + * @default + */ + scaleY: 1, + + /** + * When true, an object is rendered as flipped horizontally + * @type Boolean + * @default + */ + flipX: false, + + /** + * When true, an object is rendered as flipped vertically + * @type Boolean + * @default + */ + flipY: false, + + /** + * Opacity of an object + * @type Number + * @default + */ + opacity: 1, + + /** + * Angle of rotation of an object (in degrees) + * @type Number + * @default + */ + angle: 0, + + /** + * Angle of skew on x axes of an object (in degrees) + * @type Number + * @default + */ + skewX: 0, + + /** + * Angle of skew on y axes of an object (in degrees) + * @type Number + * @default + */ + skewY: 0, + + /** + * Size of object's controlling corners (in pixels) + * @type Number + * @default + */ + cornerSize: 13, + + /** + * When true, object's controlling corners are rendered as transparent inside (i.e. stroke instead of fill) + * @type Boolean + * @default + */ + transparentCorners: true, + + /** + * Default cursor value used when hovering over this object on canvas + * @type String + * @default + */ + hoverCursor: null, + + /** + * Default cursor value used when moving this object on canvas + * @type String + * @default + */ + moveCursor: null, + + /** + * Padding between object and its controlling borders (in pixels) + * @type Number + * @default + */ + padding: 0, + + /** + * Color of controlling borders of an object (when it's active) + * @type String + * @default + */ + borderColor: 'rgba(102,153,255,0.75)', + + /** + * Array specifying dash pattern of an object's borders (hasBorder must be true) + * @since 1.6.2 + * @type Array + */ + borderDashArray: null, + + /** + * Color of controlling corners of an object (when it's active) + * @type String + * @default + */ + cornerColor: 'rgba(102,153,255,0.5)', + + /** + * Color of controlling corners of an object (when it's active and transparentCorners false) + * @since 1.6.2 + * @type String + * @default + */ + cornerStrokeColor: null, + + /** + * Specify style of control, 'rect' or 'circle' + * @since 1.6.2 + * @type String + */ + cornerStyle: 'rect', + + /** + * Array specifying dash pattern of an object's control (hasBorder must be true) + * @since 1.6.2 + * @type Array + */ + cornerDashArray: null, + + /** + * When true, this object will use center point as the origin of transformation + * when being scaled via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, this object will use center point as the origin of transformation + * when being rotated via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: true, + + /** + * Color of object's fill + * takes css colors https://www.w3.org/TR/css-color-3/ + * @type String + * @default + */ + fill: 'rgb(0,0,0)', + + /** + * Fill rule used to fill an object + * accepted values are nonzero, evenodd + * Backwards incompatibility note: This property was used for setting globalCompositeOperation until v1.4.12 (use `fabric.Object#globalCompositeOperation` instead) + * @type String + * @default + */ + fillRule: 'nonzero', + + /** + * Composite rule used for canvas globalCompositeOperation + * @type String + * @default + */ + globalCompositeOperation: 'source-over', + + /** + * Background color of an object. + * takes css colors https://www.w3.org/TR/css-color-3/ + * @type String + * @default + */ + backgroundColor: '', + + /** + * Selection Background color of an object. colored layer behind the object when it is active. + * does not mix good with globalCompositeOperation methods. + * @type String + * @default + */ + selectionBackgroundColor: '', + + /** + * When defined, an object is rendered via stroke and this property specifies its color + * takes css colors https://www.w3.org/TR/css-color-3/ + * @type String + * @default + */ + stroke: null, + + /** + * Width of a stroke used to render this object + * @type Number + * @default + */ + strokeWidth: 1, + + /** + * Array specifying dash pattern of an object's stroke (stroke must be defined) + * @type Array + */ + strokeDashArray: null, + + /** + * Line offset of an object's stroke + * @type Number + * @default + */ + strokeDashOffset: 0, + + /** + * Line endings style of an object's stroke (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'butt', + + /** + * Corner style of an object's stroke (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'miter', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke + * @type Number + * @default + */ + strokeMiterLimit: 4, + + /** + * Shadow object representing shadow of this shape + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Opacity of object's controlling borders when object is active and moving + * @type Number + * @default + */ + borderOpacityWhenMoving: 0.4, + + /** + * Scale factor of object's controlling borders + * @type Number + * @default + */ + borderScaleFactor: 1, + + /** + * Transform matrix (similar to SVG's transform matrix) + * This property has been depreacted. Since caching and and qrDecompose this + * property can be handled with the standard top,left,scaleX,scaleY,angle and skewX. + * A documentation example on how to parse and merge a transformMatrix will be provided before + * completely removing it in fabric 4.0 + * If you are starting a project now, DO NOT use it. + * @deprecated since 3.2.0 + * @type Array + */ + transformMatrix: null, + + /** + * Minimum allowed scale value of an object + * @type Number + * @default + */ + minScaleLimit: 0, + + /** + * When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection). + * But events still fire on it. + * @type Boolean + * @default + */ + selectable: true, + + /** + * When set to `false`, an object can not be a target of events. All events propagate through it. Introduced in v1.3.4 + * @type Boolean + * @default + */ + evented: true, + + /** + * When set to `false`, an object is not rendered on canvas + * @type Boolean + * @default + */ + visible: true, + + /** + * When set to `false`, object's controls are not displayed and can not be used to manipulate object + * @type Boolean + * @default + */ + hasControls: true, + + /** + * When set to `false`, object's controlling borders are not rendered + * @type Boolean + * @default + */ + hasBorders: true, + + /** + * When set to `false`, object's controlling rotating point will not be visible or selectable + * @type Boolean + * @default + */ + hasRotatingPoint: true, + + /** + * Offset for object's controlling rotating point (when enabled via `hasRotatingPoint`) + * @type Number + * @default + */ + rotatingPointOffset: 40, + + /** + * When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * When `false`, default object's values are not included in its serialization + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Function that determines clipping of an object (context is passed as a first argument). + * If you are using code minification, ctx argument can be minified/manglied you should use + * as a workaround `var ctx = arguments[0];` in the function; + * Note that context origin is at the object's center point (not left/top corner) + * @deprecated since 2.0.0 + * @type Function + */ + clipTo: null, + + /** + * When `true`, object horizontal movement is locked + * @type Boolean + * @default + */ + lockMovementX: false, + + /** + * When `true`, object vertical movement is locked + * @type Boolean + * @default + */ + lockMovementY: false, + + /** + * When `true`, object rotation is locked + * @type Boolean + * @default + */ + lockRotation: false, + + /** + * When `true`, object horizontal scaling is locked + * @type Boolean + * @default + */ + lockScalingX: false, + + /** + * When `true`, object vertical scaling is locked + * @type Boolean + * @default + */ + lockScalingY: false, + + /** + * When `true`, object non-uniform scaling is locked + * @type Boolean + * @default + */ + lockUniScaling: false, + + /** + * When `true`, object horizontal skewing is locked + * @type Boolean + * @default + */ + lockSkewingX: false, + + /** + * When `true`, object vertical skewing is locked + * @type Boolean + * @default + */ + lockSkewingY: false, + + /** + * When `true`, object cannot be flipped by scaling into negative values + * @type Boolean + * @default + */ + lockScalingFlip: false, + + /** + * When `true`, object is not exported in OBJECT/JSON + * @since 1.6.3 + * @type Boolean + * @default + */ + excludeFromExport: false, + + /** + * When `true`, object is cached on an additional canvas. + * When `false`, object is not cached unless necessary ( clipPath ) + * default to true + * @since 1.7.0 + * @type Boolean + * @default true + */ + objectCaching: objectCaching, + + /** + * When `true`, object properties are checked for cache invalidation. In some particular + * situation you may want this to be disabled ( spray brush, very big, groups) + * or if your application does not allow you to modify properties for groups child you want + * to disable it for groups. + * default to false + * since 1.7.0 + * @type Boolean + * @default false + */ + statefullCache: false, + + /** + * When `true`, cache does not get updated during scaling. The picture will get blocky if scaled + * too much and will be redrawn with correct details at the end of scaling. + * this setting is performance and application dependant. + * default to true + * since 1.7.0 + * @type Boolean + * @default true + */ + noScaleCache: true, + + /** + * When `false`, the stoke width will scale with the object. + * When `true`, the stroke will always match the exact pixel size entered for stroke width. + * default to false + * @since 2.6.0 + * @type Boolean + * @default false + * @type Boolean + * @default false + */ + strokeUniform: false, + + /** + * When set to `true`, object's cache will be rerendered next render call. + * since 1.7.0 + * @type Boolean + * @default true + */ + dirty: true, + + /** + * keeps the value of the last hovered corner during mouse move. + * 0 is no corner, or 'mt', 'ml', 'mtr' etc.. + * It should be private, but there is no harm in using it as + * a read-only property. + * @type number|string|any + * @default 0 + */ + __corner: 0, + + /** + * Determines if the fill or the stroke is drawn first (one of "fill" or "stroke") + * @type String + * @default + */ + paintFirst: 'fill', + + /** + * List of properties to consider when checking if state + * of an object is changed (fabric.Object#hasStateChanged) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: ( + 'top left width height scaleX scaleY flipX flipY originX originY transformMatrix ' + + 'stroke strokeWidth strokeDashArray strokeLineCap strokeDashOffset strokeLineJoin strokeMiterLimit ' + + 'angle opacity fill globalCompositeOperation shadow clipTo visible backgroundColor ' + + 'skewX skewY fillRule paintFirst clipPath strokeUniform' + ).split(' '), + + /** + * List of properties to consider when checking if cache needs refresh + * Those properties are checked by statefullCache ON ( or lazy mode if we want ) or from single + * calls to Object.set(key, value). If the key is in this list, the object is marked as dirty + * and refreshed at the next render + * @type Array + */ + cacheProperties: ( + 'fill stroke strokeWidth strokeDashArray width height paintFirst strokeUniform' + + ' strokeLineCap strokeDashOffset strokeLineJoin strokeMiterLimit backgroundColor clipPath' + ).split(' '), + + /** + * a fabricObject that, without stroke define a clipping area with their shape. filled in black + * the clipPath object gets used when the object has rendered, and the context is placed in the center + * of the object cacheCanvas. + * If you want 0,0 of a clipPath to align with an object center, use clipPath.originX/Y to 'center' + * @type fabric.Object + */ + clipPath: undefined, + + /** + * Meaningful ONLY when the object is used as clipPath. + * if true, the clipPath will make the object clip to the outside of the clipPath + * since 2.4.0 + * @type boolean + * @default false + */ + inverted: false, + + /** + * Meaningful ONLY when the object is used as clipPath. + * if true, the clipPath will have its top and left relative to canvas, and will + * not be influenced by the object transform. This will make the clipPath relative + * to the canvas, but clipping just a particular object. + * WARNING this is beta, this feature may change or be renamed. + * since 2.4.0 + * @type boolean + * @default false + */ + absolutePositioned: false, + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * Create a the canvas used to keep the cached copy of the object + * @private + */ + _createCacheCanvas: function() { + this._cacheProperties = {}; + this._cacheCanvas = fabric.util.createCanvasElement(); + this._cacheContext = this._cacheCanvas.getContext('2d'); + this._updateCacheCanvas(); + // if canvas gets created, is empty, so dirty. + this.dirty = true; + }, + + /** + * Limit the cache dimensions so that X * Y do not cross fabric.perfLimitSizeTotal + * and each side do not cross fabric.cacheSideLimit + * those numbers are configurable so that you can get as much detail as you want + * making bargain with performances. + * @param {Object} dims + * @param {Object} dims.width width of canvas + * @param {Object} dims.height height of canvas + * @param {Object} dims.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @param {Object} dims.zoomY zoomY zoom value to unscale the canvas before drawing cache + * @return {Object}.width width of canvas + * @return {Object}.height height of canvas + * @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache + */ + _limitCacheSize: function(dims) { + var perfLimitSizeTotal = fabric.perfLimitSizeTotal, + width = dims.width, height = dims.height, + max = fabric.maxCacheSideLimit, min = fabric.minCacheSideLimit; + if (width <= max && height <= max && width * height <= perfLimitSizeTotal) { + if (width < min) { + dims.width = min; + } + if (height < min) { + dims.height = min; + } + return dims; + } + var ar = width / height, limitedDims = fabric.util.limitDimsByArea(ar, perfLimitSizeTotal), + capValue = fabric.util.capValue, + x = capValue(min, limitedDims.x, max), + y = capValue(min, limitedDims.y, max); + if (width > x) { + dims.zoomX /= width / x; + dims.width = x; + dims.capped = true; + } + if (height > y) { + dims.zoomY /= height / y; + dims.height = y; + dims.capped = true; + } + return dims; + }, + + /** + * Return the dimension and the zoom level needed to create a cache canvas + * big enough to host the object to be cached. + * @private + * @return {Object}.x width of object to be cached + * @return {Object}.y height of object to be cached + * @return {Object}.width width of canvas + * @return {Object}.height height of canvas + * @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache + */ + _getCacheCanvasDimensions: function() { + var objectScale = this.getTotalObjectScaling(), + // caculate dimensions without skewing + dim = this._getTransformedDimensions(0, 0), + neededX = dim.x * objectScale.scaleX / this.scaleX, + neededY = dim.y * objectScale.scaleY / this.scaleY; + return { + // for sure this ALIASING_LIMIT is slightly creating problem + // in situation in which the cache canvas gets an upper limit + // also objectScale contains already scaleX and scaleY + width: neededX + ALIASING_LIMIT, + height: neededY + ALIASING_LIMIT, + zoomX: objectScale.scaleX, + zoomY: objectScale.scaleY, + x: neededX, + y: neededY + }; + }, + + /** + * Update width and height of the canvas for cache + * returns true or false if canvas needed resize. + * @private + * @return {Boolean} true if the canvas has been resized + */ + _updateCacheCanvas: function() { + var targetCanvas = this.canvas; + if (this.noScaleCache && targetCanvas && targetCanvas._currentTransform) { + var target = targetCanvas._currentTransform.target, + action = targetCanvas._currentTransform.action; + if (this === target && action.slice && action.slice(0, 5) === 'scale') { + return false; + } + } + var canvas = this._cacheCanvas, + dims = this._limitCacheSize(this._getCacheCanvasDimensions()), + minCacheSize = fabric.minCacheSideLimit, + width = dims.width, height = dims.height, drawingWidth, drawingHeight, + zoomX = dims.zoomX, zoomY = dims.zoomY, + dimensionsChanged = width !== this.cacheWidth || height !== this.cacheHeight, + zoomChanged = this.zoomX !== zoomX || this.zoomY !== zoomY, + shouldRedraw = dimensionsChanged || zoomChanged, + additionalWidth = 0, additionalHeight = 0, shouldResizeCanvas = false; + if (dimensionsChanged) { + var canvasWidth = this._cacheCanvas.width, + canvasHeight = this._cacheCanvas.height, + sizeGrowing = width > canvasWidth || height > canvasHeight, + sizeShrinking = (width < canvasWidth * 0.9 || height < canvasHeight * 0.9) && + canvasWidth > minCacheSize && canvasHeight > minCacheSize; + shouldResizeCanvas = sizeGrowing || sizeShrinking; + if (sizeGrowing && !dims.capped && (width > minCacheSize || height > minCacheSize)) { + additionalWidth = width * 0.1; + additionalHeight = height * 0.1; + } + } + if (shouldRedraw) { + if (shouldResizeCanvas) { + canvas.width = Math.ceil(width + additionalWidth); + canvas.height = Math.ceil(height + additionalHeight); + } + else { + this._cacheContext.setTransform(1, 0, 0, 1, 0, 0); + this._cacheContext.clearRect(0, 0, canvas.width, canvas.height); + } + drawingWidth = dims.x / 2; + drawingHeight = dims.y / 2; + this.cacheTranslationX = Math.round(canvas.width / 2 - drawingWidth) + drawingWidth; + this.cacheTranslationY = Math.round(canvas.height / 2 - drawingHeight) + drawingHeight; + this.cacheWidth = width; + this.cacheHeight = height; + this._cacheContext.translate(this.cacheTranslationX, this.cacheTranslationY); + this._cacheContext.scale(zoomX, zoomY); + this.zoomX = zoomX; + this.zoomY = zoomY; + return true; + } + return false; + }, + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + this._setOptions(options); + this._initGradient(options.fill, 'fill'); + this._initGradient(options.stroke, 'stroke'); + this._initClipping(options); + this._initPattern(options.fill, 'fill'); + this._initPattern(options.stroke, 'stroke'); + }, + + /** + * Transforms context when rendering an object + * @param {CanvasRenderingContext2D} ctx Context + */ + transform: function(ctx) { + var m; + if (this.group && !this.group._transformDone) { + m = this.calcTransformMatrix(); + } + else { + m = this.calcOwnMatrix(); + } + ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + }, + + /** + * Returns an object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + object = { + type: this.type, + version: fabric.version, + originX: this.originX, + originY: this.originY, + left: toFixed(this.left, NUM_FRACTION_DIGITS), + top: toFixed(this.top, NUM_FRACTION_DIGITS), + width: toFixed(this.width, NUM_FRACTION_DIGITS), + height: toFixed(this.height, NUM_FRACTION_DIGITS), + fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill, + stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke, + strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS), + strokeDashArray: this.strokeDashArray ? this.strokeDashArray.concat() : this.strokeDashArray, + strokeLineCap: this.strokeLineCap, + strokeDashOffset: this.strokeDashOffset, + strokeLineJoin: this.strokeLineJoin, + strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS), + scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS), + scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS), + angle: toFixed(this.angle, NUM_FRACTION_DIGITS), + flipX: this.flipX, + flipY: this.flipY, + opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS), + shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow, + visible: this.visible, + clipTo: this.clipTo && String(this.clipTo), + backgroundColor: this.backgroundColor, + fillRule: this.fillRule, + paintFirst: this.paintFirst, + globalCompositeOperation: this.globalCompositeOperation, + transformMatrix: this.transformMatrix ? this.transformMatrix.concat() : null, + skewX: toFixed(this.skewX, NUM_FRACTION_DIGITS), + skewY: toFixed(this.skewY, NUM_FRACTION_DIGITS), + }; + + if (this.clipPath) { + object.clipPath = this.clipPath.toObject(propertiesToInclude); + object.clipPath.inverted = this.clipPath.inverted; + object.clipPath.absolutePositioned = this.clipPath.absolutePositioned; + } + + fabric.util.populateWithProperties(this, object, propertiesToInclude); + if (!this.includeDefaultValues) { + object = this._removeDefaultValues(object); + } + + return object; + }, + + /** + * Returns (dataless) object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + // will be overwritten by subclasses + return this.toObject(propertiesToInclude); + }, + + /** + * @private + * @param {Object} object + */ + _removeDefaultValues: function(object) { + var prototype = fabric.util.getKlass(object.type).prototype, + stateProperties = prototype.stateProperties; + stateProperties.forEach(function(prop) { + if (prop === 'left' || prop === 'top') { + return; + } + if (object[prop] === prototype[prop]) { + delete object[prop]; + } + var isArray = Object.prototype.toString.call(object[prop]) === '[object Array]' && + Object.prototype.toString.call(prototype[prop]) === '[object Array]'; + + // basically a check for [] === [] + if (isArray && object[prop].length === 0 && prototype[prop].length === 0) { + delete object[prop]; + } + }); + + return object; + }, + + /** + * Returns a string representation of an instance + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Return the object scale factor counting also the group scaling + * @return {Object} object with scaleX and scaleY properties + */ + getObjectScaling: function() { + var scaleX = this.scaleX, scaleY = this.scaleY; + if (this.group) { + var scaling = this.group.getObjectScaling(); + scaleX *= scaling.scaleX; + scaleY *= scaling.scaleY; + } + return { scaleX: scaleX, scaleY: scaleY }; + }, + + /** + * Return the object scale factor counting also the group scaling, zoom and retina + * @return {Object} object with scaleX and scaleY properties + */ + getTotalObjectScaling: function() { + var scale = this.getObjectScaling(), scaleX = scale.scaleX, scaleY = scale.scaleY; + if (this.canvas) { + var zoom = this.canvas.getZoom(); + var retina = this.canvas.getRetinaScaling(); + scaleX *= zoom * retina; + scaleY *= zoom * retina; + } + return { scaleX: scaleX, scaleY: scaleY }; + }, + + /** + * Return the object opacity counting also the group property + * @return {Number} + */ + getObjectOpacity: function() { + var opacity = this.opacity; + if (this.group) { + opacity *= this.group.getObjectOpacity(); + } + return opacity; + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Object} thisArg + */ + _set: function(key, value) { + var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY'), + isChanged = this[key] !== value, groupNeedsUpdate = false; + + if (shouldConstrainValue) { + value = this._constrainScale(value); + } + if (key === 'scaleX' && value < 0) { + this.flipX = !this.flipX; + value *= -1; + } + else if (key === 'scaleY' && value < 0) { + this.flipY = !this.flipY; + value *= -1; + } + else if (key === 'shadow' && value && !(value instanceof fabric.Shadow)) { + value = new fabric.Shadow(value); + } + else if (key === 'dirty' && this.group) { + this.group.set('dirty', value); + } + + this[key] = value; + + if (isChanged) { + groupNeedsUpdate = this.group && this.group.isOnACache(); + if (this.cacheProperties.indexOf(key) > -1) { + this.dirty = true; + groupNeedsUpdate && this.group.set('dirty', true); + } + else if (groupNeedsUpdate && this.stateProperties.indexOf(key) > -1) { + this.group.set('dirty', true); + } + } + + return this; + }, + + /** + * This callback function is called by the parent group of an object every + * time a non-delegated property changes on the group. It is passed the key + * and value as parameters. Not adding in this function's signature to avoid + * Travis build error about unused variables. + */ + setOnGroup: function() { + // implemented by sub-classes, as needed. + }, + + /** + * Retrieves viewportTransform from Object's canvas if possible + * @method getViewportTransform + * @memberOf fabric.Object.prototype + * @return {Array} + */ + getViewportTransform: function() { + if (this.canvas && this.canvas.viewportTransform) { + return this.canvas.viewportTransform; + } + return fabric.iMatrix.concat(); + }, + + /* + * @private + * return if the object would be visible in rendering + * @memberOf fabric.Object.prototype + * @return {Boolean} + */ + isNotVisible: function() { + return this.opacity === 0 || + (this.width === 0 && this.height === 0 && this.strokeWidth === 0) || + !this.visible; + }, + + /** + * Renders an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx) { + // do not render if width/height are zeros or object is not visible + if (this.isNotVisible()) { + return; + } + if (this.canvas && this.canvas.skipOffscreen && !this.group && !this.isOnScreen()) { + return; + } + ctx.save(); + this._setupCompositeOperation(ctx); + this.drawSelectionBackground(ctx); + this.transform(ctx); + this._setOpacity(ctx); + this._setShadow(ctx, this); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.clipTo && fabric.util.clipContext(this, ctx); + if (this.shouldCache()) { + this.renderCache(); + this.drawCacheOnCanvas(ctx); + } + else { + this._removeCacheCanvas(); + this.dirty = false; + this.drawObject(ctx); + if (this.objectCaching && this.statefullCache) { + this.saveState({ propertySet: 'cacheProperties' }); + } + } + this.clipTo && ctx.restore(); + ctx.restore(); + }, + + renderCache: function(options) { + options = options || {}; + if (!this._cacheCanvas) { + this._createCacheCanvas(); + } + if (this.isCacheDirty()) { + this.statefullCache && this.saveState({ propertySet: 'cacheProperties' }); + this.drawObject(this._cacheContext, options.forClipping); + this.dirty = false; + } + }, + + /** + * Remove cacheCanvas and its dimensions from the objects + */ + _removeCacheCanvas: function() { + this._cacheCanvas = null; + this.cacheWidth = 0; + this.cacheHeight = 0; + }, + + /** + * return true if the object will draw a stroke + * Does not consider text styles. This is just a shortcut used at rendering time + * We want it to be an aproximation and be fast. + * wrote to avoid extra caching, it has to return true when stroke happens, + * can guess when it will not happen at 100% chance, does not matter if it misses + * some use case where the stroke is invisible. + * @since 3.0.0 + * @returns Boolean + */ + hasStroke: function() { + return this.stroke && this.stroke !== 'transparent' && this.strokeWidth !== 0; + }, + + /** + * return true if the object will draw a fill + * Does not consider text styles. This is just a shortcut used at rendering time + * We want it to be an aproximation and be fast. + * wrote to avoid extra caching, it has to return true when fill happens, + * can guess when it will not happen at 100% chance, does not matter if it misses + * some use case where the fill is invisible. + * @since 3.0.0 + * @returns Boolean + */ + hasFill: function() { + return this.fill && this.fill !== 'transparent'; + }, + + /** + * When set to `true`, force the object to have its own cache, even if it is inside a group + * it may be needed when your object behave in a particular way on the cache and always needs + * its own isolated canvas to render correctly. + * Created to be overridden + * since 1.7.12 + * @returns Boolean + */ + needsItsOwnCache: function() { + if (this.paintFirst === 'stroke' && + this.hasFill() && this.hasStroke() && typeof this.shadow === 'object') { + return true; + } + if (this.clipPath) { + return true; + } + return false; + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * objectCaching is a global flag, wins over everything + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group outside is cached. + * Read as: cache if is needed, or if the feature is enabled but we are not already caching. + * @return {Boolean} + */ + shouldCache: function() { + this.ownCaching = this.needsItsOwnCache() || ( + this.objectCaching && + (!this.group || !this.group.isOnACache()) + ); + return this.ownCaching; + }, + + /** + * Check if this object or a child object will cast a shadow + * used by Group.shouldCache to know if child has a shadow recursively + * @return {Boolean} + */ + willDrawShadow: function() { + return !!this.shadow && (this.shadow.offsetX !== 0 || this.shadow.offsetY !== 0); + }, + + /** + * Execute the drawing operation for an object clipPath + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawClipPathOnCache: function(ctx) { + var path = this.clipPath; + ctx.save(); + // DEBUG: uncomment this line, comment the following + // ctx.globalAlpha = 0.4 + if (path.inverted) { + ctx.globalCompositeOperation = 'destination-out'; + } + else { + ctx.globalCompositeOperation = 'destination-in'; + } + //ctx.scale(1 / 2, 1 / 2); + if (path.absolutePositioned) { + var m = fabric.util.invertTransform(this.calcTransformMatrix()); + ctx.transform(m[0], m[1], m[2], m[3], m[4], m[5]); + } + path.transform(ctx); + ctx.scale(1 / path.zoomX, 1 / path.zoomY); + ctx.drawImage(path._cacheCanvas, -path.cacheTranslationX, -path.cacheTranslationY); + ctx.restore(); + }, + + /** + * Execute the drawing operation for an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawObject: function(ctx, forClipping) { + var originalFill = this.fill, originalStroke = this.stroke; + if (forClipping) { + this.fill = 'black'; + this.stroke = ''; + this._setClippingProperties(ctx); + } + else { + this._renderBackground(ctx); + this._setStrokeStyles(ctx, this); + this._setFillStyles(ctx, this); + } + this._render(ctx); + this._drawClipPath(ctx); + this.fill = originalFill; + this.stroke = originalStroke; + }, + + _drawClipPath: function(ctx) { + var path = this.clipPath; + if (!path) { return; } + // needed to setup a couple of variables + // path canvas gets overridden with this one. + // TODO find a better solution? + path.canvas = this.canvas; + path.shouldCache(); + path._transformDone = true; + path.renderCache({ forClipping: true }); + this.drawClipPathOnCache(ctx); + }, + + /** + * Paint the cached copy of the object on the target context. + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawCacheOnCanvas: function(ctx) { + ctx.scale(1 / this.zoomX, 1 / this.zoomY); + ctx.drawImage(this._cacheCanvas, -this.cacheTranslationX, -this.cacheTranslationY); + }, + + /** + * Check if cache is dirty + * @param {Boolean} skipCanvas skip canvas checks because this object is painted + * on parent canvas. + */ + isCacheDirty: function(skipCanvas) { + if (this.isNotVisible()) { + return false; + } + if (this._cacheCanvas && !skipCanvas && this._updateCacheCanvas()) { + // in this case the context is already cleared. + return true; + } + else { + if (this.dirty || + (this.clipPath && this.clipPath.absolutePositioned) || + (this.statefullCache && this.hasStateChanged('cacheProperties')) + ) { + if (this._cacheCanvas && !skipCanvas) { + var width = this.cacheWidth / this.zoomX; + var height = this.cacheHeight / this.zoomY; + this._cacheContext.clearRect(-width / 2, -height / 2, width, height); + } + return true; + } + } + return false; + }, + + /** + * Draws a background for the object big as its untransformed dimensions + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + if (!this.backgroundColor) { + return; + } + var dim = this._getNonTransformedDimensions(); + ctx.fillStyle = this.backgroundColor; + + ctx.fillRect( + -dim.x / 2, + -dim.y / 2, + dim.x, + dim.y + ); + // if there is background color no other shadows + // should be casted + this._removeShadow(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setOpacity: function(ctx) { + if (this.group && !this.group._transformDone) { + ctx.globalAlpha = this.getObjectOpacity(); + } + else { + ctx.globalAlpha *= this.opacity; + } + }, + + _setStrokeStyles: function(ctx, decl) { + if (decl.stroke) { + ctx.lineWidth = decl.strokeWidth; + ctx.lineCap = decl.strokeLineCap; + ctx.lineDashOffset = decl.strokeDashOffset; + ctx.lineJoin = decl.strokeLineJoin; + ctx.miterLimit = decl.strokeMiterLimit; + ctx.strokeStyle = decl.stroke.toLive + ? decl.stroke.toLive(ctx, this) + : decl.stroke; + } + }, + + _setFillStyles: function(ctx, decl) { + if (decl.fill) { + ctx.fillStyle = decl.fill.toLive + ? decl.fill.toLive(ctx, this) + : decl.fill; + } + }, + + _setClippingProperties: function(ctx) { + ctx.globalAlpha = 1; + ctx.strokeStyle = 'transparent'; + ctx.fillStyle = '#000000'; + }, + + /** + * @private + * Sets line dash + * @param {CanvasRenderingContext2D} ctx Context to set the dash line on + * @param {Array} dashArray array representing dashes + * @param {Function} alternative function to call if browser does not support lineDash + */ + _setLineDash: function(ctx, dashArray, alternative) { + if (!dashArray) { + return; + } + // Spec requires the concatenation of two copies the dash list when the number of elements is odd + if (1 & dashArray.length) { + dashArray.push.apply(dashArray, dashArray); + } + if (supportsLineDash) { + ctx.setLineDash(dashArray); + } + else { + alternative && alternative(ctx); + } + if (this.strokeUniform) { + ctx.setLineDash(ctx.getLineDash().map(function(value) { return value * ctx.lineWidth; })); + } + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} [styleOverride] properties to override the object style + */ + _renderControls: function(ctx, styleOverride) { + var vpt = this.getViewportTransform(), + matrix = this.calcTransformMatrix(), + options, drawBorders, drawControls; + styleOverride = styleOverride || { }; + drawBorders = typeof styleOverride.hasBorders !== 'undefined' ? styleOverride.hasBorders : this.hasBorders; + drawControls = typeof styleOverride.hasControls !== 'undefined' ? styleOverride.hasControls : this.hasControls; + matrix = fabric.util.multiplyTransformMatrices(vpt, matrix); + options = fabric.util.qrDecompose(matrix); + ctx.save(); + ctx.translate(options.translateX, options.translateY); + ctx.lineWidth = 1 * this.borderScaleFactor; + if (!this.group) { + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + } + if (styleOverride.forActiveSelection) { + ctx.rotate(degreesToRadians(options.angle)); + drawBorders && this.drawBordersInGroup(ctx, options, styleOverride); + } + else { + ctx.rotate(degreesToRadians(this.angle)); + drawBorders && this.drawBorders(ctx, styleOverride); + } + drawControls && this.drawControls(ctx, styleOverride); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setShadow: function(ctx) { + if (!this.shadow) { + return; + } + + var shadow = this.shadow, canvas = this.canvas, scaling, + multX = (canvas && canvas.viewportTransform[0]) || 1, + multY = (canvas && canvas.viewportTransform[3]) || 1; + if (shadow.nonScaling) { + scaling = { scaleX: 1, scaleY: 1 }; + } + else { + scaling = this.getObjectScaling(); + } + if (canvas && canvas._isRetinaScaling()) { + multX *= fabric.devicePixelRatio; + multY *= fabric.devicePixelRatio; + } + ctx.shadowColor = shadow.color; + ctx.shadowBlur = shadow.blur * fabric.browserShadowBlurConstant * + (multX + multY) * (scaling.scaleX + scaling.scaleY) / 4; + ctx.shadowOffsetX = shadow.offsetX * multX * scaling.scaleX; + ctx.shadowOffsetY = shadow.offsetY * multY * scaling.scaleY; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _removeShadow: function(ctx) { + if (!this.shadow) { + return; + } + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} filler fabric.Pattern or fabric.Gradient + * @return {Object} offset.offsetX offset for text rendering + * @return {Object} offset.offsetY offset for text rendering + */ + _applyPatternGradientTransform: function(ctx, filler) { + if (!filler || !filler.toLive) { + return { offsetX: 0, offsetY: 0 }; + } + var t = filler.gradientTransform || filler.patternTransform; + var offsetX = -this.width / 2 + filler.offsetX || 0, + offsetY = -this.height / 2 + filler.offsetY || 0; + + if (filler.gradientUnits === 'percentage') { + ctx.transform(this.width, 0, 0, this.height, offsetX, offsetY); + } + else { + ctx.transform(1, 0, 0, 1, offsetX, offsetY); + } + if (t) { + ctx.transform(t[0], t[1], t[2], t[3], t[4], t[5]); + } + return { offsetX: offsetX, offsetY: offsetY }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderPaintInOrder: function(ctx) { + if (this.paintFirst === 'stroke') { + this._renderStroke(ctx); + this._renderFill(ctx); + } + else { + this._renderFill(ctx); + this._renderStroke(ctx); + } + }, + + /** + * @private + * function that actually render something on the context. + * empty here to allow Obects to work on tests to benchmark fabric functionalites + * not related to rendering + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(/* ctx */) { + + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderFill: function(ctx) { + if (!this.fill) { + return; + } + + ctx.save(); + this._applyPatternGradientTransform(ctx, this.fill); + if (this.fillRule === 'evenodd') { + ctx.fill('evenodd'); + } + else { + ctx.fill(); + } + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderStroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + + ctx.save(); + if (this.strokeUniform) { + ctx.scale(1 / this.scaleX, 1 / this.scaleY); + } + this._setLineDash(ctx, this.strokeDashArray, this._renderDashedStroke); + if (this.stroke.toLive && this.stroke.gradientUnits === 'percentage') { + // need to transform gradient in a pattern. + // this is a slow process. If you are hitting this codepath, and the object + // is not using caching, you should consider switching it on. + // we need a canvas as big as the current object caching canvas. + this._applyPatternForTransformedGradient(ctx, this.stroke); + } + else { + this._applyPatternGradientTransform(ctx, this.stroke); + } + ctx.stroke(); + ctx.restore(); + }, + + /** + * This function try to patch the missing gradientTransform on canvas gradients. + * transforming a context to transform the gradient, is going to transform the stroke too. + * we want to transform the gradient but not the stroke operation, so we create + * a transformed gradient on a pattern and then we use the pattern instead of the gradient. + * this method has drwabacks: is slow, is in low resolution, needs a patch for when the size + * is limited. + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {fabric.Gradient} filler a fabric gradient instance + */ + _applyPatternForTransformedGradient: function(ctx, filler) { + var dims = this._limitCacheSize(this._getCacheCanvasDimensions()), + pCanvas = fabric.util.createCanvasElement(), pCtx, retinaScaling = this.canvas.getRetinaScaling(), + width = dims.x / this.scaleX / retinaScaling, height = dims.y / this.scaleY / retinaScaling; + pCanvas.width = width; + pCanvas.height = height; + pCtx = pCanvas.getContext('2d'); + pCtx.beginPath(); pCtx.moveTo(0, 0); pCtx.lineTo(width, 0); pCtx.lineTo(width, height); + pCtx.lineTo(0, height); pCtx.closePath(); + pCtx.translate(width / 2, height / 2); + pCtx.scale( + dims.zoomX / this.scaleX / retinaScaling, + dims.zoomY / this.scaleY / retinaScaling + ); + this._applyPatternGradientTransform(pCtx, filler); + pCtx.fillStyle = filler.toLive(ctx); + pCtx.fill(); + ctx.translate(-this.width / 2 - this.strokeWidth / 2, -this.height / 2 - this.strokeWidth / 2); + ctx.scale( + retinaScaling * this.scaleX / dims.zoomX, + retinaScaling * this.scaleY / dims.zoomY + ); + ctx.strokeStyle = pCtx.createPattern(pCanvas, 'no-repeat'); + }, + + /** + * This function is an helper for svg import. it returns the center of the object in the svg + * untransformed coordinates + * @private + * @return {Object} center point from element coordinates + */ + _findCenterFromElement: function() { + return { x: this.left + this.width / 2, y: this.top + this.height / 2 }; + }, + + /** + * This function is an helper for svg import. it decompose the transformMatrix + * and assign properties to object. + * untransformed coordinates + * @private + * @chainable + */ + _assignTransformMatrixProps: function() { + if (this.transformMatrix) { + var options = fabric.util.qrDecompose(this.transformMatrix); + this.flipX = false; + this.flipY = false; + this.set('scaleX', options.scaleX); + this.set('scaleY', options.scaleY); + this.angle = options.angle; + this.skewX = options.skewX; + this.skewY = 0; + } + }, + + /** + * This function is an helper for svg import. it removes the transform matrix + * and set to object properties that fabricjs can handle + * @private + * @param {Object} preserveAspectRatioOptions + * @return {thisArg} + */ + _removeTransformMatrix: function(preserveAspectRatioOptions) { + var center = this._findCenterFromElement(); + if (this.transformMatrix) { + this._assignTransformMatrixProps(); + center = fabric.util.transformPoint(center, this.transformMatrix); + } + this.transformMatrix = null; + if (preserveAspectRatioOptions) { + this.scaleX *= preserveAspectRatioOptions.scaleX; + this.scaleY *= preserveAspectRatioOptions.scaleY; + this.cropX = preserveAspectRatioOptions.cropX; + this.cropY = preserveAspectRatioOptions.cropY; + center.x += preserveAspectRatioOptions.offsetLeft; + center.y += preserveAspectRatioOptions.offsetTop; + this.width = preserveAspectRatioOptions.width; + this.height = preserveAspectRatioOptions.height; + } + this.setPositionByOrigin(center, 'center', 'center'); + }, + + /** + * Clones an instance, using a callback method will work for every object. + * @param {Function} callback Callback is invoked with a clone as a first argument + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + */ + clone: function(callback, propertiesToInclude) { + var objectForm = this.toObject(propertiesToInclude); + if (this.constructor.fromObject) { + this.constructor.fromObject(objectForm, callback); + } + else { + fabric.Object._fromObject('Object', objectForm, callback); + } + }, + + /** + * Creates an instance of fabric.Image out of an object + * could make use of both toDataUrl or toCanvasElement. + * @param {Function} callback callback, invoked with an instance as a first argument + * @param {Object} [options] for clone as image, passed to toDataURL + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4 + * @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4 + * @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2 + * @return {fabric.Object} thisArg + */ + cloneAsImage: function(callback, options) { + var canvasEl = this.toCanvasElement(options); + if (callback) { + callback(new fabric.Image(canvasEl)); + } + return this; + }, + + /** + * Converts an object into a HTMLCanvas element + * @param {Object} options Options object + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4 + * @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4 + * @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + */ + toCanvasElement: function(options) { + options || (options = { }); + + var utils = fabric.util, origParams = utils.saveObjectTransform(this), + originalShadow = this.shadow, abs = Math.abs, + multiplier = (options.multiplier || 1) * (options.enableRetinaScaling ? fabric.devicePixelRatio : 1); + + if (options.withoutTransform) { + utils.resetObjectTransform(this); + } + if (options.withoutShadow) { + this.shadow = null; + } + + var el = fabric.util.createCanvasElement(), + // skip canvas zoom and calculate with setCoords now. + boundingRect = this.getBoundingRect(true, true), + shadow = this.shadow, scaling, + shadowOffset = { x: 0, y: 0 }, shadowBlur; + + if (shadow) { + shadowBlur = shadow.blur; + if (shadow.nonScaling) { + scaling = { scaleX: 1, scaleY: 1 }; + } + else { + scaling = this.getObjectScaling(); + } + shadowOffset.x = 2 * Math.round(abs(shadow.offsetX) + shadowBlur) * (abs(scaling.scaleX)); + shadowOffset.y = 2 * Math.round(abs(shadow.offsetY) + shadowBlur) * (abs(scaling.scaleY)); + } + el.width = boundingRect.width + shadowOffset.x; + el.height = boundingRect.height + shadowOffset.y; + el.width += el.width % 2 ? 2 - el.width % 2 : 0; + el.height += el.height % 2 ? 2 - el.height % 2 : 0; + var canvas = new fabric.StaticCanvas(el, { + enableRetinaScaling: false, + renderOnAddRemove: false, + skipOffscreen: false, + }); + if (options.format === 'jpeg') { + canvas.backgroundColor = '#fff'; + } + this.setPositionByOrigin(new fabric.Point(canvas.width / 2, canvas.height / 2), 'center', 'center'); + + var originalCanvas = this.canvas; + canvas.add(this); + var canvasEl = canvas.toCanvasElement(multiplier || 1, options); + this.shadow = originalShadow; + this.canvas = originalCanvas; + this.set(origParams).setCoords(); + // canvas.dispose will call image.dispose that will nullify the elements + // since this canvas is a simple element for the process, we remove references + // to objects in this way in order to avoid object trashing. + canvas._objects = []; + canvas.dispose(); + canvas = null; + + return canvasEl; + }, + + /** + * Converts an object into a data-url-like string + * @param {Object} options Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @param {Boolean} [options.enableRetinaScaling] Enable retina scaling for clone image. Introduce in 1.6.4 + * @param {Boolean} [options.withoutTransform] Remove current object transform ( no scale , no angle, no flip, no skew ). Introduced in 2.3.4 + * @param {Boolean} [options.withoutShadow] Remove current object shadow. Introduced in 2.4.2 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + */ + toDataURL: function(options) { + options || (options = { }); + return fabric.util.toDataURL(this.toCanvasElement(options), options.format || 'png', options.quality || 1); + }, + + /** + * Returns true if specified type is identical to the type of an instance + * @param {String} type Type to check against + * @return {Boolean} + */ + isType: function(type) { + return this.type === type; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance (is 1 unless subclassed) + */ + complexity: function() { + return 1; + }, + + /** + * Returns a JSON representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} JSON + */ + toJSON: function(propertiesToInclude) { + // delegate, not alias + return this.toObject(propertiesToInclude); + }, + + /** + * Sets gradient (fill or stroke) of an object + * percentages for x1,x2,y1,y2,r1,r2 together with gradientUnits 'pixels', are not supported. + * Backwards incompatibility note: This method was named "setGradientFill" until v1.1.0 + * @param {String} property Property name 'stroke' or 'fill' + * @param {Object} [options] Options object + * @param {String} [options.type] Type of gradient 'radial' or 'linear' + * @param {Number} [options.x1=0] x-coordinate of start point + * @param {Number} [options.y1=0] y-coordinate of start point + * @param {Number} [options.x2=0] x-coordinate of end point + * @param {Number} [options.y2=0] y-coordinate of end point + * @param {Number} [options.r1=0] Radius of start point (only for radial gradients) + * @param {Number} [options.r2=0] Radius of end point (only for radial gradients) + * @param {Object} [options.colorStops] Color stops object eg. {0: 'ff0000', 1: '000000'} + * @param {Object} [options.gradientTransform] transformMatrix for gradient + * @return {fabric.Object} thisArg + * @chainable + * @deprecated since 3.4.0 + * @see {@link http://jsfiddle.net/fabricjs/58y8b/|jsFiddle demo} + * @example Set linear gradient + * object.setGradient('fill', { + * type: 'linear', + * x1: -object.width / 2, + * y1: 0, + * x2: object.width / 2, + * y2: 0, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + * @example Set radial gradient + * object.setGradient('fill', { + * type: 'radial', + * x1: 0, + * y1: 0, + * x2: 0, + * y2: 0, + * r1: object.width / 2, + * r2: 10, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + */ + setGradient: function(property, options) { + options || (options = { }); + + var gradient = { colorStops: [] }; + + gradient.type = options.type || (options.r1 || options.r2 ? 'radial' : 'linear'); + gradient.coords = { + x1: options.x1, + y1: options.y1, + x2: options.x2, + y2: options.y2 + }; + gradient.gradientUnits = options.gradientUnits || 'pixels'; + if (options.r1 || options.r2) { + gradient.coords.r1 = options.r1; + gradient.coords.r2 = options.r2; + } + + gradient.gradientTransform = options.gradientTransform; + fabric.Gradient.prototype.addColorStop.call(gradient, options.colorStops); + + return this.set(property, fabric.Gradient.forObject(this, gradient)); + }, + + /** + * Sets pattern fill of an object + * @param {Object} options Options object + * @param {(String|HTMLImageElement)} options.source Pattern source + * @param {String} [options.repeat=repeat] Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @param {Number} [options.offsetX=0] Pattern horizontal offset from object's left/top corner + * @param {Number} [options.offsetY=0] Pattern vertical offset from object's left/top corner + * @param {Function} [callback] Callback to invoke when image set as a pattern + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/QT3pa/|jsFiddle demo} + * @example Set pattern + * object.setPatternFill({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat' + * },canvas.renderAll.bind(canvas)); + */ + setPatternFill: function(options, callback) { + return this.set('fill', new fabric.Pattern(options, callback)); + }, + + /** + * Sets {@link fabric.Object#shadow|shadow} of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @param {String} [options.color=rgb(0,0,0)] Shadow color + * @param {Number} [options.blur=0] Shadow blur + * @param {Number} [options.offsetX=0] Shadow horizontal offset + * @param {Number} [options.offsetY=0] Shadow vertical offset + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/7gvJG/|jsFiddle demo} + * @example Set shadow with string notation + * object.setShadow('2px 2px 10px rgba(0,0,0,0.2)'); + * canvas.renderAll(); + * @example Set shadow with object notation + * object.setShadow({ + * color: 'red', + * blur: 10, + * offsetX: 20, + * offsetY: 20 + * }); + * canvas.renderAll(); + */ + setShadow: function(options) { + return this.set('shadow', options ? new fabric.Shadow(options) : null); + }, + + /** + * Sets "color" of an instance (alias of `set('fill', …)`) + * @param {String} color Color value + * @return {fabric.Object} thisArg + * @chainable + */ + setColor: function(color) { + this.set('fill', color); + return this; + }, + + /** + * Sets "angle" of an instance with centered rotation + * @param {Number} angle Angle value (in degrees) + * @return {fabric.Object} thisArg + * @chainable + */ + rotate: function(angle) { + var shouldCenterOrigin = (this.originX !== 'center' || this.originY !== 'center') && this.centeredRotation; + + if (shouldCenterOrigin) { + this._setOriginToCenter(); + } + + this.set('angle', angle); + + if (shouldCenterOrigin) { + this._resetOrigin(); + } + + return this; + }, + + /** + * Centers object horizontally on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerH: function () { + this.canvas && this.canvas.centerObjectH(this); + return this; + }, + + /** + * Centers object horizontally on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenterH: function () { + this.canvas && this.canvas.viewportCenterObjectH(this); + return this; + }, + + /** + * Centers object vertically on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerV: function () { + this.canvas && this.canvas.centerObjectV(this); + return this; + }, + + /** + * Centers object vertically on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenterV: function () { + this.canvas && this.canvas.viewportCenterObjectV(this); + return this; + }, + + /** + * Centers object vertically and horizontally on canvas to which is was added last + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + center: function () { + this.canvas && this.canvas.centerObject(this); + return this; + }, + + /** + * Centers object on current viewport of canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + viewportCenter: function () { + this.canvas && this.canvas.viewportCenterObject(this); + return this; + }, + + /** + * Returns coordinates of a pointer relative to an object + * @param {Event} e Event to operate upon + * @param {Object} [pointer] Pointer to operate upon (instead of event) + * @return {Object} Coordinates of a pointer (x, y) + */ + getLocalPointer: function(e, pointer) { + pointer = pointer || this.canvas.getPointer(e); + var pClicked = new fabric.Point(pointer.x, pointer.y), + objectLeftTop = this._getLeftTopCoords(); + if (this.angle) { + pClicked = fabric.util.rotatePoint( + pClicked, objectLeftTop, degreesToRadians(-this.angle)); + } + return { + x: pClicked.x - objectLeftTop.x, + y: pClicked.y - objectLeftTop.y + }; + }, + + /** + * Sets canvas globalCompositeOperation for specific object + * custom composition operation for the particular object can be specified using globalCompositeOperation property + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _setupCompositeOperation: function (ctx) { + if (this.globalCompositeOperation) { + ctx.globalCompositeOperation = this.globalCompositeOperation; + } + } + }); + + fabric.util.createAccessors && fabric.util.createAccessors(fabric.Object); + + extend(fabric.Object.prototype, fabric.Observable); + + /** + * Defines the number of fraction digits to use when serializing object values. + * You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc. + * @static + * @memberOf fabric.Object + * @constant + * @type Number + */ + fabric.Object.NUM_FRACTION_DIGITS = 2; + + fabric.Object._fromObject = function(className, object, callback, extraParam) { + var klass = fabric[className]; + object = clone(object, true); + fabric.util.enlivenPatterns([object.fill, object.stroke], function(patterns) { + if (typeof patterns[0] !== 'undefined') { + object.fill = patterns[0]; + } + if (typeof patterns[1] !== 'undefined') { + object.stroke = patterns[1]; + } + fabric.util.enlivenObjects([object.clipPath], function(enlivedProps) { + object.clipPath = enlivedProps[0]; + var instance = extraParam ? new klass(object[extraParam], object) : new klass(object); + callback && callback(instance); + }); + }); + }; + + /** + * Unique id used internally when creating SVG elements + * @static + * @memberOf fabric.Object + * @type Number + */ + fabric.Object.__uid = 0; + +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + var degreesToRadians = fabric.util.degreesToRadians, + originXOffset = { + left: -0.5, + center: 0, + right: 0.5 + }, + originYOffset = { + top: -0.5, + center: 0, + bottom: 0.5 + }; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Translates the coordinates from a set of origin to another (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} fromOriginX Horizontal origin: 'left', 'center' or 'right' + * @param {String} fromOriginY Vertical origin: 'top', 'center' or 'bottom' + * @param {String} toOriginX Horizontal origin: 'left', 'center' or 'right' + * @param {String} toOriginY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToGivenOrigin: function(point, fromOriginX, fromOriginY, toOriginX, toOriginY) { + var x = point.x, + y = point.y, + offsetX, offsetY, dim; + + if (typeof fromOriginX === 'string') { + fromOriginX = originXOffset[fromOriginX]; + } + else { + fromOriginX -= 0.5; + } + + if (typeof toOriginX === 'string') { + toOriginX = originXOffset[toOriginX]; + } + else { + toOriginX -= 0.5; + } + + offsetX = toOriginX - fromOriginX; + + if (typeof fromOriginY === 'string') { + fromOriginY = originYOffset[fromOriginY]; + } + else { + fromOriginY -= 0.5; + } + + if (typeof toOriginY === 'string') { + toOriginY = originYOffset[toOriginY]; + } + else { + toOriginY -= 0.5; + } + + offsetY = toOriginY - fromOriginY; + + if (offsetX || offsetY) { + dim = this._getTransformedDimensions(); + x = point.x + offsetX * dim.x; + y = point.y + offsetY * dim.y; + } + + return new fabric.Point(x, y); + }, + + /** + * Translates the coordinates from origin to center coordinates (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToCenterPoint: function(point, originX, originY) { + var p = this.translateToGivenOrigin(point, originX, originY, 'center', 'center'); + if (this.angle) { + return fabric.util.rotatePoint(p, point, degreesToRadians(this.angle)); + } + return p; + }, + + /** + * Translates the coordinates from center to origin coordinates (based on the object's dimensions) + * @param {fabric.Point} center The point which corresponds to center of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToOriginPoint: function(center, originX, originY) { + var p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY); + if (this.angle) { + return fabric.util.rotatePoint(p, center, degreesToRadians(this.angle)); + } + return p; + }, + + /** + * Returns the real center coordinates of the object + * @return {fabric.Point} + */ + getCenterPoint: function() { + var leftTop = new fabric.Point(this.left, this.top); + return this.translateToCenterPoint(leftTop, this.originX, this.originY); + }, + + /** + * Returns the coordinates of the object based on center coordinates + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @return {fabric.Point} + */ + // getOriginPoint: function(center) { + // return this.translateToOriginPoint(center, this.originX, this.originY); + // }, + + /** + * Returns the coordinates of the object as if it has a different origin + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + getPointByOrigin: function(originX, originY) { + var center = this.getCenterPoint(); + return this.translateToOriginPoint(center, originX, originY); + }, + + /** + * Returns the point in local coordinates + * @param {fabric.Point} point The point relative to the global coordinate system + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + toLocalPoint: function(point, originX, originY) { + var center = this.getCenterPoint(), + p, p2; + + if (typeof originX !== 'undefined' && typeof originY !== 'undefined' ) { + p = this.translateToGivenOrigin(center, 'center', 'center', originX, originY); + } + else { + p = new fabric.Point(this.left, this.top); + } + + p2 = new fabric.Point(point.x, point.y); + if (this.angle) { + p2 = fabric.util.rotatePoint(p2, center, -degreesToRadians(this.angle)); + } + return p2.subtractEquals(p); + }, + + /** + * Returns the point in global coordinates + * @param {fabric.Point} The point relative to the local coordinate system + * @return {fabric.Point} + */ + // toGlobalPoint: function(point) { + // return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top)); + // }, + + /** + * Sets the position of the object taking into consideration the object's origin + * @param {fabric.Point} pos The new position of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {void} + */ + setPositionByOrigin: function(pos, originX, originY) { + var center = this.translateToCenterPoint(pos, originX, originY), + position = this.translateToOriginPoint(center, this.originX, this.originY); + this.set('left', position.x); + this.set('top', position.y); + }, + + /** + * @param {String} to One of 'left', 'center', 'right' + */ + adjustPosition: function(to) { + var angle = degreesToRadians(this.angle), + hypotFull = this.getScaledWidth(), + xFull = fabric.util.cos(angle) * hypotFull, + yFull = fabric.util.sin(angle) * hypotFull, + offsetFrom, offsetTo; + + //TODO: this function does not consider mixed situation like top, center. + if (typeof this.originX === 'string') { + offsetFrom = originXOffset[this.originX]; + } + else { + offsetFrom = this.originX - 0.5; + } + if (typeof to === 'string') { + offsetTo = originXOffset[to]; + } + else { + offsetTo = to - 0.5; + } + this.left += xFull * (offsetTo - offsetFrom); + this.top += yFull * (offsetTo - offsetFrom); + this.setCoords(); + this.originX = to; + }, + + /** + * Sets the origin/position of the object to it's center point + * @private + * @return {void} + */ + _setOriginToCenter: function() { + this._originalOriginX = this.originX; + this._originalOriginY = this.originY; + + var center = this.getCenterPoint(); + + this.originX = 'center'; + this.originY = 'center'; + + this.left = center.x; + this.top = center.y; + }, + + /** + * Resets the origin/position of the object to it's original origin + * @private + * @return {void} + */ + _resetOrigin: function() { + var originPoint = this.translateToOriginPoint( + this.getCenterPoint(), + this._originalOriginX, + this._originalOriginY); + + this.originX = this._originalOriginX; + this.originY = this._originalOriginY; + + this.left = originPoint.x; + this.top = originPoint.y; + + this._originalOriginX = null; + this._originalOriginY = null; + }, + + /** + * @private + */ + _getLeftTopCoords: function() { + return this.translateToOriginPoint(this.getCenterPoint(), 'left', 'top'); + }, + }); + +})(); +(function() { + + function getCoords(coords) { + return [ + new fabric.Point(coords.tl.x, coords.tl.y), + new fabric.Point(coords.tr.x, coords.tr.y), + new fabric.Point(coords.br.x, coords.br.y), + new fabric.Point(coords.bl.x, coords.bl.y) + ]; + } + + var degreesToRadians = fabric.util.degreesToRadians, + multiplyMatrices = fabric.util.multiplyTransformMatrices, + transformPoint = fabric.util.transformPoint; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Describe object's corner position in canvas element coordinates. + * properties are tl,mt,tr,ml,mr,bl,mb,br,mtr for the main controls. + * each property is an object with x, y and corner. + * The `corner` property contains in a similar manner the 4 points of the + * interactive area of the corner. + * The coordinates depends from this properties: width, height, scaleX, scaleY + * skewX, skewY, angle, strokeWidth, viewportTransform, top, left, padding. + * The coordinates get updated with @method setCoords. + * You can calculate them without updating with @method calcCoords; + * @memberOf fabric.Object.prototype + */ + oCoords: null, + + /** + * Describe object's corner position in canvas object absolute coordinates + * properties are tl,tr,bl,br and describe the four main corner. + * each property is an object with x, y, instance of Fabric.Point. + * The coordinates depends from this properties: width, height, scaleX, scaleY + * skewX, skewY, angle, strokeWidth, top, left. + * Those coordinates are useful to understand where an object is. They get updated + * with oCoords but they do not need to be updated when zoom or panning change. + * The coordinates get updated with @method setCoords. + * You can calculate them without updating with @method calcCoords(true); + * @memberOf fabric.Object.prototype + */ + aCoords: null, + + /** + * storage for object transform matrix + */ + ownMatrixCache: null, + + /** + * storage for object full transform matrix + */ + matrixCache: null, + + /** + * return correct set of coordinates for intersection + */ + getCoords: function(absolute, calculate) { + if (!this.oCoords) { + this.setCoords(); + } + var coords = absolute ? this.aCoords : this.oCoords; + return getCoords(calculate ? this.calcCoords(absolute) : coords); + }, + + /** + * Checks if object intersects with an area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object intersects with an area formed by 2 points + */ + intersectsWithRect: function(pointTL, pointBR, absolute, calculate) { + var coords = this.getCoords(absolute, calculate), + intersection = fabric.Intersection.intersectPolygonRectangle( + coords, + pointTL, + pointBR + ); + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object intersects with another object + * @param {Object} other Object to test + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object intersects with another object + */ + intersectsWithObject: function(other, absolute, calculate) { + var intersection = fabric.Intersection.intersectPolygonPolygon( + this.getCoords(absolute, calculate), + other.getCoords(absolute, calculate) + ); + + return intersection.status === 'Intersection' + || other.isContainedWithinObject(this, absolute, calculate) + || this.isContainedWithinObject(other, absolute, calculate); + }, + + /** + * Checks if object is fully contained within area of another object + * @param {Object} other Object to test + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object is fully contained within area of another object + */ + isContainedWithinObject: function(other, absolute, calculate) { + var points = this.getCoords(absolute, calculate), + i = 0, lines = other._getImageLines( + calculate ? other.calcCoords(absolute) : absolute ? other.aCoords : other.oCoords + ); + for (; i < 4; i++) { + if (!other.containsPoint(points[i], lines)) { + return false; + } + } + return true; + }, + + /** + * Checks if object is fully contained within area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object is fully contained within area formed by 2 points + */ + isContainedWithinRect: function(pointTL, pointBR, absolute, calculate) { + var boundingRect = this.getBoundingRect(absolute, calculate); + + return ( + boundingRect.left >= pointTL.x && + boundingRect.left + boundingRect.width <= pointBR.x && + boundingRect.top >= pointTL.y && + boundingRect.top + boundingRect.height <= pointBR.y + ); + }, + + /** + * Checks if point is inside the object + * @param {fabric.Point} point Point to check against + * @param {Object} [lines] object returned from @method _getImageLines + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if point is inside the object + */ + containsPoint: function(point, lines, absolute, calculate) { + var lines = lines || this._getImageLines( + calculate ? this.calcCoords(absolute) : absolute ? this.aCoords : this.oCoords + ), + xPoints = this._findCrossPoints(point, lines); + + // if xPoints is odd then point is inside the object + return (xPoints !== 0 && xPoints % 2 === 1); + }, + + /** + * Checks if object is contained within the canvas with current viewportTransform + * the check is done stopping at first point that appears on screen + * @param {Boolean} [calculate] use coordinates of current position instead of .aCoords + * @return {Boolean} true if object is fully or partially contained within canvas + */ + isOnScreen: function(calculate) { + if (!this.canvas) { + return false; + } + var pointTL = this.canvas.vptCoords.tl, pointBR = this.canvas.vptCoords.br; + var points = this.getCoords(true, calculate), point; + for (var i = 0; i < 4; i++) { + point = points[i]; + if (point.x <= pointBR.x && point.x >= pointTL.x && point.y <= pointBR.y && point.y >= pointTL.y) { + return true; + } + } + // no points on screen, check intersection with absolute coordinates + if (this.intersectsWithRect(pointTL, pointBR, true, calculate)) { + return true; + } + return this._containsCenterOfCanvas(pointTL, pointBR, calculate); + }, + + /** + * Checks if the object contains the midpoint between canvas extremities + * Does not make sense outside the context of isOnScreen and isPartiallyOnScreen + * @private + * @param {Fabric.Point} pointTL Top Left point + * @param {Fabric.Point} pointBR Top Right point + * @param {Boolean} calculate use coordinates of current position instead of .oCoords + * @return {Boolean} true if the object contains the point + */ + _containsCenterOfCanvas: function(pointTL, pointBR, calculate) { + // worst case scenario the object is so big that contains the screen + var centerPoint = { x: (pointTL.x + pointBR.x) / 2, y: (pointTL.y + pointBR.y) / 2 }; + if (this.containsPoint(centerPoint, null, true, calculate)) { + return true; + } + return false; + }, + + /** + * Checks if object is partially contained within the canvas with current viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords + * @return {Boolean} true if object is partially contained within canvas + */ + isPartiallyOnScreen: function(calculate) { + if (!this.canvas) { + return false; + } + var pointTL = this.canvas.vptCoords.tl, pointBR = this.canvas.vptCoords.br; + if (this.intersectsWithRect(pointTL, pointBR, true, calculate)) { + return true; + } + return this._containsCenterOfCanvas(pointTL, pointBR, calculate); + }, + + /** + * Method that returns an object with the object edges in it, given the coordinates of the corners + * @private + * @param {Object} oCoords Coordinates of the object corners + */ + _getImageLines: function(oCoords) { + return { + topline: { + o: oCoords.tl, + d: oCoords.tr + }, + rightline: { + o: oCoords.tr, + d: oCoords.br + }, + bottomline: { + o: oCoords.br, + d: oCoords.bl + }, + leftline: { + o: oCoords.bl, + d: oCoords.tl + } + }; + }, + + /** + * Helper method to determine how many cross points are between the 4 object edges + * and the horizontal line determined by a point on canvas + * @private + * @param {fabric.Point} point Point to check + * @param {Object} lines Coordinates of the object being evaluated + */ + // remove yi, not used but left code here just in case. + _findCrossPoints: function(point, lines) { + var b1, b2, a1, a2, xi, // yi, + xcount = 0, + iLine; + + for (var lineKey in lines) { + iLine = lines[lineKey]; + // optimisation 1: line below point. no cross + if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) { + continue; + } + // optimisation 2: line above point. no cross + if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) { + continue; + } + // optimisation 3: vertical line case + if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) { + xi = iLine.o.x; + // yi = point.y; + } + // calculate the intersection point + else { + b1 = 0; + b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x); + a1 = point.y - b1 * point.x; + a2 = iLine.o.y - b2 * iLine.o.x; + + xi = -(a1 - a2) / (b1 - b2); + // yi = a1 + b1 * xi; + } + // dont count xi < point.x cases + if (xi >= point.x) { + xcount += 1; + } + // optimisation 4: specific for square images + if (xcount === 2) { + break; + } + } + return xcount; + }, + + /** + * Returns coordinates of object's bounding rectangle (left, top, width, height) + * the box is intended as aligned to axis of canvas. + * @param {Boolean} [absolute] use coordinates without viewportTransform + * @param {Boolean} [calculate] use coordinates of current position instead of .oCoords / .aCoords + * @return {Object} Object with left, top, width, height properties + */ + getBoundingRect: function(absolute, calculate) { + var coords = this.getCoords(absolute, calculate); + return fabric.util.makeBoundingBoxFromPoints(coords); + }, + + /** + * Returns width of an object's bounding box counting transformations + * before 2.0 it was named getWidth(); + * @return {Number} width value + */ + getScaledWidth: function() { + return this._getTransformedDimensions().x; + }, + + /** + * Returns height of an object bounding box counting transformations + * before 2.0 it was named getHeight(); + * @return {Number} height value + */ + getScaledHeight: function() { + return this._getTransformedDimensions().y; + }, + + /** + * Makes sure the scale is valid and modifies it if necessary + * @private + * @param {Number} value + * @return {Number} + */ + _constrainScale: function(value) { + if (Math.abs(value) < this.minScaleLimit) { + if (value < 0) { + return -this.minScaleLimit; + } + else { + return this.minScaleLimit; + } + } + else if (value === 0) { + return 0.0001; + } + return value; + }, + + /** + * Scales an object (equally by x and y) + * @param {Number} value Scale factor + * @return {fabric.Object} thisArg + * @chainable + */ + scale: function(value) { + this._set('scaleX', value); + this._set('scaleY', value); + return this.setCoords(); + }, + + /** + * Scales an object to a given width, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New width value + * @param {Boolean} absolute ignore viewport + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToWidth: function(value, absolute) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRect(absolute).width / this.getScaledWidth(); + return this.scale(value / this.width / boundingRectFactor); + }, + + /** + * Scales an object to a given height, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New height value + * @param {Boolean} absolute ignore viewport + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToHeight: function(value, absolute) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRect(absolute).height / this.getScaledHeight(); + return this.scale(value / this.height / boundingRectFactor); + }, + + /** + * Calculates and returns the .coords of an object. + * @return {Object} Object with tl, tr, br, bl .... + * @chainable + */ + calcCoords: function(absolute) { + var rotateMatrix = this._calcRotateMatrix(), + translateMatrix = this._calcTranslateMatrix(), + startMatrix = multiplyMatrices(translateMatrix, rotateMatrix), + vpt = this.getViewportTransform(), + finalMatrix = absolute ? startMatrix : multiplyMatrices(vpt, startMatrix), + dim = this._getTransformedDimensions(), + w = dim.x / 2, h = dim.y / 2, + tl = transformPoint({ x: -w, y: -h }, finalMatrix), + tr = transformPoint({ x: w, y: -h }, finalMatrix), + bl = transformPoint({ x: -w, y: h }, finalMatrix), + br = transformPoint({ x: w, y: h }, finalMatrix); + if (!absolute) { + var padding = this.padding, angle = degreesToRadians(this.angle), + cos = fabric.util.cos(angle), sin = fabric.util.sin(angle), + cosP = cos * padding, sinP = sin * padding, cosPSinP = cosP + sinP, + cosPMinusSinP = cosP - sinP; + if (padding) { + tl.x -= cosPMinusSinP; + tl.y -= cosPSinP; + tr.x += cosPSinP; + tr.y -= cosPMinusSinP; + bl.x -= cosPSinP; + bl.y += cosPMinusSinP; + br.x += cosPMinusSinP; + br.y += cosPSinP; + } + var ml = new fabric.Point((tl.x + bl.x) / 2, (tl.y + bl.y) / 2), + mt = new fabric.Point((tr.x + tl.x) / 2, (tr.y + tl.y) / 2), + mr = new fabric.Point((br.x + tr.x) / 2, (br.y + tr.y) / 2), + mb = new fabric.Point((br.x + bl.x) / 2, (br.y + bl.y) / 2), + mtr = new fabric.Point(mt.x + sin * this.rotatingPointOffset, mt.y - cos * this.rotatingPointOffset); + } + + // if (!absolute) { + // var canvas = this.canvas; + // setTimeout(function() { + // canvas.contextTop.clearRect(0, 0, 700, 700); + // canvas.contextTop.fillStyle = 'green'; + // canvas.contextTop.fillRect(mb.x, mb.y, 3, 3); + // canvas.contextTop.fillRect(bl.x, bl.y, 3, 3); + // canvas.contextTop.fillRect(br.x, br.y, 3, 3); + // canvas.contextTop.fillRect(tl.x, tl.y, 3, 3); + // canvas.contextTop.fillRect(tr.x, tr.y, 3, 3); + // canvas.contextTop.fillRect(ml.x, ml.y, 3, 3); + // canvas.contextTop.fillRect(mr.x, mr.y, 3, 3); + // canvas.contextTop.fillRect(mt.x, mt.y, 3, 3); + // canvas.contextTop.fillRect(mtr.x, mtr.y, 3, 3); + // }, 50); + // } + + var coords = { + // corners + tl: tl, tr: tr, br: br, bl: bl, + }; + if (!absolute) { + // middle + coords.ml = ml; + coords.mt = mt; + coords.mr = mr; + coords.mb = mb; + // rotating point + coords.mtr = mtr; + } + return coords; + }, + + /** + * Sets corner position coordinates based on current angle, width and height. + * See {@link https://github.com/kangax/fabric.js/wiki/When-to-call-setCoords|When-to-call-setCoords} + * @param {Boolean} [ignoreZoom] set oCoords with or without the viewport transform. + * @param {Boolean} [skipAbsolute] skip calculation of aCoords, useful in setViewportTransform + * @return {fabric.Object} thisArg + * @chainable + */ + setCoords: function(ignoreZoom, skipAbsolute) { + this.oCoords = this.calcCoords(ignoreZoom); + if (!skipAbsolute) { + this.aCoords = this.calcCoords(true); + } + + // set coordinates of the draggable boxes in the corners used to scale/rotate the image + ignoreZoom || (this._setCornerCoords && this._setCornerCoords()); + + return this; + }, + + /** + * calculate rotation matrix of an object + * @return {Array} rotation matrix for the object + */ + _calcRotateMatrix: function() { + return fabric.util.calcRotateMatrix(this); + }, + + /** + * calculate the translation matrix for an object transform + * @return {Array} rotation matrix for the object + */ + _calcTranslateMatrix: function() { + var center = this.getCenterPoint(); + return [1, 0, 0, 1, center.x, center.y]; + }, + + transformMatrixKey: function(skipGroup) { + var sep = '_', prefix = ''; + if (!skipGroup && this.group) { + prefix = this.group.transformMatrixKey(skipGroup) + sep; + }; + return prefix + this.top + sep + this.left + sep + this.scaleX + sep + this.scaleY + + sep + this.skewX + sep + this.skewY + sep + this.angle + sep + this.originX + sep + this.originY + + sep + this.width + sep + this.height + sep + this.strokeWidth + this.flipX + this.flipY; + }, + + /** + * calculate transform matrix that represents the current transformations from the + * object's properties. + * @param {Boolean} [skipGroup] return transform matrix for object not counting parent transformations + * @return {Array} transform matrix for the object + */ + calcTransformMatrix: function(skipGroup) { + if (skipGroup) { + return this.calcOwnMatrix(); + } + var key = this.transformMatrixKey(), cache = this.matrixCache || (this.matrixCache = {}); + if (cache.key === key) { + return cache.value; + } + var matrix = this.calcOwnMatrix(); + if (this.group) { + matrix = multiplyMatrices(this.group.calcTransformMatrix(), matrix); + } + cache.key = key; + cache.value = matrix; + return matrix; + }, + + /** + * calculate transform matrix that represents the current transformations from the + * object's properties, this matrix does not include the group transformation + * @return {Array} transform matrix for the object + */ + calcOwnMatrix: function() { + var key = this.transformMatrixKey(true), cache = this.ownMatrixCache || (this.ownMatrixCache = {}); + if (cache.key === key) { + return cache.value; + } + var tMatrix = this._calcTranslateMatrix(); + this.translateX = tMatrix[4]; + this.translateY = tMatrix[5]; + cache.key = key; + cache.value = fabric.util.composeMatrix(this); + return cache.value; + }, + + /* + * Calculate object dimensions from its properties + * @private + * @deprecated since 3.4.0, please use fabric.util._calcDimensionsTransformMatrix + * not including or including flipX, flipY to emulate the flipping boolean + * @return {Object} .x width dimension + * @return {Object} .y height dimension + */ + _calcDimensionsTransformMatrix: function(skewX, skewY, flipping) { + return fabric.util.calcDimensionsMatrix({ + skewX: skewX, + skewY: skewY, + scaleX: this.scaleX * (flipping && this.flipX ? -1 : 1), + scaleY: this.scaleY * (flipping && this.flipY ? -1 : 1) + }); + }, + + /* + * Calculate object dimensions from its properties + * @private + * @return {Object} .x width dimension + * @return {Object} .y height dimension + */ + _getNonTransformedDimensions: function() { + var strokeWidth = this.strokeWidth, + w = this.width + strokeWidth, + h = this.height + strokeWidth; + return { x: w, y: h }; + }, + + /* + * Calculate object bounding box dimensions from its properties scale, skew. + * @param {Number} skewX, a value to override current skewX + * @param {Number} skewY, a value to override current skewY + * @private + * @return {Object} .x width dimension + * @return {Object} .y height dimension + */ + _getTransformedDimensions: function(skewX, skewY) { + if (typeof skewX === 'undefined') { + skewX = this.skewX; + } + if (typeof skewY === 'undefined') { + skewY = this.skewY; + } + var dimensions = this._getNonTransformedDimensions(), dimX, dimY, + noSkew = skewX === 0 && skewY === 0; + + if (this.strokeUniform) { + dimX = this.width; + dimY = this.height; + } + else { + dimX = dimensions.x; + dimY = dimensions.y; + } + if (noSkew) { + return this._finalizeDimensions(dimX * this.scaleX, dimY * this.scaleY); + } + else { + dimX /= 2; + dimY /= 2; + } + var points = [ + { + x: -dimX, + y: -dimY + }, + { + x: dimX, + y: -dimY + }, + { + x: -dimX, + y: dimY + }, + { + x: dimX, + y: dimY + }], + transformMatrix = fabric.util.calcDimensionsMatrix({ + scaleX: this.scaleX, + scaleY: this.scaleY, + skewX: this.skewX, + skewY: this.skewY, + }), + bbox = fabric.util.makeBoundingBoxFromPoints(points, transformMatrix); + return this._finalizeDimensions(bbox.width, bbox.height); + }, + + /* + * Calculate object bounding box dimensions from its properties scale, skew. + * @param Number width width of the bbox + * @param Number height height of the bbox + * @private + * @return {Object} .x finalized width dimension + * @return {Object} .y finalized height dimension + */ + _finalizeDimensions: function(width, height) { + return this.strokeUniform ? + { x: width + this.strokeWidth, y: height + this.strokeWidth } + : + { x: width, y: height }; + }, + /* + * Calculate object dimensions for controls, including padding and canvas zoom. + * private + */ + _calculateCurrentDimensions: function() { + var vpt = this.getViewportTransform(), + dim = this._getTransformedDimensions(), + p = fabric.util.transformPoint(dim, vpt, true); + + return p.scalarAdd(2 * this.padding); + }, + }); +})(); +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Moves an object to the bottom of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + sendToBack: function() { + if (this.group) { + fabric.StaticCanvas.prototype.sendToBack.call(this.group, this); + } + else { + this.canvas.sendToBack(this); + } + return this; + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + bringToFront: function() { + if (this.group) { + fabric.StaticCanvas.prototype.bringToFront.call(this.group, this); + } + else { + this.canvas.bringToFront(this); + } + return this; + }, + + /** + * Moves an object down in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + sendBackwards: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting); + } + else { + this.canvas.sendBackwards(this, intersecting); + } + return this; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + bringForward: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting); + } + else { + this.canvas.bringForward(this, intersecting); + } + return this; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {Number} index New position of object + * @return {fabric.Object} thisArg + * @chainable + */ + moveTo: function(index) { + if (this.group && this.group.type !== 'activeSelection') { + fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index); + } + else { + this.canvas.moveTo(this, index); + } + return this; + } +}); +/* _TO_SVG_START_ */ +(function() { + function getSvgColorString(prop, value) { + if (!value) { + return prop + ': none; '; + } + else if (value.toLive) { + return prop + ': url(#SVGID_' + value.id + '); '; + } + else { + var color = new fabric.Color(value), + str = prop + ': ' + color.toRgb() + '; ', + opacity = color.getAlpha(); + if (opacity !== 1) { + //change the color in rgb + opacity + str += prop + '-opacity: ' + opacity.toString() + '; '; + } + return str; + } + } + + var toFixed = fabric.util.toFixed; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Returns styles-string for svg-export + * @param {Boolean} skipShadow a boolean to skip shadow filter output + * @return {String} + */ + getSvgStyles: function(skipShadow) { + + var fillRule = this.fillRule ? this.fillRule : 'nonzero', + strokeWidth = this.strokeWidth ? this.strokeWidth : '0', + strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(' ') : 'none', + strokeDashOffset = this.strokeDashOffset ? this.strokeDashOffset : '0', + strokeLineCap = this.strokeLineCap ? this.strokeLineCap : 'butt', + strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : 'miter', + strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : '4', + opacity = typeof this.opacity !== 'undefined' ? this.opacity : '1', + visibility = this.visible ? '' : ' visibility: hidden;', + filter = skipShadow ? '' : this.getSvgFilter(), + fill = getSvgColorString('fill', this.fill), + stroke = getSvgColorString('stroke', this.stroke); + + return [ + stroke, + 'stroke-width: ', strokeWidth, '; ', + 'stroke-dasharray: ', strokeDashArray, '; ', + 'stroke-linecap: ', strokeLineCap, '; ', + 'stroke-dashoffset: ', strokeDashOffset, '; ', + 'stroke-linejoin: ', strokeLineJoin, '; ', + 'stroke-miterlimit: ', strokeMiterLimit, '; ', + fill, + 'fill-rule: ', fillRule, '; ', + 'opacity: ', opacity, ';', + filter, + visibility + ].join(''); + }, + + /** + * Returns styles-string for svg-export + * @param {Object} style the object from which to retrieve style properties + * @param {Boolean} useWhiteSpace a boolean to include an additional attribute in the style. + * @return {String} + */ + getSvgSpanStyles: function(style, useWhiteSpace) { + var term = '; '; + var fontFamily = style.fontFamily ? + 'font-family: ' + (((style.fontFamily.indexOf('\'') === -1 && style.fontFamily.indexOf('"') === -1) ? + '\'' + style.fontFamily + '\'' : style.fontFamily)) + term : ''; + var strokeWidth = style.strokeWidth ? 'stroke-width: ' + style.strokeWidth + term : '', + fontFamily = fontFamily, + fontSize = style.fontSize ? 'font-size: ' + style.fontSize + 'px' + term : '', + fontStyle = style.fontStyle ? 'font-style: ' + style.fontStyle + term : '', + fontWeight = style.fontWeight ? 'font-weight: ' + style.fontWeight + term : '', + fill = style.fill ? getSvgColorString('fill', style.fill) : '', + stroke = style.stroke ? getSvgColorString('stroke', style.stroke) : '', + textDecoration = this.getSvgTextDecoration(style), + deltaY = style.deltaY ? 'baseline-shift: ' + (-style.deltaY) + '; ' : ''; + if (textDecoration) { + textDecoration = 'text-decoration: ' + textDecoration + term; + } + + return [ + stroke, + strokeWidth, + fontFamily, + fontSize, + fontStyle, + fontWeight, + textDecoration, + fill, + deltaY, + useWhiteSpace ? 'white-space: pre; ' : '' + ].join(''); + }, + + /** + * Returns text-decoration property for svg-export + * @param {Object} style the object from which to retrieve style properties + * @return {String} + */ + getSvgTextDecoration: function(style) { + if ('overline' in style || 'underline' in style || 'linethrough' in style) { + return (style.overline ? 'overline ' : '') + + (style.underline ? 'underline ' : '') + (style.linethrough ? 'line-through ' : ''); + } + return ''; + }, + + /** + * Returns filter for svg shadow + * @return {String} + */ + getSvgFilter: function() { + return this.shadow ? 'filter: url(#SVGID_' + this.shadow.id + ');' : ''; + }, + + /** + * Returns id attribute for svg output + * @return {String} + */ + getSvgCommons: function() { + return [ + this.id ? 'id="' + this.id + '" ' : '', + this.clipPath ? 'clip-path="url(#' + this.clipPath.clipPathId + ')" ' : '', + ].join(''); + }, + + /** + * Returns transform-string for svg-export + * @param {Boolean} use the full transform or the single object one. + * @return {String} + */ + getSvgTransform: function(full, additionalTransform) { + var transform = full ? this.calcTransformMatrix() : this.calcOwnMatrix(), + svgTransform = 'transform="' + fabric.util.matrixToSVG(transform); + return svgTransform + + (additionalTransform || '') + this.getSvgTransformMatrix() + '" '; + }, + + /** + * Returns transform-string for svg-export from the transform matrix of single elements + * @return {String} + */ + getSvgTransformMatrix: function() { + return this.transformMatrix ? ' ' + fabric.util.matrixToSVG(this.transformMatrix) : ''; + }, + + _setSVGBg: function(textBgRects) { + if (this.backgroundColor) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + textBgRects.push( + '\t\t\n'); + } + }, + + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + return this._createBaseSVGMarkup(this._toSVG(reviver), { reviver: reviver }); + }, + + /** + * Returns svg clipPath representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toClipPathSVG: function(reviver) { + return '\t' + this._createBaseClipPathSVGMarkup(this._toSVG(reviver), { reviver: reviver }); + }, + + /** + * @private + */ + _createBaseClipPathSVGMarkup: function(objectMarkup, options) { + options = options || {}; + var reviver = options.reviver, + additionalTransform = options.additionalTransform || '', + commonPieces = [ + this.getSvgTransform(true, additionalTransform), + this.getSvgCommons(), + ].join(''), + // insert commons in the markup, style and svgCommons + index = objectMarkup.indexOf('COMMON_PARTS'); + objectMarkup[index] = commonPieces; + return reviver ? reviver(objectMarkup.join('')) : objectMarkup.join(''); + }, + + /** + * @private + */ + _createBaseSVGMarkup: function(objectMarkup, options) { + options = options || {}; + var noStyle = options.noStyle, + reviver = options.reviver, + styleInfo = noStyle ? '' : 'style="' + this.getSvgStyles() + '" ', + shadowInfo = options.withShadow ? 'style="' + this.getSvgFilter() + '" ' : '', + clipPath = this.clipPath, + vectorEffect = this.strokeUniform ? 'vector-effect="non-scaling-stroke" ' : '', + absoluteClipPath = clipPath && clipPath.absolutePositioned, + stroke = this.stroke, fill = this.fill, shadow = this.shadow, + commonPieces, markup = [], clipPathMarkup, + // insert commons in the markup, style and svgCommons + index = objectMarkup.indexOf('COMMON_PARTS'), + additionalTransform = options.additionalTransform; + if (clipPath) { + clipPath.clipPathId = 'CLIPPATH_' + fabric.Object.__uid++; + clipPathMarkup = '\n' + + clipPath.toClipPathSVG(reviver) + + '\n'; + } + if (absoluteClipPath) { + markup.push( + '\n' + ); + } + markup.push( + '\n' + ); + commonPieces = [ + styleInfo, + vectorEffect, + noStyle ? '' : this.addPaintOrder(), ' ', + additionalTransform ? 'transform="' + additionalTransform + '" ' : '', + ].join(''); + objectMarkup[index] = commonPieces; + if (fill && fill.toLive) { + markup.push(fill.toSVG(this)); + } + if (stroke && stroke.toLive) { + markup.push(stroke.toSVG(this)); + } + if (shadow) { + markup.push(shadow.toSVG(this)); + } + if (clipPath) { + markup.push(clipPathMarkup); + } + markup.push(objectMarkup.join('')); + markup.push('\n'); + absoluteClipPath && markup.push('\n'); + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + + addPaintOrder: function() { + return this.paintFirst !== 'fill' ? ' paint-order="' + this.paintFirst + '" ' : ''; + } + }); +})(); +/* _TO_SVG_END_ */ +(function() { + + var extend = fabric.util.object.extend, + originalSet = 'stateProperties'; + + /* + Depends on `stateProperties` + */ + function saveProps(origin, destination, props) { + var tmpObj = { }, deep = true; + props.forEach(function(prop) { + tmpObj[prop] = origin[prop]; + }); + extend(origin[destination], tmpObj, deep); + } + + function _isEqual(origValue, currentValue, firstPass) { + if (origValue === currentValue) { + // if the objects are identical, return + return true; + } + else if (Array.isArray(origValue)) { + if (!Array.isArray(currentValue) || origValue.length !== currentValue.length) { + return false; + } + for (var i = 0, len = origValue.length; i < len; i++) { + if (!_isEqual(origValue[i], currentValue[i])) { + return false; + } + } + return true; + } + else if (origValue && typeof origValue === 'object') { + var keys = Object.keys(origValue), key; + if (!currentValue || + typeof currentValue !== 'object' || + (!firstPass && keys.length !== Object.keys(currentValue).length) + ) { + return false; + } + for (var i = 0, len = keys.length; i < len; i++) { + key = keys[i]; + // since clipPath is in the statefull cache list and the clipPath objects + // would be iterated as an object, this would lead to possible infinite recursion + if (key === 'canvas') { + continue; + } + if (!_isEqual(origValue[key], currentValue[key])) { + return false; + } + } + return true; + } + } + + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns true if object state (one of its state properties) was changed + * @param {String} [propertySet] optional name for the set of property we want to save + * @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called + */ + hasStateChanged: function(propertySet) { + propertySet = propertySet || originalSet; + var dashedPropertySet = '_' + propertySet; + if (Object.keys(this[dashedPropertySet]).length < this[propertySet].length) { + return true; + } + return !_isEqual(this[dashedPropertySet], this, true); + }, + + /** + * Saves state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + saveState: function(options) { + var propertySet = options && options.propertySet || originalSet, + destination = '_' + propertySet; + if (!this[destination]) { + return this.setupState(options); + } + saveProps(this, destination, this[propertySet]); + if (options && options.stateProperties) { + saveProps(this, destination, options.stateProperties); + } + return this; + }, + + /** + * Setups state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + setupState: function(options) { + options = options || { }; + var propertySet = options.propertySet || originalSet; + options.propertySet = propertySet; + this['_' + propertySet] = { }; + this.saveState(options); + return this; + } + }); +})(); +(function() { + + var degreesToRadians = fabric.util.degreesToRadians; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * The object interactivity controls. + * @private + */ + _controlsVisibility: null, + + /** + * Determines which corner has been clicked + * @private + * @param {Object} pointer The pointer indicating the mouse position + * @return {String|Boolean} corner code (tl, tr, bl, br, etc.), or false if nothing is found + */ + _findTargetCorner: function(pointer) { + // objects in group, anykind, are not self modificable, + // must not return an hovered corner. + if (!this.hasControls || this.group || (!this.canvas || this.canvas._activeObject !== this)) { + return false; + } + + var ex = pointer.x, + ey = pointer.y, + xPoints, + lines; + this.__corner = 0; + for (var i in this.oCoords) { + + if (!this.isControlVisible(i)) { + continue; + } + + if (i === 'mtr' && !this.hasRotatingPoint) { + continue; + } + + if (this.get('lockUniScaling') && + (i === 'mt' || i === 'mr' || i === 'mb' || i === 'ml')) { + continue; + } + + lines = this._getImageLines(this.oCoords[i].corner); + + // debugging + + // canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2); + + xPoints = this._findCrossPoints({ x: ex, y: ey }, lines); + if (xPoints !== 0 && xPoints % 2 === 1) { + this.__corner = i; + return i; + } + } + return false; + }, + + /** + * Sets the coordinates of the draggable boxes in the corners of + * the image used to scale/rotate it. + * @private + */ + _setCornerCoords: function() { + var coords = this.oCoords, + newTheta = degreesToRadians(45 - this.angle), + /* Math.sqrt(2 * Math.pow(this.cornerSize, 2)) / 2, */ + /* 0.707106 stands for sqrt(2)/2 */ + cornerHypotenuse = this.cornerSize * 0.707106, + cosHalfOffset = cornerHypotenuse * fabric.util.cos(newTheta), + sinHalfOffset = cornerHypotenuse * fabric.util.sin(newTheta), + x, y; + + for (var point in coords) { + x = coords[point].x; + y = coords[point].y; + coords[point].corner = { + tl: { + x: x - sinHalfOffset, + y: y - cosHalfOffset + }, + tr: { + x: x + cosHalfOffset, + y: y - sinHalfOffset + }, + bl: { + x: x - cosHalfOffset, + y: y + sinHalfOffset + }, + br: { + x: x + sinHalfOffset, + y: y + cosHalfOffset + } + }; + } + }, + + /** + * Draws a colored layer behind the object, inside its selection borders. + * Requires public options: padding, selectionBackgroundColor + * this function is called when the context is transformed + * has checks to be skipped when the object is on a staticCanvas + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawSelectionBackground: function(ctx) { + if (!this.selectionBackgroundColor || + (this.canvas && !this.canvas.interactive) || + (this.canvas && this.canvas._activeObject !== this) + ) { + return this; + } + ctx.save(); + var center = this.getCenterPoint(), wh = this._calculateCurrentDimensions(), + vpt = this.canvas.viewportTransform; + ctx.translate(center.x, center.y); + ctx.scale(1 / vpt[0], 1 / vpt[3]); + ctx.rotate(degreesToRadians(this.angle)); + ctx.fillStyle = this.selectionBackgroundColor; + ctx.fillRect(-wh.x / 2, -wh.y / 2, wh.x, wh.y); + ctx.restore(); + return this; + }, + + /** + * Draws borders of an object's bounding box. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {Object} styleOverride object to override the object style + * @return {fabric.Object} thisArg + * @chainable + */ + drawBorders: function(ctx, styleOverride) { + styleOverride = styleOverride || {}; + var wh = this._calculateCurrentDimensions(), + strokeWidth = 1 / this.borderScaleFactor, + width = wh.x + strokeWidth, + height = wh.y + strokeWidth, + drawRotatingPoint = typeof styleOverride.hasRotatingPoint !== 'undefined' ? + styleOverride.hasRotatingPoint : this.hasRotatingPoint, + hasControls = typeof styleOverride.hasControls !== 'undefined' ? + styleOverride.hasControls : this.hasControls, + rotatingPointOffset = typeof styleOverride.rotatingPointOffset !== 'undefined' ? + styleOverride.rotatingPointOffset : this.rotatingPointOffset; + + ctx.save(); + ctx.strokeStyle = styleOverride.borderColor || this.borderColor; + this._setLineDash(ctx, styleOverride.borderDashArray || this.borderDashArray, null); + + ctx.strokeRect( + -width / 2, + -height / 2, + width, + height + ); + + if (drawRotatingPoint && this.isControlVisible('mtr') && hasControls) { + + var rotateHeight = -height / 2; + + ctx.beginPath(); + ctx.moveTo(0, rotateHeight); + ctx.lineTo(0, rotateHeight - rotatingPointOffset); + ctx.stroke(); + } + + ctx.restore(); + return this; + }, + + /** + * Draws borders of an object's bounding box when it is inside a group. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {object} options object representing current object parameters + * @param {Object} styleOverride object to override the object style + * @return {fabric.Object} thisArg + * @chainable + */ + drawBordersInGroup: function(ctx, options, styleOverride) { + styleOverride = styleOverride || {}; + var p = this._getNonTransformedDimensions(), + matrix = fabric.util.composeMatrix({ + scaleX: options.scaleX, + scaleY: options.scaleY, + skewX: options.skewX + }), + wh = fabric.util.transformPoint(p, matrix), + strokeWidth = 1 / this.borderScaleFactor, + width = wh.x + strokeWidth, + height = wh.y + strokeWidth; + + ctx.save(); + this._setLineDash(ctx, styleOverride.borderDashArray || this.borderDashArray, null); + ctx.strokeStyle = styleOverride.borderColor || this.borderColor; + + ctx.strokeRect( + -width / 2, + -height / 2, + width, + height + ); + + ctx.restore(); + return this; + }, + + /** + * Draws corners of an object's bounding box. + * Requires public properties: width, height + * Requires public options: cornerSize, padding + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @param {Object} styleOverride object to override the object style + * @return {fabric.Object} thisArg + * @chainable + */ + drawControls: function(ctx, styleOverride) { + styleOverride = styleOverride || {}; + var wh = this._calculateCurrentDimensions(), + width = wh.x, + height = wh.y, + scaleOffset = styleOverride.cornerSize || this.cornerSize, + left = -(width + scaleOffset) / 2, + top = -(height + scaleOffset) / 2, + transparentCorners = typeof styleOverride.transparentCorners !== 'undefined' ? + styleOverride.transparentCorners : this.transparentCorners, + hasRotatingPoint = typeof styleOverride.hasRotatingPoint !== 'undefined' ? + styleOverride.hasRotatingPoint : this.hasRotatingPoint, + methodName = transparentCorners ? 'stroke' : 'fill'; + + ctx.save(); + ctx.strokeStyle = ctx.fillStyle = styleOverride.cornerColor || this.cornerColor; + if (!this.transparentCorners) { + ctx.strokeStyle = styleOverride.cornerStrokeColor || this.cornerStrokeColor; + } + this._setLineDash(ctx, styleOverride.cornerDashArray || this.cornerDashArray, null); + + // top-left + this._drawControl('tl', ctx, methodName, + left, + top, styleOverride); + + // top-right + this._drawControl('tr', ctx, methodName, + left + width, + top, styleOverride); + + // bottom-left + this._drawControl('bl', ctx, methodName, + left, + top + height, styleOverride); + + // bottom-right + this._drawControl('br', ctx, methodName, + left + width, + top + height, styleOverride); + + if (!this.get('lockUniScaling')) { + + // middle-top + this._drawControl('mt', ctx, methodName, + left + width / 2, + top, styleOverride); + + // middle-bottom + this._drawControl('mb', ctx, methodName, + left + width / 2, + top + height, styleOverride); + + // middle-right + this._drawControl('mr', ctx, methodName, + left + width, + top + height / 2, styleOverride); + + // middle-left + this._drawControl('ml', ctx, methodName, + left, + top + height / 2, styleOverride); + } + + // middle-top-rotate + if (hasRotatingPoint) { + this._drawControl('mtr', ctx, methodName, + left + width / 2, + top - this.rotatingPointOffset, styleOverride); + } + + ctx.restore(); + + return this; + }, + + /** + * @private + */ + _drawControl: function(control, ctx, methodName, left, top, styleOverride) { + styleOverride = styleOverride || {}; + if (!this.isControlVisible(control)) { + return; + } + var size = this.cornerSize, stroke = !this.transparentCorners && this.cornerStrokeColor; + switch (styleOverride.cornerStyle || this.cornerStyle) { + case 'circle': + ctx.beginPath(); + ctx.arc(left + size / 2, top + size / 2, size / 2, 0, 2 * Math.PI, false); + ctx[methodName](); + if (stroke) { + ctx.stroke(); + } + break; + default: + this.transparentCorners || ctx.clearRect(left, top, size, size); + ctx[methodName + 'Rect'](left, top, size, size); + if (stroke) { + ctx.strokeRect(left, top, size, size); + } + } + }, + + /** + * Returns true if the specified control is visible, false otherwise. + * @param {String} controlName The name of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @returns {Boolean} true if the specified control is visible, false otherwise + */ + isControlVisible: function(controlName) { + return this._getControlsVisibility()[controlName]; + }, + + /** + * Sets the visibility of the specified control. + * @param {String} controlName The name of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @param {Boolean} visible true to set the specified control visible, false otherwise + * @return {fabric.Object} thisArg + * @chainable + */ + setControlVisible: function(controlName, visible) { + this._getControlsVisibility()[controlName] = visible; + return this; + }, + + /** + * Sets the visibility state of object controls. + * @param {Object} [options] Options object + * @param {Boolean} [options.bl] true to enable the bottom-left control, false to disable it + * @param {Boolean} [options.br] true to enable the bottom-right control, false to disable it + * @param {Boolean} [options.mb] true to enable the middle-bottom control, false to disable it + * @param {Boolean} [options.ml] true to enable the middle-left control, false to disable it + * @param {Boolean} [options.mr] true to enable the middle-right control, false to disable it + * @param {Boolean} [options.mt] true to enable the middle-top control, false to disable it + * @param {Boolean} [options.tl] true to enable the top-left control, false to disable it + * @param {Boolean} [options.tr] true to enable the top-right control, false to disable it + * @param {Boolean} [options.mtr] true to enable the middle-top-rotate control, false to disable it + * @return {fabric.Object} thisArg + * @chainable + */ + setControlsVisibility: function(options) { + options || (options = { }); + + for (var p in options) { + this.setControlVisible(p, options[p]); + } + return this; + }, + + /** + * Returns the instance of the control visibility set for this object. + * @private + * @returns {Object} + */ + _getControlsVisibility: function() { + if (!this._controlsVisibility) { + this._controlsVisibility = { + tl: true, + tr: true, + br: true, + bl: true, + ml: true, + mt: true, + mr: true, + mb: true, + mtr: true + }; + } + return this._controlsVisibility; + }, + + /** + * This callback function is called every time _discardActiveObject or _setActiveObject + * try to to deselect this object. If the function returns true, the process is cancelled + * @param {Object} [options] options sent from the upper functions + * @param {Event} [options.e] event if the process is generated by an event + */ + onDeselect: function() { + // implemented by sub-classes, as needed. + }, + + + /** + * This callback function is called every time _discardActiveObject or _setActiveObject + * try to to select this object. If the function returns true, the process is cancelled + * @param {Object} [options] options sent from the upper functions + * @param {Event} [options.e] event if the process is generated by an event + */ + onSelect: function() { + // implemented by sub-classes, as needed. + } + }); +})(); +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Animation duration (in ms) for fx* methods + * @type Number + * @default + */ + FX_DURATION: 500, + + /** + * Centers object horizontally with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectH: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.left, + endValue: this.getCenter().left, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('left', value); + _this.requestRenderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Centers object vertically with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectV: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.top, + endValue: this.getCenter().top, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('top', value); + _this.requestRenderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Same as `fabric.Canvas#remove` but animated + * @param {fabric.Object} object Object to remove + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxRemove: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.opacity, + endValue: 0, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('opacity', value); + _this.requestRenderAll(); + onChange(); + }, + onComplete: function () { + _this.remove(object); + onComplete(); + } + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Animates object's properties + * @param {String|Object} property Property to animate (if string) or properties to animate (if object) + * @param {Number|Object} value Value to animate property to (if string was given first) or options object + * @return {fabric.Object} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#animation} + * @chainable + * + * As object — multiple properties + * + * object.animate({ left: ..., top: ... }); + * object.animate({ left: ..., top: ... }, { duration: ... }); + * + * As string — one property + * + * object.animate('left', ...); + * object.animate('left', { duration: ... }); + * + */ + animate: function() { + if (arguments[0] && typeof arguments[0] === 'object') { + var propsToAnimate = [], prop, skipCallbacks; + for (prop in arguments[0]) { + propsToAnimate.push(prop); + } + for (var i = 0, len = propsToAnimate.length; i < len; i++) { + prop = propsToAnimate[i]; + skipCallbacks = i !== len - 1; + this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks); + } + } + else { + this._animate.apply(this, arguments); + } + return this; + }, + + /** + * @private + * @param {String} property Property to animate + * @param {String} to Value to animate to + * @param {Object} [options] Options object + * @param {Boolean} [skipCallbacks] When true, callbacks like onchange and oncomplete are not invoked + */ + _animate: function(property, to, options, skipCallbacks) { + var _this = this, propPair; + + to = to.toString(); + + if (!options) { + options = { }; + } + else { + options = fabric.util.object.clone(options); + } + + if (~property.indexOf('.')) { + propPair = property.split('.'); + } + + var currentValue = propPair + ? this.get(propPair[0])[propPair[1]] + : this.get(property); + + if (!('from' in options)) { + options.from = currentValue; + } + + if (~to.indexOf('=')) { + to = currentValue + parseFloat(to.replace('=', '')); + } + else { + to = parseFloat(to); + } + + fabric.util.animate({ + startValue: options.from, + endValue: to, + byValue: options.by, + easing: options.easing, + duration: options.duration, + abort: options.abort && function() { + return options.abort.call(_this); + }, + onChange: function(value, valueProgress, timeProgress) { + if (propPair) { + _this[propPair[0]][propPair[1]] = value; + } + else { + _this.set(property, value); + } + if (skipCallbacks) { + return; + } + options.onChange && options.onChange(value, valueProgress, timeProgress); + }, + onComplete: function(value, valueProgress, timeProgress) { + if (skipCallbacks) { + return; + } + + _this.setCoords(); + options.onComplete && options.onComplete(value, valueProgress, timeProgress); + } + }); + } +}); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + coordProps = { x1: 1, x2: 1, y1: 1, y2: 1 }, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Line) { + fabric.warn('fabric.Line is already defined'); + return; + } + + /** + * Line class + * @class fabric.Line + * @extends fabric.Object + * @see {@link fabric.Line#initialize} for constructor definition + */ + fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'line', + + /** + * x value or first line edge + * @type Number + * @default + */ + x1: 0, + + /** + * y value or first line edge + * @type Number + * @default + */ + y1: 0, + + /** + * x value or second line edge + * @type Number + * @default + */ + x2: 0, + + /** + * y value or second line edge + * @type Number + * @default + */ + y2: 0, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('x1', 'x2', 'y1', 'y2'), + + /** + * Constructor + * @param {Array} [points] Array of points + * @param {Object} [options] Options object + * @return {fabric.Line} thisArg + */ + initialize: function(points, options) { + if (!points) { + points = [0, 0, 0, 0]; + } + + this.callSuper('initialize', options); + + this.set('x1', points[0]); + this.set('y1', points[1]); + this.set('x2', points[2]); + this.set('y2', points[3]); + + this._setWidthHeight(options); + }, + + /** + * @private + * @param {Object} [options] Options + */ + _setWidthHeight: function(options) { + options || (options = { }); + + this.width = Math.abs(this.x2 - this.x1); + this.height = Math.abs(this.y2 - this.y1); + + this.left = 'left' in options + ? options.left + : this._getLeftToOriginX(); + + this.top = 'top' in options + ? options.top + : this._getTopToOriginY(); + }, + + /** + * @private + * @param {String} key + * @param {*} value + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + if (typeof coordProps[key] !== 'undefined') { + this._setWidthHeight(); + } + return this; + }, + + /** + * @private + * @return {Number} leftToOriginX Distance from left edge of canvas to originX of Line. + */ + _getLeftToOriginX: makeEdgeToOriginGetter( + { // property names + origin: 'originX', + axis1: 'x1', + axis2: 'x2', + dimension: 'width' + }, + { // possible values of origin + nearest: 'left', + center: 'center', + farthest: 'right' + } + ), + + /** + * @private + * @return {Number} topToOriginY Distance from top edge of canvas to originY of Line. + */ + _getTopToOriginY: makeEdgeToOriginGetter( + { // property names + origin: 'originY', + axis1: 'y1', + axis2: 'y2', + dimension: 'height' + }, + { // possible values of origin + nearest: 'top', + center: 'center', + farthest: 'bottom' + } + ), + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + ctx.beginPath(); + + if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) { + // move from center (of virtual box) to its left/top corner + // we can't assume x1, y1 is top left and x2, y2 is bottom right + var p = this.calcLinePoints(); + ctx.moveTo(p.x1, p.y1); + ctx.lineTo(p.x2, p.y2); + } + + ctx.lineWidth = this.strokeWidth; + + // TODO: test this + // make sure setting "fill" changes color of a line + // (by copying fillStyle to strokeStyle, since line is stroked, not filled) + var origStrokeStyle = ctx.strokeStyle; + ctx.strokeStyle = this.stroke || ctx.fillStyle; + this.stroke && this._renderStroke(ctx); + ctx.strokeStyle = origStrokeStyle; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p = this.calcLinePoints(); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, p.x1, p.y1, p.x2, p.y2, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * This function is an helper for svg import. it returns the center of the object in the svg + * untransformed coordinates + * @private + * @return {Object} center point from element coordinates + */ + _findCenterFromElement: function() { + return { + x: (this.x1 + this.x2) / 2, + y: (this.y1 + this.y2) / 2, + }; + }, + + /** + * Returns object representation of an instance + * @methd toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), this.calcLinePoints()); + }, + + /* + * Calculate object dimensions from its properties + * @private + */ + _getNonTransformedDimensions: function() { + var dim = this.callSuper('_getNonTransformedDimensions'); + if (this.strokeLineCap === 'butt') { + if (this.width === 0) { + dim.y -= this.strokeWidth; + } + if (this.height === 0) { + dim.x -= this.strokeWidth; + } + } + return dim; + }, + + /** + * Recalculates line points given width and height + * @private + */ + calcLinePoints: function() { + var xMult = this.x1 <= this.x2 ? -1 : 1, + yMult = this.y1 <= this.y2 ? -1 : 1, + x1 = (xMult * this.width * 0.5), + y1 = (yMult * this.height * 0.5), + x2 = (xMult * this.width * -0.5), + y2 = (yMult * this.height * -0.5); + + return { + x1: x1, + x2: x2, + y1: y1, + y2: y2 + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var p = this.calcLinePoints(); + return [ + '\n' + ]; + }, + /* _TO_SVG_END_ */ + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement}) + * @static + * @memberOf fabric.Line + * @see http://www.w3.org/TR/SVG/shapes.html#LineElement + */ + fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' ')); + + /** + * Returns fabric.Line instance from an SVG element + * @static + * @memberOf fabric.Line + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @param {Function} [callback] callback function invoked after parsing + */ + fabric.Line.fromElement = function(element, callback, options) { + options = options || { }; + var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES), + points = [ + parsedAttributes.x1 || 0, + parsedAttributes.y1 || 0, + parsedAttributes.x2 || 0, + parsedAttributes.y2 || 0 + ]; + callback(new fabric.Line(points, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Line instance from an object representation + * @static + * @memberOf fabric.Line + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + */ + fabric.Line.fromObject = function(object, callback) { + function _callback(instance) { + delete instance.points; + callback && callback(instance); + }; + var options = clone(object, true); + options.points = [object.x1, object.y1, object.x2, object.y2]; + fabric.Object._fromObject('Line', options, _callback, 'points'); + }; + + /** + * Produces a function that calculates distance from canvas edge to Line origin. + */ + function makeEdgeToOriginGetter(propertyNames, originValues) { + var origin = propertyNames.origin, + axis1 = propertyNames.axis1, + axis2 = propertyNames.axis2, + dimension = propertyNames.dimension, + nearest = originValues.nearest, + center = originValues.center, + farthest = originValues.farthest; + + return function() { + switch (this.get(origin)) { + case nearest: + return Math.min(this.get(axis1), this.get(axis2)); + case center: + return Math.min(this.get(axis1), this.get(axis2)) + (0.5 * this.get(dimension)); + case farthest: + return Math.max(this.get(axis1), this.get(axis2)); + } + }; + + } + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + pi = Math.PI; + + if (fabric.Circle) { + fabric.warn('fabric.Circle is already defined.'); + return; + } + + /** + * Circle class + * @class fabric.Circle + * @extends fabric.Object + * @see {@link fabric.Circle#initialize} for constructor definition + */ + fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'circle', + + /** + * Radius of this circle + * @type Number + * @default + */ + radius: 0, + + /** + * Start angle of the circle, moving clockwise + * deprectated type, this should be in degree, this was an oversight. + * probably will change to degrees in next major version + * @type Number + * @default 0 + */ + startAngle: 0, + + /** + * End angle of the circle + * deprectated type, this should be in degree, this was an oversight. + * probably will change to degrees in next major version + * @type Number + * @default 2Pi + */ + endAngle: pi * 2, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('radius', 'startAngle', 'endAngle'), + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Circle} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key === 'radius') { + this.setRadius(value); + } + + return this; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['radius', 'startAngle', 'endAngle'].concat(propertiesToInclude)); + }, + + /* _TO_SVG_START_ */ + + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var svgString, x = 0, y = 0, + angle = (this.endAngle - this.startAngle) % ( 2 * pi); + + if (angle === 0) { + svgString = [ + '\n' + ]; + } + else { + var startX = fabric.util.cos(this.startAngle) * this.radius, + startY = fabric.util.sin(this.startAngle) * this.radius, + endX = fabric.util.cos(this.endAngle) * this.radius, + endY = fabric.util.sin(this.endAngle) * this.radius, + largeFlag = angle > pi ? '1' : '0'; + svgString = [ + '\n' + ]; + } + return svgString; + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + */ + _render: function(ctx) { + ctx.beginPath(); + ctx.arc( + 0, + 0, + this.radius, + this.startAngle, + this.endAngle, false); + this._renderPaintInOrder(ctx); + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusX: function() { + return this.get('radius') * this.get('scaleX'); + }, + + /** + * Returns vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusY: function() { + return this.get('radius') * this.get('scaleY'); + }, + + /** + * Sets radius of an object (and updates width accordingly) + * @return {fabric.Circle} thisArg + */ + setRadius: function(value) { + this.radius = value; + return this.set('width', value * 2).set('height', value * 2); + }, + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement}) + * @static + * @memberOf fabric.Circle + * @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement + */ + fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' ')); + + /** + * Returns {@link fabric.Circle} instance from an SVG element + * @static + * @memberOf fabric.Circle + * @param {SVGElement} element Element to parse + * @param {Function} [callback] Options callback invoked after parsing is finished + * @param {Object} [options] Options object + * @throws {Error} If value of `r` attribute is missing or invalid + */ + fabric.Circle.fromElement = function(element, callback) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES); + + if (!isValidRadius(parsedAttributes)) { + throw new Error('value of `r` attribute is required and can not be negative'); + } + + parsedAttributes.left = (parsedAttributes.left || 0) - parsedAttributes.radius; + parsedAttributes.top = (parsedAttributes.top || 0) - parsedAttributes.radius; + callback(new fabric.Circle(parsedAttributes)); + }; + + /** + * @private + */ + function isValidRadius(attributes) { + return (('radius' in attributes) && (attributes.radius >= 0)); + } + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Circle} instance from an object representation + * @static + * @memberOf fabric.Circle + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {Object} Instance of fabric.Circle + */ + fabric.Circle.fromObject = function(object, callback) { + return fabric.Object._fromObject('Circle', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Triangle) { + fabric.warn('fabric.Triangle is already defined'); + return; + } + + /** + * Triangle class + * @class fabric.Triangle + * @extends fabric.Object + * @return {fabric.Triangle} thisArg + * @see {@link fabric.Triangle#initialize} for constructor definition + */ + fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'triangle', + + /** + * Width is set to 100 to compensate the old initialize code that was setting it to 100 + * @type Number + * @default + */ + width: 100, + + /** + * Height is set to 100 to compensate the old initialize code that was setting it to 100 + * @type Number + * @default + */ + height: 100, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + ctx.moveTo(-widthBy2, heightBy2); + ctx.lineTo(0, -heightBy2); + ctx.lineTo(widthBy2, heightBy2); + ctx.closePath(); + + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray); + ctx.closePath(); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2, + points = [ + -widthBy2 + ' ' + heightBy2, + '0 ' + -heightBy2, + widthBy2 + ' ' + heightBy2 + ].join(','); + return [ + '' + ]; + }, + /* _TO_SVG_END_ */ + }); + + /** + * Returns {@link fabric.Triangle} instance from an object representation + * @static + * @memberOf fabric.Triangle + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + */ + fabric.Triangle.fromObject = function(object, callback) { + return fabric.Object._fromObject('Triangle', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + piBy2 = Math.PI * 2; + + if (fabric.Ellipse) { + fabric.warn('fabric.Ellipse is already defined.'); + return; + } + + /** + * Ellipse class + * @class fabric.Ellipse + * @extends fabric.Object + * @return {fabric.Ellipse} thisArg + * @see {@link fabric.Ellipse#initialize} for constructor definition + */ + fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'ellipse', + + /** + * Horizontal radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical radius + * @type Number + * @default + */ + ry: 0, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('rx', 'ry'), + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Ellipse} thisArg + */ + initialize: function(options) { + this.callSuper('initialize', options); + this.set('rx', options && options.rx || 0); + this.set('ry', options && options.ry || 0); + }, + + /** + * @private + * @param {String} key + * @param {*} value + * @return {fabric.Ellipse} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + switch (key) { + + case 'rx': + this.rx = value; + this.set('width', value * 2); + break; + + case 'ry': + this.ry = value; + this.set('height', value * 2); + break; + + } + return this; + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRx: function() { + return this.get('rx') * this.get('scaleX'); + }, + + /** + * Returns Vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRy: function() { + return this.get('ry') * this.get('scaleY'); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['rx', 'ry'].concat(propertiesToInclude)); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + return [ + '\n' + ]; + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + */ + _render: function(ctx) { + ctx.beginPath(); + ctx.save(); + ctx.transform(1, 0, 0, this.ry / this.rx, 0, 0); + ctx.arc( + 0, + 0, + this.rx, + 0, + piBy2, + false); + ctx.restore(); + this._renderPaintInOrder(ctx); + }, + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement}) + * @static + * @memberOf fabric.Ellipse + * @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement + */ + fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' ')); + + /** + * Returns {@link fabric.Ellipse} instance from an SVG element + * @static + * @memberOf fabric.Ellipse + * @param {SVGElement} element Element to parse + * @param {Function} [callback] Options callback invoked after parsing is finished + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromElement = function(element, callback) { + + var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES); + + parsedAttributes.left = (parsedAttributes.left || 0) - parsedAttributes.rx; + parsedAttributes.top = (parsedAttributes.top || 0) - parsedAttributes.ry; + callback(new fabric.Ellipse(parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Ellipse} instance from an object representation + * @static + * @memberOf fabric.Ellipse + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as first argument + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromObject = function(object, callback) { + return fabric.Object._fromObject('Ellipse', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + if (fabric.Rect) { + fabric.warn('fabric.Rect is already defined'); + return; + } + + /** + * Rectangle class + * @class fabric.Rect + * @extends fabric.Object + * @return {fabric.Rect} thisArg + * @see {@link fabric.Rect#initialize} for constructor definition + */ + fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ { + + /** + * List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: fabric.Object.prototype.stateProperties.concat('rx', 'ry'), + + /** + * Type of an object + * @type String + * @default + */ + type: 'rect', + + /** + * Horizontal border radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical border radius + * @type Number + * @default + */ + ry: 0, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('rx', 'ry'), + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + this.callSuper('initialize', options); + this._initRxRy(); + }, + + /** + * Initializes rx/ry attributes + * @private + */ + _initRxRy: function() { + if (this.rx && !this.ry) { + this.ry = this.rx; + } + else if (this.ry && !this.rx) { + this.rx = this.ry; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + + // 1x1 case (used in spray brush) optimization was removed because + // with caching and higher zoom level this makes more damage than help + + var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0, + ry = this.ry ? Math.min(this.ry, this.height / 2) : 0, + w = this.width, + h = this.height, + x = -this.width / 2, + y = -this.height / 2, + isRounded = rx !== 0 || ry !== 0, + /* "magic number" for bezier approximations of arcs (http://itc.ktu.lt/itc354/Riskus354.pdf) */ + k = 1 - 0.5522847498; + ctx.beginPath(); + + ctx.moveTo(x + rx, y); + + ctx.lineTo(x + w - rx, y); + isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry); + + ctx.lineTo(x + w, y + h - ry); + isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h); + + ctx.lineTo(x + rx, y + h); + isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry); + + ctx.lineTo(x, y + ry); + isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y); + + ctx.closePath(); + + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['rx', 'ry'].concat(propertiesToInclude)); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var x = -this.width / 2, y = -this.height / 2; + return [ + '\n' + ]; + }, + /* _TO_SVG_END_ */ + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`) + * @static + * @memberOf fabric.Rect + * @see: http://www.w3.org/TR/SVG/shapes.html#RectElement + */ + fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' ')); + + /** + * Returns {@link fabric.Rect} instance from an SVG element + * @static + * @memberOf fabric.Rect + * @param {SVGElement} element Element to parse + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Rect.fromElement = function(element, callback, options) { + if (!element) { + return callback(null); + } + options = options || { }; + + var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + parsedAttributes.height = parsedAttributes.height || 0; + parsedAttributes.width = parsedAttributes.width || 0; + var rect = new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + rect.visible = rect.visible && rect.width > 0 && rect.height > 0; + callback(rect); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Rect} instance from an object representation + * @static + * @memberOf fabric.Rect + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Rect instance is created + */ + fabric.Rect.fromObject = function(object, callback) { + return fabric.Object._fromObject('Rect', object, callback); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + toFixed = fabric.util.toFixed; + + if (fabric.Polyline) { + fabric.warn('fabric.Polyline is already defined'); + return; + } + + /** + * Polyline class + * @class fabric.Polyline + * @extends fabric.Object + * @see {@link fabric.Polyline#initialize} for constructor definition + */ + fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polyline', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('points'), + + /** + * Constructor + * @param {Array} points Array of points (where each point is an object with x and y) + * @param {Object} [options] Options object + * @return {fabric.Polyline} thisArg + * @example + * var poly = new fabric.Polyline([ + * { x: 10, y: 10 }, + * { x: 50, y: 30 }, + * { x: 40, y: 70 }, + * { x: 60, y: 50 }, + * { x: 100, y: 150 }, + * { x: 40, y: 100 } + * ], { + * stroke: 'red', + * left: 100, + * top: 100 + * }); + */ + initialize: function(points, options) { + options = options || {}; + this.points = points || []; + this.callSuper('initialize', options); + this._setPositionDimensions(options); + }, + + _setPositionDimensions: function(options) { + var calcDim = this._calcDimensions(options), correctLeftTop; + this.width = calcDim.width; + this.height = calcDim.height; + if (!options.fromSVG) { + correctLeftTop = this.translateToGivenOrigin( + { x: calcDim.left - this.strokeWidth / 2, y: calcDim.top - this.strokeWidth / 2 }, + 'left', + 'top', + this.originX, + this.originY + ); + } + if (typeof options.left === 'undefined') { + this.left = options.fromSVG ? calcDim.left : correctLeftTop.x; + } + if (typeof options.top === 'undefined') { + this.top = options.fromSVG ? calcDim.top : correctLeftTop.y; + } + this.pathOffset = { + x: calcDim.left + this.width / 2, + y: calcDim.top + this.height / 2 + }; + }, + + /** + * Calculate the polygon min and max point from points array, + * returning an object with left, top, widht, height to measure the + * polygon size + * @return {Object} object.left X coordinate of the polygon leftmost point + * @return {Object} object.top Y coordinate of the polygon topmost point + * @return {Object} object.width distance between X coordinates of the polygon leftmost and rightmost point + * @return {Object} object.height distance between Y coordinates of the polygon topmost and bottommost point + * @private + */ + _calcDimensions: function() { + + var points = this.points, + minX = min(points, 'x') || 0, + minY = min(points, 'y') || 0, + maxX = max(points, 'x') || 0, + maxY = max(points, 'y') || 0, + width = (maxX - minX), + height = (maxY - minY); + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + points: this.points.concat() + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var points = [], diffX = this.pathOffset.x, diffY = this.pathOffset.y, + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + + for (var i = 0, len = this.points.length; i < len; i++) { + points.push( + toFixed(this.points[i].x - diffX, NUM_FRACTION_DIGITS), ',', + toFixed(this.points[i].y - diffY, NUM_FRACTION_DIGITS), ' ' + ); + } + return [ + '<' + this.type + ' ', 'COMMON_PARTS', + 'points="', points.join(''), + '" />\n' + ]; + }, + /* _TO_SVG_END_ */ + + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + commonRender: function(ctx) { + var point, len = this.points.length, + x = this.pathOffset.x, + y = this.pathOffset.y; + + if (!len || isNaN(this.points[len - 1].y)) { + // do not draw if no points or odd points + // NaN comes from parseFloat of a empty string in parser + return false; + } + ctx.beginPath(); + ctx.moveTo(this.points[0].x - x, this.points[0].y - y); + for (var i = 0; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x - x, point.y - y); + } + return true; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (!this.commonRender(ctx)) { + return; + } + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p1, p2; + + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || p1; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.get('points').length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement}) + * @static + * @memberOf fabric.Polyline + * @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement + */ + fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns fabric.Polyline instance from an SVG element + * @static + * @memberOf fabric.Polyline + * @param {SVGElement} element Element to parser + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Polyline.fromElementGenerator = function(_class) { + return function(element, callback, options) { + if (!element) { + return callback(null); + } + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric[_class].ATTRIBUTE_NAMES); + parsedAttributes.fromSVG = true; + callback(new fabric[_class](points, extend(parsedAttributes, options))); + }; + }; + + fabric.Polyline.fromElement = fabric.Polyline.fromElementGenerator('Polyline'); + + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polyline instance from an object representation + * @static + * @memberOf fabric.Polyline + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Polyline.fromObject = function(object, callback) { + return fabric.Object._fromObject('Polyline', object, callback, 'points'); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Polygon) { + fabric.warn('fabric.Polygon is already defined'); + return; + } + + /** + * Polygon class + * @class fabric.Polygon + * @extends fabric.Polyline + * @see {@link fabric.Polygon#initialize} for constructor definition + */ + fabric.Polygon = fabric.util.createClass(fabric.Polyline, /** @lends fabric.Polygon.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polygon', + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (!this.commonRender(ctx)) { + return; + } + ctx.closePath(); + this._renderPaintInOrder(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + this.callSuper('_renderDashedStroke', ctx); + ctx.closePath(); + }, + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`) + * @static + * @memberOf fabric.Polygon + * @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement + */ + fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns {@link fabric.Polygon} instance from an SVG element + * @static + * @memberOf fabric.Polygon + * @param {SVGElement} element Element to parse + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Polygon.fromElement = fabric.Polyline.fromElementGenerator('Polygon'); + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polygon instance from an object representation + * @static + * @memberOf fabric.Polygon + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Polygon.fromObject = function(object, callback) { + return fabric.Object._fromObject('Polygon', object, callback, 'points'); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max, + extend = fabric.util.object.extend, + _toString = Object.prototype.toString, + drawArc = fabric.util.drawArc, + toFixed = fabric.util.toFixed, + commandLengths = { + m: 2, + l: 2, + h: 1, + v: 1, + c: 6, + s: 4, + q: 4, + t: 2, + a: 7 + }, + repeatedCommands = { + m: 'l', + M: 'L' + }; + + if (fabric.Path) { + fabric.warn('fabric.Path is already defined'); + return; + } + + /** + * Path class + * @class fabric.Path + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#path_and_pathgroup} + * @see {@link fabric.Path#initialize} for constructor definition + */ + fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path', + + /** + * Array of path points + * @type Array + * @default + */ + path: null, + + cacheProperties: fabric.Object.prototype.cacheProperties.concat('path', 'fillRule'), + + stateProperties: fabric.Object.prototype.stateProperties.concat('path'), + + /** + * Constructor + * @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens) + * @param {Object} [options] Options object + * @return {fabric.Path} thisArg + */ + initialize: function(path, options) { + options = options || { }; + this.callSuper('initialize', options); + + if (!path) { + path = []; + } + + var fromArray = _toString.call(path) === '[object Array]'; + + this.path = fromArray + ? path + // one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values) + : path.match && path.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi); + + if (!this.path) { + return; + } + + if (!fromArray) { + this.path = this._parsePath(); + } + + fabric.Polyline.prototype._setPositionDimensions.call(this, options); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _renderPathCommands: function(ctx) { + var current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + l = -this.pathOffset.x, + t = -this.pathOffset.y; + + ctx.beginPath(); + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'v': // vertical lineto, relative + y += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'V': // verical lineto, absolute + y = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + ctx.bezierCurveTo( + x + current[1] + l, // x1 + y + current[2] + t, // y1 + controlX + l, // x2 + controlY + t, // y2 + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + ctx.bezierCurveTo( + current[1] + l, + current[2] + t, + controlX + l, + controlY + t, + x + l, + y + t + ); + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + ctx.bezierCurveTo( + controlX + l, + controlY + t, + x + current[1] + l, + y + current[2] + t, + tempX + l, + tempY + t + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.bezierCurveTo( + controlX + l, + controlY + t, + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + controlX = x + current[1]; + controlY = y + current[2]; + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + + ctx.quadraticCurveTo( + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case 't': // shorthand quadraticCurveTo, relative + + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x + l, + current[7] + y + t + ]); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + l, + current[7] + t + ]); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + ctx.closePath(); + break; + } + previous = current; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _render: function(ctx) { + this._renderPathCommands(ctx); + this._renderPaintInOrder(ctx); + }, + + /** + * Returns string representation of an instance + * @return {String} string representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + path: this.path.map(function(item) { return item.slice(); }), + }); + }, + + /** + * Returns dataless object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(['sourcePath'].concat(propertiesToInclude)); + if (o.sourcePath) { + delete o.path; + } + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var path = this.path.map(function(path) { + return path.join(' '); + }).join(' '); + return [ + '\n' + ]; + }, + + _getOffsetTransform: function() { + var digits = fabric.Object.NUM_FRACTION_DIGITS; + return ' translate(' + toFixed(-this.pathOffset.x, digits) + ', ' + + toFixed(-this.pathOffset.y, digits) + ')'; + }, + + /** + * Returns svg clipPath representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toClipPathSVG: function(reviver) { + var additionalTransform = this._getOffsetTransform(); + return '\t' + this._createBaseClipPathSVGMarkup( + this._toSVG(), { reviver: reviver, additionalTransform: additionalTransform } + ); + }, + + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var additionalTransform = this._getOffsetTransform(); + return this._createBaseSVGMarkup(this._toSVG(), { reviver: reviver, additionalTransform: additionalTransform }); + }, + /* _TO_SVG_END_ */ + + /** + * Returns number representation of an instance complexity + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.path.length; + }, + + /** + * @private + */ + _parsePath: function() { + var result = [], + coords = [], + currentPath, + parsed, + re = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/ig, + match, + coordsStr; + + for (var i = 0, coordsParsed, len = this.path.length; i < len; i++) { + currentPath = this.path[i]; + + coordsStr = currentPath.slice(1).trim(); + coords.length = 0; + + while ((match = re.exec(coordsStr))) { + coords.push(match[0]); + } + + coordsParsed = [currentPath.charAt(0)]; + + for (var j = 0, jlen = coords.length; j < jlen; j++) { + parsed = parseFloat(coords[j]); + if (!isNaN(parsed)) { + coordsParsed.push(parsed); + } + } + + var command = coordsParsed[0], + commandLength = commandLengths[command.toLowerCase()], + repeatedCommand = repeatedCommands[command] || command; + + if (coordsParsed.length - 1 > commandLength) { + for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) { + result.push([command].concat(coordsParsed.slice(k, k + commandLength))); + command = repeatedCommand; + } + } + else { + result.push(coordsParsed); + } + } + + return result; + }, + + /** + * @private + */ + _calcDimensions: function() { + + var aX = [], + aY = [], + current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + bounds; + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + bounds = []; + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + bounds = []; + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + bounds = []; + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + bounds = []; + break; + + case 'v': // vertical lineto, relative + y += current[1]; + bounds = []; + break; + + case 'V': // verical lineto, absolute + y = current[1]; + bounds = []; + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = []; + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, + x + current[1], // x1 + y + current[2], // y1 + controlX, // x2 + controlY, // y2 + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + controlX = current[3]; + controlY = current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, + current[1], + current[2], + controlX, + controlY, + current[5], + current[6] + ); + x = current[5]; + y = current[6]; + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + x + current[1], + y + current[2], + tempX, + tempY + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + current[1], + current[2], + tempX, + tempY + ); + x = tempX; + y = tempY; + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + controlX = x + current[1]; + controlY = y + current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + controlX = current[1]; + controlY = current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + current[3], + current[4] + ); + x = current[3]; + y = current[4]; + break; + + case 't': // shorthand quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + bounds = fabric.util.getBoundsOfArc(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x, + current[7] + y + ); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + bounds = fabric.util.getBoundsOfArc(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6], + current[7] + ); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + break; + } + previous = current; + bounds.forEach(function (point) { + aX.push(point.x); + aY.push(point.y); + }); + aX.push(x); + aY.push(y); + } + + var minX = min(aX) || 0, + minY = min(aY) || 0, + maxX = max(aX) || 0, + maxY = max(aY) || 0, + deltaX = maxX - minX, + deltaY = maxY - minY; + + return { + left: minX, + top: minY, + width: deltaX, + height: deltaY + }; + } + }); + + /** + * Creates an instance of fabric.Path from an object + * @static + * @memberOf fabric.Path + * @param {Object} object + * @param {Function} [callback] Callback to invoke when an fabric.Path instance is created + */ + fabric.Path.fromObject = function(object, callback) { + if (typeof object.sourcePath === 'string') { + var pathUrl = object.sourcePath; + fabric.loadSVGFromURL(pathUrl, function (elements) { + var path = elements[0]; + path.setOptions(object); + callback && callback(path); + }); + } + else { + fabric.Object._fromObject('Path', object, callback, 'path'); + } + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`) + * @static + * @memberOf fabric.Path + * @see http://www.w3.org/TR/SVG/paths.html#PathElement + */ + fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']); + + /** + * Creates an instance of fabric.Path from an SVG element + * @static + * @memberOf fabric.Path + * @param {SVGElement} element to parse + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + * @param {Object} [options] Options object + * @param {Function} [callback] Options callback invoked after parsing is finished + */ + fabric.Path.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES); + parsedAttributes.fromSVG = true; + callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max; + + if (fabric.Group) { + return; + } + + /** + * Group class + * @class fabric.Group + * @extends fabric.Object + * @mixes fabric.Collection + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups} + * @see {@link fabric.Group#initialize} for constructor definition + */ + fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'group', + + /** + * Width of stroke + * @type Number + * @default + */ + strokeWidth: 0, + + /** + * Indicates if click events should also check for subtargets + * @type Boolean + * @default + */ + subTargetCheck: false, + + /** + * Groups are container, do not render anything on theyr own, ence no cache properties + * @type Array + * @default + */ + cacheProperties: [], + + /** + * setOnGroup is a method used for TextBox that is no more used since 2.0.0 The behavior is still + * available setting this boolean to true. + * @type Boolean + * @since 2.0.0 + * @default + */ + useSetOnGroup: false, + + /** + * Constructor + * @param {Object} objects Group objects + * @param {Object} [options] Options object + * @param {Boolean} [isAlreadyGrouped] if true, objects have been grouped already. + * @return {Object} thisArg + */ + initialize: function(objects, options, isAlreadyGrouped) { + options = options || {}; + this._objects = []; + // if objects enclosed in a group have been grouped already, + // we cannot change properties of objects. + // Thus we need to set options to group without objects, + isAlreadyGrouped && this.callSuper('initialize', options); + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + + if (!isAlreadyGrouped) { + var center = options && options.centerPoint; + // we want to set origins before calculating the bounding box. + // so that the topleft can be set with that in mind. + // if specific top and left are passed, are overwritten later + // with the callSuper('initialize', options) + if (options.originX !== undefined) { + this.originX = options.originX; + } + if (options.originY !== undefined) { + this.originY = options.originY; + } + // if coming from svg i do not want to calc bounds. + // i assume width and height are passed along options + center || this._calcBounds(); + this._updateObjectsCoords(center); + delete options.centerPoint; + this.callSuper('initialize', options); + } + else { + this._updateObjectsACoords(); + } + + this.setCoords(); + }, + + /** + * @private + * @param {Boolean} [skipCoordsChange] if true, coordinates of objects enclosed in a group do not change + */ + _updateObjectsACoords: function() { + var ignoreZoom = true, skipAbsolute = true; + for (var i = this._objects.length; i--; ){ + this._objects[i].setCoords(ignoreZoom, skipAbsolute); + } + }, + + /** + * @private + * @param {Boolean} [skipCoordsChange] if true, coordinates of objects enclosed in a group do not change + */ + _updateObjectsCoords: function(center) { + var center = center || this.getCenterPoint(); + for (var i = this._objects.length; i--; ){ + this._updateObjectCoords(this._objects[i], center); + } + }, + + /** + * @private + * @param {Object} object + * @param {fabric.Point} center, current center of group. + */ + _updateObjectCoords: function(object, center) { + var objectLeft = object.left, + objectTop = object.top, + ignoreZoom = true, skipAbsolute = true; + + object.set({ + left: objectLeft - center.x, + top: objectTop - center.y + }); + object.group = this; + object.setCoords(ignoreZoom, skipAbsolute); + }, + + /** + * Returns string represenation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Adds an object to a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + addWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + if (object) { + this._objects.push(object); + object.group = this; + object._set('canvas', this.canvas); + } + this._calcBounds(); + this._updateObjectsCoords(); + this.setCoords(); + this.dirty = true; + return this; + }, + + /** + * Removes an object from a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + removeWithUpdate: function(object) { + this._restoreObjectsState(); + fabric.util.resetObjectTransform(this); + + this.remove(object); + this._calcBounds(); + this._updateObjectsCoords(); + this.setCoords(); + this.dirty = true; + return this; + }, + + /** + * @private + */ + _onObjectAdded: function(object) { + this.dirty = true; + object.group = this; + object._set('canvas', this.canvas); + }, + + /** + * @private + */ + _onObjectRemoved: function(object) { + this.dirty = true; + delete object.group; + }, + + /** + * @private + */ + _set: function(key, value) { + var i = this._objects.length; + if (this.useSetOnGroup) { + while (i--) { + this._objects[i].setOnGroup(key, value); + } + } + if (key === 'canvas') { + while (i--) { + this._objects[i]._set(key, value); + } + } + fabric.Object.prototype._set.call(this, key, value); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var _includeDefaultValues = this.includeDefaultValues; + var objsToObject = this._objects.map(function(obj) { + var originalDefaults = obj.includeDefaultValues; + obj.includeDefaultValues = _includeDefaultValues; + var _obj = obj.toObject(propertiesToInclude); + obj.includeDefaultValues = originalDefaults; + return _obj; + }); + var obj = fabric.Object.prototype.toObject.call(this, propertiesToInclude); + obj.objects = objsToObject; + return obj; + }, + + /** + * Returns object representation of an instance, in dataless mode. + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var objsToObject, sourcePath = this.sourcePath; + if (sourcePath) { + objsToObject = sourcePath; + } + else { + var _includeDefaultValues = this.includeDefaultValues; + objsToObject = this._objects.map(function(obj) { + var originalDefaults = obj.includeDefaultValues; + obj.includeDefaultValues = _includeDefaultValues; + var _obj = obj.toDatalessObject(propertiesToInclude); + obj.includeDefaultValues = originalDefaults; + return _obj; + }); + } + var obj = fabric.Object.prototype.toDatalessObject.call(this, propertiesToInclude); + obj.objects = objsToObject; + return obj; + }, + + /** + * Renders instance on a given context + * @param {CanvasRenderingContext2D} ctx context to render instance on + */ + render: function(ctx) { + this._transformDone = true; + this.callSuper('render', ctx); + this._transformDone = false; + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group is already cached. + * @return {Boolean} + */ + shouldCache: function() { + var ownCache = fabric.Object.prototype.shouldCache.call(this); + if (ownCache) { + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i].willDrawShadow()) { + this.ownCaching = false; + return false; + } + } + } + return ownCache; + }, + + /** + * Check if this object or a child object will cast a shadow + * @return {Boolean} + */ + willDrawShadow: function() { + if (this.shadow) { + return fabric.Object.prototype.willDrawShadow.call(this); + } + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i].willDrawShadow()) { + return true; + } + } + return false; + }, + + /** + * Check if this group or its parent group are caching, recursively up + * @return {Boolean} + */ + isOnACache: function() { + return this.ownCaching || (this.group && this.group.isOnACache()); + }, + + /** + * Execute the drawing operation for an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + drawObject: function(ctx) { + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].render(ctx); + } + this._drawClipPath(ctx); + }, + + /** + * Check if cache is dirty + */ + isCacheDirty: function(skipCanvas) { + if (this.callSuper('isCacheDirty', skipCanvas)) { + return true; + } + if (!this.statefullCache) { + return false; + } + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i].isCacheDirty(true)) { + if (this._cacheCanvas) { + // if this group has not a cache canvas there is nothing to clean + var x = this.cacheWidth / this.zoomX, y = this.cacheHeight / this.zoomY; + this._cacheContext.clearRect(-x / 2, -y / 2, x, y); + } + return true; + } + } + return false; + }, + + /** + * Retores original state of each of group objects (original state is that which was before group was created). + * @private + * @return {fabric.Group} thisArg + * @chainable + */ + _restoreObjectsState: function() { + this._objects.forEach(this._restoreObjectState, this); + return this; + }, + + /** + * Realises the transform from this group onto the supplied object + * i.e. it tells you what would happen if the supplied object was in + * the group, and then the group was destroyed. It mutates the supplied + * object. + * @param {fabric.Object} object + * @return {fabric.Object} transformedObject + */ + realizeTransform: function(object) { + var matrix = object.calcTransformMatrix(), + options = fabric.util.qrDecompose(matrix), + center = new fabric.Point(options.translateX, options.translateY); + object.flipX = false; + object.flipY = false; + object.set('scaleX', options.scaleX); + object.set('scaleY', options.scaleY); + object.skewX = options.skewX; + object.skewY = options.skewY; + object.angle = options.angle; + object.setPositionByOrigin(center, 'center', 'center'); + return object; + }, + + /** + * Restores original state of a specified object in group + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _restoreObjectState: function(object) { + this.realizeTransform(object); + object.setCoords(); + delete object.group; + return this; + }, + + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + destroy: function() { + // when group is destroyed objects needs to get a repaint to be eventually + // displayed on canvas. + this._objects.forEach(function(object) { + object.set('dirty', true); + }); + return this._restoreObjectsState(); + }, + + /** + * make a group an active selection, remove the group from canvas + * the group has to be on canvas for this to work. + * @return {fabric.ActiveSelection} thisArg + * @chainable + */ + toActiveSelection: function() { + if (!this.canvas) { + return; + } + var objects = this._objects, canvas = this.canvas; + this._objects = []; + var options = this.toObject(); + delete options.objects; + var activeSelection = new fabric.ActiveSelection([]); + activeSelection.set(options); + activeSelection.type = 'activeSelection'; + canvas.remove(this); + objects.forEach(function(object) { + object.group = activeSelection; + object.dirty = true; + canvas.add(object); + }); + activeSelection.canvas = canvas; + activeSelection._objects = objects; + canvas._activeObject = activeSelection; + activeSelection.setCoords(); + return activeSelection; + }, + + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + ungroupOnCanvas: function() { + return this._restoreObjectsState(); + }, + + /** + * Sets coordinates of all objects inside group + * @return {fabric.Group} thisArg + * @chainable + */ + setObjectsCoords: function() { + var ignoreZoom = true, skipAbsolute = true; + this.forEachObject(function(object) { + object.setCoords(ignoreZoom, skipAbsolute); + }); + return this; + }, + + /** + * @private + */ + _calcBounds: function(onlyWidthHeight) { + var aX = [], + aY = [], + o, prop, + props = ['tr', 'br', 'bl', 'tl'], + i = 0, iLen = this._objects.length, + j, jLen = props.length, + ignoreZoom = true; + + for ( ; i < iLen; ++i) { + o = this._objects[i]; + o.setCoords(ignoreZoom); + for (j = 0; j < jLen; j++) { + prop = props[j]; + aX.push(o.oCoords[prop].x); + aY.push(o.oCoords[prop].y); + } + } + + this._getBounds(aX, aY, onlyWidthHeight); + }, + + /** + * @private + */ + _getBounds: function(aX, aY, onlyWidthHeight) { + var minXY = new fabric.Point(min(aX), min(aY)), + maxXY = new fabric.Point(max(aX), max(aY)), + top = minXY.y || 0, left = minXY.x || 0, + width = (maxXY.x - minXY.x) || 0, + height = (maxXY.y - minXY.y) || 0; + this.width = width; + this.height = height; + if (!onlyWidthHeight) { + // the bounding box always finds the topleft most corner. + // whatever is the group origin, we set up here the left/top position. + this.setPositionByOrigin({ x: left, y: top }, 'left', 'top'); + } + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + _toSVG: function(reviver) { + var svgString = ['\n']; + + for (var i = 0, len = this._objects.length; i < len; i++) { + svgString.push('\t\t', this._objects[i].toSVG(reviver)); + } + svgString.push('\n'); + return svgString; + }, + + /** + * Returns styles-string for svg-export, specific version for group + * @return {String} + */ + getSvgStyles: function() { + var opacity = typeof this.opacity !== 'undefined' && this.opacity !== 1 ? + 'opacity: ' + this.opacity + ';' : '', + visibility = this.visible ? '' : ' visibility: hidden;'; + return [ + opacity, + this.getSvgFilter(), + visibility + ].join(''); + }, + + /** + * Returns svg clipPath representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toClipPathSVG: function(reviver) { + var svgString = []; + + for (var i = 0, len = this._objects.length; i < len; i++) { + svgString.push('\t', this._objects[i].toClipPathSVG(reviver)); + } + + return this._createBaseClipPathSVGMarkup(svgString, { reviver: reviver }); + }, + /* _TO_SVG_END_ */ + }); + + /** + * Returns {@link fabric.Group} instance from an object representation + * @static + * @memberOf fabric.Group + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an group instance is created + */ + fabric.Group.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + fabric.util.enlivenObjects([object.clipPath], function(enlivedClipPath) { + var options = fabric.util.object.clone(object, true); + options.clipPath = enlivedClipPath[0]; + delete options.objects; + callback && callback(new fabric.Group(enlivenedObjects, options, true)); + }); + }); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.ActiveSelection) { + return; + } + + /** + * Group class + * @class fabric.ActiveSelection + * @extends fabric.Group + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3#groups} + * @see {@link fabric.ActiveSelection#initialize} for constructor definition + */ + fabric.ActiveSelection = fabric.util.createClass(fabric.Group, /** @lends fabric.ActiveSelection.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'activeSelection', + + /** + * Constructor + * @param {Object} objects ActiveSelection objects + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(objects, options) { + options = options || {}; + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + + if (options.originX) { + this.originX = options.originX; + } + if (options.originY) { + this.originY = options.originY; + } + this._calcBounds(); + this._updateObjectsCoords(); + fabric.Object.prototype.initialize.call(this, options); + this.setCoords(); + }, + + /** + * Change te activeSelection to a normal group, + * High level function that automatically adds it to canvas as + * active object. no events fired. + * @since 2.0.0 + * @return {fabric.Group} + */ + toGroup: function() { + var objects = this._objects.concat(); + this._objects = []; + var options = fabric.Object.prototype.toObject.call(this); + var newGroup = new fabric.Group([]); + delete options.type; + newGroup.set(options); + objects.forEach(function(object) { + object.canvas.remove(object); + object.group = newGroup; + }); + newGroup._objects = objects; + if (!this.canvas) { + return newGroup; + } + var canvas = this.canvas; + canvas.add(newGroup); + canvas._activeObject = newGroup; + newGroup.setCoords(); + return newGroup; + }, + + /** + * If returns true, deselection is cancelled. + * @since 2.0.0 + * @return {Boolean} [cancel] + */ + onDeselect: function() { + this.destroy(); + return false; + }, + + /** + * Returns string representation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * objectCaching is a global flag, wins over everything + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group outside is cached. + * @return {Boolean} + */ + shouldCache: function() { + return false; + }, + + /** + * Check if this group or its parent group are caching, recursively up + * @return {Boolean} + */ + isOnACache: function() { + return false; + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} [styleOverride] properties to override the object style + * @param {Object} [childrenOverride] properties to override the children overrides + */ + _renderControls: function(ctx, styleOverride, childrenOverride) { + ctx.save(); + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + this.callSuper('_renderControls', ctx, styleOverride); + childrenOverride = childrenOverride || { }; + if (typeof childrenOverride.hasControls === 'undefined') { + childrenOverride.hasControls = false; + } + if (typeof childrenOverride.hasRotatingPoint === 'undefined') { + childrenOverride.hasRotatingPoint = false; + } + childrenOverride.forActiveSelection = true; + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i]._renderControls(ctx, childrenOverride); + } + ctx.restore(); + }, + }); + + /** + * Returns {@link fabric.ActiveSelection} instance from an object representation + * @static + * @memberOf fabric.ActiveSelection + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an ActiveSelection instance is created + */ + fabric.ActiveSelection.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + delete object.objects; + callback && callback(new fabric.ActiveSelection(enlivenedObjects, object, true)); + }); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var extend = fabric.util.object.extend; + + if (!global.fabric) { + global.fabric = { }; + } + + if (global.fabric.Image) { + fabric.warn('fabric.Image is already defined.'); + return; + } + + /** + * Image class + * @class fabric.Image + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1#images} + * @see {@link fabric.Image#initialize} for constructor definition + */ + fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'image', + + /** + * crossOrigin value (one of "", "anonymous", "use-credentials") + * @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes + * @type String + * @default + */ + crossOrigin: '', + + /** + * Width of a stroke. + * For image quality a stroke multiple of 2 gives better results. + * @type Number + * @default + */ + strokeWidth: 0, + + /** + * When calling {@link fabric.Image.getSrc}, return value from element src with `element.getAttribute('src')`. + * This allows for relative urls as image src. + * @since 2.7.0 + * @type Boolean + * @default + */ + srcFromAttribute: false, + + /** + * private + * contains last value of scaleX to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleX: 1, + + /** + * private + * contains last value of scaleY to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleY: 1, + + /** + * private + * contains last value of scaling applied by the apply filter chain + * @type Number + */ + _filterScalingX: 1, + + /** + * private + * contains last value of scaling applied by the apply filter chain + * @type Number + */ + _filterScalingY: 1, + + /** + * minimum scale factor under which any resizeFilter is triggered to resize the image + * 0 will disable the automatic resize. 1 will trigger automatically always. + * number bigger than 1 are not implemented yet. + * @type Number + */ + minimumScaleTrigger: 0.5, + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: fabric.Object.prototype.stateProperties.concat('cropX', 'cropY'), + + /** + * key used to retrieve the texture representing this image + * @since 2.0.0 + * @type String + * @default + */ + cacheKey: '', + + /** + * Image crop in pixels from original image size. + * @since 2.0.0 + * @type Number + * @default + */ + cropX: 0, + + /** + * Image crop in pixels from original image size. + * @since 2.0.0 + * @type Number + * @default + */ + cropY: 0, + + /** + * Constructor + * @param {HTMLImageElement | String} element Image element + * @param {Object} [options] Options object + * @param {function} [callback] callback function to call after eventual filters applied. + * @return {fabric.Image} thisArg + */ + initialize: function(element, options) { + options || (options = { }); + this.filters = []; + this.cacheKey = 'texture' + fabric.Object.__uid++; + this.callSuper('initialize', options); + this._initElement(element, options); + }, + + /** + * Returns image element which this instance if based on + * @return {HTMLImageElement} Image element + */ + getElement: function() { + return this._element || {}; + }, + + /** + * Sets image element for this instance to a specified one. + * If filters defined they are applied to new image. + * You might need to call `canvas.renderAll` and `object.setCoords` after replacing, to render new image and update controls area. + * @param {HTMLImageElement} element + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setElement: function(element, options) { + this.removeTexture(this.cacheKey); + this.removeTexture(this.cacheKey + '_filtered'); + this._element = element; + this._originalElement = element; + this._initConfig(options); + if (this.filters.length !== 0) { + this.applyFilters(); + } + // resizeFilters work on the already filtered copy. + // we need to apply resizeFilters AFTER normal filters. + // applyResizeFilters is run more often than normal fiters + // and is triggered by user interactions rather than dev code + if (this.resizeFilter) { + this.applyResizeFilters(); + } + return this; + }, + + /** + * Delete a single texture if in webgl mode + */ + removeTexture: function(key) { + var backend = fabric.filterBackend; + if (backend && backend.evictCachesForKey) { + backend.evictCachesForKey(key); + } + }, + + /** + * Delete textures, reference to elements and eventually JSDOM cleanup + */ + dispose: function() { + this.removeTexture(this.cacheKey); + this.removeTexture(this.cacheKey + '_filtered'); + this._cacheContext = undefined; + ['_originalElement', '_element', '_filteredEl', '_cacheCanvas'].forEach((function(element) { + fabric.util.cleanUpJsdomNode(this[element]); + this[element] = undefined; + }).bind(this)); + }, + + /** + * Sets crossOrigin value (on an instance and corresponding image element) + * @return {fabric.Image} thisArg + * @chainable + */ + setCrossOrigin: function(value) { + this.crossOrigin = value; + this._element.crossOrigin = value; + + return this; + }, + + /** + * Returns original size of an image + * @return {Object} Object with "width" and "height" properties + */ + getOriginalSize: function() { + var element = this.getElement(); + return { + width: element.naturalWidth || element.width, + height: element.naturalHeight || element.height + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _stroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + var w = this.width / 2, h = this.height / 2; + ctx.beginPath(); + ctx.moveTo(-w, -h); + ctx.lineTo(w, -h); + ctx.lineTo(w, h); + ctx.lineTo(-w, h); + ctx.lineTo(-w, -h); + ctx.closePath(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.save(); + this._setStrokeStyles(ctx, this); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + ctx.restore(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var filters = []; + + this.filters.forEach(function(filterObj) { + if (filterObj) { + filters.push(filterObj.toObject()); + } + }); + var object = extend( + this.callSuper( + 'toObject', + ['crossOrigin', 'cropX', 'cropY'].concat(propertiesToInclude) + ), { + src: this.getSrc(), + filters: filters, + }); + if (this.resizeFilter) { + object.resizeFilter = this.resizeFilter.toObject(); + } + return object; + }, + + /** + * Returns true if an image has crop applied, inspecting values of cropX,cropY,width,hight. + * @return {Boolean} + */ + hasCrop: function() { + return this.cropX || this.cropY || this.width < this._element.width || this.height < this._element.height; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @return {Array} an array of strings with the specific svg representation + * of the instance + */ + _toSVG: function() { + var svgString = [], imageMarkup = [], strokeSvg, + x = -this.width / 2, y = -this.height / 2, clipPath = ''; + if (this.hasCrop()) { + var clipPathId = fabric.Object.__uid++; + svgString.push( + '\n', + '\t\n', + '\n' + ); + clipPath = ' clip-path="url(#imageCrop_' + clipPathId + ')" '; + } + imageMarkup.push('\t\n'); + + if (this.stroke || this.strokeDashArray) { + var origFill = this.fill; + this.fill = null; + strokeSvg = [ + '\t\n' + ]; + this.fill = origFill; + } + if (this.paintFirst !== 'fill') { + svgString = svgString.concat(strokeSvg, imageMarkup); + } + else { + svgString = svgString.concat(imageMarkup, strokeSvg); + } + return svgString; + }, + /* _TO_SVG_END_ */ + + /** + * Returns source of an image + * @param {Boolean} filtered indicates if the src is needed for svg + * @return {String} Source of an image + */ + getSrc: function(filtered) { + var element = filtered ? this._element : this._originalElement; + if (element) { + if (element.toDataURL) { + return element.toDataURL(); + } + + if (this.srcFromAttribute) { + return element.getAttribute('src'); + } + else { + return element.src; + } + } + else { + return this.src || ''; + } + }, + + /** + * Sets source of an image + * @param {String} src Source string (URL) + * @param {Function} [callback] Callback is invoked when image has been loaded (and all filters have been applied) + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setSrc: function(src, callback, options) { + fabric.util.loadImage(src, function(img) { + this.setElement(img, options); + this._setWidthHeight(); + callback && callback(this); + }, this, options && options.crossOrigin); + return this; + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of an instance + */ + toString: function() { + return '#'; + }, + + applyResizeFilters: function() { + var filter = this.resizeFilter, + minimumScale = this.minimumScaleTrigger, + objectScale = this.getTotalObjectScaling(), + scaleX = objectScale.scaleX, + scaleY = objectScale.scaleY, + elementToFilter = this._filteredEl || this._originalElement; + if (this.group) { + this.set('dirty', true); + } + if (!filter || (scaleX > minimumScale && scaleY > minimumScale)) { + this._element = elementToFilter; + this._filterScalingX = 1; + this._filterScalingY = 1; + this._lastScaleX = scaleX; + this._lastScaleY = scaleY; + return; + } + if (!fabric.filterBackend) { + fabric.filterBackend = fabric.initFilterBackend(); + } + var canvasEl = fabric.util.createCanvasElement(), + cacheKey = this._filteredEl ? (this.cacheKey + '_filtered') : this.cacheKey, + sourceWidth = elementToFilter.width, sourceHeight = elementToFilter.height; + canvasEl.width = sourceWidth; + canvasEl.height = sourceHeight; + this._element = canvasEl; + this._lastScaleX = filter.scaleX = scaleX; + this._lastScaleY = filter.scaleY = scaleY; + fabric.filterBackend.applyFilters( + [filter], elementToFilter, sourceWidth, sourceHeight, this._element, cacheKey); + this._filterScalingX = canvasEl.width / this._originalElement.width; + this._filterScalingY = canvasEl.height / this._originalElement.height; + }, + + /** + * Applies filters assigned to this image (from "filters" array) or from filter param + * @method applyFilters + * @param {Array} filters to be applied + * @param {Boolean} forResizing specify if the filter operation is a resize operation + * @return {thisArg} return the fabric.Image object + * @chainable + */ + applyFilters: function(filters) { + + filters = filters || this.filters || []; + filters = filters.filter(function(filter) { return filter && !filter.isNeutralState(); }); + this.set('dirty', true); + + // needs to clear out or WEBGL will not resize correctly + this.removeTexture(this.cacheKey + '_filtered'); + + if (filters.length === 0) { + this._element = this._originalElement; + this._filteredEl = null; + this._filterScalingX = 1; + this._filterScalingY = 1; + return this; + } + + var imgElement = this._originalElement, + sourceWidth = imgElement.naturalWidth || imgElement.width, + sourceHeight = imgElement.naturalHeight || imgElement.height; + + if (this._element === this._originalElement) { + // if the element is the same we need to create a new element + var canvasEl = fabric.util.createCanvasElement(); + canvasEl.width = sourceWidth; + canvasEl.height = sourceHeight; + this._element = canvasEl; + this._filteredEl = canvasEl; + } + else { + // clear the existing element to get new filter data + // also dereference the eventual resized _element + this._element = this._filteredEl; + this._filteredEl.getContext('2d').clearRect(0, 0, sourceWidth, sourceHeight); + // we also need to resize again at next renderAll, so remove saved _lastScaleX/Y + this._lastScaleX = 1; + this._lastScaleY = 1; + } + if (!fabric.filterBackend) { + fabric.filterBackend = fabric.initFilterBackend(); + } + fabric.filterBackend.applyFilters( + filters, this._originalElement, sourceWidth, sourceHeight, this._element, this.cacheKey); + if (this._originalElement.width !== this._element.width || + this._originalElement.height !== this._element.height) { + this._filterScalingX = this._element.width / this._originalElement.width; + this._filterScalingY = this._element.height / this._originalElement.height; + } + return this; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (this.isMoving !== true && this.resizeFilter && this._needsResize()) { + this.applyResizeFilters(); + } + this._stroke(ctx); + this._renderPaintInOrder(ctx); + }, + + /** + * Decide if the object should cache or not. Create its own cache level + * needsItsOwnCache should be used when the object drawing method requires + * a cache step. None of the fabric classes requires it. + * Generally you do not cache objects in groups because the group outside is cached. + * This is the special image version where we would like to avoid caching where possible. + * Essentially images do not benefit from caching. They may require caching, and in that + * case we do it. Also caching an image usually ends in a loss of details. + * A full performance audit should be done. + * @return {Boolean} + */ + shouldCache: function() { + return this.needsItsOwnCache(); + }, + + _renderFill: function(ctx) { + var elementToDraw = this._element, + w = this.width, h = this.height, + sW = Math.min(elementToDraw.naturalWidth || elementToDraw.width, w * this._filterScalingX), + sH = Math.min(elementToDraw.naturalHeight || elementToDraw.height, h * this._filterScalingY), + x = -w / 2, y = -h / 2, + sX = Math.max(0, this.cropX * this._filterScalingX), + sY = Math.max(0, this.cropY * this._filterScalingY); + + elementToDraw && ctx.drawImage(elementToDraw, sX, sY, sW, sH, x, y, w, h); + }, + + /** + * @private, needed to check if image needs resize + */ + _needsResize: function() { + var scale = this.getTotalObjectScaling(); + return (scale.scaleX !== this._lastScaleX || scale.scaleY !== this._lastScaleY); + }, + + /** + * @private + */ + _resetWidthHeight: function() { + this.set(this.getOriginalSize()); + }, + + /** + * The Image class's initialization method. This method is automatically + * called by the constructor. + * @private + * @param {HTMLImageElement|String} element The element representing the image + * @param {Object} [options] Options object + */ + _initElement: function(element, options) { + this.setElement(fabric.util.getById(element), options); + fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS); + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initConfig: function(options) { + options || (options = { }); + this.setOptions(options); + this._setWidthHeight(options); + if (this._element && this.crossOrigin) { + this._element.crossOrigin = this.crossOrigin; + } + }, + + /** + * @private + * @param {Array} filters to be initialized + * @param {Function} callback Callback to invoke when all fabric.Image.filters instances are created + */ + _initFilters: function(filters, callback) { + if (filters && filters.length) { + fabric.util.enlivenObjects(filters, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, 'fabric.Image.filters'); + } + else { + callback && callback(); + } + }, + + /** + * @private + * Set the width and the height of the image object, using the element or the + * options. + * @param {Object} [options] Object with width/height properties + */ + _setWidthHeight: function(options) { + options || (options = { }); + var el = this.getElement(); + this.width = options.width || el.naturalWidth || el.width || 0; + this.height = options.height || el.naturalHeight || el.height || 0; + }, + + /** + * Calculate offset for center and scale factor for the image in order to respect + * the preserveAspectRatio attribute + * @private + * @return {Object} + */ + parsePreserveAspectRatioAttribute: function() { + var pAR = fabric.util.parsePreserveAspectRatioAttribute(this.preserveAspectRatio || ''), + rWidth = this._element.width, rHeight = this._element.height, + scaleX = 1, scaleY = 1, offsetLeft = 0, offsetTop = 0, cropX = 0, cropY = 0, + offset, pWidth = this.width, pHeight = this.height, parsedAttributes = { width: pWidth, height: pHeight }; + if (pAR && (pAR.alignX !== 'none' || pAR.alignY !== 'none')) { + if (pAR.meetOrSlice === 'meet') { + scaleX = scaleY = fabric.util.findScaleToFit(this._element, parsedAttributes); + offset = (pWidth - rWidth * scaleX) / 2; + if (pAR.alignX === 'Min') { + offsetLeft = -offset; + } + if (pAR.alignX === 'Max') { + offsetLeft = offset; + } + offset = (pHeight - rHeight * scaleY) / 2; + if (pAR.alignY === 'Min') { + offsetTop = -offset; + } + if (pAR.alignY === 'Max') { + offsetTop = offset; + } + } + if (pAR.meetOrSlice === 'slice') { + scaleX = scaleY = fabric.util.findScaleToCover(this._element, parsedAttributes); + offset = rWidth - pWidth / scaleX; + if (pAR.alignX === 'Mid') { + cropX = offset / 2; + } + if (pAR.alignX === 'Max') { + cropX = offset; + } + offset = rHeight - pHeight / scaleY; + if (pAR.alignY === 'Mid') { + cropY = offset / 2; + } + if (pAR.alignY === 'Max') { + cropY = offset; + } + rWidth = pWidth / scaleX; + rHeight = pHeight / scaleY; + } + } + else { + scaleX = pWidth / rWidth; + scaleY = pHeight / rHeight; + } + return { + width: rWidth, + height: rHeight, + scaleX: scaleX, + scaleY: scaleY, + offsetLeft: offsetLeft, + offsetTop: offsetTop, + cropX: cropX, + cropY: cropY + }; + } + }); + + /** + * Default CSS class name for canvas + * @static + * @type String + * @default + */ + fabric.Image.CSS_CANVAS = 'canvas-img'; + + /** + * Alias for getSrc + * @static + */ + fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc; + + /** + * Creates an instance of fabric.Image from its object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} callback Callback to invoke when an image instance is created + */ + fabric.Image.fromObject = function(_object, callback) { + var object = fabric.util.object.clone(_object); + fabric.util.loadImage(object.src, function(img, error) { + if (error) { + callback && callback(null, error); + return; + } + fabric.Image.prototype._initFilters.call(object, object.filters, function(filters) { + object.filters = filters || []; + fabric.Image.prototype._initFilters.call(object, [object.resizeFilter], function(resizeFilters) { + object.resizeFilter = resizeFilters[0]; + fabric.util.enlivenObjects([object.clipPath], function(enlivedProps) { + object.clipPath = enlivedProps[0]; + var image = new fabric.Image(img, object); + callback(image); + }); + }); + }); + }, null, object.crossOrigin); + }; + + /** + * Creates an instance of fabric.Image from an URL string + * @static + * @param {String} url URL to create an image from + * @param {Function} [callback] Callback to invoke when image is created (newly created image is passed as a first argument) + * @param {Object} [imgOptions] Options object + */ + fabric.Image.fromURL = function(url, callback, imgOptions) { + fabric.util.loadImage(url, function(img) { + callback && callback(new fabric.Image(img, imgOptions)); + }, null, imgOptions && imgOptions.crossOrigin); + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Image.fromElement}) + * @static + * @see {@link http://www.w3.org/TR/SVG/struct.html#ImageElement} + */ + fabric.Image.ATTRIBUTE_NAMES = + fabric.SHARED_ATTRIBUTES.concat('x y width height preserveAspectRatio xlink:href crossOrigin'.split(' ')); + + /** + * Returns {@link fabric.Image} instance from an SVG element + * @static + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @param {Function} callback Callback to execute when fabric.Image object is created + * @return {fabric.Image} Instance of fabric.Image + */ + fabric.Image.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES); + fabric.Image.fromURL(parsedAttributes['xlink:href'], callback, + extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + +})(typeof exports !== 'undefined' ? exports : this); +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * @private + * @return {Number} angle value + */ + _getAngleValueForStraighten: function() { + var angle = this.angle % 360; + if (angle > 0) { + return Math.round((angle - 1) / 90) * 90; + } + return Math.round(angle / 90) * 90; + }, + + /** + * Straightens an object (rotating it from current angle to one of 0, 90, 180, 270, etc. depending on which is closer) + * @return {fabric.Object} thisArg + * @chainable + */ + straighten: function() { + this.rotate(this._getAngleValueForStraighten()); + return this; + }, + + /** + * Same as {@link fabric.Object.prototype.straighten} but with animation + * @param {Object} callbacks Object with callback functions + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Object} thisArg + * @chainable + */ + fxStraighten: function(callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: this.get('angle'), + endValue: this._getAngleValueForStraighten(), + duration: this.FX_DURATION, + onChange: function(value) { + _this.rotate(value); + onChange(); + }, + onComplete: function() { + _this.setCoords(); + onComplete(); + }, + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Straightens object, then rerenders canvas + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + straightenObject: function (object) { + object.straighten(); + this.requestRenderAll(); + return this; + }, + + /** + * Same as {@link fabric.Canvas.prototype.straightenObject}, but animated + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxStraightenObject: function (object) { + object.fxStraighten({ + onChange: this.requestRenderAllBound + }); + return this; + } +}); +(function() { + + 'use strict'; + + /** + * Tests if webgl supports certain precision + * @param {WebGL} Canvas WebGL context to test on + * @param {String} Precision to test can be any of following: 'lowp', 'mediump', 'highp' + * @returns {Boolean} Whether the user's browser WebGL supports given precision. + */ + function testPrecision(gl, precision){ + var fragmentSource = 'precision ' + precision + ' float;\nvoid main(){}'; + var fragmentShader = gl.createShader(gl.FRAGMENT_SHADER); + gl.shaderSource(fragmentShader, fragmentSource); + gl.compileShader(fragmentShader); + if (!gl.getShaderParameter(fragmentShader, gl.COMPILE_STATUS)) { + return false; + } + return true; + } + + /** + * Indicate whether this filtering backend is supported by the user's browser. + * @param {Number} tileSize check if the tileSize is supported + * @returns {Boolean} Whether the user's browser supports WebGL. + */ + fabric.isWebglSupported = function(tileSize) { + if (fabric.isLikelyNode) { + return false; + } + tileSize = tileSize || fabric.WebglFilterBackend.prototype.tileSize; + var canvas = document.createElement('canvas'); + var gl = canvas.getContext('webgl') || canvas.getContext('experimental-webgl'); + var isSupported = false; + // eslint-disable-next-line + if (gl) { + fabric.maxTextureSize = gl.getParameter(gl.MAX_TEXTURE_SIZE); + isSupported = fabric.maxTextureSize >= tileSize; + var precisions = ['highp', 'mediump', 'lowp']; + for (var i = 0; i < 3; i++){ + if (testPrecision(gl, precisions[i])){ + fabric.webGlPrecision = precisions[i]; + break; + }; + } + } + this.isSupported = isSupported; + return isSupported; + }; + + fabric.WebglFilterBackend = WebglFilterBackend; + + /** + * WebGL filter backend. + */ + function WebglFilterBackend(options) { + if (options && options.tileSize) { + this.tileSize = options.tileSize; + } + this.setupGLContext(this.tileSize, this.tileSize); + this.captureGPUInfo(); + }; + + WebglFilterBackend.prototype = /** @lends fabric.WebglFilterBackend.prototype */ { + + tileSize: 2048, + + /** + * Experimental. This object is a sort of repository of help layers used to avoid + * of recreating them during frequent filtering. If you are previewing a filter with + * a slider you problably do not want to create help layers every filter step. + * in this object there will be appended some canvases, created once, resized sometimes + * cleared never. Clearing is left to the developer. + **/ + resources: { + + }, + + /** + * Setup a WebGL context suitable for filtering, and bind any needed event handlers. + */ + setupGLContext: function(width, height) { + this.dispose(); + this.createWebGLCanvas(width, height); + // eslint-disable-next-line + this.aPosition = new Float32Array([0, 0, 0, 1, 1, 0, 1, 1]); + this.chooseFastestCopyGLTo2DMethod(width, height); + }, + + /** + * Pick a method to copy data from GL context to 2d canvas. In some browsers using + * putImageData is faster than drawImage for that specific operation. + */ + chooseFastestCopyGLTo2DMethod: function(width, height) { + var canMeasurePerf = typeof window.performance !== 'undefined', canUseImageData; + try { + new ImageData(1, 1); + canUseImageData = true; + } + catch (e) { + canUseImageData = false; + } + // eslint-disable-next-line no-undef + var canUseArrayBuffer = typeof ArrayBuffer !== 'undefined'; + // eslint-disable-next-line no-undef + var canUseUint8Clamped = typeof Uint8ClampedArray !== 'undefined'; + + if (!(canMeasurePerf && canUseImageData && canUseArrayBuffer && canUseUint8Clamped)) { + return; + } + + var targetCanvas = fabric.util.createCanvasElement(); + // eslint-disable-next-line no-undef + var imageBuffer = new ArrayBuffer(width * height * 4); + if (fabric.forceGLPutImageData) { + this.imageBuffer = imageBuffer; + this.copyGLTo2D = copyGLTo2DPutImageData; + return; + } + var testContext = { + imageBuffer: imageBuffer, + destinationWidth: width, + destinationHeight: height, + targetCanvas: targetCanvas + }; + var startTime, drawImageTime, putImageDataTime; + targetCanvas.width = width; + targetCanvas.height = height; + + startTime = window.performance.now(); + copyGLTo2DDrawImage.call(testContext, this.gl, testContext); + drawImageTime = window.performance.now() - startTime; + + startTime = window.performance.now(); + copyGLTo2DPutImageData.call(testContext, this.gl, testContext); + putImageDataTime = window.performance.now() - startTime; + + if (drawImageTime > putImageDataTime) { + this.imageBuffer = imageBuffer; + this.copyGLTo2D = copyGLTo2DPutImageData; + } + else { + this.copyGLTo2D = copyGLTo2DDrawImage; + } + }, + + /** + * Create a canvas element and associated WebGL context and attaches them as + * class properties to the GLFilterBackend class. + */ + createWebGLCanvas: function(width, height) { + var canvas = fabric.util.createCanvasElement(); + canvas.width = width; + canvas.height = height; + var glOptions = { + alpha: true, + premultipliedAlpha: false, + depth: false, + stencil: false, + antialias: false + }, + gl = canvas.getContext('webgl', glOptions); + if (!gl) { + gl = canvas.getContext('experimental-webgl', glOptions); + } + if (!gl) { + return; + } + gl.clearColor(0, 0, 0, 0); + // this canvas can fire webglcontextlost and webglcontextrestored + this.canvas = canvas; + this.gl = gl; + }, + + /** + * Attempts to apply the requested filters to the source provided, drawing the filtered output + * to the provided target canvas. + * + * @param {Array} filters The filters to apply. + * @param {HTMLImageElement|HTMLCanvasElement} source The source to be filtered. + * @param {Number} width The width of the source input. + * @param {Number} height The height of the source input. + * @param {HTMLCanvasElement} targetCanvas The destination for filtered output to be drawn. + * @param {String|undefined} cacheKey A key used to cache resources related to the source. If + * omitted, caching will be skipped. + */ + applyFilters: function(filters, source, width, height, targetCanvas, cacheKey) { + var gl = this.gl; + var cachedTexture; + if (cacheKey) { + cachedTexture = this.getCachedTexture(cacheKey, source); + } + var pipelineState = { + originalWidth: source.width || source.originalWidth, + originalHeight: source.height || source.originalHeight, + sourceWidth: width, + sourceHeight: height, + destinationWidth: width, + destinationHeight: height, + context: gl, + sourceTexture: this.createTexture(gl, width, height, !cachedTexture && source), + targetTexture: this.createTexture(gl, width, height), + originalTexture: cachedTexture || + this.createTexture(gl, width, height, !cachedTexture && source), + passes: filters.length, + webgl: true, + aPosition: this.aPosition, + programCache: this.programCache, + pass: 0, + filterBackend: this, + targetCanvas: targetCanvas + }; + var tempFbo = gl.createFramebuffer(); + gl.bindFramebuffer(gl.FRAMEBUFFER, tempFbo); + filters.forEach(function(filter) { filter && filter.applyTo(pipelineState); }); + resizeCanvasIfNeeded(pipelineState); + this.copyGLTo2D(gl, pipelineState); + gl.bindTexture(gl.TEXTURE_2D, null); + gl.deleteTexture(pipelineState.sourceTexture); + gl.deleteTexture(pipelineState.targetTexture); + gl.deleteFramebuffer(tempFbo); + targetCanvas.getContext('2d').setTransform(1, 0, 0, 1, 0, 0); + return pipelineState; + }, + + /** + * Detach event listeners, remove references, and clean up caches. + */ + dispose: function() { + if (this.canvas) { + this.canvas = null; + this.gl = null; + } + this.clearWebGLCaches(); + }, + + /** + * Wipe out WebGL-related caches. + */ + clearWebGLCaches: function() { + this.programCache = {}; + this.textureCache = {}; + }, + + /** + * Create a WebGL texture object. + * + * Accepts specific dimensions to initialize the textuer to or a source image. + * + * @param {WebGLRenderingContext} gl The GL context to use for creating the texture. + * @param {Number} width The width to initialize the texture at. + * @param {Number} height The height to initialize the texture. + * @param {HTMLImageElement|HTMLCanvasElement} textureImageSource A source for the texture data. + * @returns {WebGLTexture} + */ + createTexture: function(gl, width, height, textureImageSource) { + var texture = gl.createTexture(); + gl.bindTexture(gl.TEXTURE_2D, texture); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MAG_FILTER, gl.NEAREST); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_MIN_FILTER, gl.NEAREST); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_S, gl.CLAMP_TO_EDGE); + gl.texParameteri(gl.TEXTURE_2D, gl.TEXTURE_WRAP_T, gl.CLAMP_TO_EDGE); + if (textureImageSource) { + gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, gl.RGBA, gl.UNSIGNED_BYTE, textureImageSource); + } + else { + gl.texImage2D(gl.TEXTURE_2D, 0, gl.RGBA, width, height, 0, gl.RGBA, gl.UNSIGNED_BYTE, null); + } + return texture; + }, + + /** + * Can be optionally used to get a texture from the cache array + * + * If an existing texture is not found, a new texture is created and cached. + * + * @param {String} uniqueId A cache key to use to find an existing texture. + * @param {HTMLImageElement|HTMLCanvasElement} textureImageSource A source to use to create the + * texture cache entry if one does not already exist. + */ + getCachedTexture: function(uniqueId, textureImageSource) { + if (this.textureCache[uniqueId]) { + return this.textureCache[uniqueId]; + } + else { + var texture = this.createTexture( + this.gl, textureImageSource.width, textureImageSource.height, textureImageSource); + this.textureCache[uniqueId] = texture; + return texture; + } + }, + + /** + * Clear out cached resources related to a source image that has been + * filtered previously. + * + * @param {String} cacheKey The cache key provided when the source image was filtered. + */ + evictCachesForKey: function(cacheKey) { + if (this.textureCache[cacheKey]) { + this.gl.deleteTexture(this.textureCache[cacheKey]); + delete this.textureCache[cacheKey]; + } + }, + + copyGLTo2D: copyGLTo2DDrawImage, + + /** + * Attempt to extract GPU information strings from a WebGL context. + * + * Useful information when debugging or blacklisting specific GPUs. + * + * @returns {Object} A GPU info object with renderer and vendor strings. + */ + captureGPUInfo: function() { + if (this.gpuInfo) { + return this.gpuInfo; + } + var gl = this.gl, gpuInfo = { renderer: '', vendor: '' }; + if (!gl) { + return gpuInfo; + } + var ext = gl.getExtension('WEBGL_debug_renderer_info'); + if (ext) { + var renderer = gl.getParameter(ext.UNMASKED_RENDERER_WEBGL); + var vendor = gl.getParameter(ext.UNMASKED_VENDOR_WEBGL); + if (renderer) { + gpuInfo.renderer = renderer.toLowerCase(); + } + if (vendor) { + gpuInfo.vendor = vendor.toLowerCase(); + } + } + this.gpuInfo = gpuInfo; + return gpuInfo; + }, + }; +})(); + +function resizeCanvasIfNeeded(pipelineState) { + var targetCanvas = pipelineState.targetCanvas, + width = targetCanvas.width, height = targetCanvas.height, + dWidth = pipelineState.destinationWidth, + dHeight = pipelineState.destinationHeight; + + if (width !== dWidth || height !== dHeight) { + targetCanvas.width = dWidth; + targetCanvas.height = dHeight; + } +} + +/** + * Copy an input WebGL canvas on to an output 2D canvas. + * + * The WebGL canvas is assumed to be upside down, with the top-left pixel of the + * desired output image appearing in the bottom-left corner of the WebGL canvas. + * + * @param {WebGLRenderingContext} sourceContext The WebGL context to copy from. + * @param {HTMLCanvasElement} targetCanvas The 2D target canvas to copy on to. + * @param {Object} pipelineState The 2D target canvas to copy on to. + */ +function copyGLTo2DDrawImage(gl, pipelineState) { + var glCanvas = gl.canvas, targetCanvas = pipelineState.targetCanvas, + ctx = targetCanvas.getContext('2d'); + ctx.translate(0, targetCanvas.height); // move it down again + ctx.scale(1, -1); // vertical flip + // where is my image on the big glcanvas? + var sourceY = glCanvas.height - targetCanvas.height; + ctx.drawImage(glCanvas, 0, sourceY, targetCanvas.width, targetCanvas.height, 0, 0, + targetCanvas.width, targetCanvas.height); +} + +/** + * Copy an input WebGL canvas on to an output 2D canvas using 2d canvas' putImageData + * API. Measurably faster than using ctx.drawImage in Firefox (version 54 on OSX Sierra). + * + * @param {WebGLRenderingContext} sourceContext The WebGL context to copy from. + * @param {HTMLCanvasElement} targetCanvas The 2D target canvas to copy on to. + * @param {Object} pipelineState The 2D target canvas to copy on to. + */ +function copyGLTo2DPutImageData(gl, pipelineState) { + var targetCanvas = pipelineState.targetCanvas, ctx = targetCanvas.getContext('2d'), + dWidth = pipelineState.destinationWidth, + dHeight = pipelineState.destinationHeight, + numBytes = dWidth * dHeight * 4; + + // eslint-disable-next-line no-undef + var u8 = new Uint8Array(this.imageBuffer, 0, numBytes); + // eslint-disable-next-line no-undef + var u8Clamped = new Uint8ClampedArray(this.imageBuffer, 0, numBytes); + + gl.readPixels(0, 0, dWidth, dHeight, gl.RGBA, gl.UNSIGNED_BYTE, u8); + var imgData = new ImageData(u8Clamped, dWidth, dHeight); + ctx.putImageData(imgData, 0, 0); +} +(function() { + + 'use strict'; + + var noop = function() {}; + + fabric.Canvas2dFilterBackend = Canvas2dFilterBackend; + + /** + * Canvas 2D filter backend. + */ + function Canvas2dFilterBackend() {}; + + Canvas2dFilterBackend.prototype = /** @lends fabric.Canvas2dFilterBackend.prototype */ { + evictCachesForKey: noop, + dispose: noop, + clearWebGLCaches: noop, + + /** + * Experimental. This object is a sort of repository of help layers used to avoid + * of recreating them during frequent filtering. If you are previewing a filter with + * a slider you probably do not want to create help layers every filter step. + * in this object there will be appended some canvases, created once, resized sometimes + * cleared never. Clearing is left to the developer. + **/ + resources: { + + }, + + /** + * Apply a set of filters against a source image and draw the filtered output + * to the provided destination canvas. + * + * @param {EnhancedFilter} filters The filter to apply. + * @param {HTMLImageElement|HTMLCanvasElement} sourceElement The source to be filtered. + * @param {Number} sourceWidth The width of the source input. + * @param {Number} sourceHeight The height of the source input. + * @param {HTMLCanvasElement} targetCanvas The destination for filtered output to be drawn. + */ + applyFilters: function(filters, sourceElement, sourceWidth, sourceHeight, targetCanvas) { + var ctx = targetCanvas.getContext('2d'); + ctx.drawImage(sourceElement, 0, 0, sourceWidth, sourceHeight); + var imageData = ctx.getImageData(0, 0, sourceWidth, sourceHeight); + var originalImageData = ctx.getImageData(0, 0, sourceWidth, sourceHeight); + var pipelineState = { + sourceWidth: sourceWidth, + sourceHeight: sourceHeight, + imageData: imageData, + originalEl: sourceElement, + originalImageData: originalImageData, + canvasEl: targetCanvas, + ctx: ctx, + filterBackend: this, + }; + filters.forEach(function(filter) { filter.applyTo(pipelineState); }); + if (pipelineState.imageData.width !== sourceWidth || pipelineState.imageData.height !== sourceHeight) { + targetCanvas.width = pipelineState.imageData.width; + targetCanvas.height = pipelineState.imageData.height; + } + ctx.putImageData(pipelineState.imageData, 0, 0); + return pipelineState; + }, + + }; +})(); +/** + * @namespace fabric.Image.filters + * @memberOf fabric.Image + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#image_filters} + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + */ +fabric.Image = fabric.Image || { }; +fabric.Image.filters = fabric.Image.filters || { }; + +/** + * Root filter class from which all filter classes inherit from + * @class fabric.Image.filters.BaseFilter + * @memberOf fabric.Image.filters + */ +fabric.Image.filters.BaseFilter = fabric.util.createClass(/** @lends fabric.Image.filters.BaseFilter.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'BaseFilter', + + /** + * Array of attributes to send with buffers. do not modify + * @private + */ + + vertexSource: 'attribute vec2 aPosition;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vTexCoord = aPosition;\n' + + 'gl_Position = vec4(aPosition * 2.0 - 1.0, 0.0, 1.0);\n' + + '}', + + fragmentSource: 'precision highp float;\n' + + 'varying vec2 vTexCoord;\n' + + 'uniform sampler2D uTexture;\n' + + 'void main() {\n' + + 'gl_FragColor = texture2D(uTexture, vTexCoord);\n' + + '}', + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * Sets filter's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + }, + + /** + * Compile this filter's shader program. + * + * @param {WebGLRenderingContext} gl The GL canvas context to use for shader compilation. + * @param {String} fragmentSource fragmentShader source for compilation + * @param {String} vertexSource vertexShader source for compilation + */ + createProgram: function(gl, fragmentSource, vertexSource) { + fragmentSource = fragmentSource || this.fragmentSource; + vertexSource = vertexSource || this.vertexSource; + if (fabric.webGlPrecision !== 'highp'){ + fragmentSource = fragmentSource.replace( + /precision highp float/g, + 'precision ' + fabric.webGlPrecision + ' float' + ); + } + var vertexShader = gl.createShader(gl.VERTEX_SHADER); + gl.shaderSource(vertexShader, vertexSource); + gl.compileShader(vertexShader); + if (!gl.getShaderParameter(vertexShader, gl.COMPILE_STATUS)) { + throw new Error( + // eslint-disable-next-line prefer-template + 'Vertex shader compile error for ' + this.type + ': ' + + gl.getShaderInfoLog(vertexShader) + ); + } + + var fragmentShader = gl.createShader(gl.FRAGMENT_SHADER); + gl.shaderSource(fragmentShader, fragmentSource); + gl.compileShader(fragmentShader); + if (!gl.getShaderParameter(fragmentShader, gl.COMPILE_STATUS)) { + throw new Error( + // eslint-disable-next-line prefer-template + 'Fragment shader compile error for ' + this.type + ': ' + + gl.getShaderInfoLog(fragmentShader) + ); + } + + var program = gl.createProgram(); + gl.attachShader(program, vertexShader); + gl.attachShader(program, fragmentShader); + gl.linkProgram(program); + if (!gl.getProgramParameter(program, gl.LINK_STATUS)) { + throw new Error( + // eslint-disable-next-line prefer-template + 'Shader link error for "${this.type}" ' + + gl.getProgramInfoLog(program) + ); + } + + var attributeLocations = this.getAttributeLocations(gl, program); + var uniformLocations = this.getUniformLocations(gl, program) || { }; + uniformLocations.uStepW = gl.getUniformLocation(program, 'uStepW'); + uniformLocations.uStepH = gl.getUniformLocation(program, 'uStepH'); + return { + program: program, + attributeLocations: attributeLocations, + uniformLocations: uniformLocations + }; + }, + + /** + * Return a map of attribute names to WebGLAttributeLocation objects. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {WebGLShaderProgram} program The shader program from which to take attribute locations. + * @returns {Object} A map of attribute names to attribute locations. + */ + getAttributeLocations: function(gl, program) { + return { + aPosition: gl.getAttribLocation(program, 'aPosition'), + }; + }, + + /** + * Return a map of uniform names to WebGLUniformLocation objects. + * + * Intended to be overridden by subclasses. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {WebGLShaderProgram} program The shader program from which to take uniform locations. + * @returns {Object} A map of uniform names to uniform locations. + */ + getUniformLocations: function (/* gl, program */) { + // in case i do not need any special uniform i need to return an empty object + return { }; + }, + + /** + * Send attribute data from this filter to its shader program on the GPU. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {Object} attributeLocations A map of shader attribute names to their locations. + */ + sendAttributeData: function(gl, attributeLocations, aPositionData) { + var attributeLocation = attributeLocations.aPosition; + var buffer = gl.createBuffer(); + gl.bindBuffer(gl.ARRAY_BUFFER, buffer); + gl.enableVertexAttribArray(attributeLocation); + gl.vertexAttribPointer(attributeLocation, 2, gl.FLOAT, false, 0, 0); + gl.bufferData(gl.ARRAY_BUFFER, aPositionData, gl.STATIC_DRAW); + }, + + _setupFrameBuffer: function(options) { + var gl = options.context, width, height; + if (options.passes > 1) { + width = options.destinationWidth; + height = options.destinationHeight; + if (options.sourceWidth !== width || options.sourceHeight !== height) { + gl.deleteTexture(options.targetTexture); + options.targetTexture = options.filterBackend.createTexture(gl, width, height); + } + gl.framebufferTexture2D(gl.FRAMEBUFFER, gl.COLOR_ATTACHMENT0, gl.TEXTURE_2D, + options.targetTexture, 0); + } + else { + // draw last filter on canvas and not to framebuffer. + gl.bindFramebuffer(gl.FRAMEBUFFER, null); + gl.finish(); + } + }, + + _swapTextures: function(options) { + options.passes--; + options.pass++; + var temp = options.targetTexture; + options.targetTexture = options.sourceTexture; + options.sourceTexture = temp; + }, + + /** + * Generic isNeutral implementation for one parameter based filters. + * Used only in image applyFilters to discard filters that will not have an effect + * on the image + * Other filters may need their own verison ( ColorMatrix, HueRotation, gamma, ComposedFilter ) + * @param {Object} options + **/ + isNeutralState: function(/* options */) { + var main = this.mainParameter, + _class = fabric.Image.filters[this.type].prototype; + if (main) { + if (Array.isArray(_class[main])) { + for (var i = _class[main].length; i--;) { + if (this[main][i] !== _class[main][i]) { + return false; + } + } + return true; + } + else { + return _class[main] === this[main]; + } + } + else { + return false; + } + }, + + /** + * Apply this filter to the input image data provided. + * + * Determines whether to use WebGL or Canvas2D based on the options.webgl flag. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyTo: function(options) { + if (options.webgl) { + this._setupFrameBuffer(options); + this.applyToWebGL(options); + this._swapTextures(options); + } + else { + this.applyTo2d(options); + } + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + if (!options.programCache.hasOwnProperty(this.type)) { + options.programCache[this.type] = this.createProgram(options.context); + } + return options.programCache[this.type]; + }, + + /** + * Apply this filter using webgl. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.originalTexture The texture of the original input image. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyToWebGL: function(options) { + var gl = options.context; + var shader = this.retrieveShader(options); + if (options.pass === 0 && options.originalTexture) { + gl.bindTexture(gl.TEXTURE_2D, options.originalTexture); + } + else { + gl.bindTexture(gl.TEXTURE_2D, options.sourceTexture); + } + gl.useProgram(shader.program); + this.sendAttributeData(gl, shader.attributeLocations, options.aPosition); + + gl.uniform1f(shader.uniformLocations.uStepW, 1 / options.sourceWidth); + gl.uniform1f(shader.uniformLocations.uStepH, 1 / options.sourceHeight); + + this.sendUniformData(gl, shader.uniformLocations); + gl.viewport(0, 0, options.destinationWidth, options.destinationHeight); + gl.drawArrays(gl.TRIANGLE_STRIP, 0, 4); + }, + + bindAdditionalTexture: function(gl, texture, textureUnit) { + gl.activeTexture(textureUnit); + gl.bindTexture(gl.TEXTURE_2D, texture); + // reset active texture to 0 as usual + gl.activeTexture(gl.TEXTURE0); + }, + + unbindAdditionalTexture: function(gl, textureUnit) { + gl.activeTexture(textureUnit); + gl.bindTexture(gl.TEXTURE_2D, null); + gl.activeTexture(gl.TEXTURE0); + }, + + getMainParameter: function() { + return this[this.mainParameter]; + }, + + setMainParameter: function(value) { + this[this.mainParameter] = value; + }, + + /** + * Send uniform data from this filter to its shader program on the GPU. + * + * Intended to be overridden by subclasses. + * + * @param {WebGLRenderingContext} gl The canvas context used to compile the shader program. + * @param {Object} uniformLocations A map of shader uniform names to their locations. + */ + sendUniformData: function(/* gl, uniformLocations */) { + // Intentionally left blank. Override me in subclasses. + }, + + /** + * If needed by a 2d filter, this functions can create an helper canvas to be used + * remember that options.targetCanvas is available for use till end of chain. + */ + createHelpLayer: function(options) { + if (!options.helpLayer) { + var helpLayer = document.createElement('canvas'); + helpLayer.width = options.sourceWidth; + helpLayer.height = options.sourceHeight; + options.helpLayer = helpLayer; + } + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + var object = { type: this.type }, mainP = this.mainParameter; + if (mainP) { + object[mainP] = this[mainP]; + } + return object; + }, + + /** + * Returns a JSON representation of an instance + * @return {Object} JSON + */ + toJSON: function() { + // delegate, not alias + return this.toObject(); + } +}); + +fabric.Image.filters.BaseFilter.fromObject = function(object, callback) { + var filter = new fabric.Image.filters[object.type](object); + callback && callback(filter); + return filter; +}; +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Color Matrix filter class + * @class fabric.Image.filters.ColorMatrix + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.ColorMatrix#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @see {@Link http://www.webwasp.co.uk/tutorials/219/Color_Matrix_Filter.php} + * @see {@Link http://phoboslab.org/log/2013/11/fast-image-filters-with-webgl} + * @example Kodachrome filter + * var filter = new fabric.Image.filters.ColorMatrix({ + * matrix: [ + 1.1285582396593525, -0.3967382283601348, -0.03992559172921793, 0, 63.72958762196502, + -0.16404339962244616, 1.0835251566291304, -0.05498805115633132, 0, 24.732407896706203, + -0.16786010706155763, -0.5603416277695248, 1.6014850761964943, 0, 35.62982807460946, + 0, 0, 0, 1, 0 + ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.ColorMatrix = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.ColorMatrix.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'ColorMatrix', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'varying vec2 vTexCoord;\n' + + 'uniform mat4 uColorMatrix;\n' + + 'uniform vec4 uConstants;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'color *= uColorMatrix;\n' + + 'color += uConstants;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Colormatrix for pixels. + * array of 20 floats. Numbers in positions 4, 9, 14, 19 loose meaning + * outside the -1, 1 range. + * 0.0039215686 is the part of 1 that get translated to 1 in 2d + * @param {Array} matrix array of 20 numbers. + * @default + */ + matrix: [ + 1, 0, 0, 0, 0, + 0, 1, 0, 0, 0, + 0, 0, 1, 0, 0, + 0, 0, 0, 1, 0 + ], + + mainParameter: 'matrix', + + /** + * Lock the colormatrix on the color part, skipping alpha, manly for non webgl scenario + * to save some calculation + */ + colorsOnly: true, + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + this.callSuper('initialize', options); + // create a new array instead mutating the prototype with push + this.matrix = this.matrix.slice(0); + }, + + /** + * Apply the ColorMatrix operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, + iLen = data.length, + m = this.matrix, + r, g, b, a, i, colorsOnly = this.colorsOnly; + + for (i = 0; i < iLen; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + if (colorsOnly) { + data[i] = r * m[0] + g * m[1] + b * m[2] + m[4] * 255; + data[i + 1] = r * m[5] + g * m[6] + b * m[7] + m[9] * 255; + data[i + 2] = r * m[10] + g * m[11] + b * m[12] + m[14] * 255; + } + else { + a = data[i + 3]; + data[i] = r * m[0] + g * m[1] + b * m[2] + a * m[3] + m[4] * 255; + data[i + 1] = r * m[5] + g * m[6] + b * m[7] + a * m[8] + m[9] * 255; + data[i + 2] = r * m[10] + g * m[11] + b * m[12] + a * m[13] + m[14] * 255; + data[i + 3] = r * m[15] + g * m[16] + b * m[17] + a * m[18] + m[19] * 255; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uColorMatrix: gl.getUniformLocation(program, 'uColorMatrix'), + uConstants: gl.getUniformLocation(program, 'uConstants'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var m = this.matrix, + matrix = [ + m[0], m[1], m[2], m[3], + m[5], m[6], m[7], m[8], + m[10], m[11], m[12], m[13], + m[15], m[16], m[17], m[18] + ], + constants = [m[4], m[9], m[14], m[19]]; + gl.uniformMatrix4fv(uniformLocations.uColorMatrix, false, matrix); + gl.uniform4fv(uniformLocations.uConstants, constants); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] function to invoke after filter creation + * @return {fabric.Image.filters.ColorMatrix} Instance of fabric.Image.filters.ColorMatrix + */ + fabric.Image.filters.ColorMatrix.fromObject = fabric.Image.filters.BaseFilter.fromObject; +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Brightness filter class + * @class fabric.Image.filters.Brightness + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Brightness#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Brightness({ + * brightness: 0.05 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Brightness = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Brightness.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Brightness', + + /** + * Fragment source for the brightness program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uBrightness;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'color.rgb += uBrightness;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Brightness value, from -1 to 1. + * translated to -255 to 255 for 2d + * 0.0039215686 is the part of 1 that get translated to 1 in 2d + * @param {Number} brightness + * @default + */ + brightness: 0, + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'brightness', + + /** + * Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + if (this.brightness === 0) { + return; + } + var imageData = options.imageData, + data = imageData.data, i, len = data.length, + brightness = Math.round(this.brightness * 255); + for (i = 0; i < len; i += 4) { + data[i] = data[i] + brightness; + data[i + 1] = data[i + 1] + brightness; + data[i + 2] = data[i + 2] + brightness; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uBrightness: gl.getUniformLocation(program, 'uBrightness'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uBrightness, this.brightness); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Brightness} Instance of fabric.Image.filters.Brightness + */ + fabric.Image.filters.Brightness.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Adapted from html5rocks article + * @class fabric.Image.filters.Convolute + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Convolute#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example Sharpen filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 0, -1, 0, + * -1, 5, -1, + * 0, -1, 0 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + * @example Blur filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + * @example Emboss filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + * @example Emboss filter with opaqueness + * var filter = new fabric.Image.filters.Convolute({ + * opaque: true, + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.Convolute = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Convolute.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Convolute', + + /* + * Opaque value (true/false) + */ + opaque: false, + + /* + * matrix for the filter, max 9x9 + */ + matrix: [0, 0, 0, 0, 1, 0, 0, 0, 0], + + /** + * Fragment source for the brightness program + */ + fragmentSource: { + Convolute_3_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[9];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 3.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 3.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 1), uStepH * (h - 1));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 3.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_3_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[9];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 3.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 3.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 1.0), uStepH * (h - 1.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 3.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + Convolute_5_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[25];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 5.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 5.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 2.0), uStepH * (h - 2.0));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 5.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_5_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[25];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 5.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 5.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 2.0), uStepH * (h - 2.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 5.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + Convolute_7_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[49];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 7.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 7.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 3.0), uStepH * (h - 3.0));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 7.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_7_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[49];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 7.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 7.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 3.0), uStepH * (h - 3.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 7.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + Convolute_9_1: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[81];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 0);\n' + + 'for (float h = 0.0; h < 9.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 9.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 4.0), uStepH * (h - 4.0));\n' + + 'color += texture2D(uTexture, vTexCoord + matrixPos) * uMatrix[int(h * 9.0 + w)];\n' + + '}\n' + + '}\n' + + 'gl_FragColor = color;\n' + + '}', + Convolute_9_0: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uMatrix[81];\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = vec4(0, 0, 0, 1);\n' + + 'for (float h = 0.0; h < 9.0; h+=1.0) {\n' + + 'for (float w = 0.0; w < 9.0; w+=1.0) {\n' + + 'vec2 matrixPos = vec2(uStepW * (w - 4.0), uStepH * (h - 4.0));\n' + + 'color.rgb += texture2D(uTexture, vTexCoord + matrixPos).rgb * uMatrix[int(h * 9.0 + w)];\n' + + '}\n' + + '}\n' + + 'float alpha = texture2D(uTexture, vTexCoord).a;\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.a = alpha;\n' + + '}', + }, + + /** + * Constructor + * @memberOf fabric.Image.filters.Convolute.prototype + * @param {Object} [options] Options object + * @param {Boolean} [options.opaque=false] Opaque value (true/false) + * @param {Array} [options.matrix] Filter matrix + */ + + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var size = Math.sqrt(this.matrix.length); + var cacheKey = this.type + '_' + size + '_' + (this.opaque ? 1 : 0); + var shaderSource = this.fragmentSource[cacheKey]; + if (!options.programCache.hasOwnProperty(cacheKey)) { + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + /** + * Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, + weights = this.matrix, + side = Math.round(Math.sqrt(weights.length)), + halfSide = Math.floor(side / 2), + sw = imageData.width, + sh = imageData.height, + output = options.ctx.createImageData(sw, sh), + dst = output.data, + // go through the destination image pixels + alphaFac = this.opaque ? 1 : 0, + r, g, b, a, dstOff, + scx, scy, srcOff, wt, + x, y, cx, cy; + + for (y = 0; y < sh; y++) { + for (x = 0; x < sw; x++) { + dstOff = (y * sw + x) * 4; + // calculate the weighed sum of the source image pixels that + // fall under the convolution matrix + r = 0; g = 0; b = 0; a = 0; + + for (cy = 0; cy < side; cy++) { + for (cx = 0; cx < side; cx++) { + scy = y + cy - halfSide; + scx = x + cx - halfSide; + + // eslint-disable-next-line max-depth + if (scy < 0 || scy > sh || scx < 0 || scx > sw) { + continue; + } + + srcOff = (scy * sw + scx) * 4; + wt = weights[cy * side + cx]; + + r += data[srcOff] * wt; + g += data[srcOff + 1] * wt; + b += data[srcOff + 2] * wt; + // eslint-disable-next-line max-depth + if (!alphaFac) { + a += data[srcOff + 3] * wt; + } + } + } + dst[dstOff] = r; + dst[dstOff + 1] = g; + dst[dstOff + 2] = b; + if (!alphaFac) { + dst[dstOff + 3] = a; + } + else { + dst[dstOff + 3] = data[dstOff + 3]; + } + } + } + options.imageData = output; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uMatrix: gl.getUniformLocation(program, 'uMatrix'), + uOpaque: gl.getUniformLocation(program, 'uOpaque'), + uHalfSize: gl.getUniformLocation(program, 'uHalfSize'), + uSize: gl.getUniformLocation(program, 'uSize'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1fv(uniformLocations.uMatrix, this.matrix); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + opaque: this.opaque, + matrix: this.matrix + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Convolute} Instance of fabric.Image.filters.Convolute + */ + fabric.Image.filters.Convolute.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Grayscale image filter class + * @class fabric.Image.filters.Grayscale + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Grayscale(); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Grayscale = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Grayscale.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Grayscale', + + fragmentSource: { + average: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'float average = (color.r + color.b + color.g) / 3.0;\n' + + 'gl_FragColor = vec4(average, average, average, color.a);\n' + + '}', + lightness: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform int uMode;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 col = texture2D(uTexture, vTexCoord);\n' + + 'float average = (max(max(col.r, col.g),col.b) + min(min(col.r, col.g),col.b)) / 2.0;\n' + + 'gl_FragColor = vec4(average, average, average, col.a);\n' + + '}', + luminosity: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform int uMode;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 col = texture2D(uTexture, vTexCoord);\n' + + 'float average = 0.21 * col.r + 0.72 * col.g + 0.07 * col.b;\n' + + 'gl_FragColor = vec4(average, average, average, col.a);\n' + + '}', + }, + + + /** + * Grayscale mode, between 'average', 'lightness', 'luminosity' + * @param {String} type + * @default + */ + mode: 'average', + + mainParameter: 'mode', + + /** + * Apply the Grayscale operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, i, + len = data.length, value, + mode = this.mode; + for (i = 0; i < len; i += 4) { + if (mode === 'average') { + value = (data[i] + data[i + 1] + data[i + 2]) / 3; + } + else if (mode === 'lightness') { + value = (Math.min(data[i], data[i + 1], data[i + 2]) + + Math.max(data[i], data[i + 1], data[i + 2])) / 2; + } + else if (mode === 'luminosity') { + value = 0.21 * data[i] + 0.72 * data[i + 1] + 0.07 * data[i + 2]; + } + data[i] = value; + data[i + 1] = value; + data[i + 2] = value; + } + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var cacheKey = this.type + '_' + this.mode; + if (!options.programCache.hasOwnProperty(cacheKey)) { + var shaderSource = this.fragmentSource[this.mode]; + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uMode: gl.getUniformLocation(program, 'uMode'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + // default average mode. + var mode = 1; + gl.uniform1i(uniformLocations.uMode, mode); + }, + + /** + * Grayscale filter isNeutralState implementation + * The filter is never neutral + * on the image + **/ + isNeutralState: function() { + return false; + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Grayscale} Instance of fabric.Image.filters.Grayscale + */ + fabric.Image.filters.Grayscale.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Invert filter class + * @class fabric.Image.filters.Invert + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Invert(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Invert = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Invert.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Invert', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform int uInvert;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'if (uInvert == 1) {\n' + + 'gl_FragColor = vec4(1.0 - color.r,1.0 -color.g,1.0 -color.b,color.a);\n' + + '} else {\n' + + 'gl_FragColor = color;\n' + + '}\n' + + '}', + + /** + * Filter invert. if false, does nothing + * @param {Boolean} invert + * @default + */ + invert: true, + + mainParameter: 'invert', + + /** + * Apply the Invert operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, i, + len = data.length; + for (i = 0; i < len; i += 4) { + data[i] = 255 - data[i]; + data[i + 1] = 255 - data[i + 1]; + data[i + 2] = 255 - data[i + 2]; + } + }, + + /** + * Invert filter isNeutralState implementation + * Used only in image applyFilters to discard filters that will not have an effect + * on the image + * @param {Object} options + **/ + isNeutralState: function() { + return !this.invert; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uInvert: gl.getUniformLocation(program, 'uInvert'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1i(uniformLocations.uInvert, this.invert); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Invert} Instance of fabric.Image.filters.Invert + */ + fabric.Image.filters.Invert.fromObject = fabric.Image.filters.BaseFilter.fromObject; + + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Noise filter class + * @class fabric.Image.filters.Noise + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Noise#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Noise({ + * noise: 700 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.Noise = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Noise.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Noise', + + /** + * Fragment source for the noise program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uStepH;\n' + + 'uniform float uNoise;\n' + + 'uniform float uSeed;\n' + + 'varying vec2 vTexCoord;\n' + + 'float rand(vec2 co, float seed, float vScale) {\n' + + 'return fract(sin(dot(co.xy * vScale ,vec2(12.9898 , 78.233))) * 43758.5453 * (seed + 0.01) / 2.0);\n' + + '}\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'color.rgb += (0.5 - rand(vTexCoord, uSeed, 0.1 / uStepH)) * uNoise;\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'noise', + + /** + * Noise value, from + * @param {Number} noise + * @default + */ + noise: 0, + + /** + * Apply the Brightness operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + if (this.noise === 0) { + return; + } + var imageData = options.imageData, + data = imageData.data, i, len = data.length, + noise = this.noise, rand; + + for (i = 0, len = data.length; i < len; i += 4) { + + rand = (0.5 - Math.random()) * noise; + + data[i] += rand; + data[i + 1] += rand; + data[i + 2] += rand; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uNoise: gl.getUniformLocation(program, 'uNoise'), + uSeed: gl.getUniformLocation(program, 'uSeed'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uNoise, this.noise / 255); + gl.uniform1f(uniformLocations.uSeed, Math.random()); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + noise: this.noise + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Noise} Instance of fabric.Image.filters.Noise + */ + fabric.Image.filters.Noise.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Pixelate filter class + * @class fabric.Image.filters.Pixelate + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Pixelate#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Pixelate({ + * blocksize: 8 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Pixelate = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Pixelate.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Pixelate', + + blocksize: 4, + + mainParameter: 'blocksize', + + /** + * Fragment source for the Pixelate program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uBlocksize;\n' + + 'uniform float uStepW;\n' + + 'uniform float uStepH;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'float blockW = uBlocksize * uStepW;\n' + + 'float blockH = uBlocksize * uStepW;\n' + + 'int posX = int(vTexCoord.x / blockW);\n' + + 'int posY = int(vTexCoord.y / blockH);\n' + + 'float fposX = float(posX);\n' + + 'float fposY = float(posY);\n' + + 'vec2 squareCoords = vec2(fposX * blockW, fposY * blockH);\n' + + 'vec4 color = texture2D(uTexture, squareCoords);\n' + + 'gl_FragColor = color;\n' + + '}', + + /** + * Apply the Pixelate operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, + iLen = imageData.height, + jLen = imageData.width, + index, i, j, r, g, b, a, + _i, _j, _iLen, _jLen; + + for (i = 0; i < iLen; i += this.blocksize) { + for (j = 0; j < jLen; j += this.blocksize) { + + index = (i * 4) * jLen + (j * 4); + + r = data[index]; + g = data[index + 1]; + b = data[index + 2]; + a = data[index + 3]; + + _iLen = Math.min(i + this.blocksize, iLen); + _jLen = Math.min(j + this.blocksize, jLen); + for (_i = i; _i < _iLen; _i++) { + for (_j = j; _j < _jLen; _j++) { + index = (_i * 4) * jLen + (_j * 4); + data[index] = r; + data[index + 1] = g; + data[index + 2] = b; + data[index + 3] = a; + } + } + } + } + }, + + /** + * Indicate when the filter is not gonna apply changes to the image + **/ + isNeutralState: function() { + return this.blocksize === 1; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uBlocksize: gl.getUniformLocation(program, 'uBlocksize'), + uStepW: gl.getUniformLocation(program, 'uStepW'), + uStepH: gl.getUniformLocation(program, 'uStepH'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uBlocksize, this.blocksize); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Pixelate} Instance of fabric.Image.filters.Pixelate + */ + fabric.Image.filters.Pixelate.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Remove white filter class + * @class fabric.Image.filters.RemoveColor + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.RemoveColor#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.RemoveColor({ + * threshold: 0.2, + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.RemoveColor = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.RemoveColor.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'RemoveColor', + + /** + * Color to remove, in any format understood by fabric.Color. + * @param {String} type + * @default + */ + color: '#FFFFFF', + + /** + * Fragment source for the brightness program + */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec4 uLow;\n' + + 'uniform vec4 uHigh;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'gl_FragColor = texture2D(uTexture, vTexCoord);\n' + + 'if(all(greaterThan(gl_FragColor.rgb,uLow.rgb)) && all(greaterThan(uHigh.rgb,gl_FragColor.rgb))) {\n' + + 'gl_FragColor.a = 0.0;\n' + + '}\n' + + '}', + + /** + * distance to actual color, as value up or down from each r,g,b + * between 0 and 1 + **/ + distance: 0.02, + + /** + * For color to remove inside distance, use alpha channel for a smoother deletion + * NOT IMPLEMENTED YET + **/ + useAlpha: false, + + /** + * Constructor + * @memberOf fabric.Image.filters.RemoveWhite.prototype + * @param {Object} [options] Options object + * @param {Number} [options.color=#RRGGBB] Threshold value + * @param {Number} [options.distance=10] Distance value + */ + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, i, + distance = this.distance * 255, + r, g, b, + source = new fabric.Color(this.color).getSource(), + lowC = [ + source[0] - distance, + source[1] - distance, + source[2] - distance, + ], + highC = [ + source[0] + distance, + source[1] + distance, + source[2] + distance, + ]; + + + for (i = 0; i < data.length; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + if (r > lowC[0] && + g > lowC[1] && + b > lowC[2] && + r < highC[0] && + g < highC[1] && + b < highC[2]) { + data[i + 3] = 0; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uLow: gl.getUniformLocation(program, 'uLow'), + uHigh: gl.getUniformLocation(program, 'uHigh'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var source = new fabric.Color(this.color).getSource(), + distance = parseFloat(this.distance), + lowC = [ + 0 + source[0] / 255 - distance, + 0 + source[1] / 255 - distance, + 0 + source[2] / 255 - distance, + 1 + ], + highC = [ + source[0] / 255 + distance, + source[1] / 255 + distance, + source[2] / 255 + distance, + 1 + ]; + gl.uniform4fv(uniformLocations.uLow, lowC); + gl.uniform4fv(uniformLocations.uHigh, highC); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + color: this.color, + distance: this.distance + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.RemoveColor} Instance of fabric.Image.filters.RemoveWhite + */ + fabric.Image.filters.RemoveColor.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + var matrices = { + Brownie: [ + 0.59970,0.34553,-0.27082,0,0.186, + -0.03770,0.86095,0.15059,0,-0.1449, + 0.24113,-0.07441,0.44972,0,-0.02965, + 0,0,0,1,0 + ], + Vintage: [ + 0.62793,0.32021,-0.03965,0,0.03784, + 0.02578,0.64411,0.03259,0,0.02926, + 0.04660,-0.08512,0.52416,0,0.02023, + 0,0,0,1,0 + ], + Kodachrome: [ + 1.12855,-0.39673,-0.03992,0,0.24991, + -0.16404,1.08352,-0.05498,0,0.09698, + -0.16786,-0.56034,1.60148,0,0.13972, + 0,0,0,1,0 + ], + Technicolor: [ + 1.91252,-0.85453,-0.09155,0,0.04624, + -0.30878,1.76589,-0.10601,0,-0.27589, + -0.23110,-0.75018,1.84759,0,0.12137, + 0,0,0,1,0 + ], + Polaroid: [ + 1.438,-0.062,-0.062,0,0, + -0.122,1.378,-0.122,0,0, + -0.016,-0.016,1.483,0,0, + 0,0,0,1,0 + ], + Sepia: [ + 0.393, 0.769, 0.189, 0, 0, + 0.349, 0.686, 0.168, 0, 0, + 0.272, 0.534, 0.131, 0, 0, + 0, 0, 0, 1, 0 + ], + BlackWhite: [ + 1.5, 1.5, 1.5, 0, -1, + 1.5, 1.5, 1.5, 0, -1, + 1.5, 1.5, 1.5, 0, -1, + 0, 0, 0, 1, 0, + ] + }; + + for (var key in matrices) { + filters[key] = createClass(filters.ColorMatrix, /** @lends fabric.Image.filters.Sepia.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: key, + + /** + * Colormatrix for the effect + * array of 20 floats. Numbers in positions 4, 9, 14, 19 loose meaning + * outside the -1, 1 range. + * @param {Array} matrix array of 20 numbers. + * @default + */ + matrix: matrices[key], + + /** + * Lock the matrix export for this kind of static, parameter less filters. + */ + mainParameter: false, + /** + * Lock the colormatrix on the color part, skipping alpha + */ + colorsOnly: true, + + }); + fabric.Image.filters[key].fromObject = fabric.Image.filters.BaseFilter.fromObject; + } +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + 'use strict'; + + var fabric = global.fabric, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Color Blend filter class + * @class fabric.Image.filter.BlendColor + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example + * var filter = new fabric.Image.filters.BlendColor({ + * color: '#000', + * mode: 'multiply' + * }); + * + * var filter = new fabric.Image.filters.BlendImage({ + * image: fabricImageObject, + * mode: 'multiply', + * alpha: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + + filters.BlendColor = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blend.prototype */ { + type: 'BlendColor', + + /** + * Color to make the blend operation with. default to a reddish color since black or white + * gives always strong result. + **/ + color: '#F95C63', + + /** + * Blend mode for the filter: one of multiply, add, diff, screen, subtract, + * darken, lighten, overlay, exclusion, tint. + **/ + mode: 'multiply', + + /** + * alpha value. represent the strength of the blend color operation. + **/ + alpha: 1, + + /** + * Fragment source for the Multiply program + */ + fragmentSource: { + multiply: 'gl_FragColor.rgb *= uColor.rgb;\n', + screen: 'gl_FragColor.rgb = 1.0 - (1.0 - gl_FragColor.rgb) * (1.0 - uColor.rgb);\n', + add: 'gl_FragColor.rgb += uColor.rgb;\n', + diff: 'gl_FragColor.rgb = abs(gl_FragColor.rgb - uColor.rgb);\n', + subtract: 'gl_FragColor.rgb -= uColor.rgb;\n', + lighten: 'gl_FragColor.rgb = max(gl_FragColor.rgb, uColor.rgb);\n', + darken: 'gl_FragColor.rgb = min(gl_FragColor.rgb, uColor.rgb);\n', + exclusion: 'gl_FragColor.rgb += uColor.rgb - 2.0 * (uColor.rgb * gl_FragColor.rgb);\n', + overlay: 'if (uColor.r < 0.5) {\n' + + 'gl_FragColor.r *= 2.0 * uColor.r;\n' + + '} else {\n' + + 'gl_FragColor.r = 1.0 - 2.0 * (1.0 - gl_FragColor.r) * (1.0 - uColor.r);\n' + + '}\n' + + 'if (uColor.g < 0.5) {\n' + + 'gl_FragColor.g *= 2.0 * uColor.g;\n' + + '} else {\n' + + 'gl_FragColor.g = 1.0 - 2.0 * (1.0 - gl_FragColor.g) * (1.0 - uColor.g);\n' + + '}\n' + + 'if (uColor.b < 0.5) {\n' + + 'gl_FragColor.b *= 2.0 * uColor.b;\n' + + '} else {\n' + + 'gl_FragColor.b = 1.0 - 2.0 * (1.0 - gl_FragColor.b) * (1.0 - uColor.b);\n' + + '}\n', + tint: 'gl_FragColor.rgb *= (1.0 - uColor.a);\n' + + 'gl_FragColor.rgb += uColor.rgb;\n', + }, + + /** + * build the fragment source for the filters, joining the common part with + * the specific one. + * @param {String} mode the mode of the filter, a key of this.fragmentSource + * @return {String} the source to be compiled + * @private + */ + buildSource: function(mode) { + return 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec4 uColor;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'gl_FragColor = color;\n' + + 'if (color.a > 0.0) {\n' + + this.fragmentSource[mode] + + '}\n' + + '}'; + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var cacheKey = this.type + '_' + this.mode, shaderSource; + if (!options.programCache.hasOwnProperty(cacheKey)) { + shaderSource = this.buildSource(this.mode); + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + /** + * Apply the Blend operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + data = imageData.data, iLen = data.length, + tr, tg, tb, + r, g, b, + source, alpha1 = 1 - this.alpha; + + source = new fabric.Color(this.color).getSource(); + tr = source[0] * this.alpha; + tg = source[1] * this.alpha; + tb = source[2] * this.alpha; + + for (var i = 0; i < iLen; i += 4) { + + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + switch (this.mode) { + case 'multiply': + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + break; + case 'screen': + data[i] = 255 - (255 - r) * (255 - tr) / 255; + data[i + 1] = 255 - (255 - g) * (255 - tg) / 255; + data[i + 2] = 255 - (255 - b) * (255 - tb) / 255; + break; + case 'add': + data[i] = r + tr; + data[i + 1] = g + tg; + data[i + 2] = b + tb; + break; + case 'diff': + case 'difference': + data[i] = Math.abs(r - tr); + data[i + 1] = Math.abs(g - tg); + data[i + 2] = Math.abs(b - tb); + break; + case 'subtract': + data[i] = r - tr; + data[i + 1] = g - tg; + data[i + 2] = b - tb; + break; + case 'darken': + data[i] = Math.min(r, tr); + data[i + 1] = Math.min(g, tg); + data[i + 2] = Math.min(b, tb); + break; + case 'lighten': + data[i] = Math.max(r, tr); + data[i + 1] = Math.max(g, tg); + data[i + 2] = Math.max(b, tb); + break; + case 'overlay': + data[i] = tr < 128 ? (2 * r * tr / 255) : (255 - 2 * (255 - r) * (255 - tr) / 255); + data[i + 1] = tg < 128 ? (2 * g * tg / 255) : (255 - 2 * (255 - g) * (255 - tg) / 255); + data[i + 2] = tb < 128 ? (2 * b * tb / 255) : (255 - 2 * (255 - b) * (255 - tb) / 255); + break; + case 'exclusion': + data[i] = tr + r - ((2 * tr * r) / 255); + data[i + 1] = tg + g - ((2 * tg * g) / 255); + data[i + 2] = tb + b - ((2 * tb * b) / 255); + break; + case 'tint': + data[i] = tr + r * alpha1; + data[i + 1] = tg + g * alpha1; + data[i + 2] = tb + b * alpha1; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uColor: gl.getUniformLocation(program, 'uColor'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var source = new fabric.Color(this.color).getSource(); + source[0] = this.alpha * source[0] / 255; + source[1] = this.alpha * source[1] / 255; + source[2] = this.alpha * source[2] / 255; + source[3] = this.alpha; + gl.uniform4fv(uniformLocations.uColor, source); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + color: this.color, + mode: this.mode, + alpha: this.alpha + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.BlendColor} Instance of fabric.Image.filters.BlendColor + */ + fabric.Image.filters.BlendColor.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + 'use strict'; + + var fabric = global.fabric, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Image Blend filter class + * @class fabric.Image.filter.BlendImage + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example + * var filter = new fabric.Image.filters.BlendColor({ + * color: '#000', + * mode: 'multiply' + * }); + * + * var filter = new fabric.Image.filters.BlendImage({ + * image: fabricImageObject, + * mode: 'multiply', + * alpha: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + + filters.BlendImage = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.BlendImage.prototype */ { + type: 'BlendImage', + + /** + * Color to make the blend operation with. default to a reddish color since black or white + * gives always strong result. + **/ + image: null, + + /** + * Blend mode for the filter: one of multiply, add, diff, screen, subtract, + * darken, lighten, overlay, exclusion, tint. + **/ + mode: 'multiply', + + /** + * alpha value. represent the strength of the blend image operation. + * not implemented. + **/ + alpha: 1, + + vertexSource: 'attribute vec2 aPosition;\n' + + 'varying vec2 vTexCoord;\n' + + 'varying vec2 vTexCoord2;\n' + + 'uniform mat3 uTransformMatrix;\n' + + 'void main() {\n' + + 'vTexCoord = aPosition;\n' + + 'vTexCoord2 = (uTransformMatrix * vec3(aPosition, 1.0)).xy;\n' + + 'gl_Position = vec4(aPosition * 2.0 - 1.0, 0.0, 1.0);\n' + + '}', + + /** + * Fragment source for the Multiply program + */ + fragmentSource: { + multiply: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform sampler2D uImage;\n' + + 'uniform vec4 uColor;\n' + + 'varying vec2 vTexCoord;\n' + + 'varying vec2 vTexCoord2;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'vec4 color2 = texture2D(uImage, vTexCoord2);\n' + + 'color.rgba *= color2.rgba;\n' + + 'gl_FragColor = color;\n' + + '}', + mask: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform sampler2D uImage;\n' + + 'uniform vec4 uColor;\n' + + 'varying vec2 vTexCoord;\n' + + 'varying vec2 vTexCoord2;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'vec4 color2 = texture2D(uImage, vTexCoord2);\n' + + 'color.a = color2.a;\n' + + 'gl_FragColor = color;\n' + + '}', + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var cacheKey = this.type + '_' + this.mode; + var shaderSource = this.fragmentSource[this.mode]; + if (!options.programCache.hasOwnProperty(cacheKey)) { + options.programCache[cacheKey] = this.createProgram(options.context, shaderSource); + } + return options.programCache[cacheKey]; + }, + + applyToWebGL: function(options) { + // load texture to blend. + var gl = options.context, + texture = this.createTexture(options.filterBackend, this.image); + this.bindAdditionalTexture(gl, texture, gl.TEXTURE1); + this.callSuper('applyToWebGL', options); + this.unbindAdditionalTexture(gl, gl.TEXTURE1); + }, + + createTexture: function(backend, image) { + return backend.getCachedTexture(image.cacheKey, image._element); + }, + + /** + * Calculate a transformMatrix to adapt the image to blend over + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + calculateMatrix: function() { + var image = this.image, + width = image._element.width, + height = image._element.height; + return [ + 1 / image.scaleX, 0, 0, + 0, 1 / image.scaleY, 0, + -image.left / width, -image.top / height, 1 + ]; + }, + + /** + * Apply the Blend operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, + resources = options.filterBackend.resources, + data = imageData.data, iLen = data.length, + width = imageData.width, + height = imageData.height, + tr, tg, tb, ta, + r, g, b, a, + canvas1, context, image = this.image, blendData; + + if (!resources.blendImage) { + resources.blendImage = fabric.util.createCanvasElement(); + } + canvas1 = resources.blendImage; + context = canvas1.getContext('2d'); + if (canvas1.width !== width || canvas1.height !== height) { + canvas1.width = width; + canvas1.height = height; + } + else { + context.clearRect(0, 0, width, height); + } + context.setTransform(image.scaleX, 0, 0, image.scaleY, image.left, image.top); + context.drawImage(image._element, 0, 0, width, height); + blendData = context.getImageData(0, 0, width, height).data; + for (var i = 0; i < iLen; i += 4) { + + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + a = data[i + 3]; + + tr = blendData[i]; + tg = blendData[i + 1]; + tb = blendData[i + 2]; + ta = blendData[i + 3]; + + switch (this.mode) { + case 'multiply': + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + data[i + 3] = a * ta / 255; + break; + case 'mask': + data[i + 3] = ta; + break; + } + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uTransformMatrix: gl.getUniformLocation(program, 'uTransformMatrix'), + uImage: gl.getUniformLocation(program, 'uImage'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var matrix = this.calculateMatrix(); + gl.uniform1i(uniformLocations.uImage, 1); // texture unit 1. + gl.uniformMatrix3fv(uniformLocations.uTransformMatrix, false, matrix); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + image: this.image && this.image.toObject(), + mode: this.mode, + alpha: this.alpha + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} callback to be invoked after filter creation + * @return {fabric.Image.filters.BlendImage} Instance of fabric.Image.filters.BlendImage + */ + fabric.Image.filters.BlendImage.fromObject = function(object, callback) { + fabric.Image.fromObject(object.image, function(image) { + var options = fabric.util.object.clone(object); + options.image = image; + callback(new fabric.Image.filters.BlendImage(options)); + }); + }; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), pow = Math.pow, floor = Math.floor, + sqrt = Math.sqrt, abs = Math.abs, round = Math.round, sin = Math.sin, + ceil = Math.ceil, + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Resize image filter class + * @class fabric.Image.filters.Resize + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Resize(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + filters.Resize = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Resize.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Resize', + + /** + * Resize type + * for webgl resizeType is just lanczos, for canvas2d can be: + * bilinear, hermite, sliceHack, lanczos. + * @param {String} resizeType + * @default + */ + resizeType: 'hermite', + + /** + * Scale factor for resizing, x axis + * @param {Number} scaleX + * @default + */ + scaleX: 1, + + /** + * Scale factor for resizing, y axis + * @param {Number} scaleY + * @default + */ + scaleY: 1, + + /** + * LanczosLobes parameter for lanczos filter, valid for resizeType lanczos + * @param {Number} lanczosLobes + * @default + */ + lanczosLobes: 3, + + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uDelta: gl.getUniformLocation(program, 'uDelta'), + uTaps: gl.getUniformLocation(program, 'uTaps'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform2fv(uniformLocations.uDelta, this.horizontal ? [1 / this.width, 0] : [0, 1 / this.height]); + gl.uniform1fv(uniformLocations.uTaps, this.taps); + }, + + /** + * Retrieves the cached shader. + * @param {Object} options + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + retrieveShader: function(options) { + var filterWindow = this.getFilterWindow(), cacheKey = this.type + '_' + filterWindow; + if (!options.programCache.hasOwnProperty(cacheKey)) { + var fragmentShader = this.generateShader(filterWindow); + options.programCache[cacheKey] = this.createProgram(options.context, fragmentShader); + } + return options.programCache[cacheKey]; + }, + + getFilterWindow: function() { + var scale = this.tempScale; + return Math.ceil(this.lanczosLobes / scale); + }, + + getTaps: function() { + var lobeFunction = this.lanczosCreate(this.lanczosLobes), scale = this.tempScale, + filterWindow = this.getFilterWindow(), taps = new Array(filterWindow); + for (var i = 1; i <= filterWindow; i++) { + taps[i - 1] = lobeFunction(i * scale); + } + return taps; + }, + + /** + * Generate vertex and shader sources from the necessary steps numbers + * @param {Number} filterWindow + */ + generateShader: function(filterWindow) { + var offsets = new Array(filterWindow), + fragmentShader = this.fragmentSourceTOP, filterWindow; + + for (var i = 1; i <= filterWindow; i++) { + offsets[i - 1] = i + '.0 * uDelta'; + } + + fragmentShader += 'uniform float uTaps[' + filterWindow + '];\n'; + fragmentShader += 'void main() {\n'; + fragmentShader += ' vec4 color = texture2D(uTexture, vTexCoord);\n'; + fragmentShader += ' float sum = 1.0;\n'; + + offsets.forEach(function(offset, i) { + fragmentShader += ' color += texture2D(uTexture, vTexCoord + ' + offset + ') * uTaps[' + i + '];\n'; + fragmentShader += ' color += texture2D(uTexture, vTexCoord - ' + offset + ') * uTaps[' + i + '];\n'; + fragmentShader += ' sum += 2.0 * uTaps[' + i + '];\n'; + }); + fragmentShader += ' gl_FragColor = color / sum;\n'; + fragmentShader += '}'; + return fragmentShader; + }, + + fragmentSourceTOP: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec2 uDelta;\n' + + 'varying vec2 vTexCoord;\n', + + /** + * Apply the resize filter to the image + * Determines whether to use WebGL or Canvas2D based on the options.webgl flag. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyTo: function(options) { + if (options.webgl) { + options.passes++; + this.width = options.sourceWidth; + this.horizontal = true; + this.dW = Math.round(this.width * this.scaleX); + this.dH = options.sourceHeight; + this.tempScale = this.dW / this.width; + this.taps = this.getTaps(); + options.destinationWidth = this.dW; + this._setupFrameBuffer(options); + this.applyToWebGL(options); + this._swapTextures(options); + options.sourceWidth = options.destinationWidth; + + this.height = options.sourceHeight; + this.horizontal = false; + this.dH = Math.round(this.height * this.scaleY); + this.tempScale = this.dH / this.height; + this.taps = this.getTaps(); + options.destinationHeight = this.dH; + this._setupFrameBuffer(options); + this.applyToWebGL(options); + this._swapTextures(options); + options.sourceHeight = options.destinationHeight; + } + else { + this.applyTo2d(options); + } + }, + + isNeutralState: function() { + return this.scaleX === 1 && this.scaleY === 1; + }, + + lanczosCreate: function(lobes) { + return function(x) { + if (x >= lobes || x <= -lobes) { + return 0.0; + } + if (x < 1.19209290E-07 && x > -1.19209290E-07) { + return 1.0; + } + x *= Math.PI; + var xx = x / lobes; + return (sin(x) / x) * sin(xx) / xx; + }; + }, + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Resize.prototype + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} scaleX + * @param {Number} scaleY + */ + applyTo2d: function(options) { + var imageData = options.imageData, + scaleX = this.scaleX, + scaleY = this.scaleY; + + this.rcpScaleX = 1 / scaleX; + this.rcpScaleY = 1 / scaleY; + + var oW = imageData.width, oH = imageData.height, + dW = round(oW * scaleX), dH = round(oH * scaleY), + newData; + + if (this.resizeType === 'sliceHack') { + newData = this.sliceByTwo(options, oW, oH, dW, dH); + } + else if (this.resizeType === 'hermite') { + newData = this.hermiteFastResize(options, oW, oH, dW, dH); + } + else if (this.resizeType === 'bilinear') { + newData = this.bilinearFiltering(options, oW, oH, dW, dH); + } + else if (this.resizeType === 'lanczos') { + newData = this.lanczosResize(options, oW, oH, dW, dH); + } + options.imageData = newData; + }, + + /** + * Filter sliceByTwo + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + sliceByTwo: function(options, oW, oH, dW, dH) { + var imageData = options.imageData, + mult = 0.5, doneW = false, doneH = false, stepW = oW * mult, + stepH = oH * mult, resources = fabric.filterBackend.resources, + tmpCanvas, ctx, sX = 0, sY = 0, dX = oW, dY = 0; + if (!resources.sliceByTwo) { + resources.sliceByTwo = document.createElement('canvas'); + } + tmpCanvas = resources.sliceByTwo; + if (tmpCanvas.width < oW * 1.5 || tmpCanvas.height < oH) { + tmpCanvas.width = oW * 1.5; + tmpCanvas.height = oH; + } + ctx = tmpCanvas.getContext('2d'); + ctx.clearRect(0, 0, oW * 1.5, oH); + ctx.putImageData(imageData, 0, 0); + + dW = floor(dW); + dH = floor(dH); + + while (!doneW || !doneH) { + oW = stepW; + oH = stepH; + if (dW < floor(stepW * mult)) { + stepW = floor(stepW * mult); + } + else { + stepW = dW; + doneW = true; + } + if (dH < floor(stepH * mult)) { + stepH = floor(stepH * mult); + } + else { + stepH = dH; + doneH = true; + } + ctx.drawImage(tmpCanvas, sX, sY, oW, oH, dX, dY, stepW, stepH); + sX = dX; + sY = dY; + dY += stepH; + } + return ctx.getImageData(sX, sY, dW, dH); + }, + + /** + * Filter lanczosResize + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + lanczosResize: function(options, oW, oH, dW, dH) { + + function process(u) { + var v, i, weight, idx, a, red, green, + blue, alpha, fX, fY; + center.x = (u + 0.5) * ratioX; + icenter.x = floor(center.x); + for (v = 0; v < dH; v++) { + center.y = (v + 0.5) * ratioY; + icenter.y = floor(center.y); + a = 0; red = 0; green = 0; blue = 0; alpha = 0; + for (i = icenter.x - range2X; i <= icenter.x + range2X; i++) { + if (i < 0 || i >= oW) { + continue; + } + fX = floor(1000 * abs(i - center.x)); + if (!cacheLanc[fX]) { + cacheLanc[fX] = { }; + } + for (var j = icenter.y - range2Y; j <= icenter.y + range2Y; j++) { + if (j < 0 || j >= oH) { + continue; + } + fY = floor(1000 * abs(j - center.y)); + if (!cacheLanc[fX][fY]) { + cacheLanc[fX][fY] = lanczos(sqrt(pow(fX * rcpRatioX, 2) + pow(fY * rcpRatioY, 2)) / 1000); + } + weight = cacheLanc[fX][fY]; + if (weight > 0) { + idx = (j * oW + i) * 4; + a += weight; + red += weight * srcData[idx]; + green += weight * srcData[idx + 1]; + blue += weight * srcData[idx + 2]; + alpha += weight * srcData[idx + 3]; + } + } + } + idx = (v * dW + u) * 4; + destData[idx] = red / a; + destData[idx + 1] = green / a; + destData[idx + 2] = blue / a; + destData[idx + 3] = alpha / a; + } + + if (++u < dW) { + return process(u); + } + else { + return destImg; + } + } + + var srcData = options.imageData.data, + destImg = options.ctx.createImageData(dW, dH), + destData = destImg.data, + lanczos = this.lanczosCreate(this.lanczosLobes), + ratioX = this.rcpScaleX, ratioY = this.rcpScaleY, + rcpRatioX = 2 / this.rcpScaleX, rcpRatioY = 2 / this.rcpScaleY, + range2X = ceil(ratioX * this.lanczosLobes / 2), + range2Y = ceil(ratioY * this.lanczosLobes / 2), + cacheLanc = { }, center = { }, icenter = { }; + + return process(0); + }, + + /** + * bilinearFiltering + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + bilinearFiltering: function(options, oW, oH, dW, dH) { + var a, b, c, d, x, y, i, j, xDiff, yDiff, chnl, + color, offset = 0, origPix, ratioX = this.rcpScaleX, + ratioY = this.rcpScaleY, + w4 = 4 * (oW - 1), img = options.imageData, + pixels = img.data, destImage = options.ctx.createImageData(dW, dH), + destPixels = destImage.data; + for (i = 0; i < dH; i++) { + for (j = 0; j < dW; j++) { + x = floor(ratioX * j); + y = floor(ratioY * i); + xDiff = ratioX * j - x; + yDiff = ratioY * i - y; + origPix = 4 * (y * oW + x); + + for (chnl = 0; chnl < 4; chnl++) { + a = pixels[origPix + chnl]; + b = pixels[origPix + 4 + chnl]; + c = pixels[origPix + w4 + chnl]; + d = pixels[origPix + w4 + 4 + chnl]; + color = a * (1 - xDiff) * (1 - yDiff) + b * xDiff * (1 - yDiff) + + c * yDiff * (1 - xDiff) + d * xDiff * yDiff; + destPixels[offset++] = color; + } + } + } + return destImage; + }, + + /** + * hermiteFastResize + * @param {Object} canvasEl Canvas element to apply filter to + * @param {Number} oW Original Width + * @param {Number} oH Original Height + * @param {Number} dW Destination Width + * @param {Number} dH Destination Height + * @returns {ImageData} + */ + hermiteFastResize: function(options, oW, oH, dW, dH) { + var ratioW = this.rcpScaleX, ratioH = this.rcpScaleY, + ratioWHalf = ceil(ratioW / 2), + ratioHHalf = ceil(ratioH / 2), + img = options.imageData, data = img.data, + img2 = options.ctx.createImageData(dW, dH), data2 = img2.data; + for (var j = 0; j < dH; j++) { + for (var i = 0; i < dW; i++) { + var x2 = (i + j * dW) * 4, weight = 0, weights = 0, weightsAlpha = 0, + gxR = 0, gxG = 0, gxB = 0, gxA = 0, centerY = (j + 0.5) * ratioH; + for (var yy = floor(j * ratioH); yy < (j + 1) * ratioH; yy++) { + var dy = abs(centerY - (yy + 0.5)) / ratioHHalf, + centerX = (i + 0.5) * ratioW, w0 = dy * dy; + for (var xx = floor(i * ratioW); xx < (i + 1) * ratioW; xx++) { + var dx = abs(centerX - (xx + 0.5)) / ratioWHalf, + w = sqrt(w0 + dx * dx); + /* eslint-disable max-depth */ + if (w > 1 && w < -1) { + continue; + } + //hermite filter + weight = 2 * w * w * w - 3 * w * w + 1; + if (weight > 0) { + dx = 4 * (xx + yy * oW); + //alpha + gxA += weight * data[dx + 3]; + weightsAlpha += weight; + //colors + if (data[dx + 3] < 255) { + weight = weight * data[dx + 3] / 250; + } + gxR += weight * data[dx]; + gxG += weight * data[dx + 1]; + gxB += weight * data[dx + 2]; + weights += weight; + } + /* eslint-enable max-depth */ + } + } + data2[x2] = gxR / weights; + data2[x2 + 1] = gxG / weights; + data2[x2 + 2] = gxB / weights; + data2[x2 + 3] = gxA / weightsAlpha; + } + } + return img2; + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + scaleX: this.scaleX, + scaleY: this.scaleY, + resizeType: this.resizeType, + lanczosLobes: this.lanczosLobes + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Resize} Instance of fabric.Image.filters.Resize + */ + fabric.Image.filters.Resize.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Contrast filter class + * @class fabric.Image.filters.Contrast + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Contrast#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Contrast({ + * contrast: 40 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Contrast = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Contrast.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Contrast', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uContrast;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'float contrastF = 1.015 * (uContrast + 1.0) / (1.0 * (1.015 - uContrast));\n' + + 'color.rgb = contrastF * (color.rgb - 0.5) + 0.5;\n' + + 'gl_FragColor = color;\n' + + '}', + + contrast: 0, + + mainParameter: 'contrast', + + /** + * Constructor + * @memberOf fabric.Image.filters.Contrast.prototype + * @param {Object} [options] Options object + * @param {Number} [options.contrast=0] Value to contrast the image up (-1...1) + */ + + /** + * Apply the Contrast operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + if (this.contrast === 0) { + return; + } + var imageData = options.imageData, i, len, + data = imageData.data, len = data.length, + contrast = Math.floor(this.contrast * 255), + contrastF = 259 * (contrast + 255) / (255 * (259 - contrast)); + + for (i = 0; i < len; i += 4) { + data[i] = contrastF * (data[i] - 128) + 128; + data[i + 1] = contrastF * (data[i + 1] - 128) + 128; + data[i + 2] = contrastF * (data[i + 2] - 128) + 128; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uContrast: gl.getUniformLocation(program, 'uContrast'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uContrast, this.contrast); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Contrast} Instance of fabric.Image.filters.Contrast + */ + fabric.Image.filters.Contrast.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Saturate filter class + * @class fabric.Image.filters.Saturation + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Saturation#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Saturation({ + * saturation: 100 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Saturation = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Saturation.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Saturation', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform float uSaturation;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'float rgMax = max(color.r, color.g);\n' + + 'float rgbMax = max(rgMax, color.b);\n' + + 'color.r += rgbMax != color.r ? (rgbMax - color.r) * uSaturation : 0.00;\n' + + 'color.g += rgbMax != color.g ? (rgbMax - color.g) * uSaturation : 0.00;\n' + + 'color.b += rgbMax != color.b ? (rgbMax - color.b) * uSaturation : 0.00;\n' + + 'gl_FragColor = color;\n' + + '}', + + saturation: 0, + + mainParameter: 'saturation', + + /** + * Constructor + * @memberOf fabric.Image.filters.Saturate.prototype + * @param {Object} [options] Options object + * @param {Number} [options.saturate=0] Value to saturate the image (-1...1) + */ + + /** + * Apply the Saturation operation to a Uint8ClampedArray representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8ClampedArray to be filtered. + */ + applyTo2d: function(options) { + if (this.saturation === 0) { + return; + } + var imageData = options.imageData, + data = imageData.data, len = data.length, + adjust = -this.saturation, i, max; + + for (i = 0; i < len; i += 4) { + max = Math.max(data[i], data[i + 1], data[i + 2]); + data[i] += max !== data[i] ? (max - data[i]) * adjust : 0; + data[i + 1] += max !== data[i + 1] ? (max - data[i + 1]) * adjust : 0; + data[i + 2] += max !== data[i + 2] ? (max - data[i + 2]) * adjust : 0; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uSaturation: gl.getUniformLocation(program, 'uSaturation'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform1f(uniformLocations.uSaturation, -this.saturation); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Saturation} Instance of fabric.Image.filters.Saturate + */ + fabric.Image.filters.Saturation.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Blur filter class + * @class fabric.Image.filters.Blur + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Blur#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Blur({ + * blur: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + * canvas.renderAll(); + */ + filters.Blur = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Blur.prototype */ { + + type: 'Blur', + + /* +'gl_FragColor = vec4(0.0);', +'gl_FragColor += texture2D(texture, vTexCoord + -7 * uDelta)*0.0044299121055113265;', +'gl_FragColor += texture2D(texture, vTexCoord + -6 * uDelta)*0.00895781211794;', +'gl_FragColor += texture2D(texture, vTexCoord + -5 * uDelta)*0.0215963866053;', +'gl_FragColor += texture2D(texture, vTexCoord + -4 * uDelta)*0.0443683338718;', +'gl_FragColor += texture2D(texture, vTexCoord + -3 * uDelta)*0.0776744219933;', +'gl_FragColor += texture2D(texture, vTexCoord + -2 * uDelta)*0.115876621105;', +'gl_FragColor += texture2D(texture, vTexCoord + -1 * uDelta)*0.147308056121;', +'gl_FragColor += texture2D(texture, vTexCoord )*0.159576912161;', +'gl_FragColor += texture2D(texture, vTexCoord + 1 * uDelta)*0.147308056121;', +'gl_FragColor += texture2D(texture, vTexCoord + 2 * uDelta)*0.115876621105;', +'gl_FragColor += texture2D(texture, vTexCoord + 3 * uDelta)*0.0776744219933;', +'gl_FragColor += texture2D(texture, vTexCoord + 4 * uDelta)*0.0443683338718;', +'gl_FragColor += texture2D(texture, vTexCoord + 5 * uDelta)*0.0215963866053;', +'gl_FragColor += texture2D(texture, vTexCoord + 6 * uDelta)*0.00895781211794;', +'gl_FragColor += texture2D(texture, vTexCoord + 7 * uDelta)*0.0044299121055113265;', +*/ + + /* eslint-disable max-len */ + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec2 uDelta;\n' + + 'varying vec2 vTexCoord;\n' + + 'const float nSamples = 15.0;\n' + + 'vec3 v3offset = vec3(12.9898, 78.233, 151.7182);\n' + + 'float random(vec3 scale) {\n' + + /* use the fragment position for a different seed per-pixel */ + 'return fract(sin(dot(gl_FragCoord.xyz, scale)) * 43758.5453);\n' + + '}\n' + + 'void main() {\n' + + 'vec4 color = vec4(0.0);\n' + + 'float total = 0.0;\n' + + 'float offset = random(v3offset);\n' + + 'for (float t = -nSamples; t <= nSamples; t++) {\n' + + 'float percent = (t + offset - 0.5) / nSamples;\n' + + 'float weight = 1.0 - abs(percent);\n' + + 'color += texture2D(uTexture, vTexCoord + uDelta * percent) * weight;\n' + + 'total += weight;\n' + + '}\n' + + 'gl_FragColor = color / total;\n' + + '}', + /* eslint-enable max-len */ + + /** + * blur value, in percentage of image dimensions. + * specific to keep the image blur constant at different resolutions + * range bewteen 0 and 1. + */ + blur: 0, + + mainParameter: 'blur', + + applyTo: function(options) { + if (options.webgl) { + // this aspectRatio is used to give the same blur to vertical and horizontal + this.aspectRatio = options.sourceWidth / options.sourceHeight; + options.passes++; + this._setupFrameBuffer(options); + this.horizontal = true; + this.applyToWebGL(options); + this._swapTextures(options); + this._setupFrameBuffer(options); + this.horizontal = false; + this.applyToWebGL(options); + this._swapTextures(options); + } + else { + this.applyTo2d(options); + } + }, + + applyTo2d: function(options) { + // paint canvasEl with current image data. + //options.ctx.putImageData(options.imageData, 0, 0); + options.imageData = this.simpleBlur(options); + }, + + simpleBlur: function(options) { + var resources = options.filterBackend.resources, canvas1, canvas2, + width = options.imageData.width, + height = options.imageData.height; + + if (!resources.blurLayer1) { + resources.blurLayer1 = fabric.util.createCanvasElement(); + resources.blurLayer2 = fabric.util.createCanvasElement(); + } + canvas1 = resources.blurLayer1; + canvas2 = resources.blurLayer2; + if (canvas1.width !== width || canvas1.height !== height) { + canvas2.width = canvas1.width = width; + canvas2.height = canvas1.height = height; + } + var ctx1 = canvas1.getContext('2d'), + ctx2 = canvas2.getContext('2d'), + nSamples = 15, + random, percent, j, i, + blur = this.blur * 0.06 * 0.5; + + // load first canvas + ctx1.putImageData(options.imageData, 0, 0); + ctx2.clearRect(0, 0, width, height); + + for (i = -nSamples; i <= nSamples; i++) { + random = (Math.random() - 0.5) / 4; + percent = i / nSamples; + j = blur * percent * width + random; + ctx2.globalAlpha = 1 - Math.abs(percent); + ctx2.drawImage(canvas1, j, random); + ctx1.drawImage(canvas2, 0, 0); + ctx2.globalAlpha = 1; + ctx2.clearRect(0, 0, canvas2.width, canvas2.height); + } + for (i = -nSamples; i <= nSamples; i++) { + random = (Math.random() - 0.5) / 4; + percent = i / nSamples; + j = blur * percent * height + random; + ctx2.globalAlpha = 1 - Math.abs(percent); + ctx2.drawImage(canvas1, random, j); + ctx1.drawImage(canvas2, 0, 0); + ctx2.globalAlpha = 1; + ctx2.clearRect(0, 0, canvas2.width, canvas2.height); + } + options.ctx.drawImage(canvas1, 0, 0); + var newImageData = options.ctx.getImageData(0, 0, canvas1.width, canvas1.height); + ctx1.globalAlpha = 1; + ctx1.clearRect(0, 0, canvas1.width, canvas1.height); + return newImageData; + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + delta: gl.getUniformLocation(program, 'uDelta'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + var delta = this.chooseRightDelta(); + gl.uniform2fv(uniformLocations.delta, delta); + }, + + /** + * choose right value of image percentage to blur with + * @returns {Array} a numeric array with delta values + */ + chooseRightDelta: function() { + var blurScale = 1, delta = [0, 0], blur; + if (this.horizontal) { + if (this.aspectRatio > 1) { + // image is wide, i want to shrink radius horizontal + blurScale = 1 / this.aspectRatio; + } + } + else { + if (this.aspectRatio < 1) { + // image is tall, i want to shrink radius vertical + blurScale = this.aspectRatio; + } + } + blur = blurScale * this.blur * 0.12; + if (this.horizontal) { + delta[0] = blur; + } + else { + delta[1] = blur; + } + return delta; + }, + }); + + /** + * Deserialize a JSON definition of a BlurFilter into a concrete instance. + */ + filters.Blur.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * Gamma filter class + * @class fabric.Image.filters.Gamma + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Gamma#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Gamma({ + * brightness: 200 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.Gamma = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Gamma.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Gamma', + + fragmentSource: 'precision highp float;\n' + + 'uniform sampler2D uTexture;\n' + + 'uniform vec3 uGamma;\n' + + 'varying vec2 vTexCoord;\n' + + 'void main() {\n' + + 'vec4 color = texture2D(uTexture, vTexCoord);\n' + + 'vec3 correction = (1.0 / uGamma);\n' + + 'color.r = pow(color.r, correction.r);\n' + + 'color.g = pow(color.g, correction.g);\n' + + 'color.b = pow(color.b, correction.b);\n' + + 'gl_FragColor = color;\n' + + 'gl_FragColor.rgb *= color.a;\n' + + '}', + + /** + * Gamma array value, from 0.01 to 2.2. + * @param {Array} gamma + * @default + */ + gamma: [1, 1, 1], + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'gamma', + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + this.gamma = [1, 1, 1]; + filters.BaseFilter.prototype.initialize.call(this, options); + }, + + /** + * Apply the Gamma operation to a Uint8Array representing the pixels of an image. + * + * @param {Object} options + * @param {ImageData} options.imageData The Uint8Array to be filtered. + */ + applyTo2d: function(options) { + var imageData = options.imageData, data = imageData.data, + gamma = this.gamma, len = data.length, + rInv = 1 / gamma[0], gInv = 1 / gamma[1], + bInv = 1 / gamma[2], i; + + if (!this.rVals) { + // eslint-disable-next-line + this.rVals = new Uint8Array(256); + // eslint-disable-next-line + this.gVals = new Uint8Array(256); + // eslint-disable-next-line + this.bVals = new Uint8Array(256); + } + + // This is an optimization - pre-compute a look-up table for each color channel + // instead of performing these pow calls for each pixel in the image. + for (i = 0, len = 256; i < len; i++) { + this.rVals[i] = Math.pow(i / 255, rInv) * 255; + this.gVals[i] = Math.pow(i / 255, gInv) * 255; + this.bVals[i] = Math.pow(i / 255, bInv) * 255; + } + for (i = 0, len = data.length; i < len; i += 4) { + data[i] = this.rVals[data[i]]; + data[i + 1] = this.gVals[data[i + 1]]; + data[i + 2] = this.bVals[data[i + 2]]; + } + }, + + /** + * Return WebGL uniform locations for this filter's shader. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {WebGLShaderProgram} program This filter's compiled shader program. + */ + getUniformLocations: function(gl, program) { + return { + uGamma: gl.getUniformLocation(program, 'uGamma'), + }; + }, + + /** + * Send data from this filter to its shader program's uniforms. + * + * @param {WebGLRenderingContext} gl The GL canvas context used to compile this filter's shader. + * @param {Object} uniformLocations A map of string uniform names to WebGLUniformLocation objects + */ + sendUniformData: function(gl, uniformLocations) { + gl.uniform3fv(uniformLocations.uGamma, this.gamma); + }, + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.Gamma} Instance of fabric.Image.filters.Gamma + */ + fabric.Image.filters.Gamma.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * A container class that knows how to apply a sequence of filters to an input image. + */ + filters.Composed = createClass(filters.BaseFilter, /** @lends fabric.Image.filters.Composed.prototype */ { + + type: 'Composed', + + /** + * A non sparse array of filters to apply + */ + subFilters: [], + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + this.callSuper('initialize', options); + // create a new array instead mutating the prototype with push + this.subFilters = this.subFilters.slice(0); + }, + + /** + * Apply this container's filters to the input image provided. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be applied. + */ + applyTo: function(options) { + options.passes += this.subFilters.length - 1; + this.subFilters.forEach(function(filter) { + filter.applyTo(options); + }); + }, + + /** + * Serialize this filter into JSON. + * + * @returns {Object} A JSON representation of this filter. + */ + toObject: function() { + return fabric.util.object.extend(this.callSuper('toObject'), { + subFilters: this.subFilters.map(function(filter) { return filter.toObject(); }), + }); + }, + + isNeutralState: function() { + return !this.subFilters.some(function(filter) { return !filter.isNeutralState(); }); + } + }); + + /** + * Deserialize a JSON definition of a ComposedFilter into a concrete instance. + */ + fabric.Image.filters.Composed.fromObject = function(object, callback) { + var filters = object.subFilters || [], + subFilters = filters.map(function(filter) { + return new fabric.Image.filters[filter.type](filter); + }), + instance = new fabric.Image.filters.Composed({ subFilters: subFilters }); + callback && callback(instance); + return instance; + }; +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + filters = fabric.Image.filters, + createClass = fabric.util.createClass; + + /** + * HueRotation filter class + * @class fabric.Image.filters.HueRotation + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.HueRotation#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.HueRotation({ + * rotation: -0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(); + */ + filters.HueRotation = createClass(filters.ColorMatrix, /** @lends fabric.Image.filters.HueRotation.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'HueRotation', + + /** + * HueRotation value, from -1 to 1. + * the unit is radians + * @param {Number} myParameter + * @default + */ + rotation: 0, + + /** + * Describe the property that is the filter parameter + * @param {String} m + * @default + */ + mainParameter: 'rotation', + + calculateMatrix: function() { + var rad = this.rotation * Math.PI, cos = fabric.util.cos(rad), sin = fabric.util.sin(rad), + aThird = 1 / 3, aThirdSqtSin = Math.sqrt(aThird) * sin, OneMinusCos = 1 - cos; + this.matrix = [ + 1, 0, 0, 0, 0, + 0, 1, 0, 0, 0, + 0, 0, 1, 0, 0, + 0, 0, 0, 1, 0 + ]; + this.matrix[0] = cos + OneMinusCos / 3; + this.matrix[1] = aThird * OneMinusCos - aThirdSqtSin; + this.matrix[2] = aThird * OneMinusCos + aThirdSqtSin; + this.matrix[5] = aThird * OneMinusCos + aThirdSqtSin; + this.matrix[6] = cos + aThird * OneMinusCos; + this.matrix[7] = aThird * OneMinusCos - aThirdSqtSin; + this.matrix[10] = aThird * OneMinusCos - aThirdSqtSin; + this.matrix[11] = aThird * OneMinusCos + aThirdSqtSin; + this.matrix[12] = cos + aThird * OneMinusCos; + }, + + /** + * HueRotation isNeutralState implementation + * Used only in image applyFilters to discard filters that will not have an effect + * on the image + * @param {Object} options + **/ + isNeutralState: function(options) { + this.calculateMatrix(); + return filters.BaseFilter.prototype.isNeutralState.call(this, options); + }, + + /** + * Apply this filter to the input image data provided. + * + * Determines whether to use WebGL or Canvas2D based on the options.webgl flag. + * + * @param {Object} options + * @param {Number} options.passes The number of filters remaining to be executed + * @param {Boolean} options.webgl Whether to use webgl to render the filter. + * @param {WebGLTexture} options.sourceTexture The texture setup as the source to be filtered. + * @param {WebGLTexture} options.targetTexture The texture where filtered output should be drawn. + * @param {WebGLRenderingContext} options.context The GL context used for rendering. + * @param {Object} options.programCache A map of compiled shader programs, keyed by filter type. + */ + applyTo: function(options) { + this.calculateMatrix(); + filters.BaseFilter.prototype.applyTo.call(this, options); + }, + + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {function} [callback] to be invoked after filter creation + * @return {fabric.Image.filters.HueRotation} Instance of fabric.Image.filters.HueRotation + */ + fabric.Image.filters.HueRotation.fromObject = fabric.Image.filters.BaseFilter.fromObject; + +})(typeof exports !== 'undefined' ? exports : this); +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + clone = fabric.util.object.clone; + + if (fabric.Text) { + fabric.warn('fabric.Text is already defined'); + return; + } + + /** + * Text class + * @class fabric.Text + * @extends fabric.Object + * @return {fabric.Text} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2#text} + * @see {@link fabric.Text#initialize} for constructor definition + */ + fabric.Text = fabric.util.createClass(fabric.Object, /** @lends fabric.Text.prototype */ { + + /** + * Properties which when set cause object to change dimensions + * @type Array + * @private + */ + _dimensionAffectingProps: [ + 'fontSize', + 'fontWeight', + 'fontFamily', + 'fontStyle', + 'lineHeight', + 'text', + 'charSpacing', + 'textAlign', + 'styles', + ], + + /** + * @private + */ + _reNewline: /\r?\n/, + + /** + * Use this regular expression to filter for whitespaces that is not a new line. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reSpacesAndTabs: /[ \t\r]/g, + + /** + * Use this regular expression to filter for whitespace that is not a new line. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reSpaceAndTab: /[ \t\r]/, + + /** + * Use this regular expression to filter consecutive groups of non spaces. + * Mostly used when text is 'justify' aligned. + * @private + */ + _reWords: /\S+/g, + + /** + * Type of an object + * @type String + * @default + */ + type: 'text', + + /** + * Font size (in pixels) + * @type Number + * @default + */ + fontSize: 40, + + /** + * Font weight (e.g. bold, normal, 400, 600, 800) + * @type {(Number|String)} + * @default + */ + fontWeight: 'normal', + + /** + * Font family + * @type String + * @default + */ + fontFamily: 'Times New Roman', + + /** + * Text decoration underline. + * @type Boolean + * @default + */ + underline: false, + + /** + * Text decoration overline. + * @type Boolean + * @default + */ + overline: false, + + /** + * Text decoration linethrough. + * @type Boolean + * @default + */ + linethrough: false, + + /** + * Text alignment. Possible values: "left", "center", "right", "justify", + * "justify-left", "justify-center" or "justify-right". + * @type String + * @default + */ + textAlign: 'left', + + /** + * Font style . Possible values: "", "normal", "italic" or "oblique". + * @type String + * @default + */ + fontStyle: 'normal', + + /** + * Line height + * @type Number + * @default + */ + lineHeight: 1.16, + + /** + * Superscript schema object (minimum overlap) + * @type {Object} + * @default + */ + superscript: { + size: 0.60, // fontSize factor + baseline: -0.35 // baseline-shift factor (upwards) + }, + + /** + * Subscript schema object (minimum overlap) + * @type {Object} + * @default + */ + subscript: { + size: 0.60, // fontSize factor + baseline: 0.11 // baseline-shift factor (downwards) + }, + + /** + * Background color of text lines + * @type String + * @default + */ + textBackgroundColor: '', + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: fabric.Object.prototype.stateProperties.concat('fontFamily', + 'fontWeight', + 'fontSize', + 'text', + 'underline', + 'overline', + 'linethrough', + 'textAlign', + 'fontStyle', + 'lineHeight', + 'textBackgroundColor', + 'charSpacing', + 'styles'), + + /** + * List of properties to consider when checking if cache needs refresh + * @type Array + */ + cacheProperties: fabric.Object.prototype.cacheProperties.concat('fontFamily', + 'fontWeight', + 'fontSize', + 'text', + 'underline', + 'overline', + 'linethrough', + 'textAlign', + 'fontStyle', + 'lineHeight', + 'textBackgroundColor', + 'charSpacing', + 'styles'), + + /** + * When defined, an object is rendered via stroke and this property specifies its color. + * Backwards incompatibility note: This property was named "strokeStyle" until v1.1.6 + * @type String + * @default + */ + stroke: null, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property was named "textShadow" (String) until v1.2.11 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * @private + */ + _fontSizeFraction: 0.222, + + /** + * @private + */ + offsets: { + underline: 0.10, + linethrough: -0.315, + overline: -0.88 + }, + + /** + * Text Line proportion to font Size (in pixels) + * @type Number + * @default + */ + _fontSizeMult: 1.13, + + /** + * additional space between characters + * expressed in thousands of em unit + * @type Number + * @default + */ + charSpacing: 0, + + /** + * Object containing character styles - top-level properties -> line numbers, + * 2nd-level properties - charater numbers + * @type Object + * @default + */ + styles: null, + + /** + * Reference to a context to measure text char or couple of chars + * the cacheContext of the canvas will be used or a freshly created one if the object is not on canvas + * once created it will be referenced on fabric._measuringContext to avoide creating a canvas for every + * text object created. + * @type {CanvasRenderingContext2D} + * @default + */ + _measuringContext: null, + + /** + * Baseline shift, stlyes only, keep at 0 for the main text object + * @type {Number} + * @default + */ + deltaY: 0, + + /** + * Array of properties that define a style unit (of 'styles'). + * @type {Array} + * @default + */ + _styleProperties: [ + 'stroke', + 'strokeWidth', + 'fill', + 'fontFamily', + 'fontSize', + 'fontWeight', + 'fontStyle', + 'underline', + 'overline', + 'linethrough', + 'deltaY', + 'textBackgroundColor', + ], + + /** + * contains characters bounding boxes + */ + __charBounds: [], + + /** + * use this size when measuring text. To avoid IE11 rounding errors + * @type {Number} + * @default + * @readonly + * @private + */ + CACHE_FONT_SIZE: 400, + + /** + * contains the min text width to avoid getting 0 + * @type {Number} + * @default + */ + MIN_TEXT_WIDTH: 2, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Text} thisArg + */ + initialize: function(text, options) { + this.styles = options ? (options.styles || { }) : { }; + this.text = text; + this.__skipDimension = true; + this.callSuper('initialize', options); + this.__skipDimension = false; + this.initDimensions(); + this.setCoords(); + this.setupState({ propertySet: '_dimensionAffectingProps' }); + }, + + /** + * Return a contex for measurement of text string. + * if created it gets stored for reuse + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Text} thisArg + */ + getMeasuringContext: function() { + // if we did not return we have to measure something. + if (!fabric._measuringContext) { + fabric._measuringContext = this.canvas && this.canvas.contextCache || + fabric.util.createCanvasElement().getContext('2d'); + } + return fabric._measuringContext; + }, + + /** + * @private + * Divides text into lines of text and lines of graphemes. + */ + _splitText: function() { + var newLines = this._splitTextIntoLines(this.text); + this.textLines = newLines.lines; + this._textLines = newLines.graphemeLines; + this._unwrappedTextLines = newLines._unwrappedLines; + this._text = newLines.graphemeText; + return newLines; + }, + + /** + * Initialize or update text dimensions. + * Updates this.width and this.height with the proper values. + * Does not return dimensions. + */ + initDimensions: function() { + if (this.__skipDimension) { + return; + } + this._splitText(); + this._clearCache(); + this.width = this.calcTextWidth() || this.cursorWidth || this.MIN_TEXT_WIDTH; + if (this.textAlign.indexOf('justify') !== -1) { + // once text is measured we need to make space fatter to make justified text. + this.enlargeSpaces(); + } + this.height = this.calcTextHeight(); + this.saveState({ propertySet: '_dimensionAffectingProps' }); + }, + + /** + * Enlarge space boxes and shift the others + */ + enlargeSpaces: function() { + var diffSpace, currentLineWidth, numberOfSpaces, accumulatedSpace, line, charBound, spaces; + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (this.textAlign !== 'justify' && (i === len - 1 || this.isEndOfWrapping(i))) { + continue; + } + accumulatedSpace = 0; + line = this._textLines[i]; + currentLineWidth = this.getLineWidth(i); + if (currentLineWidth < this.width && (spaces = this.textLines[i].match(this._reSpacesAndTabs))) { + numberOfSpaces = spaces.length; + diffSpace = (this.width - currentLineWidth) / numberOfSpaces; + for (var j = 0, jlen = line.length; j <= jlen; j++) { + charBound = this.__charBounds[i][j]; + if (this._reSpaceAndTab.test(line[j])) { + charBound.width += diffSpace; + charBound.kernedWidth += diffSpace; + charBound.left += accumulatedSpace; + accumulatedSpace += diffSpace; + } + else { + charBound.left += accumulatedSpace; + } + } + } + } + }, + + /** + * Detect if the text line is ended with an hard break + * text and itext do not have wrapping, return false + * @return {Boolean} + */ + isEndOfWrapping: function(lineIndex) { + return lineIndex === this._textLines.length - 1; + }, + + /** + * Detect if a line has a linebreak and so we need to account for it when moving + * and counting style. + * It return always for text and Itext. + * @return Number + */ + missingNewlineOffset: function() { + return 1; + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of text object + */ + toString: function() { + return '#'; + }, + + /** + * Return the dimension and the zoom level needed to create a cache canvas + * big enough to host the object to be cached. + * @private + * @param {Object} dim.x width of object to be cached + * @param {Object} dim.y height of object to be cached + * @return {Object}.width width of canvas + * @return {Object}.height height of canvas + * @return {Object}.zoomX zoomX zoom value to unscale the canvas before drawing cache + * @return {Object}.zoomY zoomY zoom value to unscale the canvas before drawing cache + */ + _getCacheCanvasDimensions: function() { + var dims = this.callSuper('_getCacheCanvasDimensions'); + var fontSize = this.fontSize; + dims.width += fontSize * dims.zoomX; + dims.height += fontSize * dims.zoomY; + return dims; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this._setTextStyles(ctx); + this._renderTextLinesBackground(ctx); + this._renderTextDecoration(ctx, 'underline'); + this._renderText(ctx); + this._renderTextDecoration(ctx, 'overline'); + this._renderTextDecoration(ctx, 'linethrough'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderText: function(ctx) { + if (this.paintFirst === 'stroke') { + this._renderTextStroke(ctx); + this._renderTextFill(ctx); + } + else { + this._renderTextFill(ctx); + this._renderTextStroke(ctx); + } + }, + + /** + * Set the font parameter of the context with the object properties or with charStyle + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Object} [charStyle] object with font style properties + * @param {String} [charStyle.fontFamily] Font Family + * @param {Number} [charStyle.fontSize] Font size in pixels. ( without px suffix ) + * @param {String} [charStyle.fontWeight] Font weight + * @param {String} [charStyle.fontStyle] Font style (italic|normal) + */ + _setTextStyles: function(ctx, charStyle, forMeasuring) { + ctx.textBaseline = 'alphabetic'; + ctx.font = this._getFontDeclaration(charStyle, forMeasuring); + }, + + /** + * calculate and return the text Width measuring each line. + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {Number} Maximum width of fabric.Text object + */ + calcTextWidth: function() { + var maxWidth = this.getLineWidth(0); + + for (var i = 1, len = this._textLines.length; i < len; i++) { + var currentLineWidth = this.getLineWidth(i); + if (currentLineWidth > maxWidth) { + maxWidth = currentLineWidth; + } + } + return maxWidth; + }, + + /** + * @private + * @param {String} method Method name ("fillText" or "strokeText") + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Text to render + * @param {Number} left Left position of text + * @param {Number} top Top position of text + * @param {Number} lineIndex Index of a line in a text + */ + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + this._renderChars(method, ctx, line, left, top, lineIndex); + }, + + /** + * Renders the text background for lines, taking care of style + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextLinesBackground: function(ctx) { + if (!this.textBackgroundColor && !this.styleHas('textBackgroundColor')) { + return; + } + var lineTopOffset = 0, heightOfLine, + lineLeftOffset, originalFill = ctx.fillStyle, + line, lastColor, + leftOffset = this._getLeftOffset(), + topOffset = this._getTopOffset(), + boxStart = 0, boxWidth = 0, charBox, currentColor; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this.getHeightOfLine(i); + if (!this.textBackgroundColor && !this.styleHas('textBackgroundColor', i)) { + lineTopOffset += heightOfLine; + continue; + } + line = this._textLines[i]; + lineLeftOffset = this._getLineLeftOffset(i); + boxWidth = 0; + boxStart = 0; + lastColor = this.getValueOfPropertyAt(i, 0, 'textBackgroundColor'); + for (var j = 0, jlen = line.length; j < jlen; j++) { + charBox = this.__charBounds[i][j]; + currentColor = this.getValueOfPropertyAt(i, j, 'textBackgroundColor'); + if (currentColor !== lastColor) { + ctx.fillStyle = lastColor; + lastColor && ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + topOffset + lineTopOffset, + boxWidth, + heightOfLine / this.lineHeight + ); + boxStart = charBox.left; + boxWidth = charBox.width; + lastColor = currentColor; + } + else { + boxWidth += charBox.kernedWidth; + } + } + if (currentColor) { + ctx.fillStyle = currentColor; + ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + topOffset + lineTopOffset, + boxWidth, + heightOfLine / this.lineHeight + ); + } + lineTopOffset += heightOfLine; + } + ctx.fillStyle = originalFill; + // if there is text background color no + // other shadows should be casted + this._removeShadow(ctx); + }, + + /** + * @private + * @param {Object} decl style declaration for cache + * @param {String} decl.fontFamily fontFamily + * @param {String} decl.fontStyle fontStyle + * @param {String} decl.fontWeight fontWeight + * @return {Object} reference to cache + */ + getFontCache: function(decl) { + var fontFamily = decl.fontFamily.toLowerCase(); + if (!fabric.charWidthsCache[fontFamily]) { + fabric.charWidthsCache[fontFamily] = { }; + } + var cache = fabric.charWidthsCache[fontFamily], + cacheProp = decl.fontStyle.toLowerCase() + '_' + (decl.fontWeight + '').toLowerCase(); + if (!cache[cacheProp]) { + cache[cacheProp] = { }; + } + return cache[cacheProp]; + }, + + /** + * apply all the character style to canvas for rendering + * @private + * @param {String} _char + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} [decl] + */ + _applyCharStyles: function(method, ctx, lineIndex, charIndex, styleDeclaration) { + + this._setFillStyles(ctx, styleDeclaration); + this._setStrokeStyles(ctx, styleDeclaration); + + ctx.font = this._getFontDeclaration(styleDeclaration); + }, + + /** + * measure and return the width of a single character. + * possibly overridden to accommodate different measure logic or + * to hook some external lib for character measurement + * @private + * @param {String} _char, char to be measured + * @param {Object} charStyle style of char to be measured + * @param {String} [previousChar] previous char + * @param {Object} [prevCharStyle] style of previous char + */ + _measureChar: function(_char, charStyle, previousChar, prevCharStyle) { + // first i try to return from cache + var fontCache = this.getFontCache(charStyle), fontDeclaration = this._getFontDeclaration(charStyle), + previousFontDeclaration = this._getFontDeclaration(prevCharStyle), couple = previousChar + _char, + stylesAreEqual = fontDeclaration === previousFontDeclaration, width, coupleWidth, previousWidth, + fontMultiplier = charStyle.fontSize / this.CACHE_FONT_SIZE, kernedWidth; + + if (previousChar && fontCache[previousChar] !== undefined) { + previousWidth = fontCache[previousChar]; + } + if (fontCache[_char] !== undefined) { + kernedWidth = width = fontCache[_char]; + } + if (stylesAreEqual && fontCache[couple] !== undefined) { + coupleWidth = fontCache[couple]; + kernedWidth = coupleWidth - previousWidth; + } + if (width === undefined || previousWidth === undefined || coupleWidth === undefined) { + var ctx = this.getMeasuringContext(); + // send a TRUE to specify measuring font size CACHE_FONT_SIZE + this._setTextStyles(ctx, charStyle, true); + } + if (width === undefined) { + kernedWidth = width = ctx.measureText(_char).width; + fontCache[_char] = width; + } + if (previousWidth === undefined && stylesAreEqual && previousChar) { + previousWidth = ctx.measureText(previousChar).width; + fontCache[previousChar] = previousWidth; + } + if (stylesAreEqual && coupleWidth === undefined) { + // we can measure the kerning couple and subtract the width of the previous character + coupleWidth = ctx.measureText(couple).width; + fontCache[couple] = coupleWidth; + kernedWidth = coupleWidth - previousWidth; + } + return { width: width * fontMultiplier, kernedWidth: kernedWidth * fontMultiplier }; + }, + + /** + * Computes height of character at given position + * @param {Number} line the line index number + * @param {Number} _char the character index number + * @return {Number} fontSize of the character + */ + getHeightOfChar: function(line, _char) { + return this.getValueOfPropertyAt(line, _char, 'fontSize'); + }, + + /** + * measure a text line measuring all characters. + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + measureLine: function(lineIndex) { + var lineInfo = this._measureLine(lineIndex); + if (this.charSpacing !== 0) { + lineInfo.width -= this._getWidthOfCharSpacing(); + } + if (lineInfo.width < 0) { + lineInfo.width = 0; + } + return lineInfo; + }, + + /** + * measure every grapheme of a line, populating __charBounds + * @param {Number} lineIndex + * @return {Object} object.width total width of characters + * @return {Object} object.widthOfSpaces length of chars that match this._reSpacesAndTabs + */ + _measureLine: function(lineIndex) { + var width = 0, i, grapheme, line = this._textLines[lineIndex], prevGrapheme, + graphemeInfo, numOfSpaces = 0, lineBounds = new Array(line.length); + + this.__charBounds[lineIndex] = lineBounds; + for (i = 0; i < line.length; i++) { + grapheme = line[i]; + graphemeInfo = this._getGraphemeBox(grapheme, lineIndex, i, prevGrapheme); + lineBounds[i] = graphemeInfo; + width += graphemeInfo.kernedWidth; + prevGrapheme = grapheme; + } + // this latest bound box represent the last character of the line + // to simplify cursor handling in interactive mode. + lineBounds[i] = { + left: graphemeInfo ? graphemeInfo.left + graphemeInfo.width : 0, + width: 0, + kernedWidth: 0, + height: this.fontSize + }; + return { width: width, numOfSpaces: numOfSpaces }; + }, + + /** + * Measure and return the info of a single grapheme. + * needs the the info of previous graphemes already filled + * @private + * @param {String} grapheme to be measured + * @param {Number} lineIndex index of the line where the char is + * @param {Number} charIndex position in the line + * @param {String} [prevGrapheme] character preceding the one to be measured + */ + _getGraphemeBox: function(grapheme, lineIndex, charIndex, prevGrapheme, skipLeft) { + var style = this.getCompleteStyleDeclaration(lineIndex, charIndex), + prevStyle = prevGrapheme ? this.getCompleteStyleDeclaration(lineIndex, charIndex - 1) : { }, + info = this._measureChar(grapheme, style, prevGrapheme, prevStyle), + kernedWidth = info.kernedWidth, + width = info.width, charSpacing; + + if (this.charSpacing !== 0) { + charSpacing = this._getWidthOfCharSpacing(); + width += charSpacing; + kernedWidth += charSpacing; + } + + var box = { + width: width, + left: 0, + height: style.fontSize, + kernedWidth: kernedWidth, + deltaY: style.deltaY, + }; + if (charIndex > 0 && !skipLeft) { + var previousBox = this.__charBounds[lineIndex][charIndex - 1]; + box.left = previousBox.left + previousBox.width + info.kernedWidth - info.width; + } + return box; + }, + + /** + * Calculate height of line at 'lineIndex' + * @param {Number} lineIndex index of line to calculate + * @return {Number} + */ + getHeightOfLine: function(lineIndex) { + if (this.__lineHeights[lineIndex]) { + return this.__lineHeights[lineIndex]; + } + + var line = this._textLines[lineIndex], + // char 0 is measured before the line cycle because it nneds to char + // emptylines + maxHeight = this.getHeightOfChar(lineIndex, 0); + for (var i = 1, len = line.length; i < len; i++) { + maxHeight = Math.max(this.getHeightOfChar(lineIndex, i), maxHeight); + } + + return this.__lineHeights[lineIndex] = maxHeight * this.lineHeight * this._fontSizeMult; + }, + + /** + * Calculate text box height + */ + calcTextHeight: function() { + var lineHeight, height = 0; + for (var i = 0, len = this._textLines.length; i < len; i++) { + lineHeight = this.getHeightOfLine(i); + height += (i === len - 1 ? lineHeight / this.lineHeight : lineHeight); + } + return height; + }, + + /** + * @private + * @return {Number} Left offset + */ + _getLeftOffset: function() { + return -this.width / 2; + }, + + /** + * @private + * @return {Number} Top offset + */ + _getTopOffset: function() { + return -this.height / 2; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} method Method name ("fillText" or "strokeText") + */ + _renderTextCommon: function(ctx, method) { + ctx.save(); + var lineHeights = 0, left = this._getLeftOffset(), top = this._getTopOffset(), + offsets = this._applyPatternGradientTransform(ctx, method === 'fillText' ? this.fill : this.stroke); + for (var i = 0, len = this._textLines.length; i < len; i++) { + var heightOfLine = this.getHeightOfLine(i), + maxHeight = heightOfLine / this.lineHeight, + leftOffset = this._getLineLeftOffset(i); + this._renderTextLine( + method, + ctx, + this._textLines[i], + left + leftOffset - offsets.offsetX, + top + lineHeights + maxHeight - offsets.offsetY, + i + ); + lineHeights += heightOfLine; + } + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextFill: function(ctx) { + if (!this.fill && !this.styleHas('fill')) { + return; + } + + this._renderTextCommon(ctx, 'fillText'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextStroke: function(ctx) { + if ((!this.stroke || this.strokeWidth === 0) && this.isEmptyStyles()) { + return; + } + + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + + ctx.save(); + this._setLineDash(ctx, this.strokeDashArray); + ctx.beginPath(); + this._renderTextCommon(ctx, 'strokeText'); + ctx.closePath(); + ctx.restore(); + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Content of the line + * @param {Number} left + * @param {Number} top + * @param {Number} lineIndex + * @param {Number} charOffset + */ + _renderChars: function(method, ctx, line, left, top, lineIndex) { + // set proper line offset + var lineHeight = this.getHeightOfLine(lineIndex), + isJustify = this.textAlign.indexOf('justify') !== -1, + actualStyle, + nextStyle, + charsToRender = '', + charBox, + boxWidth = 0, + timeToRender, + shortCut = !isJustify && this.charSpacing === 0 && this.isEmptyStyles(lineIndex); + + ctx.save(); + top -= lineHeight * this._fontSizeFraction / this.lineHeight; + if (shortCut) { + // render all the line in one pass without checking + this._renderChar(method, ctx, lineIndex, 0, this.textLines[lineIndex], left, top, lineHeight); + ctx.restore(); + return; + } + for (var i = 0, len = line.length - 1; i <= len; i++) { + timeToRender = i === len || this.charSpacing; + charsToRender += line[i]; + charBox = this.__charBounds[lineIndex][i]; + if (boxWidth === 0) { + left += charBox.kernedWidth - charBox.width; + boxWidth += charBox.width; + } + else { + boxWidth += charBox.kernedWidth; + } + if (isJustify && !timeToRender) { + if (this._reSpaceAndTab.test(line[i])) { + timeToRender = true; + } + } + if (!timeToRender) { + // if we have charSpacing, we render char by char + actualStyle = actualStyle || this.getCompleteStyleDeclaration(lineIndex, i); + nextStyle = this.getCompleteStyleDeclaration(lineIndex, i + 1); + timeToRender = this._hasStyleChanged(actualStyle, nextStyle); + } + if (timeToRender) { + this._renderChar(method, ctx, lineIndex, i, charsToRender, left, top, lineHeight); + charsToRender = ''; + actualStyle = nextStyle; + left += boxWidth; + boxWidth = 0; + } + } + ctx.restore(); + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {String} _char + * @param {Number} left Left coordinate + * @param {Number} top Top coordinate + * @param {Number} lineHeight Height of the line + */ + _renderChar: function(method, ctx, lineIndex, charIndex, _char, left, top) { + var decl = this._getStyleDeclaration(lineIndex, charIndex), + fullDecl = this.getCompleteStyleDeclaration(lineIndex, charIndex), + shouldFill = method === 'fillText' && fullDecl.fill, + shouldStroke = method === 'strokeText' && fullDecl.stroke && fullDecl.strokeWidth; + + if (!shouldStroke && !shouldFill) { + return; + } + decl && ctx.save(); + + this._applyCharStyles(method, ctx, lineIndex, charIndex, fullDecl); + + if (decl && decl.textBackgroundColor) { + this._removeShadow(ctx); + } + if (decl && decl.deltaY) { + top += decl.deltaY; + } + + shouldFill && ctx.fillText(_char, left, top); + shouldStroke && ctx.strokeText(_char, left, top); + decl && ctx.restore(); + }, + + /** + * Turns the character into a 'superior figure' (i.e. 'superscript') + * @param {Number} start selection start + * @param {Number} end selection end + * @returns {fabric.Text} thisArg + * @chainable + */ + setSuperscript: function(start, end) { + return this._setScript(start, end, this.superscript); + }, + + /** + * Turns the character into an 'inferior figure' (i.e. 'subscript') + * @param {Number} start selection start + * @param {Number} end selection end + * @returns {fabric.Text} thisArg + * @chainable + */ + setSubscript: function(start, end) { + return this._setScript(start, end, this.subscript); + }, + + /** + * Applies 'schema' at given position + * @private + * @param {Number} start selection start + * @param {Number} end selection end + * @param {Number} schema + * @returns {fabric.Text} thisArg + * @chainable + */ + _setScript: function(start, end, schema) { + var loc = this.get2DCursorLocation(start, true), + fontSize = this.getValueOfPropertyAt(loc.lineIndex, loc.charIndex, 'fontSize'), + dy = this.getValueOfPropertyAt(loc.lineIndex, loc.charIndex, 'deltaY'), + style = { fontSize: fontSize * schema.size, deltaY: dy + fontSize * schema.baseline }; + this.setSelectionStyles(style, start, end); + return this; + }, + + /** + * @private + * @param {Object} prevStyle + * @param {Object} thisStyle + */ + _hasStyleChanged: function(prevStyle, thisStyle) { + return prevStyle.fill !== thisStyle.fill || + prevStyle.stroke !== thisStyle.stroke || + prevStyle.strokeWidth !== thisStyle.strokeWidth || + prevStyle.fontSize !== thisStyle.fontSize || + prevStyle.fontFamily !== thisStyle.fontFamily || + prevStyle.fontWeight !== thisStyle.fontWeight || + prevStyle.fontStyle !== thisStyle.fontStyle || + prevStyle.deltaY !== thisStyle.deltaY; + }, + + /** + * @private + * @param {Object} prevStyle + * @param {Object} thisStyle + */ + _hasStyleChangedForSvg: function(prevStyle, thisStyle) { + return this._hasStyleChanged(prevStyle, thisStyle) || + prevStyle.overline !== thisStyle.overline || + prevStyle.underline !== thisStyle.underline || + prevStyle.linethrough !== thisStyle.linethrough; + }, + + /** + * @private + * @param {Number} lineIndex index text line + * @return {Number} Line left offset + */ + _getLineLeftOffset: function(lineIndex) { + var lineWidth = this.getLineWidth(lineIndex); + if (this.textAlign === 'center') { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === 'right') { + return this.width - lineWidth; + } + if (this.textAlign === 'justify-center' && this.isEndOfWrapping(lineIndex)) { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === 'justify-right' && this.isEndOfWrapping(lineIndex)) { + return this.width - lineWidth; + } + return 0; + }, + + /** + * @private + */ + _clearCache: function() { + this.__lineWidths = []; + this.__lineHeights = []; + this.__charBounds = []; + }, + + /** + * @private + */ + _shouldClearDimensionCache: function() { + var shouldClear = this._forceClearCache; + shouldClear || (shouldClear = this.hasStateChanged('_dimensionAffectingProps')); + if (shouldClear) { + this.dirty = true; + this._forceClearCache = false; + } + return shouldClear; + }, + + /** + * Measure a single line given its index. Used to calculate the initial + * text bounding box. The values are calculated and stored in __lineWidths cache. + * @private + * @param {Number} lineIndex line number + * @return {Number} Line width + */ + getLineWidth: function(lineIndex) { + if (this.__lineWidths[lineIndex]) { + return this.__lineWidths[lineIndex]; + } + + var width, line = this._textLines[lineIndex], lineInfo; + + if (line === '') { + width = 0; + } + else { + lineInfo = this.measureLine(lineIndex); + width = lineInfo.width; + } + this.__lineWidths[lineIndex] = width; + return width; + }, + + _getWidthOfCharSpacing: function() { + if (this.charSpacing !== 0) { + return this.fontSize * this.charSpacing / 1000; + } + return 0; + }, + + /** + * Retrieves the value of property at given character position + * @param {Number} lineIndex the line number + * @param {Number} charIndex the charater number + * @param {String} property the property name + * @returns the value of 'property' + */ + getValueOfPropertyAt: function(lineIndex, charIndex, property) { + var charStyle = this._getStyleDeclaration(lineIndex, charIndex); + if (charStyle && typeof charStyle[property] !== 'undefined') { + return charStyle[property]; + } + return this[property]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextDecoration: function(ctx, type) { + if (!this[type] && !this.styleHas(type)) { + return; + } + var heightOfLine, size, _size, + lineLeftOffset, dy, _dy, + line, lastDecoration, + leftOffset = this._getLeftOffset(), + topOffset = this._getTopOffset(), top, + boxStart, boxWidth, charBox, currentDecoration, + maxHeight, currentFill, lastFill, + charSpacing = this._getWidthOfCharSpacing(); + + for (var i = 0, len = this._textLines.length; i < len; i++) { + heightOfLine = this.getHeightOfLine(i); + if (!this[type] && !this.styleHas(type, i)) { + topOffset += heightOfLine; + continue; + } + line = this._textLines[i]; + maxHeight = heightOfLine / this.lineHeight; + lineLeftOffset = this._getLineLeftOffset(i); + boxStart = 0; + boxWidth = 0; + lastDecoration = this.getValueOfPropertyAt(i, 0, type); + lastFill = this.getValueOfPropertyAt(i, 0, 'fill'); + top = topOffset + maxHeight * (1 - this._fontSizeFraction); + size = this.getHeightOfChar(i, 0); + dy = this.getValueOfPropertyAt(i, 0, 'deltaY'); + for (var j = 0, jlen = line.length; j < jlen; j++) { + charBox = this.__charBounds[i][j]; + currentDecoration = this.getValueOfPropertyAt(i, j, type); + currentFill = this.getValueOfPropertyAt(i, j, 'fill'); + _size = this.getHeightOfChar(i, j); + _dy = this.getValueOfPropertyAt(i, j, 'deltaY'); + if ((currentDecoration !== lastDecoration || currentFill !== lastFill || _size !== size || _dy !== dy) && + boxWidth > 0) { + ctx.fillStyle = lastFill; + lastDecoration && lastFill && ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + top + this.offsets[type] * size + dy, + boxWidth, + this.fontSize / 15 + ); + boxStart = charBox.left; + boxWidth = charBox.width; + lastDecoration = currentDecoration; + lastFill = currentFill; + size = _size; + dy = _dy; + } + else { + boxWidth += charBox.kernedWidth; + } + } + ctx.fillStyle = currentFill; + currentDecoration && currentFill && ctx.fillRect( + leftOffset + lineLeftOffset + boxStart, + top + this.offsets[type] * size + dy, + boxWidth - charSpacing, + this.fontSize / 15 + ); + topOffset += heightOfLine; + } + // if there is text background color no + // other shadows should be casted + this._removeShadow(ctx); + }, + + /** + * return font declaration string for canvas context + * @param {Object} [styleObject] object + * @returns {String} font declaration formatted for canvas context. + */ + _getFontDeclaration: function(styleObject, forMeasuring) { + var style = styleObject || this, family = this.fontFamily, + fontIsGeneric = fabric.Text.genericFonts.indexOf(family.toLowerCase()) > -1; + var fontFamily = family === undefined || + family.indexOf('\'') > -1 || family.indexOf(',') > -1 || + family.indexOf('"') > -1 || fontIsGeneric + ? style.fontFamily : '"' + style.fontFamily + '"'; + return [ + // node-canvas needs "weight style", while browsers need "style weight" + // verify if this can be fixed in JSDOM + (fabric.isLikelyNode ? style.fontWeight : style.fontStyle), + (fabric.isLikelyNode ? style.fontStyle : style.fontWeight), + forMeasuring ? this.CACHE_FONT_SIZE + 'px' : style.fontSize + 'px', + fontFamily + ].join(' '); + }, + + /** + * Renders text instance on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } + if (this.canvas && this.canvas.skipOffscreen && !this.group && !this.isOnScreen()) { + return; + } + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + } + this.callSuper('render', ctx); + }, + + /** + * Returns the text as an array of lines. + * @param {String} text text to split + * @returns {Array} Lines in the text + */ + _splitTextIntoLines: function(text) { + var lines = text.split(this._reNewline), + newLines = new Array(lines.length), + newLine = ['\n'], + newText = []; + for (var i = 0; i < lines.length; i++) { + newLines[i] = fabric.util.string.graphemeSplit(lines[i]); + newText = newText.concat(newLines[i], newLine); + } + newText.pop(); + return { _unwrappedLines: newLines, lines: lines, graphemeText: newText, graphemeLines: newLines }; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var additionalProperties = [ + 'text', + 'fontSize', + 'fontWeight', + 'fontFamily', + 'fontStyle', + 'lineHeight', + 'underline', + 'overline', + 'linethrough', + 'textAlign', + 'textBackgroundColor', + 'charSpacing', + ].concat(propertiesToInclude); + var obj = this.callSuper('toObject', additionalProperties); + obj.styles = clone(this.styles, true); + return obj; + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + this.callSuper('set', key, value); + var needsDims = false; + if (typeof key === 'object') { + for (var _key in key) { + needsDims = needsDims || this._dimensionAffectingProps.indexOf(_key) !== -1; + } + } + else { + needsDims = this._dimensionAffectingProps.indexOf(key) !== -1; + } + if (needsDims) { + this.initDimensions(); + this.setCoords(); + } + return this; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Text.fromElement}) + * @static + * @memberOf fabric.Text + * @see: http://www.w3.org/TR/SVG/text.html#TextElement + */ + fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat( + 'x y dx dy font-family font-style font-weight font-size letter-spacing text-decoration text-anchor'.split(' ')); + + /** + * Default SVG font size + * @static + * @memberOf fabric.Text + */ + fabric.Text.DEFAULT_SVG_FONT_SIZE = 16; + + /** + * Returns fabric.Text instance from an SVG element (not yet implemented) + * @static + * @memberOf fabric.Text + * @param {SVGElement} element Element to parse + * @param {Function} callback callback function invoked after parsing + * @param {Object} [options] Options object + */ + fabric.Text.fromElement = function(element, callback, options) { + if (!element) { + return callback(null); + } + + var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES), + parsedAnchor = parsedAttributes.textAnchor || 'left'; + options = fabric.util.object.extend((options ? clone(options) : { }), parsedAttributes); + + options.top = options.top || 0; + options.left = options.left || 0; + if (parsedAttributes.textDecoration) { + var textDecoration = parsedAttributes.textDecoration; + if (textDecoration.indexOf('underline') !== -1) { + options.underline = true; + } + if (textDecoration.indexOf('overline') !== -1) { + options.overline = true; + } + if (textDecoration.indexOf('line-through') !== -1) { + options.linethrough = true; + } + delete options.textDecoration; + } + if ('dx' in parsedAttributes) { + options.left += parsedAttributes.dx; + } + if ('dy' in parsedAttributes) { + options.top += parsedAttributes.dy; + } + if (!('fontSize' in options)) { + options.fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + + var textContent = ''; + + // The XML is not properly parsed in IE9 so a workaround to get + // textContent is through firstChild.data. Another workaround would be + // to convert XML loaded from a file to be converted using DOMParser (same way loadSVGFromString() does) + if (!('textContent' in element)) { + if ('firstChild' in element && element.firstChild !== null) { + if ('data' in element.firstChild && element.firstChild.data !== null) { + textContent = element.firstChild.data; + } + } + } + else { + textContent = element.textContent; + } + + textContent = textContent.replace(/^\s+|\s+$|\n+/g, '').replace(/\s+/g, ' '); + var originalStrokeWidth = options.strokeWidth; + options.strokeWidth = 0; + + var text = new fabric.Text(textContent, options), + textHeightScaleFactor = text.getScaledHeight() / text.height, + lineHeightDiff = (text.height + text.strokeWidth) * text.lineHeight - text.height, + scaledDiff = lineHeightDiff * textHeightScaleFactor, + textHeight = text.getScaledHeight() + scaledDiff, + offX = 0; + /* + Adjust positioning: + x/y attributes in SVG correspond to the bottom-left corner of text bounding box + fabric output by default at top, left. + */ + if (parsedAnchor === 'center') { + offX = text.getScaledWidth() / 2; + } + if (parsedAnchor === 'right') { + offX = text.getScaledWidth(); + } + text.set({ + left: text.left - offX, + top: text.top - (textHeight - text.fontSize * (0.07 + text._fontSizeFraction)) / text.lineHeight, + strokeWidth: typeof originalStrokeWidth !== 'undefined' ? originalStrokeWidth : 1, + }); + callback(text); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Text instance from an object representation + * @static + * @memberOf fabric.Text + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Text instance is created + */ + fabric.Text.fromObject = function(object, callback) { + return fabric.Object._fromObject('Text', object, callback, 'text'); + }; + + fabric.Text.genericFonts = ['sans-serif', 'serif', 'cursive', 'fantasy', 'monospace']; + + fabric.util.createAccessors && fabric.util.createAccessors(fabric.Text); + +})(typeof exports !== 'undefined' ? exports : this); +(function() { + fabric.util.object.extend(fabric.Text.prototype, /** @lends fabric.Text.prototype */ { + /** + * Returns true if object has no styling or no styling in a line + * @param {Number} lineIndex , lineIndex is on wrapped lines. + * @return {Boolean} + */ + isEmptyStyles: function(lineIndex) { + if (!this.styles) { + return true; + } + if (typeof lineIndex !== 'undefined' && !this.styles[lineIndex]) { + return true; + } + var obj = typeof lineIndex === 'undefined' ? this.styles : { line: this.styles[lineIndex] }; + for (var p1 in obj) { + for (var p2 in obj[p1]) { + // eslint-disable-next-line no-unused-vars + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + return true; + }, + + /** + * Returns true if object has a style property or has it ina specified line + * This function is used to detect if a text will use a particular property or not. + * @param {String} property to check for + * @param {Number} lineIndex to check the style on + * @return {Boolean} + */ + styleHas: function(property, lineIndex) { + if (!this.styles || !property || property === '') { + return false; + } + if (typeof lineIndex !== 'undefined' && !this.styles[lineIndex]) { + return false; + } + var obj = typeof lineIndex === 'undefined' ? this.styles : { 0: this.styles[lineIndex] }; + // eslint-disable-next-line + for (var p1 in obj) { + // eslint-disable-next-line + for (var p2 in obj[p1]) { + if (typeof obj[p1][p2][property] !== 'undefined') { + return true; + } + } + } + return false; + }, + + /** + * Check if characters in a text have a value for a property + * whose value matches the textbox's value for that property. If so, + * the character-level property is deleted. If the character + * has no other properties, then it is also deleted. Finally, + * if the line containing that character has no other characters + * then it also is deleted. + * + * @param {string} property The property to compare between characters and text. + */ + cleanStyle: function(property) { + if (!this.styles || !property || property === '') { + return false; + } + var obj = this.styles, stylesCount = 0, letterCount, stylePropertyValue, + allStyleObjectPropertiesMatch = true, graphemeCount = 0, styleObject; + // eslint-disable-next-line + for (var p1 in obj) { + letterCount = 0; + // eslint-disable-next-line + for (var p2 in obj[p1]) { + var styleObject = obj[p1][p2], + stylePropertyHasBeenSet = styleObject.hasOwnProperty(property); + + stylesCount++; + + if (stylePropertyHasBeenSet) { + if (!stylePropertyValue) { + stylePropertyValue = styleObject[property]; + } + else if (styleObject[property] !== stylePropertyValue) { + allStyleObjectPropertiesMatch = false; + } + + if (styleObject[property] === this[property]) { + delete styleObject[property]; + } + } + else { + allStyleObjectPropertiesMatch = false; + } + + if (Object.keys(styleObject).length !== 0) { + letterCount++; + } + else { + delete obj[p1][p2]; + } + } + + if (letterCount === 0) { + delete obj[p1]; + } + } + // if every grapheme has the same style set then + // delete those styles and set it on the parent + for (var i = 0; i < this._textLines.length; i++) { + graphemeCount += this._textLines[i].length; + } + if (allStyleObjectPropertiesMatch && stylesCount === graphemeCount) { + this[property] = stylePropertyValue; + this.removeStyle(property); + } + }, + + /** + * Remove a style property or properties from all individual character styles + * in a text object. Deletes the character style object if it contains no other style + * props. Deletes a line style object if it contains no other character styles. + * + * @param {String} props The property to remove from character styles. + */ + removeStyle: function(property) { + if (!this.styles || !property || property === '') { + return; + } + var obj = this.styles, line, lineNum, charNum; + for (lineNum in obj) { + line = obj[lineNum]; + for (charNum in line) { + delete line[charNum][property]; + if (Object.keys(line[charNum]).length === 0) { + delete line[charNum]; + } + } + if (Object.keys(line).length === 0) { + delete obj[lineNum]; + } + } + }, + + /** + * @private + */ + _extendStyles: function(index, styles) { + var loc = this.get2DCursorLocation(index); + + if (!this._getLineStyle(loc.lineIndex)) { + this._setLineStyle(loc.lineIndex); + } + + if (!this._getStyleDeclaration(loc.lineIndex, loc.charIndex)) { + this._setStyleDeclaration(loc.lineIndex, loc.charIndex, {}); + } + + fabric.util.object.extend(this._getStyleDeclaration(loc.lineIndex, loc.charIndex), styles); + }, + + /** + * Returns 2d representation (lineIndex and charIndex) of cursor (or selection start) + * @param {Number} [selectionStart] Optional index. When not given, current selectionStart is used. + * @param {Boolean} [skipWrapping] consider the location for unwrapped lines. usefull to manage styles. + */ + get2DCursorLocation: function(selectionStart, skipWrapping) { + if (typeof selectionStart === 'undefined') { + selectionStart = this.selectionStart; + } + var lines = skipWrapping ? this._unwrappedTextLines : this._textLines, + len = lines.length; + for (var i = 0; i < len; i++) { + if (selectionStart <= lines[i].length) { + return { + lineIndex: i, + charIndex: selectionStart + }; + } + selectionStart -= lines[i].length + this.missingNewlineOffset(i); + } + return { + lineIndex: i - 1, + charIndex: lines[i - 1].length < selectionStart ? lines[i - 1].length : selectionStart + }; + }, + + /** + * Gets style of a current selection/cursor (at the start position) + * if startIndex or endIndex are not provided, slectionStart or selectionEnd will be used. + * @param {Number} [startIndex] Start index to get styles at + * @param {Number} [endIndex] End index to get styles at, if not specified selectionEnd or startIndex + 1 + * @param {Boolean} [complete] get full style or not + * @return {Array} styles an array with one, zero or more Style objects + */ + getSelectionStyles: function(startIndex, endIndex, complete) { + if (typeof startIndex === 'undefined') { + startIndex = this.selectionStart || 0; + } + if (typeof endIndex === 'undefined') { + endIndex = this.selectionEnd || startIndex; + } + var styles = []; + for (var i = startIndex; i < endIndex; i++) { + styles.push(this.getStyleAtPosition(i, complete)); + } + return styles; + }, + + /** + * Gets style of a current selection/cursor position + * @param {Number} position to get styles at + * @param {Boolean} [complete] full style if true + * @return {Object} style Style object at a specified index + * @private + */ + getStyleAtPosition: function(position, complete) { + var loc = this.get2DCursorLocation(position), + style = complete ? this.getCompleteStyleDeclaration(loc.lineIndex, loc.charIndex) : + this._getStyleDeclaration(loc.lineIndex, loc.charIndex); + return style || {}; + }, + + /** + * Sets style of a current selection, if no selection exist, do not set anything. + * @param {Object} [styles] Styles object + * @param {Number} [startIndex] Start index to get styles at + * @param {Number} [endIndex] End index to get styles at, if not specified selectionEnd or startIndex + 1 + * @return {fabric.IText} thisArg + * @chainable + */ + setSelectionStyles: function(styles, startIndex, endIndex) { + if (typeof startIndex === 'undefined') { + startIndex = this.selectionStart || 0; + } + if (typeof endIndex === 'undefined') { + endIndex = this.selectionEnd || startIndex; + } + for (var i = startIndex; i < endIndex; i++) { + this._extendStyles(i, styles); + } + /* not included in _extendStyles to avoid clearing cache more than once */ + this._forceClearCache = true; + return this; + }, + + /** + * get the reference, not a clone, of the style object for a given character + * @param {Number} lineIndex + * @param {Number} charIndex + * @return {Object} style object + */ + _getStyleDeclaration: function(lineIndex, charIndex) { + var lineStyle = this.styles && this.styles[lineIndex]; + if (!lineStyle) { + return null; + } + return lineStyle[charIndex]; + }, + + /** + * return a new object that contains all the style property for a character + * the object returned is newly created + * @param {Number} lineIndex of the line where the character is + * @param {Number} charIndex position of the character on the line + * @return {Object} style object + */ + getCompleteStyleDeclaration: function(lineIndex, charIndex) { + var style = this._getStyleDeclaration(lineIndex, charIndex) || { }, + styleObject = { }, prop; + for (var i = 0; i < this._styleProperties.length; i++) { + prop = this._styleProperties[i]; + styleObject[prop] = typeof style[prop] === 'undefined' ? this[prop] : style[prop]; + } + return styleObject; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} style + * @private + */ + _setStyleDeclaration: function(lineIndex, charIndex, style) { + this.styles[lineIndex][charIndex] = style; + }, + + /** + * + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _deleteStyleDeclaration: function(lineIndex, charIndex) { + delete this.styles[lineIndex][charIndex]; + }, + + /** + * @param {Number} lineIndex + * @return {Boolean} if the line exists or not + * @private + */ + _getLineStyle: function(lineIndex) { + return !!this.styles[lineIndex]; + }, + + /** + * Set the line style to an empty object so that is initialized + * @param {Number} lineIndex + * @private + */ + _setLineStyle: function(lineIndex) { + this.styles[lineIndex] = {}; + }, + + /** + * @param {Number} lineIndex + * @private + */ + _deleteLineStyle: function(lineIndex) { + delete this.styles[lineIndex]; + } + }); +})(); +(function() { + + function parseDecoration(object) { + if (object.textDecoration) { + object.textDecoration.indexOf('underline') > -1 && (object.underline = true); + object.textDecoration.indexOf('line-through') > -1 && (object.linethrough = true); + object.textDecoration.indexOf('overline') > -1 && (object.overline = true); + delete object.textDecoration; + } + } + + /** + * IText class (introduced in v1.4) Events are also fired with "text:" + * prefix when observing canvas. + * @class fabric.IText + * @extends fabric.Text + * @mixes fabric.Observable + * + * @fires changed + * @fires selection:changed + * @fires editing:entered + * @fires editing:exited + * + * @return {fabric.IText} thisArg + * @see {@link fabric.IText#initialize} for constructor definition + * + *

Supported key combinations:

+ *
+   *   Move cursor:                    left, right, up, down
+   *   Select character:               shift + left, shift + right
+   *   Select text vertically:         shift + up, shift + down
+   *   Move cursor by word:            alt + left, alt + right
+   *   Select words:                   shift + alt + left, shift + alt + right
+   *   Move cursor to line start/end:  cmd + left, cmd + right or home, end
+   *   Select till start/end of line:  cmd + shift + left, cmd + shift + right or shift + home, shift + end
+   *   Jump to start/end of text:      cmd + up, cmd + down
+   *   Select till start/end of text:  cmd + shift + up, cmd + shift + down or shift + pgUp, shift + pgDown
+   *   Delete character:               backspace
+   *   Delete word:                    alt + backspace
+   *   Delete line:                    cmd + backspace
+   *   Forward delete:                 delete
+   *   Copy text:                      ctrl/cmd + c
+   *   Paste text:                     ctrl/cmd + v
+   *   Cut text:                       ctrl/cmd + x
+   *   Select entire text:             ctrl/cmd + a
+   *   Quit editing                    tab or esc
+   * 
+ * + *

Supported mouse/touch combination

+ *
+   *   Position cursor:                click/touch
+   *   Create selection:               click/touch & drag
+   *   Create selection:               click & shift + click
+   *   Select word:                    double click
+   *   Select line:                    triple click
+   * 
+ */ + fabric.IText = fabric.util.createClass(fabric.Text, fabric.Observable, /** @lends fabric.IText.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'i-text', + + /** + * Index where text selection starts (or where cursor is when there is no selection) + * @type Number + * @default + */ + selectionStart: 0, + + /** + * Index where text selection ends + * @type Number + * @default + */ + selectionEnd: 0, + + /** + * Color of text selection + * @type String + * @default + */ + selectionColor: 'rgba(17,119,255,0.3)', + + /** + * Indicates whether text is in editing mode + * @type Boolean + * @default + */ + isEditing: false, + + /** + * Indicates whether a text can be edited + * @type Boolean + * @default + */ + editable: true, + + /** + * Border color of text object while it's in editing mode + * @type String + * @default + */ + editingBorderColor: 'rgba(102,153,255,0.25)', + + /** + * Width of cursor (in px) + * @type Number + * @default + */ + cursorWidth: 2, + + /** + * Color of default cursor (when not overwritten by character style) + * @type String + * @default + */ + cursorColor: '#333', + + /** + * Delay between cursor blink (in ms) + * @type Number + * @default + */ + cursorDelay: 1000, + + /** + * Duration of cursor fadein (in ms) + * @type Number + * @default + */ + cursorDuration: 600, + + /** + * Indicates whether internal text char widths can be cached + * @type Boolean + * @default + */ + caching: true, + + /** + * @private + */ + _reSpace: /\s|\n/, + + /** + * @private + */ + _currentCursorOpacity: 0, + + /** + * @private + */ + _selectionDirection: null, + + /** + * @private + */ + _abortCursorAnimation: false, + + /** + * @private + */ + __widthOfSpace: [], + + /** + * Helps determining when the text is in composition, so that the cursor + * rendering is altered. + */ + inCompositionMode: false, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.IText} thisArg + */ + initialize: function(text, options) { + this.callSuper('initialize', text, options); + this.initBehavior(); + }, + + /** + * Sets selection start (left boundary of a selection) + * @param {Number} index Index to set selection start to + */ + setSelectionStart: function(index) { + index = Math.max(index, 0); + this._updateAndFire('selectionStart', index); + }, + + /** + * Sets selection end (right boundary of a selection) + * @param {Number} index Index to set selection end to + */ + setSelectionEnd: function(index) { + index = Math.min(index, this.text.length); + this._updateAndFire('selectionEnd', index); + }, + + /** + * @private + * @param {String} property 'selectionStart' or 'selectionEnd' + * @param {Number} index new position of property + */ + _updateAndFire: function(property, index) { + if (this[property] !== index) { + this._fireSelectionChanged(); + this[property] = index; + } + this._updateTextarea(); + }, + + /** + * Fires the even of selection changed + * @private + */ + _fireSelectionChanged: function() { + this.fire('selection:changed'); + this.canvas && this.canvas.fire('text:selection:changed', { target: this }); + }, + + /** + * Initialize text dimensions. Render all text on given context + * or on a offscreen canvas to get the text width with measureText. + * Updates this.width and this.height with the proper values. + * Does not return dimensions. + * @private + */ + initDimensions: function() { + this.isEditing && this.initDelayedCursor(); + this.clearContextTop(); + this.callSuper('initDimensions'); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx) { + this.clearContextTop(); + this.callSuper('render', ctx); + // clear the cursorOffsetCache, so we ensure to calculate once per renderCursor + // the correct position but not at every cursor animation. + this.cursorOffsetCache = { }; + this.renderCursorOrSelection(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this.callSuper('_render', ctx); + }, + + /** + * Prepare and clean the contextTop + */ + clearContextTop: function(skipRestore) { + if (!this.isEditing || !this.canvas || !this.canvas.contextTop) { + return; + } + var ctx = this.canvas.contextTop, v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + this.transform(ctx); + this.transformMatrix && ctx.transform.apply(ctx, this.transformMatrix); + this._clearTextArea(ctx); + skipRestore || ctx.restore(); + }, + + /** + * Renders cursor or selection (depending on what exists) + * it does on the contextTop. If contextTop is not available, do nothing. + */ + renderCursorOrSelection: function() { + if (!this.isEditing || !this.canvas || !this.canvas.contextTop) { + return; + } + var boundaries = this._getCursorBoundaries(), + ctx = this.canvas.contextTop; + this.clearContextTop(true); + if (this.selectionStart === this.selectionEnd) { + this.renderCursor(boundaries, ctx); + } + else { + this.renderSelection(boundaries, ctx); + } + ctx.restore(); + }, + + _clearTextArea: function(ctx) { + // we add 4 pixel, to be sure to do not leave any pixel out + var width = this.width + 4, height = this.height + 4; + ctx.clearRect(-width / 2, -height / 2, width, height); + }, + + /** + * Returns cursor boundaries (left, top, leftOffset, topOffset) + * @private + * @param {Array} chars Array of characters + * @param {String} typeOfBoundaries + */ + _getCursorBoundaries: function(position) { + + // left/top are left/top of entire text box + // leftOffset/topOffset are offset from that left/top point of a text box + + if (typeof position === 'undefined') { + position = this.selectionStart; + } + + var left = this._getLeftOffset(), + top = this._getTopOffset(), + offsets = this._getCursorBoundariesOffsets(position); + + return { + left: left, + top: top, + leftOffset: offsets.left, + topOffset: offsets.top + }; + }, + + /** + * @private + */ + _getCursorBoundariesOffsets: function(position) { + if (this.cursorOffsetCache && 'top' in this.cursorOffsetCache) { + return this.cursorOffsetCache; + } + var lineLeftOffset, + lineIndex, + charIndex, + topOffset = 0, + leftOffset = 0, + boundaries, + cursorPosition = this.get2DCursorLocation(position); + charIndex = cursorPosition.charIndex; + lineIndex = cursorPosition.lineIndex; + for (var i = 0; i < lineIndex; i++) { + topOffset += this.getHeightOfLine(i); + } + lineLeftOffset = this._getLineLeftOffset(lineIndex); + var bound = this.__charBounds[lineIndex][charIndex]; + bound && (leftOffset = bound.left); + if (this.charSpacing !== 0 && charIndex === this._textLines[lineIndex].length) { + leftOffset -= this._getWidthOfCharSpacing(); + } + boundaries = { + top: topOffset, + left: lineLeftOffset + (leftOffset > 0 ? leftOffset : 0), + }; + this.cursorOffsetCache = boundaries; + return this.cursorOffsetCache; + }, + + /** + * Renders cursor + * @param {Object} boundaries + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderCursor: function(boundaries, ctx) { + var cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex > 0 ? cursorLocation.charIndex - 1 : 0, + charHeight = this.getValueOfPropertyAt(lineIndex, charIndex, 'fontSize'), + multiplier = this.scaleX * this.canvas.getZoom(), + cursorWidth = this.cursorWidth / multiplier, + topOffset = boundaries.topOffset, + dy = this.getValueOfPropertyAt(lineIndex, charIndex, 'deltaY'); + + topOffset += (1 - this._fontSizeFraction) * this.getHeightOfLine(lineIndex) / this.lineHeight + - charHeight * (1 - this._fontSizeFraction); + + if (this.inCompositionMode) { + this.renderSelection(boundaries, ctx); + } + + ctx.fillStyle = this.getValueOfPropertyAt(lineIndex, charIndex, 'fill'); + ctx.globalAlpha = this.__isMousedown ? 1 : this._currentCursorOpacity; + ctx.fillRect( + boundaries.left + boundaries.leftOffset - cursorWidth / 2, + topOffset + boundaries.top + dy, + cursorWidth, + charHeight); + }, + + /** + * Renders text selection + * @param {Object} boundaries Object with left/top/leftOffset/topOffset + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderSelection: function(boundaries, ctx) { + + var selectionStart = this.inCompositionMode ? this.hiddenTextarea.selectionStart : this.selectionStart, + selectionEnd = this.inCompositionMode ? this.hiddenTextarea.selectionEnd : this.selectionEnd, + isJustify = this.textAlign.indexOf('justify') !== -1, + start = this.get2DCursorLocation(selectionStart), + end = this.get2DCursorLocation(selectionEnd), + startLine = start.lineIndex, + endLine = end.lineIndex, + startChar = start.charIndex < 0 ? 0 : start.charIndex, + endChar = end.charIndex < 0 ? 0 : end.charIndex; + + for (var i = startLine; i <= endLine; i++) { + var lineOffset = this._getLineLeftOffset(i) || 0, + lineHeight = this.getHeightOfLine(i), + realLineHeight = 0, boxStart = 0, boxEnd = 0; + + if (i === startLine) { + boxStart = this.__charBounds[startLine][startChar].left; + } + if (i >= startLine && i < endLine) { + boxEnd = isJustify && !this.isEndOfWrapping(i) ? this.width : this.getLineWidth(i) || 5; // WTF is this 5? + } + else if (i === endLine) { + if (endChar === 0) { + boxEnd = this.__charBounds[endLine][endChar].left; + } + else { + var charSpacing = this._getWidthOfCharSpacing(); + boxEnd = this.__charBounds[endLine][endChar - 1].left + + this.__charBounds[endLine][endChar - 1].width - charSpacing; + } + } + realLineHeight = lineHeight; + if (this.lineHeight < 1 || (i === endLine && this.lineHeight > 1)) { + lineHeight /= this.lineHeight; + } + if (this.inCompositionMode) { + ctx.fillStyle = this.compositionColor || 'black'; + ctx.fillRect( + boundaries.left + lineOffset + boxStart, + boundaries.top + boundaries.topOffset + lineHeight, + boxEnd - boxStart, + 1); + } + else { + ctx.fillStyle = this.selectionColor; + ctx.fillRect( + boundaries.left + lineOffset + boxStart, + boundaries.top + boundaries.topOffset, + boxEnd - boxStart, + lineHeight); + } + + + boundaries.topOffset += realLineHeight; + } + }, + + /** + * High level function to know the height of the cursor. + * the currentChar is the one that precedes the cursor + * Returns fontSize of char at the current cursor + * @return {Number} Character font size + */ + getCurrentCharFontSize: function() { + var cp = this._getCurrentCharIndex(); + return this.getValueOfPropertyAt(cp.l, cp.c, 'fontSize'); + }, + + /** + * High level function to know the color of the cursor. + * the currentChar is the one that precedes the cursor + * Returns color (fill) of char at the current cursor + * @return {String} Character color (fill) + */ + getCurrentCharColor: function() { + var cp = this._getCurrentCharIndex(); + return this.getValueOfPropertyAt(cp.l, cp.c, 'fill'); + }, + + /** + * Returns the cursor position for the getCurrent.. functions + * @private + */ + _getCurrentCharIndex: function() { + var cursorPosition = this.get2DCursorLocation(this.selectionStart, true), + charIndex = cursorPosition.charIndex > 0 ? cursorPosition.charIndex - 1 : 0; + return { l: cursorPosition.lineIndex, c: charIndex }; + } + }); + + /** + * Returns fabric.IText instance from an object representation + * @static + * @memberOf fabric.IText + * @param {Object} object Object to create an instance from + * @param {function} [callback] invoked with new instance as argument + */ + fabric.IText.fromObject = function(object, callback) { + parseDecoration(object); + if (object.styles) { + for (var i in object.styles) { + for (var j in object.styles[i]) { + parseDecoration(object.styles[i][j]); + } + } + } + fabric.Object._fromObject('IText', object, callback, 'text'); + }; +})(); +(function() { + + var clone = fabric.util.object.clone; + + fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes all the interactive behavior of IText + */ + initBehavior: function() { + this.initAddedHandler(); + this.initRemovedHandler(); + this.initCursorSelectionHandlers(); + this.initDoubleClickSimulation(); + this.mouseMoveHandler = this.mouseMoveHandler.bind(this); + }, + + onDeselect: function() { + this.isEditing && this.exitEditing(); + this.selected = false; + }, + + /** + * Initializes "added" event handler + */ + initAddedHandler: function() { + var _this = this; + this.on('added', function() { + var canvas = _this.canvas; + if (canvas) { + if (!canvas._hasITextHandlers) { + canvas._hasITextHandlers = true; + _this._initCanvasHandlers(canvas); + } + canvas._iTextInstances = canvas._iTextInstances || []; + canvas._iTextInstances.push(_this); + } + }); + }, + + initRemovedHandler: function() { + var _this = this; + this.on('removed', function() { + var canvas = _this.canvas; + if (canvas) { + canvas._iTextInstances = canvas._iTextInstances || []; + fabric.util.removeFromArray(canvas._iTextInstances, _this); + if (canvas._iTextInstances.length === 0) { + canvas._hasITextHandlers = false; + _this._removeCanvasHandlers(canvas); + } + } + }); + }, + + /** + * register canvas event to manage exiting on other instances + * @private + */ + _initCanvasHandlers: function(canvas) { + canvas._mouseUpITextHandler = function() { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.__isMousedown = false; + }); + } + }; + canvas.on('mouse:up', canvas._mouseUpITextHandler); + }, + + /** + * remove canvas event to manage exiting on other instances + * @private + */ + _removeCanvasHandlers: function(canvas) { + canvas.off('mouse:up', canvas._mouseUpITextHandler); + }, + + /** + * @private + */ + _tick: function() { + this._currentTickState = this._animateCursor(this, 1, this.cursorDuration, '_onTickComplete'); + }, + + /** + * @private + */ + _animateCursor: function(obj, targetOpacity, duration, completeMethod) { + + var tickState; + + tickState = { + isAborted: false, + abort: function() { + this.isAborted = true; + }, + }; + + obj.animate('_currentCursorOpacity', targetOpacity, { + duration: duration, + onComplete: function() { + if (!tickState.isAborted) { + obj[completeMethod](); + } + }, + onChange: function() { + // we do not want to animate a selection, only cursor + if (obj.canvas && obj.selectionStart === obj.selectionEnd) { + obj.renderCursorOrSelection(); + } + }, + abort: function() { + return tickState.isAborted; + } + }); + return tickState; + }, + + /** + * @private + */ + _onTickComplete: function() { + + var _this = this; + + if (this._cursorTimeout1) { + clearTimeout(this._cursorTimeout1); + } + this._cursorTimeout1 = setTimeout(function() { + _this._currentTickCompleteState = _this._animateCursor(_this, 0, this.cursorDuration / 2, '_tick'); + }, 100); + }, + + /** + * Initializes delayed cursor + */ + initDelayedCursor: function(restart) { + var _this = this, + delay = restart ? 0 : this.cursorDelay; + + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this._cursorTimeout2 = setTimeout(function() { + _this._tick(); + }, delay); + }, + + /** + * Aborts cursor animation and clears all timeouts + */ + abortCursorAnimation: function() { + var shouldClear = this._currentTickState || this._currentTickCompleteState, + canvas = this.canvas; + this._currentTickState && this._currentTickState.abort(); + this._currentTickCompleteState && this._currentTickCompleteState.abort(); + + clearTimeout(this._cursorTimeout1); + clearTimeout(this._cursorTimeout2); + + this._currentCursorOpacity = 0; + // to clear just itext area we need to transform the context + // it may not be worth it + if (shouldClear && canvas) { + canvas.clearContext(canvas.contextTop || canvas.contextContainer); + } + + }, + + /** + * Selects entire text + * @return {fabric.IText} thisArg + * @chainable + */ + selectAll: function() { + this.selectionStart = 0; + this.selectionEnd = this._text.length; + this._fireSelectionChanged(); + this._updateTextarea(); + return this; + }, + + /** + * Returns selected text + * @return {String} + */ + getSelectedText: function() { + return this._text.slice(this.selectionStart, this.selectionEnd).join(''); + }, + + /** + * Find new selection index representing start of current word according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findWordBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + // remove space before cursor first + if (this._reSpace.test(this._text[index])) { + while (this._reSpace.test(this._text[index])) { + offset++; + index--; + } + } + while (/\S/.test(this._text[index]) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current word according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findWordBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + // remove space after cursor first + if (this._reSpace.test(this._text[index])) { + while (this._reSpace.test(this._text[index])) { + offset++; + index++; + } + } + while (/\S/.test(this._text[index]) && index < this._text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Find new selection index representing start of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + while (!/\n/.test(this._text[index]) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + while (!/\n/.test(this._text[index]) && index < this._text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Finds index corresponding to beginning or end of a word + * @param {Number} selectionStart Index of a character + * @param {Number} direction 1 or -1 + * @return {Number} Index of the beginning or end of a word + */ + searchWordBoundary: function(selectionStart, direction) { + var index = this._reSpace.test(this._text[selectionStart]) ? selectionStart - 1 : selectionStart, + _char = this._text[index], + reNonWord = /[ \n\.,;!\?\-]/; + + while (!reNonWord.test(_char) && index > 0 && index < this._text.length) { + index += direction; + _char = this._text[index]; + } + if (reNonWord.test(_char) && _char !== '\n') { + index += direction === 1 ? 0 : 1; + } + return index; + }, + + /** + * Selects a word based on the index + * @param {Number} selectionStart Index of a character + */ + selectWord: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.searchWordBoundary(selectionStart, -1), /* search backwards */ + newSelectionEnd = this.searchWordBoundary(selectionStart, 1); /* search forward */ + + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + }, + + /** + * Selects a line based on the index + * @param {Number} selectionStart Index of a character + * @return {fabric.IText} thisArg + * @chainable + */ + selectLine: function(selectionStart) { + selectionStart = selectionStart || this.selectionStart; + var newSelectionStart = this.findLineBoundaryLeft(selectionStart), + newSelectionEnd = this.findLineBoundaryRight(selectionStart); + + this.selectionStart = newSelectionStart; + this.selectionEnd = newSelectionEnd; + this._fireSelectionChanged(); + this._updateTextarea(); + return this; + }, + + /** + * Enters editing state + * @return {fabric.IText} thisArg + * @chainable + */ + enterEditing: function(e) { + if (this.isEditing || !this.editable) { + return; + } + + if (this.canvas) { + this.canvas.calcOffset(); + this.exitEditingOnOthers(this.canvas); + } + + this.isEditing = true; + + this.initHiddenTextarea(e); + this.hiddenTextarea.focus(); + this.hiddenTextarea.value = this.text; + this._updateTextarea(); + this._saveEditingProps(); + this._setEditingProps(); + this._textBeforeEdit = this.text; + + this._tick(); + this.fire('editing:entered'); + this._fireSelectionChanged(); + if (!this.canvas) { + return this; + } + this.canvas.fire('text:editing:entered', { target: this }); + this.initMouseMoveHandler(); + this.canvas.requestRenderAll(); + return this; + }, + + exitEditingOnOthers: function(canvas) { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.selected = false; + if (obj.isEditing) { + obj.exitEditing(); + } + }); + } + }, + + /** + * Initializes "mousemove" event handler + */ + initMouseMoveHandler: function() { + this.canvas.on('mouse:move', this.mouseMoveHandler); + }, + + /** + * @private + */ + mouseMoveHandler: function(options) { + if (!this.__isMousedown || !this.isEditing) { + return; + } + + var newSelectionStart = this.getSelectionStartFromPointer(options.e), + currentStart = this.selectionStart, + currentEnd = this.selectionEnd; + if ( + (newSelectionStart !== this.__selectionStartOnMouseDown || currentStart === currentEnd) + && + (currentStart === newSelectionStart || currentEnd === newSelectionStart) + ) { + return; + } + if (newSelectionStart > this.__selectionStartOnMouseDown) { + this.selectionStart = this.__selectionStartOnMouseDown; + this.selectionEnd = newSelectionStart; + } + else { + this.selectionStart = newSelectionStart; + this.selectionEnd = this.__selectionStartOnMouseDown; + } + if (this.selectionStart !== currentStart || this.selectionEnd !== currentEnd) { + this.restartCursorIfNeeded(); + this._fireSelectionChanged(); + this._updateTextarea(); + this.renderCursorOrSelection(); + } + }, + + /** + * @private + */ + _setEditingProps: function() { + this.hoverCursor = 'text'; + + if (this.canvas) { + this.canvas.defaultCursor = this.canvas.moveCursor = 'text'; + } + + this.borderColor = this.editingBorderColor; + this.hasControls = this.selectable = false; + this.lockMovementX = this.lockMovementY = true; + }, + + /** + * convert from textarea to grapheme indexes + */ + fromStringToGraphemeSelection: function(start, end, text) { + var smallerTextStart = text.slice(0, start), + graphemeStart = fabric.util.string.graphemeSplit(smallerTextStart).length; + if (start === end) { + return { selectionStart: graphemeStart, selectionEnd: graphemeStart }; + } + var smallerTextEnd = text.slice(start, end), + graphemeEnd = fabric.util.string.graphemeSplit(smallerTextEnd).length; + return { selectionStart: graphemeStart, selectionEnd: graphemeStart + graphemeEnd }; + }, + + /** + * convert from fabric to textarea values + */ + fromGraphemeToStringSelection: function(start, end, _text) { + var smallerTextStart = _text.slice(0, start), + graphemeStart = smallerTextStart.join('').length; + if (start === end) { + return { selectionStart: graphemeStart, selectionEnd: graphemeStart }; + } + var smallerTextEnd = _text.slice(start, end), + graphemeEnd = smallerTextEnd.join('').length; + return { selectionStart: graphemeStart, selectionEnd: graphemeStart + graphemeEnd }; + }, + + /** + * @private + */ + _updateTextarea: function() { + this.cursorOffsetCache = { }; + if (!this.hiddenTextarea) { + return; + } + if (!this.inCompositionMode) { + var newSelection = this.fromGraphemeToStringSelection(this.selectionStart, this.selectionEnd, this._text); + this.hiddenTextarea.selectionStart = newSelection.selectionStart; + this.hiddenTextarea.selectionEnd = newSelection.selectionEnd; + } + this.updateTextareaPosition(); + }, + + /** + * @private + */ + updateFromTextArea: function() { + if (!this.hiddenTextarea) { + return; + } + this.cursorOffsetCache = { }; + this.text = this.hiddenTextarea.value; + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + var newSelection = this.fromStringToGraphemeSelection( + this.hiddenTextarea.selectionStart, this.hiddenTextarea.selectionEnd, this.hiddenTextarea.value); + this.selectionEnd = this.selectionStart = newSelection.selectionEnd; + if (!this.inCompositionMode) { + this.selectionStart = newSelection.selectionStart; + } + this.updateTextareaPosition(); + }, + + /** + * @private + */ + updateTextareaPosition: function() { + if (this.selectionStart === this.selectionEnd) { + var style = this._calcTextareaPosition(); + this.hiddenTextarea.style.left = style.left; + this.hiddenTextarea.style.top = style.top; + } + }, + + /** + * @private + * @return {Object} style contains style for hiddenTextarea + */ + _calcTextareaPosition: function() { + if (!this.canvas) { + return { x: 1, y: 1 }; + } + var desiredPosition = this.inCompositionMode ? this.compositionStart : this.selectionStart, + boundaries = this._getCursorBoundaries(desiredPosition), + cursorLocation = this.get2DCursorLocation(desiredPosition), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex, + charHeight = this.getValueOfPropertyAt(lineIndex, charIndex, 'fontSize') * this.lineHeight, + leftOffset = boundaries.leftOffset, + m = this.calcTransformMatrix(), + p = { + x: boundaries.left + leftOffset, + y: boundaries.top + boundaries.topOffset + charHeight + }, + upperCanvas = this.canvas.upperCanvasEl, + upperCanvasWidth = upperCanvas.width, + upperCanvasHeight = upperCanvas.height, + maxWidth = upperCanvasWidth - charHeight, + maxHeight = upperCanvasHeight - charHeight, + scaleX = upperCanvas.clientWidth / upperCanvasWidth, + scaleY = upperCanvas.clientHeight / upperCanvasHeight; + + p = fabric.util.transformPoint(p, m); + p = fabric.util.transformPoint(p, this.canvas.viewportTransform); + p.x *= scaleX; + p.y *= scaleY; + if (p.x < 0) { + p.x = 0; + } + if (p.x > maxWidth) { + p.x = maxWidth; + } + if (p.y < 0) { + p.y = 0; + } + if (p.y > maxHeight) { + p.y = maxHeight; + } + + // add canvas offset on document + p.x += this.canvas._offset.left; + p.y += this.canvas._offset.top; + + return { left: p.x + 'px', top: p.y + 'px', fontSize: charHeight + 'px', charHeight: charHeight }; + }, + + /** + * @private + */ + _saveEditingProps: function() { + this._savedProps = { + hasControls: this.hasControls, + borderColor: this.borderColor, + lockMovementX: this.lockMovementX, + lockMovementY: this.lockMovementY, + hoverCursor: this.hoverCursor, + selectable: this.selectable, + defaultCursor: this.canvas && this.canvas.defaultCursor, + moveCursor: this.canvas && this.canvas.moveCursor + }; + }, + + /** + * @private + */ + _restoreEditingProps: function() { + if (!this._savedProps) { + return; + } + + this.hoverCursor = this._savedProps.hoverCursor; + this.hasControls = this._savedProps.hasControls; + this.borderColor = this._savedProps.borderColor; + this.selectable = this._savedProps.selectable; + this.lockMovementX = this._savedProps.lockMovementX; + this.lockMovementY = this._savedProps.lockMovementY; + + if (this.canvas) { + this.canvas.defaultCursor = this._savedProps.defaultCursor; + this.canvas.moveCursor = this._savedProps.moveCursor; + } + }, + + /** + * Exits from editing state + * @return {fabric.IText} thisArg + * @chainable + */ + exitEditing: function() { + var isTextChanged = (this._textBeforeEdit !== this.text); + this.selected = false; + this.isEditing = false; + + this.selectionEnd = this.selectionStart; + + if (this.hiddenTextarea) { + this.hiddenTextarea.blur && this.hiddenTextarea.blur(); + this.canvas && this.hiddenTextarea.parentNode.removeChild(this.hiddenTextarea); + this.hiddenTextarea = null; + } + + this.abortCursorAnimation(); + this._restoreEditingProps(); + this._currentCursorOpacity = 0; + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + this.fire('editing:exited'); + isTextChanged && this.fire('modified'); + if (this.canvas) { + this.canvas.off('mouse:move', this.mouseMoveHandler); + this.canvas.fire('text:editing:exited', { target: this }); + isTextChanged && this.canvas.fire('object:modified', { target: this }); + } + return this; + }, + + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this.styles) { + if (!this._textLines[prop]) { + delete this.styles[prop]; + } + } + }, + + /** + * remove and reflow a style block from start to end. + * @param {Number} start linear start position for removal (included in removal) + * @param {Number} end linear end position for removal ( excluded from removal ) + */ + removeStyleFromTo: function(start, end) { + var cursorStart = this.get2DCursorLocation(start, true), + cursorEnd = this.get2DCursorLocation(end, true), + lineStart = cursorStart.lineIndex, + charStart = cursorStart.charIndex, + lineEnd = cursorEnd.lineIndex, + charEnd = cursorEnd.charIndex, + i, styleObj; + if (lineStart !== lineEnd) { + // step1 remove the trailing of lineStart + if (this.styles[lineStart]) { + for (i = charStart; i < this._unwrappedTextLines[lineStart].length; i++) { + delete this.styles[lineStart][i]; + } + } + // step2 move the trailing of lineEnd to lineStart if needed + if (this.styles[lineEnd]) { + for (i = charEnd; i < this._unwrappedTextLines[lineEnd].length; i++) { + styleObj = this.styles[lineEnd][i]; + if (styleObj) { + this.styles[lineStart] || (this.styles[lineStart] = { }); + this.styles[lineStart][charStart + i - charEnd] = styleObj; + } + } + } + // step3 detects lines will be completely removed. + for (i = lineStart + 1; i <= lineEnd; i++) { + delete this.styles[i]; + } + // step4 shift remaining lines. + this.shiftLineStyles(lineEnd, lineStart - lineEnd); + } + else { + // remove and shift left on the same line + if (this.styles[lineStart]) { + styleObj = this.styles[lineStart]; + var diff = charEnd - charStart, numericChar, _char; + for (i = charStart; i < charEnd; i++) { + delete styleObj[i]; + } + for (_char in this.styles[lineStart]) { + numericChar = parseInt(_char, 10); + if (numericChar >= charEnd) { + styleObj[numericChar - diff] = styleObj[_char]; + delete styleObj[_char]; + } + } + } + } + }, + + /** + * Shifts line styles up or down + * @param {Number} lineIndex Index of a line + * @param {Number} offset Can any number? + */ + shiftLineStyles: function(lineIndex, offset) { + // shift all line styles by offset upward or downward + // do not clone deep. we need new array, not new style objects + var clonedStyles = clone(this.styles); + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + if (!clonedStyles[numericLine - offset]) { + delete this.styles[numericLine]; + } + } + } + }, + + restartCursorIfNeeded: function() { + if (!this._currentTickState || this._currentTickState.isAborted + || !this._currentTickCompleteState || this._currentTickCompleteState.isAborted + ) { + this.initDelayedCursor(); + } + }, + + /** + * Inserts new style object + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Number} qty number of lines to add + * @param {Array} copiedStyle Array of objects styles + */ + insertNewlineStyleObject: function(lineIndex, charIndex, qty, copiedStyle) { + var currentCharStyle, + newLineStyles = {}, + somethingAdded = false; + + qty || (qty = 1); + this.shiftLineStyles(lineIndex, qty); + if (this.styles[lineIndex]) { + currentCharStyle = this.styles[lineIndex][charIndex === 0 ? charIndex : charIndex - 1]; + } + + // we clone styles of all chars + // after cursor onto the current line + for (var index in this.styles[lineIndex]) { + var numIndex = parseInt(index, 10); + if (numIndex >= charIndex) { + somethingAdded = true; + newLineStyles[numIndex - charIndex] = this.styles[lineIndex][index]; + // remove lines from the previous line since they're on a new line now + delete this.styles[lineIndex][index]; + } + } + if (somethingAdded) { + this.styles[lineIndex + qty] = newLineStyles; + } + else { + delete this.styles[lineIndex + qty]; + } + // for the other lines + // we clone current char style onto the next (otherwise empty) line + while (qty > 1) { + qty--; + if (copiedStyle && copiedStyle[qty]) { + this.styles[lineIndex + qty] = { 0: clone(copiedStyle[qty]) }; + } + else if (currentCharStyle) { + this.styles[lineIndex + qty] = { 0: clone(currentCharStyle) }; + } + else { + delete this.styles[lineIndex + qty]; + } + } + this._forceClearCache = true; + }, + + /** + * Inserts style object for a given line/char index + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Number} quantity number Style object to insert, if given + * @param {Array} copiedStyle array of style objects + */ + insertCharStyleObject: function(lineIndex, charIndex, quantity, copiedStyle) { + if (!this.styles) { + this.styles = {}; + } + var currentLineStyles = this.styles[lineIndex], + currentLineStylesCloned = currentLineStyles ? clone(currentLineStyles) : {}; + + quantity || (quantity = 1); + // shift all char styles by quantity forward + // 0,1,2,3 -> (charIndex=2) -> 0,1,3,4 -> (insert 2) -> 0,1,2,3,4 + for (var index in currentLineStylesCloned) { + var numericIndex = parseInt(index, 10); + if (numericIndex >= charIndex) { + currentLineStyles[numericIndex + quantity] = currentLineStylesCloned[numericIndex]; + // only delete the style if there was nothing moved there + if (!currentLineStylesCloned[numericIndex - quantity]) { + delete currentLineStyles[numericIndex]; + } + } + } + this._forceClearCache = true; + if (copiedStyle) { + while (quantity--) { + if (!Object.keys(copiedStyle[quantity]).length) { + continue; + } + if (!this.styles[lineIndex]) { + this.styles[lineIndex] = {}; + } + this.styles[lineIndex][charIndex + quantity] = clone(copiedStyle[quantity]); + } + return; + } + if (!currentLineStyles) { + return; + } + var newStyle = currentLineStyles[charIndex ? charIndex - 1 : 1]; + while (newStyle && quantity--) { + this.styles[lineIndex][charIndex + quantity] = clone(newStyle); + } + }, + + /** + * Inserts style object(s) + * @param {Array} insertedText Characters at the location where style is inserted + * @param {Number} start cursor index for inserting style + * @param {Array} [copiedStyle] array of style objects to insert. + */ + insertNewStyleBlock: function(insertedText, start, copiedStyle) { + var cursorLoc = this.get2DCursorLocation(start, true), + addedLines = [0], linesLength = 0; + for (var i = 0; i < insertedText.length; i++) { + if (insertedText[i] === '\n') { + linesLength++; + addedLines[linesLength] = 0; + } + else { + addedLines[linesLength]++; + } + } + if (addedLines[0] > 0) { + this.insertCharStyleObject(cursorLoc.lineIndex, cursorLoc.charIndex, addedLines[0], copiedStyle); + copiedStyle = copiedStyle && copiedStyle.slice(addedLines[0] + 1); + } + linesLength && this.insertNewlineStyleObject( + cursorLoc.lineIndex, cursorLoc.charIndex + addedLines[0], linesLength); + for (var i = 1; i < linesLength; i++) { + if (addedLines[i] > 0) { + this.insertCharStyleObject(cursorLoc.lineIndex + i, 0, addedLines[i], copiedStyle); + } + else if (copiedStyle) { + this.styles[cursorLoc.lineIndex + i][0] = copiedStyle[0]; + } + copiedStyle = copiedStyle && copiedStyle.slice(addedLines[i] + 1); + } + // we use i outside the loop to get it like linesLength + if (addedLines[i] > 0) { + this.insertCharStyleObject(cursorLoc.lineIndex + i, 0, addedLines[i], copiedStyle); + } + }, + + /** + * Set the selectionStart and selectionEnd according to the new position of cursor + * mimic the key - mouse navigation when shift is pressed. + */ + setSelectionStartEndWithShift: function(start, end, newSelection) { + if (newSelection <= start) { + if (end === start) { + this._selectionDirection = 'left'; + } + else if (this._selectionDirection === 'right') { + this._selectionDirection = 'left'; + this.selectionEnd = start; + } + this.selectionStart = newSelection; + } + else if (newSelection > start && newSelection < end) { + if (this._selectionDirection === 'right') { + this.selectionEnd = newSelection; + } + else { + this.selectionStart = newSelection; + } + } + else { + // newSelection is > selection start and end + if (end === start) { + this._selectionDirection = 'right'; + } + else if (this._selectionDirection === 'left') { + this._selectionDirection = 'right'; + this.selectionStart = end; + } + this.selectionEnd = newSelection; + } + }, + + setSelectionInBoundaries: function() { + var length = this.text.length; + if (this.selectionStart > length) { + this.selectionStart = length; + } + else if (this.selectionStart < 0) { + this.selectionStart = 0; + } + if (this.selectionEnd > length) { + this.selectionEnd = length; + } + else if (this.selectionEnd < 0) { + this.selectionEnd = 0; + } + } + }); +})(); +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + /** + * Initializes "dbclick" event handler + */ + initDoubleClickSimulation: function() { + + // for double click + this.__lastClickTime = +new Date(); + + // for triple click + this.__lastLastClickTime = +new Date(); + + this.__lastPointer = { }; + + this.on('mousedown', this.onMouseDown); + }, + + /** + * Default event handler to simulate triple click + * @private + */ + onMouseDown: function(options) { + if (!this.canvas) { + return; + } + this.__newClickTime = +new Date(); + var newPointer = options.pointer; + if (this.isTripleClick(newPointer)) { + this.fire('tripleclick', options); + this._stopEvent(options.e); + } + this.__lastLastClickTime = this.__lastClickTime; + this.__lastClickTime = this.__newClickTime; + this.__lastPointer = newPointer; + this.__lastIsEditing = this.isEditing; + this.__lastSelected = this.selected; + }, + + isTripleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && + this.__lastClickTime - this.__lastLastClickTime < 500 && + this.__lastPointer.x === newPointer.x && + this.__lastPointer.y === newPointer.y; + }, + + /** + * @private + */ + _stopEvent: function(e) { + e.preventDefault && e.preventDefault(); + e.stopPropagation && e.stopPropagation(); + }, + + /** + * Initializes event handlers related to cursor or selection + */ + initCursorSelectionHandlers: function() { + this.initMousedownHandler(); + this.initMouseupHandler(); + this.initClicks(); + }, + + /** + * Initializes double and triple click event handlers + */ + initClicks: function() { + this.on('mousedblclick', function(options) { + this.selectWord(this.getSelectionStartFromPointer(options.e)); + }); + this.on('tripleclick', function(options) { + this.selectLine(this.getSelectionStartFromPointer(options.e)); + }); + }, + + /** + * Default event handler for the basic functionalities needed on _mouseDown + * can be overridden to do something different. + * Scope of this implementation is: find the click position, set selectionStart + * find selectionEnd, initialize the drawing of either cursor or selection area + */ + _mouseDownHandler: function(options) { + if (!this.canvas || !this.editable || (options.e.button && options.e.button !== 1)) { + return; + } + + this.__isMousedown = true; + + if (this.selected) { + this.setCursorByClick(options.e); + } + + if (this.isEditing) { + this.__selectionStartOnMouseDown = this.selectionStart; + if (this.selectionStart === this.selectionEnd) { + this.abortCursorAnimation(); + } + this.renderCursorOrSelection(); + } + }, + + /** + * Default event handler for the basic functionalities needed on mousedown:before + * can be overridden to do something different. + * Scope of this implementation is: verify the object is already selected when mousing down + */ + _mouseDownHandlerBefore: function(options) { + if (!this.canvas || !this.editable || (options.e.button && options.e.button !== 1)) { + return; + } + if (this === this.canvas._activeObject) { + this.selected = true; + } + }, + + /** + * Initializes "mousedown" event handler + */ + initMousedownHandler: function() { + this.on('mousedown', this._mouseDownHandler); + this.on('mousedown:before', this._mouseDownHandlerBefore); + }, + + /** + * Initializes "mouseup" event handler + */ + initMouseupHandler: function() { + this.on('mouseup', this.mouseUpHandler); + }, + + /** + * standard hander for mouse up, overridable + * @private + */ + mouseUpHandler: function(options) { + this.__isMousedown = false; + if (!this.editable || this.group || + (options.transform && options.transform.actionPerformed) || + (options.e.button && options.e.button !== 1)) { + return; + } + + if (this.canvas) { + var currentActive = this.canvas._activeObject; + if (currentActive && currentActive !== this) { + // avoid running this logic when there is an active object + // this because is possible with shift click and fast clicks, + // to rapidly deselect and reselect this object and trigger an enterEdit + return; + } + } + + if (this.__lastSelected && !this.__corner) { + this.selected = false; + this.__lastSelected = false; + this.enterEditing(options.e); + if (this.selectionStart === this.selectionEnd) { + this.initDelayedCursor(true); + } + else { + this.renderCursorOrSelection(); + } + } + else { + this.selected = true; + } + }, + + /** + * Changes cursor location in a text depending on passed pointer (x/y) object + * @param {Event} e Event object + */ + setCursorByClick: function(e) { + var newSelection = this.getSelectionStartFromPointer(e), + start = this.selectionStart, end = this.selectionEnd; + if (e.shiftKey) { + this.setSelectionStartEndWithShift(start, end, newSelection); + } + else { + this.selectionStart = newSelection; + this.selectionEnd = newSelection; + } + if (this.isEditing) { + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Returns index of a character corresponding to where an object was clicked + * @param {Event} e Event object + * @return {Number} Index of a character + */ + getSelectionStartFromPointer: function(e) { + var mouseOffset = this.getLocalPointer(e), + prevWidth = 0, + width = 0, + height = 0, + charIndex = 0, + lineIndex = 0, + lineLeftOffset, + line; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (height <= mouseOffset.y) { + height += this.getHeightOfLine(i) * this.scaleY; + lineIndex = i; + if (i > 0) { + charIndex += this._textLines[i - 1].length + this.missingNewlineOffset(i - 1); + } + } + else { + break; + } + } + lineLeftOffset = this._getLineLeftOffset(lineIndex); + width = lineLeftOffset * this.scaleX; + line = this._textLines[lineIndex]; + for (var j = 0, jlen = line.length; j < jlen; j++) { + prevWidth = width; + // i removed something about flipX here, check. + width += this.__charBounds[lineIndex][j].kernedWidth * this.scaleX; + if (width <= mouseOffset.x) { + charIndex++; + } + else { + break; + } + } + return this._getNewSelectionStartFromOffset(mouseOffset, prevWidth, width, charIndex, jlen); + }, + + /** + * @private + */ + _getNewSelectionStartFromOffset: function(mouseOffset, prevWidth, width, index, jlen) { + // we need Math.abs because when width is after the last char, the offset is given as 1, while is 0 + var distanceBtwLastCharAndCursor = mouseOffset.x - prevWidth, + distanceBtwNextCharAndCursor = width - mouseOffset.x, + offset = distanceBtwNextCharAndCursor > distanceBtwLastCharAndCursor || + distanceBtwNextCharAndCursor < 0 ? 0 : 1, + newSelectionStart = index + offset; + // if object is horizontally flipped, mirror cursor location from the end + if (this.flipX) { + newSelectionStart = jlen - newSelectionStart; + } + + if (newSelectionStart > this._text.length) { + newSelectionStart = this._text.length; + } + + return newSelectionStart; + } +}); +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes hidden textarea (needed to bring up keyboard in iOS) + */ + initHiddenTextarea: function() { + this.hiddenTextarea = fabric.document.createElement('textarea'); + this.hiddenTextarea.setAttribute('autocapitalize', 'off'); + this.hiddenTextarea.setAttribute('autocorrect', 'off'); + this.hiddenTextarea.setAttribute('autocomplete', 'off'); + this.hiddenTextarea.setAttribute('spellcheck', 'false'); + this.hiddenTextarea.setAttribute('data-fabric-hiddentextarea', ''); + this.hiddenTextarea.setAttribute('wrap', 'off'); + var style = this._calcTextareaPosition(); + // line-height: 1px; was removed from the style to fix this: + // https://bugs.chromium.org/p/chromium/issues/detail?id=870966 + this.hiddenTextarea.style.cssText = 'position: absolute; top: ' + style.top + + '; left: ' + style.left + '; z-index: -999; opacity: 0; width: 1px; height: 1px; font-size: 1px;' + + ' paddingーtop: ' + style.fontSize + ';'; + fabric.document.body.appendChild(this.hiddenTextarea); + + fabric.util.addListener(this.hiddenTextarea, 'keydown', this.onKeyDown.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'keyup', this.onKeyUp.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'input', this.onInput.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'copy', this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'cut', this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'paste', this.paste.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionstart', this.onCompositionStart.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionupdate', this.onCompositionUpdate.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'compositionend', this.onCompositionEnd.bind(this)); + + if (!this._clickHandlerInitialized && this.canvas) { + fabric.util.addListener(this.canvas.upperCanvasEl, 'click', this.onClick.bind(this)); + this._clickHandlerInitialized = true; + } + }, + + /** + * For functionalities on keyDown + * Map a special key to a function of the instance/prototype + * If you need different behaviour for ESC or TAB or arrows, you have to change + * this map setting the name of a function that you build on the fabric.Itext or + * your prototype. + * the map change will affect all Instances unless you need for only some text Instances + * in that case you have to clone this object and assign your Instance. + * this.keysMap = fabric.util.object.clone(this.keysMap); + * The function must be in fabric.Itext.prototype.myFunction And will receive event as args[0] + */ + keysMap: { + 9: 'exitEditing', + 27: 'exitEditing', + 33: 'moveCursorUp', + 34: 'moveCursorDown', + 35: 'moveCursorRight', + 36: 'moveCursorLeft', + 37: 'moveCursorLeft', + 38: 'moveCursorUp', + 39: 'moveCursorRight', + 40: 'moveCursorDown', + }, + + /** + * For functionalities on keyUp + ctrl || cmd + */ + ctrlKeysMapUp: { + 67: 'copy', + 88: 'cut' + }, + + /** + * For functionalities on keyDown + ctrl || cmd + */ + ctrlKeysMapDown: { + 65: 'selectAll' + }, + + onClick: function() { + // No need to trigger click event here, focus is enough to have the keyboard appear on Android + this.hiddenTextarea && this.hiddenTextarea.focus(); + }, + + /** + * Handles keyup event + * @param {Event} e Event object + */ + onKeyDown: function(e) { + if (!this.isEditing || this.inCompositionMode) { + return; + } + if (e.keyCode in this.keysMap) { + this[this.keysMap[e.keyCode]](e); + } + else if ((e.keyCode in this.ctrlKeysMapDown) && (e.ctrlKey || e.metaKey)) { + this[this.ctrlKeysMapDown[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + if (e.keyCode >= 33 && e.keyCode <= 40) { + // if i press an arrow key just update selection + this.clearContextTop(); + this.renderCursorOrSelection(); + } + else { + this.canvas && this.canvas.requestRenderAll(); + } + }, + + /** + * Handles keyup event + * We handle KeyUp because ie11 and edge have difficulties copy/pasting + * if a copy/cut event fired, keyup is dismissed + * @param {Event} e Event object + */ + onKeyUp: function(e) { + if (!this.isEditing || this._copyDone || this.inCompositionMode) { + this._copyDone = false; + return; + } + if ((e.keyCode in this.ctrlKeysMapUp) && (e.ctrlKey || e.metaKey)) { + this[this.ctrlKeysMapUp[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.requestRenderAll(); + }, + + /** + * Handles onInput event + * @param {Event} e Event object + */ + onInput: function(e) { + var fromPaste = this.fromPaste; + this.fromPaste = false; + e && e.stopPropagation(); + if (!this.isEditing) { + return; + } + // decisions about style changes. + var nextText = this._splitTextIntoLines(this.hiddenTextarea.value).graphemeText, + charCount = this._text.length, + nextCharCount = nextText.length, + removedText, insertedText, + charDiff = nextCharCount - charCount; + if (this.hiddenTextarea.value === '') { + this.styles = { }; + this.updateFromTextArea(); + this.fire('changed'); + if (this.canvas) { + this.canvas.fire('text:changed', { target: this }); + this.canvas.requestRenderAll(); + } + return; + } + + var textareaSelection = this.fromStringToGraphemeSelection( + this.hiddenTextarea.selectionStart, + this.hiddenTextarea.selectionEnd, + this.hiddenTextarea.value + ); + var backDelete = this.selectionStart > textareaSelection.selectionStart; + + if (this.selectionStart !== this.selectionEnd) { + removedText = this._text.slice(this.selectionStart, this.selectionEnd); + charDiff += this.selectionEnd - this.selectionStart; + } + else if (nextCharCount < charCount) { + if (backDelete) { + removedText = this._text.slice(this.selectionEnd + charDiff, this.selectionEnd); + } + else { + removedText = this._text.slice(this.selectionStart, this.selectionStart - charDiff); + } + } + insertedText = nextText.slice(textareaSelection.selectionEnd - charDiff, textareaSelection.selectionEnd); + if (removedText && removedText.length) { + if (this.selectionStart !== this.selectionEnd) { + this.removeStyleFromTo(this.selectionStart, this.selectionEnd); + } + else if (backDelete) { + // detect differencies between forwardDelete and backDelete + this.removeStyleFromTo(this.selectionEnd - removedText.length, this.selectionEnd); + } + else { + this.removeStyleFromTo(this.selectionEnd, this.selectionEnd + removedText.length); + } + } + if (insertedText.length) { + if (fromPaste && insertedText.join('') === fabric.copiedText && !fabric.disableStyleCopyPaste) { + this.insertNewStyleBlock(insertedText, this.selectionStart, fabric.copiedTextStyle); + } + else { + this.insertNewStyleBlock(insertedText, this.selectionStart); + } + } + this.updateFromTextArea(); + this.fire('changed'); + if (this.canvas) { + this.canvas.fire('text:changed', { target: this }); + this.canvas.requestRenderAll(); + } + }, + /** + * Composition start + */ + onCompositionStart: function() { + this.inCompositionMode = true; + }, + + /** + * Composition end + */ + onCompositionEnd: function() { + this.inCompositionMode = false; + }, + + // /** + // * Composition update + // */ + onCompositionUpdate: function(e) { + this.compositionStart = e.target.selectionStart; + this.compositionEnd = e.target.selectionEnd; + this.updateTextareaPosition(); + }, + + /** + * Copies selected text + * @param {Event} e Event object + */ + copy: function() { + if (this.selectionStart === this.selectionEnd) { + //do not cut-copy if no selection + return; + } + + fabric.copiedText = this.getSelectedText(); + if (!fabric.disableStyleCopyPaste) { + fabric.copiedTextStyle = this.getSelectionStyles(this.selectionStart, this.selectionEnd, true); + } + else { + fabric.copiedTextStyle = null; + } + this._copyDone = true; + }, + + /** + * Pastes text + * @param {Event} e Event object + */ + paste: function() { + this.fromPaste = true; + }, + + /** + * @private + * @param {Event} e Event object + * @return {Object} Clipboard data object + */ + _getClipboardData: function(e) { + return (e && e.clipboardData) || fabric.window.clipboardData; + }, + + /** + * Finds the width in pixels before the cursor on the same line + * @private + * @param {Number} lineIndex + * @param {Number} charIndex + * @return {Number} widthBeforeCursor width before cursor + */ + _getWidthBeforeCursor: function(lineIndex, charIndex) { + var widthBeforeCursor = this._getLineLeftOffset(lineIndex), bound; + + if (charIndex > 0) { + bound = this.__charBounds[lineIndex][charIndex - 1]; + widthBeforeCursor += bound.left + bound.width; + } + return widthBeforeCursor; + }, + + /** + * Gets start offset of a selection + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getDownCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), + cursorLocation = this.get2DCursorLocation(selectionProp), + lineIndex = cursorLocation.lineIndex; + // if on last line, down cursor goes to end of line + if (lineIndex === this._textLines.length - 1 || e.metaKey || e.keyCode === 34) { + // move to the end of a text + return this._text.length - selectionProp; + } + var charIndex = cursorLocation.charIndex, + widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), + indexOnOtherLine = this._getIndexOnLine(lineIndex + 1, widthBeforeCursor), + textAfterCursor = this._textLines[lineIndex].slice(charIndex); + return textAfterCursor.length + indexOnOtherLine + 1 + this.missingNewlineOffset(lineIndex); + }, + + /** + * private + * Helps finding if the offset should be counted from Start or End + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + _getSelectionForOffset: function(e, isRight) { + if (e.shiftKey && this.selectionStart !== this.selectionEnd && isRight) { + return this.selectionEnd; + } + else { + return this.selectionStart; + } + }, + + /** + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getUpCursorOffset: function(e, isRight) { + var selectionProp = this._getSelectionForOffset(e, isRight), + cursorLocation = this.get2DCursorLocation(selectionProp), + lineIndex = cursorLocation.lineIndex; + if (lineIndex === 0 || e.metaKey || e.keyCode === 33) { + // if on first line, up cursor goes to start of line + return -selectionProp; + } + var charIndex = cursorLocation.charIndex, + widthBeforeCursor = this._getWidthBeforeCursor(lineIndex, charIndex), + indexOnOtherLine = this._getIndexOnLine(lineIndex - 1, widthBeforeCursor), + textBeforeCursor = this._textLines[lineIndex].slice(0, charIndex), + missingNewlineOffset = this.missingNewlineOffset(lineIndex - 1); + // return a negative offset + return -this._textLines[lineIndex - 1].length + + indexOnOtherLine - textBeforeCursor.length + (1 - missingNewlineOffset); + }, + + /** + * for a given width it founds the matching character. + * @private + */ + _getIndexOnLine: function(lineIndex, width) { + + var line = this._textLines[lineIndex], + lineLeftOffset = this._getLineLeftOffset(lineIndex), + widthOfCharsOnLine = lineLeftOffset, + indexOnLine = 0, charWidth, foundMatch; + + for (var j = 0, jlen = line.length; j < jlen; j++) { + charWidth = this.__charBounds[lineIndex][j].width; + widthOfCharsOnLine += charWidth; + if (widthOfCharsOnLine > width) { + foundMatch = true; + var leftEdge = widthOfCharsOnLine - charWidth, + rightEdge = widthOfCharsOnLine, + offsetFromLeftEdge = Math.abs(leftEdge - width), + offsetFromRightEdge = Math.abs(rightEdge - width); + + indexOnLine = offsetFromRightEdge < offsetFromLeftEdge ? j : (j - 1); + break; + } + } + + // reached end + if (!foundMatch) { + indexOnLine = line.length - 1; + } + + return indexOnLine; + }, + + + /** + * Moves cursor down + * @param {Event} e Event object + */ + moveCursorDown: function(e) { + if (this.selectionStart >= this._text.length && this.selectionEnd >= this._text.length) { + return; + } + this._moveCursorUpOrDown('Down', e); + }, + + /** + * Moves cursor up + * @param {Event} e Event object + */ + moveCursorUp: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorUpOrDown('Up', e); + }, + + /** + * Moves cursor up or down, fires the events + * @param {String} direction 'Up' or 'Down' + * @param {Event} e Event object + */ + _moveCursorUpOrDown: function(direction, e) { + // getUpCursorOffset + // getDownCursorOffset + var action = 'get' + direction + 'CursorOffset', + offset = this[action](e, this._selectionDirection === 'right'); + if (e.shiftKey) { + this.moveCursorWithShift(offset); + } + else { + this.moveCursorWithoutShift(offset); + } + if (offset !== 0) { + this.setSelectionInBoundaries(); + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Moves cursor with shift + * @param {Number} offset + */ + moveCursorWithShift: function(offset) { + var newSelection = this._selectionDirection === 'left' + ? this.selectionStart + offset + : this.selectionEnd + offset; + this.setSelectionStartEndWithShift(this.selectionStart, this.selectionEnd, newSelection); + return offset !== 0; + }, + + /** + * Moves cursor up without shift + * @param {Number} offset + */ + moveCursorWithoutShift: function(offset) { + if (offset < 0) { + this.selectionStart += offset; + this.selectionEnd = this.selectionStart; + } + else { + this.selectionEnd += offset; + this.selectionStart = this.selectionEnd; + } + return offset !== 0; + }, + + /** + * Moves cursor left + * @param {Event} e Event object + */ + moveCursorLeft: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + this._moveCursorLeftOrRight('Left', e); + }, + + /** + * @private + * @return {Boolean} true if a change happened + */ + _move: function(e, prop, direction) { + var newValue; + if (e.altKey) { + newValue = this['findWordBoundary' + direction](this[prop]); + } + else if (e.metaKey || e.keyCode === 35 || e.keyCode === 36 ) { + newValue = this['findLineBoundary' + direction](this[prop]); + } + else { + this[prop] += direction === 'Left' ? -1 : 1; + return true; + } + if (typeof newValue !== undefined && this[prop] !== newValue) { + this[prop] = newValue; + return true; + } + }, + + /** + * @private + */ + _moveLeft: function(e, prop) { + return this._move(e, prop, 'Left'); + }, + + /** + * @private + */ + _moveRight: function(e, prop) { + return this._move(e, prop, 'Right'); + }, + + /** + * Moves cursor left without keeping selection + * @param {Event} e + */ + moveCursorLeftWithoutShift: function(e) { + var change = true; + this._selectionDirection = 'left'; + + // only move cursor when there is no selection, + // otherwise we discard it, and leave cursor on same place + if (this.selectionEnd === this.selectionStart && this.selectionStart !== 0) { + change = this._moveLeft(e, 'selectionStart'); + + } + this.selectionEnd = this.selectionStart; + return change; + }, + + /** + * Moves cursor left while keeping selection + * @param {Event} e + */ + moveCursorLeftWithShift: function(e) { + if (this._selectionDirection === 'right' && this.selectionStart !== this.selectionEnd) { + return this._moveLeft(e, 'selectionEnd'); + } + else if (this.selectionStart !== 0){ + this._selectionDirection = 'left'; + return this._moveLeft(e, 'selectionStart'); + } + }, + + /** + * Moves cursor right + * @param {Event} e Event object + */ + moveCursorRight: function(e) { + if (this.selectionStart >= this._text.length && this.selectionEnd >= this._text.length) { + return; + } + this._moveCursorLeftOrRight('Right', e); + }, + + /** + * Moves cursor right or Left, fires event + * @param {String} direction 'Left', 'Right' + * @param {Event} e Event object + */ + _moveCursorLeftOrRight: function(direction, e) { + var actionName = 'moveCursor' + direction + 'With'; + this._currentCursorOpacity = 1; + + if (e.shiftKey) { + actionName += 'Shift'; + } + else { + actionName += 'outShift'; + } + if (this[actionName](e)) { + this.abortCursorAnimation(); + this.initDelayedCursor(); + this._fireSelectionChanged(); + this._updateTextarea(); + } + }, + + /** + * Moves cursor right while keeping selection + * @param {Event} e + */ + moveCursorRightWithShift: function(e) { + if (this._selectionDirection === 'left' && this.selectionStart !== this.selectionEnd) { + return this._moveRight(e, 'selectionStart'); + } + else if (this.selectionEnd !== this._text.length) { + this._selectionDirection = 'right'; + return this._moveRight(e, 'selectionEnd'); + } + }, + + /** + * Moves cursor right without keeping selection + * @param {Event} e Event object + */ + moveCursorRightWithoutShift: function(e) { + var changed = true; + this._selectionDirection = 'right'; + + if (this.selectionStart === this.selectionEnd) { + changed = this._moveRight(e, 'selectionStart'); + this.selectionEnd = this.selectionStart; + } + else { + this.selectionStart = this.selectionEnd; + } + return changed; + }, + + /** + * Removes characters from start/end + * start/end ar per grapheme position in _text array. + * + * @param {Number} start + * @param {Number} end default to start + 1 + */ + removeChars: function(start, end) { + if (typeof end === 'undefined') { + end = start + 1; + } + this.removeStyleFromTo(start, end); + this._text.splice(start, end - start); + this.text = this._text.join(''); + this.set('dirty', true); + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + this._removeExtraneousStyles(); + }, + + /** + * insert characters at start position, before start position. + * start equal 1 it means the text get inserted between actual grapheme 0 and 1 + * if style array is provided, it must be as the same length of text in graphemes + * if end is provided and is bigger than start, old text is replaced. + * start/end ar per grapheme position in _text array. + * + * @param {String} text text to insert + * @param {Array} style array of style objects + * @param {Number} start + * @param {Number} end default to start + 1 + */ + insertChars: function(text, style, start, end) { + if (typeof end === 'undefined') { + end = start; + } + if (end > start) { + this.removeStyleFromTo(start, end); + } + var graphemes = fabric.util.string.graphemeSplit(text); + this.insertNewStyleBlock(graphemes, start, style); + this._text = [].concat(this._text.slice(0, start), graphemes, this._text.slice(end)); + this.text = this._text.join(''); + this.set('dirty', true); + if (this._shouldClearDimensionCache()) { + this.initDimensions(); + this.setCoords(); + } + this._removeExtraneousStyles(); + }, + +}); +/* _TO_SVG_START_ */ +(function() { + var toFixed = fabric.util.toFixed, + multipleSpacesRegex = / +/g; + + fabric.util.object.extend(fabric.Text.prototype, /** @lends fabric.Text.prototype */ { + + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + _toSVG: function() { + var offsets = this._getSVGLeftTopOffsets(), + textAndBg = this._getSVGTextAndBg(offsets.textTop, offsets.textLeft); + return this._wrapSVGTextAndBg(textAndBg); + }, + + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + return this._createBaseSVGMarkup( + this._toSVG(), + { reviver: reviver, noStyle: true, withShadow: true } + ); + }, + + /** + * @private + */ + _getSVGLeftTopOffsets: function() { + return { + textLeft: -this.width / 2, + textTop: -this.height / 2, + lineTop: this.getHeightOfLine(0) + }; + }, + + /** + * @private + */ + _wrapSVGTextAndBg: function(textAndBg) { + var noShadow = true, + textDecoration = this.getSvgTextDecoration(this); + return [ + textAndBg.textBgRects.join(''), + '\t\t', + textAndBg.textSpans.join(''), + '\n' + ]; + }, + + /** + * @private + * @param {Number} textTopOffset Text top offset + * @param {Number} textLeftOffset Text left offset + * @return {Object} + */ + _getSVGTextAndBg: function(textTopOffset, textLeftOffset) { + var textSpans = [], + textBgRects = [], + height = textTopOffset, lineOffset; + // bounding-box background + this._setSVGBg(textBgRects); + + // text and text-background + for (var i = 0, len = this._textLines.length; i < len; i++) { + lineOffset = this._getLineLeftOffset(i); + if (this.textBackgroundColor || this.styleHas('textBackgroundColor', i)) { + this._setSVGTextLineBg(textBgRects, i, textLeftOffset + lineOffset, height); + } + this._setSVGTextLineText(textSpans, i, textLeftOffset + lineOffset, height); + height += this.getHeightOfLine(i); + } + + return { + textSpans: textSpans, + textBgRects: textBgRects + }; + }, + + /** + * @private + */ + _createTextCharSpan: function(_char, styleDecl, left, top) { + var shouldUseWhitespace = _char !== _char.trim() || _char.match(multipleSpacesRegex), + styleProps = this.getSvgSpanStyles(styleDecl, shouldUseWhitespace), + fillStyles = styleProps ? 'style="' + styleProps + '"' : '', + dy = styleDecl.deltaY, dySpan = '', + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + if (dy) { + dySpan = ' dy="' + toFixed(dy, NUM_FRACTION_DIGITS) + '" '; + } + return [ + '', + fabric.util.string.escapeXml(_char), + '' + ].join(''); + }, + + _setSVGTextLineText: function(textSpans, lineIndex, textLeftOffset, textTopOffset) { + // set proper line offset + var lineHeight = this.getHeightOfLine(lineIndex), + isJustify = this.textAlign.indexOf('justify') !== -1, + actualStyle, + nextStyle, + charsToRender = '', + charBox, style, + boxWidth = 0, + line = this._textLines[lineIndex], + timeToRender; + + textTopOffset += lineHeight * (1 - this._fontSizeFraction) / this.lineHeight; + for (var i = 0, len = line.length - 1; i <= len; i++) { + timeToRender = i === len || this.charSpacing; + charsToRender += line[i]; + charBox = this.__charBounds[lineIndex][i]; + if (boxWidth === 0) { + textLeftOffset += charBox.kernedWidth - charBox.width; + boxWidth += charBox.width; + } + else { + boxWidth += charBox.kernedWidth; + } + if (isJustify && !timeToRender) { + if (this._reSpaceAndTab.test(line[i])) { + timeToRender = true; + } + } + if (!timeToRender) { + // if we have charSpacing, we render char by char + actualStyle = actualStyle || this.getCompleteStyleDeclaration(lineIndex, i); + nextStyle = this.getCompleteStyleDeclaration(lineIndex, i + 1); + timeToRender = this._hasStyleChangedForSvg(actualStyle, nextStyle); + } + if (timeToRender) { + style = this._getStyleDeclaration(lineIndex, i) || { }; + textSpans.push(this._createTextCharSpan(charsToRender, style, textLeftOffset, textTopOffset)); + charsToRender = ''; + actualStyle = nextStyle; + textLeftOffset += boxWidth; + boxWidth = 0; + } + } + }, + + _pushTextBgRect: function(textBgRects, color, left, top, width, height) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS; + textBgRects.push( + '\t\t\n'); + }, + + _setSVGTextLineBg: function(textBgRects, i, leftOffset, textTopOffset) { + var line = this._textLines[i], + heightOfLine = this.getHeightOfLine(i) / this.lineHeight, + boxWidth = 0, + boxStart = 0, + charBox, currentColor, + lastColor = this.getValueOfPropertyAt(i, 0, 'textBackgroundColor'); + for (var j = 0, jlen = line.length; j < jlen; j++) { + charBox = this.__charBounds[i][j]; + currentColor = this.getValueOfPropertyAt(i, j, 'textBackgroundColor'); + if (currentColor !== lastColor) { + lastColor && this._pushTextBgRect(textBgRects, lastColor, leftOffset + boxStart, + textTopOffset, boxWidth, heightOfLine); + boxStart = charBox.left; + boxWidth = charBox.width; + lastColor = currentColor; + } + else { + boxWidth += charBox.kernedWidth; + } + } + currentColor && this._pushTextBgRect(textBgRects, currentColor, leftOffset + boxStart, + textTopOffset, boxWidth, heightOfLine); + }, + + /** + * Adobe Illustrator (at least CS5) is unable to render rgba()-based fill values + * we work around it by "moving" alpha channel into opacity attribute and setting fill's alpha to 1 + * + * @private + * @param {*} value + * @return {String} + */ + _getFillAttributes: function(value) { + var fillColor = (value && typeof value === 'string') ? new fabric.Color(value) : ''; + if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) { + return 'fill="' + value + '"'; + } + return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"'; + }, + + /** + * @private + */ + _getSVGLineTopOffset: function(lineIndex) { + var lineTopOffset = 0, lastHeight = 0; + for (var j = 0; j < lineIndex; j++) { + lineTopOffset += this.getHeightOfLine(j); + } + lastHeight = this.getHeightOfLine(j); + return { + lineTop: lineTopOffset, + offset: (this._fontSizeMult - this._fontSizeFraction) * lastHeight / (this.lineHeight * this._fontSizeMult) + }; + }, + + /** + * Returns styles-string for svg-export + * @param {Boolean} skipShadow a boolean to skip shadow filter output + * @return {String} + */ + getSvgStyles: function(skipShadow) { + var svgStyle = fabric.Object.prototype.getSvgStyles.call(this, skipShadow); + return svgStyle + ' white-space: pre;'; + }, + }); +})(); +/* _TO_SVG_END_ */ +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = {}); + + /** + * Textbox class, based on IText, allows the user to resize the text rectangle + * and wraps lines automatically. Textboxes have their Y scaling locked, the + * user can only change width. Height is adjusted automatically based on the + * wrapping of lines. + * @class fabric.Textbox + * @extends fabric.IText + * @mixes fabric.Observable + * @return {fabric.Textbox} thisArg + * @see {@link fabric.Textbox#initialize} for constructor definition + */ + fabric.Textbox = fabric.util.createClass(fabric.IText, fabric.Observable, { + + /** + * Type of an object + * @type String + * @default + */ + type: 'textbox', + + /** + * Minimum width of textbox, in pixels. + * @type Number + * @default + */ + minWidth: 20, + + /** + * Minimum calculated width of a textbox, in pixels. + * fixed to 2 so that an empty textbox cannot go to 0 + * and is still selectable without text. + * @type Number + * @default + */ + dynamicMinWidth: 2, + + /** + * Cached array of text wrapping. + * @type Array + */ + __cachedLines: null, + + /** + * Override standard Object class values + */ + lockScalingFlip: true, + + /** + * Override standard Object class values + * Textbox needs this on false + */ + noScaleCache: false, + + /** + * Properties which when set cause object to change dimensions + * @type Object + * @private + */ + _dimensionAffectingProps: fabric.Text.prototype._dimensionAffectingProps.concat('width'), + + /** + * Use this regular expression to split strings in breakable lines + * @private + */ + _wordJoiners: /[ \t\r]/, + + /** + * Use this boolean property in order to split strings that have no white space concept. + * this is a cheap way to help with chinese/japaense + * @type Boolean + * @since 2.6.0 + */ + splitByGrapheme: false, + + /** + * Unlike superclass's version of this function, Textbox does not update + * its width. + * @private + * @override + */ + initDimensions: function() { + if (this.__skipDimension) { + return; + } + this.isEditing && this.initDelayedCursor(); + this.clearContextTop(); + this._clearCache(); + // clear dynamicMinWidth as it will be different after we re-wrap line + this.dynamicMinWidth = 0; + // wrap lines + this._styleMap = this._generateStyleMap(this._splitText()); + // if after wrapping, the width is smaller than dynamicMinWidth, change the width and re-wrap + if (this.dynamicMinWidth > this.width) { + this._set('width', this.dynamicMinWidth); + } + if (this.textAlign.indexOf('justify') !== -1) { + // once text is measured we need to make space fatter to make justified text. + this.enlargeSpaces(); + } + // clear cache and re-calculate height + this.height = this.calcTextHeight(); + this.saveState({ propertySet: '_dimensionAffectingProps' }); + }, + + /** + * Generate an object that translates the style object so that it is + * broken up by visual lines (new lines and automatic wrapping). + * The original text styles object is broken up by actual lines (new lines only), + * which is only sufficient for Text / IText + * @private + */ + _generateStyleMap: function(textInfo) { + var realLineCount = 0, + realLineCharCount = 0, + charCount = 0, + map = {}; + + for (var i = 0; i < textInfo.graphemeLines.length; i++) { + if (textInfo.graphemeText[charCount] === '\n' && i > 0) { + realLineCharCount = 0; + charCount++; + realLineCount++; + } + else if (!this.splitByGrapheme && this._reSpaceAndTab.test(textInfo.graphemeText[charCount]) && i > 0) { + // this case deals with space's that are removed from end of lines when wrapping + realLineCharCount++; + charCount++; + } + + map[i] = { line: realLineCount, offset: realLineCharCount }; + + charCount += textInfo.graphemeLines[i].length; + realLineCharCount += textInfo.graphemeLines[i].length; + } + + return map; + }, + + /** + * Returns true if object has a style property or has it on a specified line + * @param {Number} lineIndex + * @return {Boolean} + */ + styleHas: function(property, lineIndex) { + if (this._styleMap && !this.isWrapping) { + var map = this._styleMap[lineIndex]; + if (map) { + lineIndex = map.line; + } + } + return fabric.Text.prototype.styleHas.call(this, property, lineIndex); + }, + + /** + * Returns true if object has no styling or no styling in a line + * @param {Number} lineIndex , lineIndex is on wrapped lines. + * @return {Boolean} + */ + isEmptyStyles: function(lineIndex) { + var offset = 0, nextLineIndex = lineIndex + 1, nextOffset, obj, shouldLimit = false; + var map = this._styleMap[lineIndex]; + var mapNextLine = this._styleMap[lineIndex + 1]; + if (map) { + lineIndex = map.line; + offset = map.offset; + } + if (mapNextLine) { + nextLineIndex = mapNextLine.line; + shouldLimit = nextLineIndex === lineIndex; + nextOffset = mapNextLine.offset; + } + obj = typeof lineIndex === 'undefined' ? this.styles : { line: this.styles[lineIndex] }; + for (var p1 in obj) { + for (var p2 in obj[p1]) { + if (p2 >= offset && (!shouldLimit || p2 < nextOffset)) { + // eslint-disable-next-line no-unused-vars + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + } + return true; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _getStyleDeclaration: function(lineIndex, charIndex) { + if (this._styleMap && !this.isWrapping) { + var map = this._styleMap[lineIndex]; + if (!map) { + return null; + } + lineIndex = map.line; + charIndex = map.offset + charIndex; + } + return this.callSuper('_getStyleDeclaration', lineIndex, charIndex); + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} style + * @private + */ + _setStyleDeclaration: function(lineIndex, charIndex, style) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + + this.styles[lineIndex][charIndex] = style; + }, + + /** + * @param {Number} lineIndex + * @param {Number} charIndex + * @private + */ + _deleteStyleDeclaration: function(lineIndex, charIndex) { + var map = this._styleMap[lineIndex]; + lineIndex = map.line; + charIndex = map.offset + charIndex; + delete this.styles[lineIndex][charIndex]; + }, + + /** + * probably broken need a fix + * Returns the real style line that correspond to the wrapped lineIndex line + * Used just to verify if the line does exist or not. + * @param {Number} lineIndex + * @returns {Boolean} if the line exists or not + * @private + */ + _getLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + return !!this.styles[map.line]; + }, + + /** + * Set the line style to an empty object so that is initialized + * @param {Number} lineIndex + * @param {Object} style + * @private + */ + _setLineStyle: function(lineIndex) { + var map = this._styleMap[lineIndex]; + this.styles[map.line] = {}; + }, + + /** + * Wraps text using the 'width' property of Textbox. First this function + * splits text on newlines, so we preserve newlines entered by the user. + * Then it wraps each line using the width of the Textbox by calling + * _wrapLine(). + * @param {Array} lines The string array of text that is split into lines + * @param {Number} desiredWidth width you want to wrap to + * @returns {Array} Array of lines + */ + _wrapText: function(lines, desiredWidth) { + var wrapped = [], i; + this.isWrapping = true; + for (i = 0; i < lines.length; i++) { + wrapped = wrapped.concat(this._wrapLine(lines[i], i, desiredWidth)); + } + this.isWrapping = false; + return wrapped; + }, + + /** + * Helper function to measure a string of text, given its lineIndex and charIndex offset + * it gets called when charBounds are not available yet. + * @param {CanvasRenderingContext2D} ctx + * @param {String} text + * @param {number} lineIndex + * @param {number} charOffset + * @returns {number} + * @private + */ + _measureWord: function(word, lineIndex, charOffset) { + var width = 0, prevGrapheme, skipLeft = true; + charOffset = charOffset || 0; + for (var i = 0, len = word.length; i < len; i++) { + var box = this._getGraphemeBox(word[i], lineIndex, i + charOffset, prevGrapheme, skipLeft); + width += box.kernedWidth; + prevGrapheme = word[i]; + } + return width; + }, + + /** + * Wraps a line of text using the width of the Textbox and a context. + * @param {Array} line The grapheme array that represent the line + * @param {Number} lineIndex + * @param {Number} desiredWidth width you want to wrap the line to + * @param {Number} reservedSpace space to remove from wrapping for custom functionalities + * @returns {Array} Array of line(s) into which the given text is wrapped + * to. + */ + _wrapLine: function(_line, lineIndex, desiredWidth, reservedSpace) { + var lineWidth = 0, + splitByGrapheme = this.splitByGrapheme, + graphemeLines = [], + line = [], + // spaces in different languges? + words = splitByGrapheme ? fabric.util.string.graphemeSplit(_line) : _line.split(this._wordJoiners), + word = '', + offset = 0, + infix = splitByGrapheme ? '' : ' ', + wordWidth = 0, + infixWidth = 0, + largestWordWidth = 0, + lineJustStarted = true, + additionalSpace = splitByGrapheme ? 0 : this._getWidthOfCharSpacing(), + reservedSpace = reservedSpace || 0; + // fix a difference between split and graphemeSplit + if (words.length === 0) { + words.push([]); + } + desiredWidth -= reservedSpace; + for (var i = 0; i < words.length; i++) { + // if using splitByGrapheme words are already in graphemes. + word = splitByGrapheme ? words[i] : fabric.util.string.graphemeSplit(words[i]); + wordWidth = this._measureWord(word, lineIndex, offset); + offset += word.length; + + lineWidth += infixWidth + wordWidth - additionalSpace; + + if (lineWidth >= desiredWidth && !lineJustStarted) { + graphemeLines.push(line); + line = []; + lineWidth = wordWidth; + lineJustStarted = true; + } + else { + lineWidth += additionalSpace; + } + + if (!lineJustStarted && !splitByGrapheme) { + line.push(infix); + } + line = line.concat(word); + + infixWidth = this._measureWord([infix], lineIndex, offset); + offset++; + lineJustStarted = false; + // keep track of largest word + if (wordWidth > largestWordWidth) { + largestWordWidth = wordWidth; + } + } + + i && graphemeLines.push(line); + + if (largestWordWidth + reservedSpace > this.dynamicMinWidth) { + this.dynamicMinWidth = largestWordWidth - additionalSpace + reservedSpace; + } + + return graphemeLines; + }, + + /** + * Detect if the text line is ended with an hard break + * text and itext do not have wrapping, return false + * @param {Number} lineIndex text to split + * @return {Boolean} + */ + isEndOfWrapping: function(lineIndex) { + if (!this._styleMap[lineIndex + 1]) { + // is last line, return true; + return true; + } + if (this._styleMap[lineIndex + 1].line !== this._styleMap[lineIndex].line) { + // this is last line before a line break, return true; + return true; + } + return false; + }, + + /** + * Detect if a line has a linebreak and so we need to account for it when moving + * and counting style. + * @return Number + */ + missingNewlineOffset: function(lineIndex) { + if (this.splitByGrapheme) { + return this.isEndOfWrapping(lineIndex) ? 1 : 0; + } + return 1; + }, + + /** + * Gets lines of text to render in the Textbox. This function calculates + * text wrapping on the fly every time it is called. + * @param {String} text text to split + * @returns {Array} Array of lines in the Textbox. + * @override + */ + _splitTextIntoLines: function(text) { + var newText = fabric.Text.prototype._splitTextIntoLines.call(this, text), + graphemeLines = this._wrapText(newText.lines, this.width), + lines = new Array(graphemeLines.length); + for (var i = 0; i < graphemeLines.length; i++) { + lines[i] = graphemeLines[i].join(''); + } + newText.lines = lines; + newText.graphemeLines = graphemeLines; + return newText; + }, + + getMinWidth: function() { + return Math.max(this.minWidth, this.dynamicMinWidth); + }, + + _removeExtraneousStyles: function() { + var linesToKeep = {}; + for (var prop in this._styleMap) { + if (this._textLines[prop]) { + linesToKeep[this._styleMap[prop].line] = 1; + } + } + for (var prop in this.styles) { + if (!linesToKeep[prop]) { + delete this.styles[prop]; + } + } + }, + + /** + * Returns object representation of an instance + * @method toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return this.callSuper('toObject', ['minWidth', 'splitByGrapheme'].concat(propertiesToInclude)); + } + }); + + /** + * Returns fabric.Textbox instance from an object representation + * @static + * @memberOf fabric.Textbox + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an fabric.Textbox instance is created + */ + fabric.Textbox.fromObject = function(object, callback) { + return fabric.Object._fromObject('Textbox', object, callback, 'text'); + }; +})(typeof exports !== 'undefined' ? exports : this); +(function() { + + /** + * Override _setObjectScale and add Textbox specific resizing behavior. Resizing + * a Textbox doesn't scale text, it only changes width and makes text wrap automatically. + */ + var setObjectScaleOverridden = fabric.Canvas.prototype._setObjectScale; + + fabric.Canvas.prototype._setObjectScale = function(localMouse, transform, + lockScalingX, lockScalingY, by, lockScalingFlip, _dim) { + + var t = transform.target, scaled, + scaleX = localMouse.x * t.scaleX / _dim.x, + scaleY = localMouse.y * t.scaleY / _dim.y; + if (by === 'x' && t instanceof fabric.Textbox) { + var tw = t._getTransformedDimensions().x; + var w = t.width * (localMouse.x / tw); + transform.newScaleX = scaleX; + transform.newScaleY = scaleY; + if (w >= t.getMinWidth()) { + scaled = w !== t.width; + t.set('width', w); + return scaled; + } + } + else { + return setObjectScaleOverridden.call(fabric.Canvas.prototype, localMouse, transform, + lockScalingX, lockScalingY, by, lockScalingFlip, _dim); + } + }; + + fabric.util.object.extend(fabric.Textbox.prototype, /** @lends fabric.IText.prototype */ { + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this._styleMap) { + if (!this._textLines[prop]) { + delete this.styles[this._styleMap[prop].line]; + } + } + }, + + }); +})(); diff --git a/public/index.php b/public/index.php new file mode 100644 index 0000000..1536d07 --- /dev/null +++ b/public/index.php @@ -0,0 +1,218 @@ +soulless feelings"; + $stampsImgList=scandir("../stamps"); + foreach( $stampsImgList as $file ){ + if( strpos( "$file", ".") != 0 ){ + $stampsSelect .= ""; + } + } + + + $bgdImgList = scandir("../synthesis"); + $randomKeys = array_rand( $bgdImgList , 13 ); + $bgdSelect=""; + foreach( $randomKeys as $key ){ + $file = $bgdImgList[ $key ]; + if( strpos( "$file", ".") != 0 ){ + $key = substr( $file, 11, -4 ); + // $bgdArr[$key] =""; + } + + +?> + + + + + + + Make your own flyer + + + + +
+ +
+
+ +
+
+
+ +